- Name
- Sulfur dioxide
- InChI
- InChI=1S/O2S/c1-3-2
- InChI Key
- RAHZWNYVWXNFOC-UHFFFAOYSA-N
- Formula
- O2S
- SMILES
- O=S=O
- Mol. Weight (g/mol)
- 64.06
- CAS
- 7446-09-5
- Name
- Urea, tetramethyl-
- InChI
- InChI=1S/C5H12N2O/c1-6(2)5(8)7(3)4/h1-4H3
- InChI Key
- AVQQQNCBBIEMEU-UHFFFAOYSA-N
- Formula
- C5H12N2O
- SMILES
- CN(C)C(=O)N(C)C
- Mol. Weight (g/mol)
- 116.16
- CAS
- 632-22-4
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Molality, mol/kg of Sulfur dioxide (1) [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Pressure, kPa - Liquid | Molality, mol/kg of Sulfur dioxide (1) - Liquid |
| 293.15 | 3.20 | 1.8106 |
| 293.15 | 6.10 | 2.8596 |
| 293.15 | 9.30 | 3.7147 |
| 293.15 | 15.30 | 4.9593 |
| 293.15 | 20.00 | 6.0118 |
| 293.15 | 25.40 | 6.9867 |
| 293.15 | 31.20 | 7.7983 |
| 293.15 | 38.80 | 8.7289 |
| 293.15 | 49.30 | 9.7557 |
| 293.15 | 60.30 | 10.7132 |
| 293.15 | 71.00 | 11.5881 |
| 293.15 | 80.30 | 12.5092 |
| 293.15 | 89.70 | 13.2162 |
| 293.15 | 99.70 | 14.0068 |
| 293.15 | 108.90 | 14.7173 |
| 293.15 | 119.20 | 15.4978 |
| 303.15 | 3.50 | 1.312 |
| 303.15 | 6.30 | 2.0606 |
| 303.15 | 9.40 | 2.7559 |
| 303.15 | 15.10 | 3.7323 |
| 303.15 | 20.40 | 4.4699 |
| 303.15 | 26.10 | 5.1547 |
| 303.15 | 30.80 | 5.6365 |
| 303.15 | 39.90 | 6.5754 |
| 303.15 | 51.00 | 7.5426 |
| 303.15 | 61.10 | 8.3349 |
| 303.15 | 69.30 | 9.0039 |
| 303.15 | 79.90 | 9.7772 |
| 303.15 | 90.50 | 10.4989 |
| 303.15 | 100.10 | 11.0727 |
| 303.15 | 110.90 | 11.6927 |
| 303.15 | 121.80 | 12.2969 |
| 313.15 | 3.90 | 0.9015 |
| 313.15 | 7.80 | 1.6706 |
| 313.15 | 10.70 | 2.1278 |
| 313.15 | 15.30 | 2.7405 |
| 313.15 | 20.70 | 3.3616 |
| 313.15 | 25.60 | 3.8519 |
| 313.15 | 29.90 | 4.2539 |
| 313.15 | 40.20 | 5.0894 |
| 313.15 | 51.40 | 5.9207 |
| 313.15 | 60.90 | 6.5502 |
| 313.15 | 71.40 | 7.1945 |
| 313.15 | 80.70 | 7.7477 |
| 313.15 | 90.80 | 8.3221 |
| 313.15 | 100.70 | 8.8655 |
| 313.15 | 110.20 | 9.3661 |
| 313.15 | 120.40 | 9.9085 |
| 323.15 | 5.40 | 0.6771 |
| 323.15 | 7.90 | 1.0116 |
| 323.15 | 10.10 | 1.2942 |
| 323.15 | 16.70 | 2.013 |
| 323.15 | 20.80 | 2.3996 |
| 323.15 | 26.40 | 2.8773 |
| 323.15 | 31.60 | 3.2808 |
| 323.15 | 43.10 | 4.0621 |
| 323.15 | 52.90 | 4.6656 |
| 323.15 | 62.60 | 5.1985 |
| 323.15 | 72.00 | 5.6851 |
| 323.15 | 81.60 | 6.1577 |
| 323.15 | 92.10 | 6.6462 |
| 323.15 | 102.60 | 7.1016 |
| 323.15 | 110.30 | 7.4407 |
| 323.15 | 120.00 | 7.8551 |
Sources
Note: These property values are available through the Cheméo API. A free account gives you an access key.