- Name
- Phosphoric Acid
- InChI
- InChI=1S/H3O4P/c1-5(2,3)4/h(H3,1,2,3,4)
- InChI Key
- NBIIXXVUZAFLBC-UHFFFAOYSA-N
- Formula
- H3O4P
- SMILES
- O=P(O)(O)O
- Mol. Weight (g/mol)
- 98.00
- CAS
- 7664-38-2
- Name
- 2-Pentanol, 4-methyl-
- InChI
- InChI=1S/C6H14O/c1-5(2)4-6(3)7/h5-7H,4H2,1-3H3
- InChI Key
- WVYWICLMDOOCFB-UHFFFAOYSA-N
- Formula
- C6H14O
- SMILES
- CC(C)CC(C)O
- Mol. Weight (g/mol)
- 102.17
- CAS
- 108-11-2
- Name
- Water
- InChI
- InChI=1S/H2O/h1H2
- InChI Key
- XLYOFNOQVPJJNP-UHFFFAOYSA-N
- Formula
- H2O
- SMILES
- O
- Mol. Weight (g/mol)
- 18.02
- CAS
- 7732-18-5
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Mass fraction of Phosphoric Acid (1) [ref]
Operational condition: Pressure, kPa = 100 (Liquid mixture 1)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid mixture 1 | Mass fraction of Water (3) - Liquid mixture 1 | Mass fraction of Phosphoric Acid (1) - Liquid mixture 1 |
| 298.20 | 0.9864 | 0.0000 |
| 298.20 | 0.9180 | 0.0686 |
| 298.20 | 0.8833 | 0.1032 |
| 298.20 | 0.7308 | 0.2576 |
| 298.20 | 0.6493 | 0.3391 |
| 298.20 | 0.5033 | 0.4852 |
| 298.20 | 0.4001 | 0.5884 |
| 298.20 | 0.2489 | 0.7395 |
| 298.20 | 0.2078 | 0.7808 |
| 298.20 | 0.0356 | 0.7675 |
| 298.20 | 0.0286 | 0.7184 |
| 298.20 | 0.0290 | 0.5825 |
| 298.20 | 0.0282 | 0.4814 |
| 298.20 | 0.0282 | 0.3473 |
| 298.20 | 0.0352 | 0.2577 |
| 298.20 | 0.0418 | 0.1534 |
| 298.20 | 0.0483 | 0.0604 |
| 298.20 | 0.0514 | 0.0000 |
| 308.20 | 0.9845 | 0.0000 |
| 308.20 | 0.9308 | 0.0537 |
| 308.20 | 0.8306 | 0.1539 |
| 308.20 | 0.7266 | 0.2580 |
| 308.20 | 0.6388 | 0.3455 |
| 308.20 | 0.4995 | 0.4833 |
| 308.20 | 0.4022 | 0.5803 |
| 308.20 | 0.2560 | 0.7266 |
| 308.20 | 0.1928 | 0.7898 |
| 308.20 | 0.0355 | 0.7704 |
| 308.20 | 0.0286 | 0.7164 |
| 308.20 | 0.0286 | 0.5721 |
| 308.20 | 0.0283 | 0.4922 |
| 308.20 | 0.0285 | 0.3458 |
| 308.20 | 0.0353 | 0.2400 |
| 308.20 | 0.0416 | 0.1088 |
| 308.20 | 0.0459 | 0.0676 |
| 308.20 | 0.0564 | 0.0000 |
| 318.20 | 0.9843 | 0.0000 |
| 318.20 | 0.9334 | 0.0511 |
| 318.20 | 0.8297 | 0.1547 |
| 318.20 | 0.7215 | 0.2631 |
| 318.20 | 0.6433 | 0.3413 |
| 318.20 | 0.4871 | 0.4954 |
| 318.20 | 0.4015 | 0.5812 |
| 318.20 | 0.2544 | 0.7282 |
| 318.20 | 0.2077 | 0.7751 |
| 318.20 | 0.0444 | 0.7484 |
| 318.20 | 0.0350 | 0.7191 |
| 318.20 | 0.0361 | 0.5781 |
| 318.20 | 0.0356 | 0.4787 |
| 318.20 | 0.0377 | 0.3378 |
| 318.20 | 0.0419 | 0.2514 |
| 318.20 | 0.0463 | 0.1543 |
| 318.20 | 0.0489 | 0.0521 |
| 318.20 | 0.0585 | 0.0000 |
Temperature, K x Mass fraction [ref]
Operational condition: Pressure, kPa = 100 (Liquid mixture 2)
| Fixed | Measured | |||
|---|---|---|---|---|
| Temperature, K - Liquid mixture 1 | Mass fraction of Phosphoric Acid (1) - Liquid mixture 2 | Mass fraction of Water (3) - Liquid mixture 2 | Mass fraction of Phosphoric Acid (1) - Liquid mixture 1 | Mass fraction of Water (3) - Liquid mixture 1 |
| 298.20 | 0.0080 | 0.0470 | 0.1440 | 0.8430 |
| 298.20 | 0.0180 | 0.0470 | 0.1980 | 0.7890 |
| 298.20 | 0.0340 | 0.0470 | 0.2500 | 0.7370 |
| 298.20 | 0.0450 | 0.0480 | 0.3090 | 0.6780 |
| 298.20 | 0.0880 | 0.0480 | 0.4110 | 0.5760 |
| 298.20 | 0.1270 | 0.0480 | 0.4770 | 0.5110 |
| 308.20 | 0.0110 | 0.0490 | 0.1530 | 0.8280 |
| 308.20 | 0.0190 | 0.0530 | 0.2100 | 0.7730 |
| 308.20 | 0.0280 | 0.0560 | 0.2600 | 0.7240 |
| 308.20 | 0.0430 | 0.0500 | 0.3120 | 0.6720 |
| 308.20 | 0.0810 | 0.0460 | 0.3830 | 0.5990 |
| 308.20 | 0.1200 | 0.0420 | 0.4690 | 0.5120 |
| 318.20 | 0.0120 | 0.0490 | 0.1590 | 0.8240 |
| 318.20 | 0.0200 | 0.0490 | 0.2050 | 0.7780 |
| 318.20 | 0.0340 | 0.0480 | 0.2670 | 0.7160 |
| 318.20 | 0.0490 | 0.0490 | 0.3150 | 0.6670 |
| 318.20 | 0.0860 | 0.0480 | 0.4010 | 0.5770 |
| 318.20 | 0.1250 | 0.0470 | 0.4750 | 0.5010 |
Mass fraction of Phosphoric Acid (1) [ref]
Operational condition: Pressure, kPa = 100 (Liquid mixture 1)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid mixture 1 | Mass fraction of Water (3) - Liquid mixture 1 | Mass fraction of Phosphoric Acid (1) - Liquid mixture 1 |
| 298.20 | 0.9864 | 0.0000 |
| 298.20 | 0.9180 | 0.0686 |
| 298.20 | 0.8833 | 0.1032 |
| 298.20 | 0.7308 | 0.2576 |
| 298.20 | 0.6493 | 0.3391 |
| 298.20 | 0.5033 | 0.4852 |
| 298.20 | 0.4001 | 0.5884 |
| 298.20 | 0.2489 | 0.7395 |
| 298.20 | 0.2078 | 0.7808 |
| 298.20 | 0.0356 | 0.7675 |
| 298.20 | 0.0286 | 0.7184 |
| 298.20 | 0.0290 | 0.5825 |
| 298.20 | 0.0282 | 0.4814 |
| 298.20 | 0.0282 | 0.3473 |
| 298.20 | 0.0352 | 0.2577 |
| 298.20 | 0.0418 | 0.1534 |
| 298.20 | 0.0483 | 0.0604 |
| 298.20 | 0.0514 | 0.0000 |
| 308.20 | 0.9845 | 0.0000 |
| 308.20 | 0.9308 | 0.0537 |
| 308.20 | 0.8306 | 0.1539 |
| 308.20 | 0.7266 | 0.2580 |
| 308.20 | 0.6388 | 0.3455 |
| 308.20 | 0.4995 | 0.4833 |
| 308.20 | 0.4022 | 0.5803 |
| 308.20 | 0.2560 | 0.7266 |
| 308.20 | 0.1928 | 0.7898 |
| 308.20 | 0.0355 | 0.7704 |
| 308.20 | 0.0286 | 0.7164 |
| 308.20 | 0.0286 | 0.5721 |
| 308.20 | 0.0283 | 0.4922 |
| 308.20 | 0.0285 | 0.3458 |
| 308.20 | 0.0353 | 0.2400 |
| 308.20 | 0.0416 | 0.1088 |
| 308.20 | 0.0459 | 0.0676 |
| 308.20 | 0.0564 | 0.0000 |
| 318.20 | 0.9843 | 0.0000 |
| 318.20 | 0.9334 | 0.0511 |
| 318.20 | 0.8297 | 0.1547 |
| 318.20 | 0.7215 | 0.2631 |
| 318.20 | 0.6433 | 0.3413 |
| 318.20 | 0.4871 | 0.4954 |
| 318.20 | 0.4015 | 0.5812 |
| 318.20 | 0.2544 | 0.7282 |
| 318.20 | 0.2077 | 0.7751 |
| 318.20 | 0.0444 | 0.7484 |
| 318.20 | 0.0350 | 0.7191 |
| 318.20 | 0.0361 | 0.5781 |
| 318.20 | 0.0356 | 0.4787 |
| 318.20 | 0.0377 | 0.3378 |
| 318.20 | 0.0419 | 0.2514 |
| 318.20 | 0.0463 | 0.1543 |
| 318.20 | 0.0489 | 0.0521 |
| 318.20 | 0.0585 | 0.0000 |
Temperature, K x Mass fraction [ref]
Operational condition: Pressure, kPa = 100 (Liquid mixture 2)
| Fixed | Measured | |||
|---|---|---|---|---|
| Temperature, K - Liquid mixture 1 | Mass fraction of Phosphoric Acid (1) - Liquid mixture 2 | Mass fraction of Water (3) - Liquid mixture 2 | Mass fraction of Phosphoric Acid (1) - Liquid mixture 1 | Mass fraction of Water (3) - Liquid mixture 1 |
| 298.20 | 0.0080 | 0.0470 | 0.1440 | 0.8430 |
| 298.20 | 0.0180 | 0.0470 | 0.1980 | 0.7890 |
| 298.20 | 0.0340 | 0.0470 | 0.2500 | 0.7370 |
| 298.20 | 0.0450 | 0.0480 | 0.3090 | 0.6780 |
| 298.20 | 0.0880 | 0.0480 | 0.4110 | 0.5760 |
| 298.20 | 0.1270 | 0.0480 | 0.4770 | 0.5110 |
| 308.20 | 0.0110 | 0.0490 | 0.1530 | 0.8280 |
| 308.20 | 0.0190 | 0.0530 | 0.2100 | 0.7730 |
| 308.20 | 0.0280 | 0.0560 | 0.2600 | 0.7240 |
| 308.20 | 0.0430 | 0.0500 | 0.3120 | 0.6720 |
| 308.20 | 0.0810 | 0.0460 | 0.3830 | 0.5990 |
| 308.20 | 0.1200 | 0.0420 | 0.4690 | 0.5120 |
| 318.20 | 0.0120 | 0.0490 | 0.1590 | 0.8240 |
| 318.20 | 0.0200 | 0.0490 | 0.2050 | 0.7780 |
| 318.20 | 0.0340 | 0.0480 | 0.2670 | 0.7160 |
| 318.20 | 0.0490 | 0.0490 | 0.3150 | 0.6670 |
| 318.20 | 0.0860 | 0.0480 | 0.4010 | 0.5770 |
| 318.20 | 0.1250 | 0.0470 | 0.4750 | 0.5010 |
Sources
Note: These property values are available through the Cheméo API. A free account gives you an access key.