- Name
- 2-IMIDAZOLIDINONE, 1,3-DIMETHYL-
- InChI
- InChI=1S/C5H10N2O/c1-6-3-4-7(2)5(6)8/h3-4H2,1-2H3
- InChI Key
- CYSGHNMQYZDMIA-UHFFFAOYSA-N
- Formula
- C5H10N2O
- SMILES
- CN1CCN(C)C1=O
- Mol. Weight (g/mol)
- 114.15
- Name
- Sulfur dioxide
- InChI
- InChI=1S/O2S/c1-3-2
- InChI Key
- RAHZWNYVWXNFOC-UHFFFAOYSA-N
- Formula
- O2S
- SMILES
- O=S=O
- Mol. Weight (g/mol)
- 64.06
- CAS
- 7446-09-5
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Molality, mol/kg of Sulfur dioxide (2) [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Pressure, kPa - Liquid | Molality, mol/kg of Sulfur dioxide (2) - Liquid |
| 293.15 | 8.50 | 3.4877 |
| 293.15 | 11.30 | 4.0332 |
| 293.15 | 14.70 | 4.811 |
| 293.15 | 19.10 | 5.6622 |
| 293.15 | 24.10 | 6.486 |
| 293.15 | 29.20 | 7.2728 |
| 293.15 | 39.70 | 8.7211 |
| 293.15 | 53.60 | 10.2073 |
| 293.15 | 64.40 | 11.2523 |
| 293.15 | 71.30 | 11.8828 |
| 293.15 | 79.20 | 12.5783 |
| 293.15 | 88.40 | 13.3609 |
| 293.15 | 98.70 | 14.2103 |
| 293.15 | 108.20 | 14.9743 |
| 293.15 | 118.70 | 15.802 |
| 303.15 | 7.90 | 2.4449 |
| 303.15 | 10.70 | 2.9964 |
| 303.15 | 15.60 | 3.7923 |
| 303.15 | 19.20 | 4.3161 |
| 303.15 | 24.80 | 5.0081 |
| 303.15 | 30.10 | 5.6109 |
| 303.15 | 39.30 | 6.5382 |
| 303.15 | 48.00 | 7.3427 |
| 303.15 | 56.60 | 8.0704 |
| 303.15 | 68.30 | 9.0206 |
| 303.15 | 79.00 | 9.835 |
| 303.15 | 91.30 | 10.7781 |
| 303.15 | 99.90 | 11.4237 |
| 303.15 | 109.70 | 12.1393 |
| 303.15 | 120.00 | 12.9264 |
| 313.15 | 2.90 | 0.6386 |
| 313.15 | 6.10 | 1.2667 |
| 313.15 | 9.70 | 1.8603 |
| 313.15 | 14.60 | 2.5221 |
| 313.15 | 20.90 | 3.2437 |
| 313.15 | 26.90 | 3.8493 |
| 313.15 | 32.70 | 4.3587 |
| 313.15 | 41.70 | 5.0839 |
| 313.15 | 65.80 | 6.7503 |
| 313.15 | 70.20 | 7.0319 |
| 313.15 | 79.90 | 7.607 |
| 313.15 | 89.50 | 8.1787 |
| 313.15 | 99.70 | 8.7615 |
| 313.15 | 110.50 | 9.3701 |
| 313.15 | 119.60 | 9.8697 |
| 323.15 | 3.30 | 0.3718 |
| 323.15 | 5.70 | 0.6634 |
| 323.15 | 8.90 | 1.0315 |
| 323.15 | 14.60 | 1.6361 |
| 323.15 | 19.50 | 2.1107 |
| 323.15 | 25.50 | 2.6443 |
| 323.15 | 29.90 | 3.0069 |
| 323.15 | 40.60 | 3.8056 |
| 323.15 | 49.50 | 4.3969 |
| 323.15 | 59.50 | 4.9993 |
| 323.15 | 70.00 | 5.5815 |
| 323.15 | 78.60 | 6.0173 |
| 323.15 | 90.00 | 6.5819 |
| 323.15 | 100.90 | 7.0991 |
| 323.15 | 109.40 | 7.484 |
| 323.15 | 119.50 | 7.9396 |
Sources
Note: These property values are available through the Cheméo API. A free account gives you an access key.