- Name
- N,N'-DIACETYLHEXAMETHYLENEDIAMINE
- InChI
- InChI=1S/C10H20N2O2/c1-9(13)11-7-5-3-4-6-8-12-10(2)14/h3-8H2,1-2H3,(H,11,13)(H,12,14)
- InChI Key
- BNQSTAOJRULKNX-UHFFFAOYSA-N
- Formula
- C10H20N2O2
- SMILES
- CC(=O)NCCCCCCNC(C)=O
- Mol. Weight (g/mol)
- 200.28
- Name
- Water
- InChI
- InChI=1S/H2O/h1H2
- InChI Key
- XLYOFNOQVPJJNP-UHFFFAOYSA-N
- Formula
- H2O
- SMILES
- O
- Mol. Weight (g/mol)
- 18.02
- CAS
- 7732-18-5
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Molar enthalpy of dilution, kJ/mol [ref]
Operational conditions:
- Initial molality of solute, mol/kg = 0.50009 (Liquid)
- Temperature, K = 298.15 (Liquid)
- Pressure, kPa = 101.325 (Liquid)
| Final molality of solute, mol/kg - Liquid | Molar enthalpy of dilution, kJ/mol - Liquid |
|---|---|
| 0.0117 | -1.0567 |
| 0.0229 | -1.0358 |
| 0.0336 | -1.0163 |
| 0.0438 | -0.9933 |
| 0.0536 | -0.9735 |
| 0.0629 | -0.9547 |
| 0.0719 | -0.9365 |
| 0.0805 | -0.9219 |
| 0.0888 | -0.9075 |
| 0.0967 | -0.8909 |
| 0.1044 | -0.8757 |
| 0.1117 | -0.8600 |
| 0.1188 | -0.8450 |
| 0.1257 | -0.8300 |
| 0.1322 | -0.8157 |
| 0.1386 | -0.8018 |
| 0.1448 | -0.7891 |
| 0.1507 | -0.7775 |
| 0.1564 | -0.7650 |
| 0.1620 | -0.7530 |
| 0.1674 | -0.7410 |
| 0.1726 | -0.7292 |
| 0.1776 | -0.7179 |
| 0.1825 | -0.7067 |
| 0.1873 | -0.6963 |
| 0.1919 | -0.6861 |
| 0.1964 | -0.6763 |
| 0.2007 | -0.6666 |
| 0.2049 | -0.6570 |
| 0.2090 | -0.6476 |
| 0.2130 | -0.6389 |
| 0.2169 | -0.6301 |
| 0.2207 | -0.6217 |
| 0.2243 | -0.6134 |
| 0.2279 | -0.6053 |
| 0.2314 | -0.5972 |
| 0.2348 | -0.5876 |
| 0.2381 | -0.5812 |
| 0.2413 | -0.5709 |
| 0.2445 | -0.5647 |
Molar enthalpy of dilution, kJ/mol [ref]
Operational conditions:
- Temperature, K = 298.15 (Liquid)
- Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Initial molality of solute, mol/kg - Liquid | Final molality of solute, mol/kg - Liquid | Molar enthalpy of dilution, kJ/mol - Liquid |
| 0.0500 | 0.0263 | -0.0415 |
| 0.0800 | 0.0422 | -0.0754 |
| 0.1000 | 0.0525 | -0.0984 |
| 0.1200 | 0.0631 | -0.1206 |
| 0.1500 | 0.0784 | -0.1552 |
| 0.1800 | 0.0941 | -0.1884 |
| 0.2000 | 0.1048 | -0.2102 |
| 0.2200 | 0.1148 | -0.2333 |
| 0.2500 | 0.1300 | -0.2677 |
| 0.2800 | 0.1454 | -0.3016 |
| 0.3000 | 0.1554 | -0.3249 |
| 0.3200 | 0.1650 | -0.3494 |
Refractive index (Na D-line) [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Temperature, K = 298.15 (Liquid)
| Molality, mol/kg of N,N'-DIACETYLHEXAMETHYLENEDIAMINE (1) - Liquid | Refractive index (Na D-line) - Liquid |
|---|---|
| 0.0000 | 1.332 |
| 0.0999 | 1.335 |
| 0.1498 | 1.3365 |
| 0.1998 | 1.338 |
| 0.2500 | 1.3396 |
| 0.3001 | 1.3409 |
| 0.3503 | 1.342 |
| 0.3984 | 1.3433 |
Refractive index (Na D-line) [ref]
Operational conditions:
- Temperature, K = 298.15 (Liquid)
- Pressure, kPa = 101 (Liquid)
| Molality, mol/kg of N,N'-DIACETYLHEXAMETHYLENEDIAMINE (1) - Liquid | Refractive index (Na D-line) - Liquid |
|---|---|
| 0.1000 | 1.3348 |
| 0.1500 | 1.3363 |
| 0.2000 | 1.3382 |
| 0.2500 | 1.3393 |
| 0.3000 | 1.3409 |
| 0.3500 | 1.3419 |
| 0.4000 | 1.3431 |
Mass density, kg/m3 [ref]
Operational conditions:
- Temperature, K = 298.15 (Liquid)
- Pressure, kPa = 101.325 (Liquid)
| Molality, mol/kg of N,N'-DIACETYLHEXAMETHYLENEDIAMINE (1) - Liquid | Mass density, kg/m3 - Liquid |
|---|---|
| 0.0501 | 997.509 |
| 0.1000 | 997.98 |
| 0.1501 | 998.452 |
| 0.2000 | 998.938 |
| 0.2500 | 999.43 |
| 0.2999 | 999.91 |
| 0.3501 | 1000.427 |
| 0.4000 | 1000.925 |
| 0.4501 | 1001.424 |
| 0.5000 | 1001.928 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of N,N'-DIACETYLHEXAMETHYLENEDIAMINE (1) - Liquid | Mass density, kg/m3 - Liquid |
| 288.15 | 0.0000 | 999.107 |
| 288.15 | 0.0999 | 1000.159 |
| 288.15 | 0.1498 | 1000.68 |
| 288.15 | 0.1998 | 1001.225 |
| 288.15 | 0.2500 | 1001.78 |
| 288.15 | 0.3001 | 1002.341 |
| 288.15 | 0.3503 | 1002.88 |
| 288.15 | 0.3984 | 1003.424 |
| 293.15 | 0.0000 | 998.207 |
| 293.15 | 0.0999 | 999.201 |
| 293.15 | 0.1498 | 999.691 |
| 293.15 | 0.1998 | 1000.198 |
| 293.15 | 0.2500 | 1000.721 |
| 293.15 | 0.3001 | 1001.247 |
| 293.15 | 0.3503 | 1001.754 |
| 293.15 | 0.3984 | 1002.262 |
| 298.15 | 0.0000 | 997.047 |
| 298.15 | 0.0999 | 997.982 |
| 298.15 | 0.1498 | 998.441 |
| 298.15 | 0.1998 | 998.923 |
| 298.15 | 0.2500 | 999.415 |
| 298.15 | 0.3001 | 999.908 |
| 298.15 | 0.3503 | 1000.383 |
| 298.15 | 0.3984 | 1000.865 |
| 303.15 | 0.0000 | 995.649 |
| 303.15 | 0.0999 | 996.53 |
| 303.15 | 0.1498 | 996.965 |
| 303.15 | 0.1998 | 997.419 |
| 303.15 | 0.2500 | 997.884 |
| 303.15 | 0.3001 | 998.347 |
| 303.15 | 0.3503 | 998.795 |
| 303.15 | 0.3984 | 999.248 |
| 308.15 | 0.0000 | 994.03 |
| 308.15 | 0.0999 | 994.869 |
| 308.15 | 0.1498 | 995.284 |
| 308.15 | 0.1998 | 995.708 |
| 308.15 | 0.2500 | 996.146 |
| 308.15 | 0.3001 | 996.58 |
| 308.15 | 0.3503 | 997.002 |
| 308.15 | 0.3984 | 997.432 |
Mass density, kg/m3 [ref]
Operational conditions:
- Temperature, K = 298.15 (Liquid)
- Pressure, kPa = 101 (Liquid)
| Molality, mol/kg of N,N'-DIACETYLHEXAMETHYLENEDIAMINE (1) - Liquid | Mass density, kg/m3 - Liquid |
|---|---|
| 0.1000 | 997.981 |
| 0.1500 | 998.443 |
| 0.2000 | 998.931 |
| 0.2500 | 999.413 |
| 0.3000 | 999.901 |
| 0.3500 | 1000.372 |
| 0.4000 | 1000.882 |
Sources
- Enthalpies of dilution and volumetric properties of N,N0-hexamethylenebisacetamide in aqueous solutions of sodium chloride at 298.15 K
- Volumetric Properties and Refractive Indices of N,N'-Hexamethylenebisacetamide in Aqueous Glucose and Sucrose Solutions
- Enthalpies of Dilution, Volumetric Properties, and Refractive Indices of N,N'-Hexamethylenebisacetamide in Aqueous Xylitol or d-Mannitol Solutions at T = 298.15 K