- Name
- Bis(2-ethylhexyl)hydrogen phosphate
- InChI
- InChI=1S/C16H35O4P/c1-5-9-11-15(7-3)13-19-21(17,18)20-14-16(8-4)12-10-6-2/h15-16H,5-14H2,1-4H3,(H,17,18)
- InChI Key
- SEGLCEQVOFDUPX-UHFFFAOYSA-N
- Formula
- C16H35O4P
- SMILES
- CCCCC(CC)COP(=O)(O)OCC(CC)CCCC
- Mol. Weight (g/mol)
- 322.42
- CAS
- 298-07-7
- Name
- 1-Octanol
- InChI
- InChI=1S/C8H18O/c1-2-3-4-5-6-7-8-9/h9H,2-8H2,1H3
- InChI Key
- KBPLFHHGFOOTCA-UHFFFAOYSA-N
- Formula
- C8H18O
- SMILES
- CCCCCCCCO
- Mol. Weight (g/mol)
- 130.23
- CAS
- 111-87-5
- Name
- Water
- InChI
- InChI=1S/H2O/h1H2
- InChI Key
- XLYOFNOQVPJJNP-UHFFFAOYSA-N
- Formula
- H2O
- SMILES
- O
- Mol. Weight (g/mol)
- 18.02
- CAS
- 7732-18-5
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Mass fraction of Bis(2-ethylhexyl)hydrogen phosphate (1) [ref]
Operational conditions:
- Pressure, kPa = 100 (Liquid mixture 1)
- Temperature, K = 298.2 (Liquid mixture 1)
| Mass fraction of Water (3) - Liquid mixture 1 | Mass fraction of Bis(2-ethylhexyl)hydrogen phosphate (1) - Liquid mixture 1 |
|---|---|
| 0.0401 | 0.0000 |
| 0.0385 | 0.0714 |
| 0.0400 | 0.1371 |
| 0.0409 | 0.2258 |
| 0.0372 | 0.3289 |
| 0.0341 | 0.4513 |
| 0.0308 | 0.5565 |
| 0.0293 | 0.6588 |
| 0.0271 | 0.7542 |
| 0.0244 | 0.8448 |
| 0.0005 | 0.9995 |
| 0.9995 | 0.0000 |
| 0.9992 | 0.0008 |
Mass fraction [ref]
Operational conditions:
- Temperature, K = 298.2 (Liquid mixture 2)
- Pressure, kPa = 100 (Liquid mixture 2)
| Fixed | Measured | ||
|---|---|---|---|
| Mass fraction of Bis(2-ethylhexyl)hydrogen phosphate (1) - Liquid mixture 1 | Mass fraction of Water (3) - Liquid mixture 1 | Mass fraction of Water (3) - Liquid mixture 2 | Mass fraction of Bis(2-ethylhexyl)hydrogen phosphate (1) - Liquid mixture 2 |
| 0.0012 | 0.9932 | 0.0414 | 0.0412 |
| 0.0049 | 0.9940 | 0.0411 | 0.0708 |
| 0.0053 | 0.9935 | 0.0431 | 0.1742 |
| 0.0064 | 0.9928 | 0.0421 | 0.3051 |
| 0.0078 | 0.9919 | 0.0387 | 0.3879 |
| 0.0085 | 0.9902 | 0.0327 | 0.4906 |
| 0.0093 | 0.9900 | 0.0317 | 0.5596 |
| 0.0096 | 0.9898 | 0.0310 | 0.6829 |
| 0.0051 | 0.9945 | 0.0296 | 0.7721 |
| 0.0039 | 0.9931 | 0.0244 | 0.8739 |
Mass fraction of Bis(2-ethylhexyl)hydrogen phosphate (1) [ref]
Operational condition: Pressure, kPa = 100 (Liquid mixture 1)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid mixture 1 | Mass fraction of Water (3) - Liquid mixture 1 | Mass fraction of Bis(2-ethylhexyl)hydrogen phosphate (1) - Liquid mixture 1 |
| 303.20 | 0.0493 | 0.0000 |
| 303.20 | 0.0520 | 0.0474 |
| 303.20 | 0.0516 | 0.1500 |
| 303.20 | 0.0513 | 0.2477 |
| 303.20 | 0.0510 | 0.3508 |
| 303.20 | 0.0505 | 0.4534 |
| 303.20 | 0.0472 | 0.5535 |
| 303.20 | 0.0421 | 0.6571 |
| 303.20 | 0.0364 | 0.7647 |
| 303.20 | 0.0308 | 0.8680 |
| 303.20 | 0.0240 | 0.9760 |
| 303.20 | 0.9995 | 0.0000 |
| 303.20 | 0.9999 | 0.0001 |
| 313.20 | 0.0522 | 0.0000 |
| 313.20 | 0.0548 | 0.0452 |
| 313.20 | 0.0545 | 0.1478 |
| 313.20 | 0.0544 | 0.2452 |
| 313.20 | 0.0540 | 0.3486 |
| 313.20 | 0.0542 | 0.4498 |
| 313.20 | 0.0507 | 0.5512 |
| 313.20 | 0.0454 | 0.6540 |
| 313.20 | 0.0399 | 0.7615 |
| 313.20 | 0.0335 | 0.8641 |
| 313.20 | 0.0248 | 0.9752 |
| 313.20 | 0.9993 | 0.0000 |
| 313.20 | 0.9998 | 0.0002 |
| 323.20 | 0.0534 | 0.0000 |
| 323.20 | 0.0558 | 0.0443 |
| 323.20 | 0.0563 | 0.1463 |
| 323.20 | 0.0568 | 0.2427 |
| 323.20 | 0.0565 | 0.3462 |
| 323.20 | 0.0561 | 0.4474 |
| 323.20 | 0.0530 | 0.5487 |
| 323.20 | 0.0481 | 0.6511 |
| 323.20 | 0.0423 | 0.7589 |
| 323.20 | 0.0356 | 0.8632 |
| 323.20 | 0.0252 | 0.9748 |
| 323.20 | 0.9991 | 0.0000 |
| 323.20 | 0.9998 | 0.0002 |
| 333.20 | 0.0563 | 0.0000 |
| 333.20 | 0.0587 | 0.0408 |
| 333.20 | 0.0589 | 0.1435 |
| 333.20 | 0.0597 | 0.2401 |
| 333.20 | 0.0595 | 0.3442 |
| 333.20 | 0.0583 | 0.4478 |
| 333.20 | 0.0549 | 0.5464 |
| 333.20 | 0.0510 | 0.6487 |
| 333.20 | 0.0451 | 0.7561 |
| 333.20 | 0.0379 | 0.8634 |
| 333.20 | 0.0258 | 0.9742 |
| 333.20 | 0.9989 | 0.0000 |
| 333.20 | 0.9998 | 0.0001 |
Temperature, K x Mass fraction [ref]
Operational condition: Pressure, kPa = 100 (Liquid mixture 2)
| Fixed | Measured | |||
|---|---|---|---|---|
| Temperature, K - Liquid mixture 1 | Mass fraction of Bis(2-ethylhexyl)hydrogen phosphate (1) - Liquid mixture 2 | Mass fraction of Water (3) - Liquid mixture 2 | Mass fraction of Water (3) - Liquid mixture 1 | Mass fraction of Bis(2-ethylhexyl)hydrogen phosphate (1) - Liquid mixture 1 |
| 303.20 | 0.0006 | 0.9990 | 0.0520 | 0.0468 |
| 303.20 | 0.0010 | 0.9987 | 0.0515 | 0.2476 |
| 303.20 | 0.0016 | 0.9982 | 0.0475 | 0.5518 |
| 303.20 | 0.0023 | 0.9976 | 0.0309 | 0.8689 |
| 313.20 | 0.0004 | 0.9990 | 0.0549 | 0.0434 |
| 313.20 | 0.0008 | 0.9987 | 0.0547 | 0.2432 |
| 313.20 | 0.0014 | 0.9983 | 0.0510 | 0.5471 |
| 313.20 | 0.0022 | 0.9976 | 0.0336 | 0.8648 |
| 323.20 | 0.0003 | 0.9989 | 0.0558 | 0.0415 |
| 323.20 | 0.0006 | 0.9987 | 0.0570 | 0.2400 |
| 323.20 | 0.0011 | 0.9983 | 0.0533 | 0.5438 |
| 323.20 | 0.0021 | 0.9976 | 0.0358 | 0.8616 |
| 333.20 | 0.0001 | 0.9988 | 0.0587 | 0.0381 |
| 333.20 | 0.0004 | 0.9987 | 0.0597 | 0.2370 |
| 333.20 | 0.0010 | 0.9983 | 0.0552 | 0.5409 |
| 333.20 | 0.0019 | 0.9977 | 0.0384 | 0.8586 |
Mass fraction of Bis(2-ethylhexyl)hydrogen phosphate (1) [ref]
Operational conditions:
- Pressure, kPa = 100 (Liquid mixture 1)
- Temperature, K = 298.2 (Liquid mixture 1)
| Mass fraction of Water (3) - Liquid mixture 1 | Mass fraction of Bis(2-ethylhexyl)hydrogen phosphate (1) - Liquid mixture 1 |
|---|---|
| 0.0401 | 0.0000 |
| 0.0385 | 0.0714 |
| 0.0400 | 0.1371 |
| 0.0409 | 0.2258 |
| 0.0372 | 0.3289 |
| 0.0341 | 0.4513 |
| 0.0308 | 0.5565 |
| 0.0293 | 0.6588 |
| 0.0271 | 0.7542 |
| 0.0244 | 0.8448 |
| 0.0005 | 0.9995 |
| 0.9995 | 0.0000 |
| 0.9992 | 0.0008 |
Mass fraction [ref]
Operational conditions:
- Temperature, K = 298.2 (Liquid mixture 2)
- Pressure, kPa = 100 (Liquid mixture 2)
| Fixed | Measured | ||
|---|---|---|---|
| Mass fraction of Bis(2-ethylhexyl)hydrogen phosphate (1) - Liquid mixture 1 | Mass fraction of Water (3) - Liquid mixture 1 | Mass fraction of Water (3) - Liquid mixture 2 | Mass fraction of Bis(2-ethylhexyl)hydrogen phosphate (1) - Liquid mixture 2 |
| 0.0012 | 0.9932 | 0.0414 | 0.0412 |
| 0.0049 | 0.9940 | 0.0411 | 0.0708 |
| 0.0053 | 0.9935 | 0.0431 | 0.1742 |
| 0.0064 | 0.9928 | 0.0421 | 0.3051 |
| 0.0078 | 0.9919 | 0.0387 | 0.3879 |
| 0.0085 | 0.9902 | 0.0327 | 0.4906 |
| 0.0093 | 0.9900 | 0.0317 | 0.5596 |
| 0.0096 | 0.9898 | 0.0310 | 0.6829 |
| 0.0051 | 0.9945 | 0.0296 | 0.7721 |
| 0.0039 | 0.9931 | 0.0244 | 0.8739 |
Mass fraction of Bis(2-ethylhexyl)hydrogen phosphate (1) [ref]
Operational condition: Pressure, kPa = 100 (Liquid mixture 1)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid mixture 1 | Mass fraction of Water (3) - Liquid mixture 1 | Mass fraction of Bis(2-ethylhexyl)hydrogen phosphate (1) - Liquid mixture 1 |
| 303.20 | 0.0493 | 0.0000 |
| 303.20 | 0.0520 | 0.0474 |
| 303.20 | 0.0516 | 0.1500 |
| 303.20 | 0.0513 | 0.2477 |
| 303.20 | 0.0510 | 0.3508 |
| 303.20 | 0.0505 | 0.4534 |
| 303.20 | 0.0472 | 0.5535 |
| 303.20 | 0.0421 | 0.6571 |
| 303.20 | 0.0364 | 0.7647 |
| 303.20 | 0.0308 | 0.8680 |
| 303.20 | 0.0240 | 0.9760 |
| 303.20 | 0.9995 | 0.0000 |
| 303.20 | 0.9999 | 0.0001 |
| 313.20 | 0.0522 | 0.0000 |
| 313.20 | 0.0548 | 0.0452 |
| 313.20 | 0.0545 | 0.1478 |
| 313.20 | 0.0544 | 0.2452 |
| 313.20 | 0.0540 | 0.3486 |
| 313.20 | 0.0542 | 0.4498 |
| 313.20 | 0.0507 | 0.5512 |
| 313.20 | 0.0454 | 0.6540 |
| 313.20 | 0.0399 | 0.7615 |
| 313.20 | 0.0335 | 0.8641 |
| 313.20 | 0.0248 | 0.9752 |
| 313.20 | 0.9993 | 0.0000 |
| 313.20 | 0.9998 | 0.0002 |
| 323.20 | 0.0534 | 0.0000 |
| 323.20 | 0.0558 | 0.0443 |
| 323.20 | 0.0563 | 0.1463 |
| 323.20 | 0.0568 | 0.2427 |
| 323.20 | 0.0565 | 0.3462 |
| 323.20 | 0.0561 | 0.4474 |
| 323.20 | 0.0530 | 0.5487 |
| 323.20 | 0.0481 | 0.6511 |
| 323.20 | 0.0423 | 0.7589 |
| 323.20 | 0.0356 | 0.8632 |
| 323.20 | 0.0252 | 0.9748 |
| 323.20 | 0.9991 | 0.0000 |
| 323.20 | 0.9998 | 0.0002 |
| 333.20 | 0.0563 | 0.0000 |
| 333.20 | 0.0587 | 0.0408 |
| 333.20 | 0.0589 | 0.1435 |
| 333.20 | 0.0597 | 0.2401 |
| 333.20 | 0.0595 | 0.3442 |
| 333.20 | 0.0583 | 0.4478 |
| 333.20 | 0.0549 | 0.5464 |
| 333.20 | 0.0510 | 0.6487 |
| 333.20 | 0.0451 | 0.7561 |
| 333.20 | 0.0379 | 0.8634 |
| 333.20 | 0.0258 | 0.9742 |
| 333.20 | 0.9989 | 0.0000 |
| 333.20 | 0.9998 | 0.0001 |
Temperature, K x Mass fraction [ref]
Operational condition: Pressure, kPa = 100 (Liquid mixture 2)
| Fixed | Measured | |||
|---|---|---|---|---|
| Temperature, K - Liquid mixture 1 | Mass fraction of Bis(2-ethylhexyl)hydrogen phosphate (1) - Liquid mixture 2 | Mass fraction of Water (3) - Liquid mixture 2 | Mass fraction of Water (3) - Liquid mixture 1 | Mass fraction of Bis(2-ethylhexyl)hydrogen phosphate (1) - Liquid mixture 1 |
| 303.20 | 0.0006 | 0.9990 | 0.0520 | 0.0468 |
| 303.20 | 0.0010 | 0.9987 | 0.0515 | 0.2476 |
| 303.20 | 0.0016 | 0.9982 | 0.0475 | 0.5518 |
| 303.20 | 0.0023 | 0.9976 | 0.0309 | 0.8689 |
| 313.20 | 0.0004 | 0.9990 | 0.0549 | 0.0434 |
| 313.20 | 0.0008 | 0.9987 | 0.0547 | 0.2432 |
| 313.20 | 0.0014 | 0.9983 | 0.0510 | 0.5471 |
| 313.20 | 0.0022 | 0.9976 | 0.0336 | 0.8648 |
| 323.20 | 0.0003 | 0.9989 | 0.0558 | 0.0415 |
| 323.20 | 0.0006 | 0.9987 | 0.0570 | 0.2400 |
| 323.20 | 0.0011 | 0.9983 | 0.0533 | 0.5438 |
| 323.20 | 0.0021 | 0.9976 | 0.0358 | 0.8616 |
| 333.20 | 0.0001 | 0.9988 | 0.0587 | 0.0381 |
| 333.20 | 0.0004 | 0.9987 | 0.0597 | 0.2370 |
| 333.20 | 0.0010 | 0.9983 | 0.0552 | 0.5409 |
| 333.20 | 0.0019 | 0.9977 | 0.0384 | 0.8586 |
Sources
- The role of organic diluents in the aspects of equilibrium, kinetics and thermodynamic model for silver ion extraction using an extractant D2EHPA
- Phase equilibrium for ternary liquid systems of water + di-(2- ethylhexyl)phosphoric acid + organic diluents: Thermodynamic study
Note: These property values are available through the Cheméo API. A free account gives you an access key.