- Name
- Sulfur dioxide
- InChI
- InChI=1S/O2S/c1-3-2
- InChI Key
- RAHZWNYVWXNFOC-UHFFFAOYSA-N
- Formula
- O2S
- SMILES
- O=S=O
- Mol. Weight (g/mol)
- 64.06
- CAS
- 7446-09-5
- Name
- 1,3-Dimethyl-3,4,5,6-tetrahydro-2(1H)-pyrimidinone
- InChI
- InChI=1S/C6H12N2O/c1-7-4-3-5-8(2)6(7)9/h3-5H2,1-2H3
- InChI Key
- GUVUOGQBMYCBQP-UHFFFAOYSA-N
- Formula
- C6H12N2O
- SMILES
- CN1CCCN(C)C1=O
- Mol. Weight (g/mol)
- 128.17
- CAS
- 7226-23-5
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Molality, mol/kg of Sulfur dioxide (1) [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Pressure, kPa - Liquid | Molality, mol/kg of Sulfur dioxide (1) - Liquid |
| 293.15 | 3.10 | 2.031 |
| 293.15 | 5.90 | 3.0871 |
| 293.15 | 9.30 | 3.8952 |
| 293.15 | 14.50 | 4.9831 |
| 293.15 | 19.40 | 6.1741 |
| 293.15 | 23.90 | 6.8522 |
| 293.15 | 29.30 | 7.4566 |
| 293.15 | 38.60 | 8.4965 |
| 293.15 | 49.80 | 9.5803 |
| 293.15 | 59.90 | 10.2456 |
| 293.15 | 69.10 | 11.0832 |
| 293.15 | 78.20 | 11.9426 |
| 293.15 | 88.80 | 12.7666 |
| 293.15 | 99.80 | 13.6008 |
| 293.15 | 110.00 | 14.4401 |
| 293.15 | 119.70 | 15.1426 |
| 303.15 | 3.10 | 1.4555 |
| 303.15 | 6.20 | 2.3896 |
| 303.15 | 9.90 | 3.196 |
| 303.15 | 15.80 | 4.1891 |
| 303.15 | 20.00 | 4.7657 |
| 303.15 | 24.80 | 5.329 |
| 303.15 | 29.40 | 5.8168 |
| 303.15 | 39.40 | 6.7487 |
| 303.15 | 49.10 | 7.5562 |
| 303.15 | 58.90 | 8.3119 |
| 303.15 | 69.20 | 9.043 |
| 303.15 | 78.80 | 9.7067 |
| 303.15 | 90.60 | 10.5055 |
| 303.15 | 102.40 | 11.1546 |
| 303.15 | 111.70 | 11.6605 |
| 303.15 | 121.60 | 12.1863 |
| 313.15 | 3.00 | 1.0079 |
| 313.15 | 7.10 | 1.9772 |
| 313.15 | 9.00 | 2.3246 |
| 313.15 | 14.50 | 3.1529 |
| 313.15 | 22.90 | 4.1412 |
| 313.15 | 25.70 | 4.4054 |
| 313.15 | 29.80 | 4.791 |
| 313.15 | 40.00 | 5.6076 |
| 313.15 | 54.40 | 6.5772 |
| 313.15 | 60.90 | 6.9717 |
| 313.15 | 70.70 | 7.5569 |
| 313.15 | 79.80 | 8.0593 |
| 313.15 | 91.90 | 8.7036 |
| 313.15 | 101.10 | 9.1753 |
| 313.15 | 112.00 | 9.7199 |
| 313.15 | 121.00 | 10.1581 |
| 323.15 | 3.10 | 0.5144 |
| 323.15 | 5.90 | 0.9791 |
| 323.15 | 9.60 | 1.53 |
| 323.15 | 15.00 | 2.2304 |
| 323.15 | 21.30 | 2.9767 |
| 323.15 | 27.40 | 3.4846 |
| 323.15 | 33.00 | 3.8964 |
| 323.15 | 43.70 | 4.7665 |
| 323.15 | 51.30 | 5.2484 |
| 323.15 | 59.60 | 5.7224 |
| 323.15 | 72.70 | 6.3872 |
| 323.15 | 80.70 | 6.7546 |
| 323.15 | 89.10 | 7.1158 |
| 323.15 | 101.20 | 7.6006 |
| 323.15 | 113.80 | 8.0701 |
| 323.15 | 125.40 | 8.4773 |
Sources
Note: These property values are available through the Cheméo API. A free account gives you an access key.