- Name
- Methenamine
- InChI
- InChI=1S/C6H12N4/c1-7-2-9-4-8(1)5-10(3-7)6-9/h1-6H2
- InChI Key
- VKYKSIONXSXAKP-UHFFFAOYSA-N
- Formula
- C6H12N4
- SMILES
- C1N2CN3CN1CN(C2)C3
- Mol. Weight (g/mol)
- 140.19
- CAS
- 100-97-0
- Name
- Water
- InChI
- InChI=1S/H2O/h1H2
- InChI Key
- XLYOFNOQVPJJNP-UHFFFAOYSA-N
- Formula
- H2O
- SMILES
- O
- Mol. Weight (g/mol)
- 18.02
- CAS
- 7732-18-5
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- Mass fraction (2)
- η - Viscosity, Pa*s
- ρl - Mass density, kg/m3
- csound,fluid - Speed of Sound, m/s
- γ - Surface tension liquid-gas, N/m
Mass fraction of Methenamine (1) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Temperature, K - Liquid | Mass fraction of Methenamine (1) - Liquid |
|---|---|
| 275.15 | 0.4552 |
| 277.15 | 0.4465 |
| 279.15 | 0.4409 |
| 283.15 | 0.4311 |
| 284.15 | 0.4621 |
| 285.15 | 0.4608 |
| 288.15 | 0.4559 |
| 293.15 | 0.4434 |
| 298.15 | 0.4332 |
| 303.15 | 0.4438 |
| 308.15 | 0.4513 |
| 313.15 | 0.4558 |
Mole fraction of Methenamine (1) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Temperature, K - Liquid | Mole fraction of Methenamine (1) - Liquid |
|---|---|
| 303.21 | 0.0980 |
| 307.40 | 0.0959 |
| 312.18 | 0.0948 |
| 317.05 | 0.0931 |
| 321.86 | 0.0914 |
| 326.15 | 0.0894 |
| 330.45 | 0.0891 |
| 335.42 | 0.0895 |
| 340.35 | 0.0914 |
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of Methenamine (1) - Liquid | Viscosity, Pa*s - Liquid |
| 293.15 | 0.0000 | 0.0010 |
| 293.15 | 0.2070 | 0.0011 |
| 293.15 | 0.4250 | 0.0012 |
| 293.15 | 0.6540 | 0.0013 |
| 293.15 | 0.8970 | 0.0014 |
| 293.15 | 1.164 | 0.0016 |
| 293.15 | 1.449 | 0.0017 |
| 293.15 | 1.748 | 0.0019 |
| 293.15 | 2.068 | 0.0021 |
| 293.15 | 2.412 | 0.0025 |
| 293.15 | 2.779 | 0.0028 |
| 293.15 | 3.181 | 0.0032 |
| 293.15 | 3.617 | 0.0037 |
| 293.15 | 4.088 | 0.0042 |
| 293.15 | 4.609 | 0.0050 |
| 293.15 | 5.155 | 0.0059 |
| 303.15 | 0.0000 | 0.0008 |
| 303.15 | 0.2070 | 0.0009 |
| 303.15 | 0.4250 | 0.0009 |
| 303.15 | 0.6540 | 0.0010 |
| 303.15 | 0.8970 | 0.0011 |
| 303.15 | 1.164 | 0.0012 |
| 303.15 | 1.449 | 0.0013 |
| 303.15 | 1.748 | 0.0015 |
| 303.15 | 2.068 | 0.0016 |
| 303.15 | 2.412 | 0.0019 |
| 303.15 | 2.779 | 0.0021 |
| 303.15 | 3.181 | 0.0024 |
| 303.15 | 3.617 | 0.0027 |
| 303.15 | 4.088 | 0.0031 |
| 303.15 | 4.609 | 0.0036 |
| 303.15 | 5.155 | 0.0042 |
| 313.15 | 0.0000 | 0.0007 |
| 313.15 | 0.2070 | 0.0007 |
| 313.15 | 0.4250 | 0.0008 |
| 313.15 | 0.6540 | 0.0008 |
| 313.15 | 0.8970 | 0.0009 |
| 313.15 | 1.164 | 0.0009 |
| 313.15 | 1.449 | 0.0010 |
| 313.15 | 1.748 | 0.0012 |
| 313.15 | 2.068 | 0.0013 |
| 313.15 | 2.412 | 0.0014 |
| 313.15 | 2.779 | 0.0016 |
| 313.15 | 3.181 | 0.0018 |
| 313.15 | 3.617 | 0.0021 |
| 313.15 | 4.088 | 0.0023 |
| 313.15 | 4.609 | 0.0027 |
| 313.15 | 5.155 | 0.0031 |
| 323.15 | 0.0000 | 0.0006 |
| 323.15 | 0.2070 | 0.0006 |
| 323.15 | 0.4250 | 0.0006 |
| 323.15 | 0.6540 | 0.0007 |
| 323.15 | 0.8970 | 0.0007 |
| 323.15 | 1.164 | 0.0008 |
| 323.15 | 1.449 | 0.0008 |
| 323.15 | 1.748 | 0.0009 |
| 323.15 | 2.068 | 0.0010 |
| 323.15 | 2.412 | 0.0011 |
| 323.15 | 2.779 | 0.0012 |
| 323.15 | 3.181 | 0.0014 |
| 323.15 | 3.617 | 0.0016 |
| 323.15 | 4.088 | 0.0018 |
| 323.15 | 4.609 | 0.0020 |
| 323.15 | 5.155 | 0.0023 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of Methenamine (1) - Liquid | Mass density, kg/m3 - Liquid |
| 293.15 | 0.0000 | 998.2 |
| 293.15 | 0.2070 | 1004.3 |
| 293.15 | 0.4250 | 1010.5 |
| 293.15 | 0.6540 | 1016.6 |
| 293.15 | 0.8970 | 1022.9 |
| 293.15 | 1.164 | 1029.5 |
| 293.15 | 1.449 | 1036.1 |
| 293.15 | 1.748 | 1042.9 |
| 293.15 | 2.068 | 1049.6 |
| 293.15 | 2.412 | 1056.3 |
| 293.15 | 2.779 | 1063.3 |
| 293.15 | 3.181 | 1070.4 |
| 293.15 | 3.617 | 1077.6 |
| 293.15 | 4.088 | 1084.9 |
| 293.15 | 4.609 | 1092.3 |
| 293.15 | 5.155 | 1099.8 |
| 303.15 | 0.0000 | 995.9 |
| 303.15 | 0.2070 | 1001.6 |
| 303.15 | 0.4250 | 1007.7 |
| 303.15 | 0.6540 | 1013.8 |
| 303.15 | 0.8970 | 1019.9 |
| 303.15 | 1.164 | 1026.4 |
| 303.15 | 1.449 | 1032.9 |
| 303.15 | 1.748 | 1039.4 |
| 303.15 | 2.068 | 1046.0 |
| 303.15 | 2.412 | 1052.9 |
| 303.15 | 2.779 | 1059.7 |
| 303.15 | 3.181 | 1066.6 |
| 303.15 | 3.617 | 1073.6 |
| 303.15 | 4.088 | 1080.8 |
| 303.15 | 4.609 | 1088.0 |
| 303.15 | 5.155 | 1095.0 |
| 313.15 | 0.0000 | 992.3 |
| 313.15 | 0.2070 | 998.0 |
| 313.15 | 0.4250 | 1004.1 |
| 313.15 | 0.6540 | 1010.1 |
| 313.15 | 0.8970 | 1016.1 |
| 313.15 | 1.164 | 1022.5 |
| 313.15 | 1.449 | 1028.9 |
| 313.15 | 1.748 | 1035.4 |
| 313.15 | 2.068 | 1041.8 |
| 313.15 | 2.412 | 1048.3 |
| 313.15 | 2.779 | 1055.0 |
| 313.15 | 3.181 | 1061.8 |
| 313.15 | 3.617 | 1068.7 |
| 313.15 | 4.088 | 1075.6 |
| 313.15 | 4.609 | 1082.7 |
| 313.15 | 5.155 | 1089.8 |
| 323.15 | 0.0000 | 988.1 |
| 323.15 | 0.2070 | 993.9 |
| 323.15 | 0.4250 | 999.7 |
| 323.15 | 0.6540 | 1005.6 |
| 323.15 | 0.8970 | 1011.0 |
| 323.15 | 1.164 | 1018.0 |
| 323.15 | 1.449 | 1024.3 |
| 323.15 | 1.748 | 1030.7 |
| 323.15 | 2.068 | 1037.1 |
| 323.15 | 2.412 | 1043.5 |
| 323.15 | 2.779 | 1050.1 |
| 323.15 | 3.181 | 1056.8 |
| 323.15 | 3.617 | 1063.5 |
| 323.15 | 4.088 | 1070.4 |
| 323.15 | 4.609 | 1077.3 |
| 323.15 | 5.155 | 1084.2 |
Speed of sound, m/s [ref]
Operational conditions:
- Pressure, kPa = 100 (Liquid)
- Frequency, MHz = 3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of Methenamine (1) - Liquid | Speed of sound, m/s - Liquid |
| 293.15 | 0.0000 | 1482.7 |
| 293.15 | 0.2070 | 1493.6 |
| 293.15 | 0.4250 | 1504.9 |
| 293.15 | 0.6540 | 1516.5 |
| 293.15 | 0.8970 | 1528.8 |
| 293.15 | 1.164 | 1541.8 |
| 293.15 | 1.449 | 1555.9 |
| 293.15 | 1.748 | 1569.3 |
| 293.15 | 2.068 | 1583.3 |
| 293.15 | 2.412 | 1597.1 |
| 293.15 | 2.779 | 1611.8 |
| 293.15 | 3.181 | 1626.9 |
| 293.15 | 3.617 | 1642.5 |
| 293.15 | 4.088 | 1658.4 |
| 293.15 | 4.609 | 1674.7 |
| 293.15 | 5.155 | 1691.4 |
| 303.15 | 0.0000 | 1509.4 |
| 303.15 | 0.2070 | 1519.0 |
| 303.15 | 0.4250 | 1529.4 |
| 303.15 | 0.6540 | 1539.3 |
| 303.15 | 0.8970 | 1550.0 |
| 303.15 | 1.164 | 1561.1 |
| 303.15 | 1.449 | 1573.6 |
| 303.15 | 1.748 | 1585.0 |
| 303.15 | 2.068 | 1597.4 |
| 303.15 | 2.412 | 1609.3 |
| 303.15 | 2.779 | 1622.1 |
| 303.15 | 3.181 | 1635.2 |
| 303.15 | 3.617 | 1648.7 |
| 303.15 | 4.088 | 1662.4 |
| 303.15 | 4.609 | 1676.5 |
| 303.15 | 5.155 | 1690.9 |
| 313.15 | 0.0000 | 1529.1 |
| 313.15 | 0.2070 | 1538.0 |
| 313.15 | 0.4250 | 1546.6 |
| 313.15 | 0.6540 | 1555.4 |
| 313.15 | 0.8970 | 1565.0 |
| 313.15 | 1.164 | 1574.7 |
| 313.15 | 1.449 | 1585.8 |
| 313.15 | 1.748 | 1595.6 |
| 313.15 | 2.068 | 1606.6 |
| 313.15 | 2.412 | 1616.0 |
| 313.15 | 2.779 | 1627.1 |
| 313.15 | 3.181 | 1638.5 |
| 313.15 | 3.617 | 1650.1 |
| 313.15 | 4.088 | 1661.9 |
| 313.15 | 4.609 | 1674.0 |
| 313.15 | 5.155 | 1687.2 |
| 323.15 | 0.0000 | 1541.5 |
| 323.15 | 0.2070 | 1549.2 |
| 323.15 | 0.4250 | 1557.4 |
| 323.15 | 0.6540 | 1566.1 |
| 323.15 | 0.8970 | 1574.4 |
| 323.15 | 1.164 | 1583.0 |
| 323.15 | 1.449 | 1593.1 |
| 323.15 | 1.748 | 1601.3 |
| 323.15 | 2.068 | 1611.1 |
| 323.15 | 2.412 | 1620.0 |
| 323.15 | 2.779 | 1629.6 |
| 323.15 | 3.181 | 1639.4 |
| 323.15 | 3.617 | 1649.3 |
| 323.15 | 4.088 | 1659.4 |
| 323.15 | 4.609 | 1669.7 |
| 323.15 | 5.155 | 1680.2 |
Surface tension liquid-gas, N/m [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of Methenamine (1) - Liquid | Surface tension liquid-gas, N/m - Liquid |
| 293.15 | 0.0000 | 0.0726 |
| 293.15 | 0.2070 | 0.0692 |
| 293.15 | 0.4250 | 0.0674 |
| 293.15 | 0.6540 | 0.0662 |
| 293.15 | 0.8970 | 0.0654 |
| 293.15 | 1.164 | 0.0648 |
| 293.15 | 1.449 | 0.0644 |
| 293.15 | 1.748 | 0.0640 |
| 293.15 | 2.068 | 0.0637 |
| 293.15 | 2.412 | 0.0635 |
| 293.15 | 2.779 | 0.0633 |
| 293.15 | 3.181 | 0.0632 |
| 293.15 | 3.617 | 0.0631 |
| 293.15 | 4.088 | 0.0630 |
| 293.15 | 4.609 | 0.0629 |
| 293.15 | 5.155 | 0.0629 |
| 303.15 | 0.0000 | 0.0711 |
| 303.15 | 0.2070 | 0.0675 |
| 303.15 | 0.4250 | 0.0661 |
| 303.15 | 0.6540 | 0.0650 |
| 303.15 | 0.8970 | 0.0642 |
| 303.15 | 1.164 | 0.0635 |
| 303.15 | 1.449 | 0.0629 |
| 303.15 | 1.748 | 0.0625 |
| 303.15 | 2.068 | 0.0622 |
| 303.15 | 2.412 | 0.0619 |
| 303.15 | 2.779 | 0.0617 |
| 303.15 | 3.181 | 0.0615 |
| 303.15 | 3.617 | 0.0614 |
| 303.15 | 4.088 | 0.0613 |
| 303.15 | 4.609 | 0.0612 |
| 303.15 | 5.155 | 0.0612 |
| 313.15 | 0.0000 | 0.0692 |
| 313.15 | 0.2070 | 0.0663 |
| 313.15 | 0.4250 | 0.0647 |
| 313.15 | 0.6540 | 0.0635 |
| 313.15 | 0.8970 | 0.0628 |
| 313.15 | 1.164 | 0.0621 |
| 313.15 | 1.449 | 0.0615 |
| 313.15 | 1.748 | 0.0611 |
| 313.15 | 2.068 | 0.0607 |
| 313.15 | 2.412 | 0.0605 |
| 313.15 | 2.779 | 0.0603 |
| 313.15 | 3.181 | 0.0602 |
| 313.15 | 3.617 | 0.0601 |
| 313.15 | 4.088 | 0.0600 |
| 313.15 | 4.609 | 0.0599 |
| 313.15 | 5.155 | 0.0599 |
| 323.15 | 0.0000 | 0.0677 |
| 323.15 | 0.2070 | 0.0651 |
| 323.15 | 0.4250 | 0.0634 |
| 323.15 | 0.6540 | 0.0621 |
| 323.15 | 0.8970 | 0.0612 |
| 323.15 | 1.164 | 0.0605 |
| 323.15 | 1.449 | 0.0601 |
| 323.15 | 1.748 | 0.0597 |
| 323.15 | 2.068 | 0.0595 |
| 323.15 | 2.412 | 0.0592 |
| 323.15 | 2.779 | 0.0590 |
| 323.15 | 3.181 | 0.0589 |
| 323.15 | 3.617 | 0.0588 |
| 323.15 | 4.088 | 0.0587 |
| 323.15 | 4.609 | 0.0586 |
| 323.15 | 5.155 | 0.0586 |
Sources
- Solubility of 1,3,5,7-tetra azatricyclo[3.3.1.13,7]decane (HMT) in water from 275.15K to 313.15K
- Density, Speed of Sound, Viscosity, and Surface Tension of Hexamethylenetetramine Aqueous Solutions from T = (293.15 to 323.15) K
- Solubility of Hexamethylenetetramine in a Pure Water, Methanol, Acetic Acid, and Ethanol + Water Mixture from (299.38 to 340.35) K
Note: These property values are available through the Cheméo API. A free account gives you an access key.