- Name
- N,N-Dimethylaminoethanol
- InChI
- InChI=1S/C4H11NO/c1-5(2)3-4-6/h6H,3-4H2,1-2H3
- InChI Key
- UEEJHVSXFDXPFK-UHFFFAOYSA-N
- Formula
- C4H11NO
- SMILES
- CN(C)CCO
- Mol. Weight (g/mol)
- 89.14
- CAS
- 108-01-0
- Name
- Methyl Alcohol
- InChI
- InChI=1S/CH4O/c1-2/h2H,1H3
- InChI Key
- OKKJLVBELUTLKV-UHFFFAOYSA-N
- Formula
- CH4O
- SMILES
- CO
- Mol. Weight (g/mol)
- 32.04
- CAS
- 67-56-1
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Excess molar enthalpy (molar enthalpy of mixing), kJ/mol [ref]
| Fixed | Measured | ||
|---|---|---|---|
| Temperature, K - Liquid | Pressure, kPa - Liquid | Mole fraction of N,N-Dimethylaminoethanol (1) - Liquid | Excess molar enthalpy (molar enthalpy of mixing), kJ/mol - Liquid |
| 298.20 | 100.00 | 0.0499 | -0.2518 |
| 298.20 | 100.00 | 0.0990 | -0.4528 |
| 298.20 | 100.00 | 0.1495 | -0.6030 |
| 298.20 | 100.00 | 0.1981 | -0.7192 |
| 298.20 | 100.00 | 0.2479 | -0.8057 |
| 298.20 | 100.00 | 0.2982 | -0.8648 |
| 298.20 | 100.00 | 0.3481 | -0.8961 |
| 298.20 | 100.00 | 0.3968 | -0.9063 |
| 298.20 | 100.00 | 0.4466 | -0.8972 |
| 298.20 | 100.00 | 0.4972 | -0.8673 |
| 298.20 | 100.00 | 0.5483 | -0.8256 |
| 298.20 | 100.00 | 0.5992 | -0.7670 |
| 298.20 | 100.00 | 0.6494 | -0.7006 |
| 298.20 | 100.00 | 0.6981 | -0.6220 |
| 298.20 | 100.00 | 0.7506 | -0.5322 |
| 298.20 | 100.00 | 0.8007 | -0.4382 |
| 298.20 | 100.00 | 0.8477 | -0.3433 |
| 298.20 | 100.00 | 0.8977 | -0.2360 |
| 298.20 | 100.00 | 0.9512 | -0.1130 |
| 298.20 | 10000.00 | 0.0500 | -0.2757 |
| 298.20 | 10000.00 | 0.0993 | -0.4687 |
| 298.20 | 10000.00 | 0.1479 | -0.6126 |
| 298.20 | 10000.00 | 0.1986 | -0.7310 |
| 298.20 | 10000.00 | 0.2485 | -0.8126 |
| 298.20 | 10000.00 | 0.2961 | -0.8654 |
| 298.20 | 10000.00 | 0.3458 | -0.8962 |
| 298.20 | 10000.00 | 0.3976 | -0.9057 |
| 298.20 | 10000.00 | 0.4474 | -0.8951 |
| 298.20 | 10000.00 | 0.4981 | -0.8674 |
| 298.20 | 10000.00 | 0.5447 | -0.8270 |
| 298.20 | 10000.00 | 0.5952 | -0.7715 |
| 298.20 | 10000.00 | 0.6450 | -0.7047 |
| 298.20 | 10000.00 | 0.6988 | -0.6213 |
| 298.20 | 10000.00 | 0.7452 | -0.5409 |
| 298.20 | 10000.00 | 0.7948 | -0.4508 |
| 298.20 | 10000.00 | 0.8481 | -0.3423 |
| 298.20 | 10000.00 | 0.8980 | -0.2351 |
| 313.20 | 100.00 | 0.0499 | -0.2594 |
| 313.20 | 100.00 | 0.0990 | -0.4565 |
| 313.20 | 100.00 | 0.1495 | -0.6213 |
| 313.20 | 100.00 | 0.1981 | -0.7397 |
| 313.20 | 100.00 | 0.2479 | -0.8227 |
| 313.20 | 100.00 | 0.2982 | -0.8805 |
| 313.20 | 100.00 | 0.3481 | -0.9086 |
| 313.20 | 100.00 | 0.3968 | -0.9166 |
| 313.20 | 100.00 | 0.4466 | -0.9091 |
| 313.20 | 100.00 | 0.4972 | -0.8814 |
| 313.20 | 100.00 | 0.5483 | -0.8339 |
| 313.20 | 100.00 | 0.5992 | -0.7814 |
| 313.20 | 100.00 | 0.6494 | -0.7102 |
| 313.20 | 100.00 | 0.6981 | -0.6320 |
| 313.20 | 100.00 | 0.7506 | -0.5449 |
| 313.20 | 100.00 | 0.8007 | -0.4454 |
| 313.20 | 100.00 | 0.8477 | -0.3477 |
| 313.20 | 100.00 | 0.8977 | -0.2367 |
| 313.20 | 100.00 | 0.9512 | -0.1173 |
| 313.20 | 10000.00 | 0.0502 | -0.2609 |
| 313.20 | 10000.00 | 0.0996 | -0.4633 |
| 313.20 | 10000.00 | 0.1484 | -0.6177 |
| 313.20 | 10000.00 | 0.1992 | -0.7424 |
| 313.20 | 10000.00 | 0.2491 | -0.8291 |
| 313.20 | 10000.00 | 0.2968 | -0.8840 |
| 313.20 | 10000.00 | 0.3465 | -0.9176 |
| 313.20 | 10000.00 | 0.3983 | -0.9279 |
| 313.20 | 10000.00 | 0.4482 | -0.9171 |
| 313.20 | 10000.00 | 0.4989 | -0.8900 |
| 313.20 | 10000.00 | 0.5455 | -0.8511 |
| 313.20 | 10000.00 | 0.5960 | -0.7947 |
| 313.20 | 10000.00 | 0.6457 | -0.7272 |
| 313.20 | 10000.00 | 0.6995 | -0.6400 |
| 313.20 | 10000.00 | 0.7458 | -0.5585 |
| 313.20 | 10000.00 | 0.7953 | -0.4639 |
| 313.20 | 10000.00 | 0.8485 | -0.3543 |
| 313.20 | 10000.00 | 0.8983 | -0.2417 |
| 328.20 | 100.00 | 0.1479 | -0.5919 |
| 328.20 | 100.00 | 0.1972 | -0.7142 |
| 328.20 | 100.00 | 0.2469 | -0.8026 |
| 328.20 | 100.00 | 0.2976 | -0.8599 |
| 328.20 | 100.00 | 0.3469 | -0.8941 |
| 328.20 | 100.00 | 0.3974 | -0.9026 |
| 328.20 | 100.00 | 0.4466 | -0.8949 |
| 328.20 | 100.00 | 0.4956 | -0.8653 |
| 328.20 | 100.00 | 0.5465 | -0.8224 |
| 328.20 | 100.00 | 0.5963 | -0.7659 |
| 328.20 | 100.00 | 0.6473 | -0.6999 |
| 328.20 | 10000.00 | 0.1487 | -0.5927 |
| 328.20 | 10000.00 | 0.1983 | -0.7172 |
| 328.20 | 10000.00 | 0.2481 | -0.8099 |
| 328.20 | 10000.00 | 0.2973 | -0.8679 |
| 328.20 | 10000.00 | 0.3465 | -0.9030 |
| 328.20 | 10000.00 | 0.3970 | -0.9111 |
| 328.20 | 10000.00 | 0.4460 | -0.9061 |
| 328.20 | 10000.00 | 0.4972 | -0.8798 |
| 328.20 | 10000.00 | 0.5455 | -0.8396 |
| 328.20 | 10000.00 | 0.5979 | -0.7828 |
| 328.20 | 10000.00 | 0.6457 | -0.7202 |
| 328.20 | 10000.00 | 0.6973 | -0.6422 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Mole fraction of N,N-Dimethylaminoethanol (1) - Liquid | Temperature, K - Liquid | Mass density, kg/m3 - Liquid |
| 0.0000 | 298.15 | 786.74 |
| 0.0971 | 298.15 | 814.11 |
| 0.1983 | 298.15 | 835.29 |
| 0.2962 | 298.15 | 850.65 |
| 0.4039 | 298.15 | 862.04 |
| 0.5020 | 298.15 | 868.4 |
| 0.6070 | 298.15 | 873.13 |
| 0.7075 | 298.15 | 876.61 |
| 0.7999 | 298.15 | 879.06 |
| 0.9015 | 298.15 | 881.19 |
| 1.0000 | 298.15 | 883.34 |
| 0.0000 | 308.15 | 777.45 |
| 0.0971 | 308.15 | 806.11 |
| 0.1983 | 308.15 | 827.54 |
| 0.2962 | 308.15 | 842.65 |
| 0.4039 | 308.15 | 853.81 |
| 0.5020 | 308.15 | 860.4 |
| 0.6070 | 308.15 | 865.13 |
| 0.7075 | 308.15 | 868.67 |
| 0.7999 | 308.15 | 871.15 |
| 0.9015 | 308.15 | 873.28 |
| 1.0000 | 308.15 | 874.99 |
| 0.0000 | 318.15 | 768.01 |
| 0.0971 | 318.15 | 797.9 |
| 0.1983 | 318.15 | 819.51 |
| 0.2962 | 318.15 | 834.22 |
| 0.4039 | 318.15 | 845.26 |
| 0.5020 | 318.15 | 852.01 |
| 0.6070 | 318.15 | 856.89 |
| 0.7075 | 318.15 | 860.58 |
| 0.7999 | 318.15 | 862.98 |
| 0.9015 | 318.15 | 865.23 |
| 1.0000 | 318.15 | 866.37 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Mole fraction of N,N-Dimethylaminoethanol (1) - Liquid | Temperature, K - Liquid | Speed of sound, m/s - Liquid |
| 0.0000 | 298.15 | 1100.7 |
| 0.0971 | 298.15 | 1152.4 |
| 0.1983 | 298.15 | 1204.7 |
| 0.2962 | 298.15 | 1249.8 |
| 0.4039 | 298.15 | 1290.2 |
| 0.5020 | 298.15 | 1312.0 |
| 0.6070 | 298.15 | 1322.4 |
| 0.7075 | 298.15 | 1326.9 |
| 0.7999 | 298.15 | 1330.6 |
| 0.9015 | 298.15 | 1335.0 |
| 1.0000 | 298.15 | 1344.4 |
| 0.0000 | 308.15 | 1068.2 |
| 0.0971 | 308.15 | 1126.7 |
| 0.1983 | 308.15 | 1180.5 |
| 0.2962 | 308.15 | 1225.3 |
| 0.4039 | 308.15 | 1265.5 |
| 0.5020 | 308.15 | 1288.1 |
| 0.6070 | 308.15 | 1299.3 |
| 0.7075 | 308.15 | 1301.3 |
| 0.7999 | 308.15 | 1303.1 |
| 0.9015 | 308.15 | 1304.2 |
| 1.0000 | 308.15 | 1309.1 |
| 0.0000 | 318.15 | 1037.0 |
| 0.0971 | 318.15 | 1101.6 |
| 0.1983 | 318.15 | 1156.2 |
| 0.2962 | 318.15 | 1199.5 |
| 0.4039 | 318.15 | 1238.9 |
| 0.5020 | 318.15 | 1261.3 |
| 0.6070 | 318.15 | 1272.9 |
| 0.7075 | 318.15 | 1273.6 |
| 0.7999 | 318.15 | 1273.9 |
| 0.9015 | 318.15 | 1274.0 |
| 1.0000 | 318.15 | 1274.1 |
Sources
- Study of intermolecular interactions in binary mixtures of 2-(dimethylamino)ethanol with methanol and ethanol at various temperatures
- Excess Molar Enthalpies of N,N-Dimethylethanolamine with (Methanol, Ethanol, 1-Propanol, and 2-Propanol) at T ) (298.2, 313.2, and 328.2) K and p ) (0.1 and 10.0) MPa
Note: These property values are available through the Cheméo API. A free account gives you an access key.