- Name
- 1-(1-methyl-2-propoxyethoxy)-2-propanol
- InChI
- InChI=1S/C9H20O3/c1-4-5-11-7-9(3)12-6-8(2)10/h8-10H,4-7H2,1-3H3
- InChI Key
- WEZPLQKRXDBPEP-UHFFFAOYSA-N
- Formula
- C9H20O3
- SMILES
- CCCOCC(C)OCC(C)O
- Mol. Weight (g/mol)
- 176.26
- Name
- Water
- InChI
- InChI=1S/H2O/h1H2
- InChI Key
- XLYOFNOQVPJJNP-UHFFFAOYSA-N
- Formula
- H2O
- SMILES
- O
- Mol. Weight (g/mol)
- 18.02
- CAS
- 7732-18-5
Datasets
Mass fraction of 1-(1-methyl-2-propoxyethoxy)-2-propanol (1) [ref]
Operational condition: Pressure, kPa = 101 (Liquid mixture 1)
| Temperature, K - Liquid mixture 1 | Mass fraction of 1-(1-methyl-2-propoxyethoxy)-2-propanol (1) - Liquid mixture 2 |
|---|---|
| 298.15 | 0.1720 |
| 298.15 | 0.1726 |
| 298.15 | 0.1719 |
| 308.15 | 0.1064 |
| 308.15 | 0.0980 |
| 308.15 | 0.0807 |
| 308.15 | 0.0482 |
| 308.15 | 0.1077 |
| 308.15 | 0.1113 |
| 308.15 | 0.1216 |
| 318.15 | 0.0387 |
| 318.15 | 0.0610 |
| 318.15 | 0.0706 |
| 318.15 | 0.0748 |
| 318.15 | 0.0759 |
| 318.15 | 0.0761 |
| 318.15 | 0.0765 |
| 318.15 | 0.0768 |
| 318.15 | 0.0798 |
| 318.15 | 0.0834 |
Mass fraction of Water (2) [ref]
Operational condition: Pressure, kPa = 101 (Liquid mixture 1)
| Temperature, K - Liquid mixture 1 | Mass fraction of Water (2) - Liquid mixture 1 |
|---|---|
| 298.15 | 0.2053 |
| 308.15 | 0.1743 |
| 318.15 | 0.1468 |
Mass fraction of 1-(1-methyl-2-propoxyethoxy)-2-propanol (1) [ref]
Operational condition: Pressure, kPa = 101.325 (Liquid mixture 1)
| Temperature, K - Liquid mixture 1 | Mass fraction of 1-(1-methyl-2-propoxyethoxy)-2-propanol (1) - Liquid mixture 1 |
|---|---|
| 288.15 | 0.2910 |
| 293.15 | 0.2020 |
| 303.15 | 0.1300 |
| 313.15 | 0.0932 |
| 333.15 | 0.0544 |
Mass fraction of 1-(1-methyl-2-propoxyethoxy)-2-propanol (1) [ref]
Operational condition: Pressure, kPa = 101.325 (Liquid mixture 1)
| Temperature, K - Liquid mixture 2 | Mass fraction of 1-(1-methyl-2-propoxyethoxy)-2-propanol (1) - Liquid mixture 2 |
|---|---|
| 288.15 | 0.6970 |
| 293.15 | 0.7420 |
| 303.15 | 0.8000 |
| 313.15 | 0.8730 |
| 333.15 | 0.9290 |
Mass fraction of 1-(1-methyl-2-propoxyethoxy)-2-propanol (1) [ref]
Operational condition: Pressure, kPa = 101 (Liquid mixture 1)
| Temperature, K - Liquid mixture 1 | Mass fraction of 1-(1-methyl-2-propoxyethoxy)-2-propanol (1) - Liquid mixture 2 |
|---|---|
| 298.15 | 0.1720 |
| 298.15 | 0.1726 |
| 298.15 | 0.1719 |
| 308.15 | 0.1064 |
| 308.15 | 0.0980 |
| 308.15 | 0.0807 |
| 308.15 | 0.0482 |
| 308.15 | 0.1077 |
| 308.15 | 0.1113 |
| 308.15 | 0.1216 |
| 318.15 | 0.0387 |
| 318.15 | 0.0610 |
| 318.15 | 0.0706 |
| 318.15 | 0.0748 |
| 318.15 | 0.0759 |
| 318.15 | 0.0761 |
| 318.15 | 0.0765 |
| 318.15 | 0.0768 |
| 318.15 | 0.0798 |
| 318.15 | 0.0834 |
Mass fraction of Water (2) [ref]
Operational condition: Pressure, kPa = 101 (Liquid mixture 1)
| Temperature, K - Liquid mixture 1 | Mass fraction of Water (2) - Liquid mixture 1 |
|---|---|
| 298.15 | 0.2053 |
| 308.15 | 0.1743 |
| 318.15 | 0.1468 |
Mass fraction of 1-(1-methyl-2-propoxyethoxy)-2-propanol (1) [ref]
Operational condition: Pressure, kPa = 101.325 (Liquid mixture 1)
| Temperature, K - Liquid mixture 1 | Mass fraction of 1-(1-methyl-2-propoxyethoxy)-2-propanol (1) - Liquid mixture 1 |
|---|---|
| 288.15 | 0.2910 |
| 293.15 | 0.2020 |
| 303.15 | 0.1300 |
| 313.15 | 0.0932 |
| 333.15 | 0.0544 |
Mass fraction of 1-(1-methyl-2-propoxyethoxy)-2-propanol (1) [ref]
Operational condition: Pressure, kPa = 101.325 (Liquid mixture 1)
| Temperature, K - Liquid mixture 2 | Mass fraction of 1-(1-methyl-2-propoxyethoxy)-2-propanol (1) - Liquid mixture 2 |
|---|---|
| 288.15 | 0.6970 |
| 293.15 | 0.7420 |
| 303.15 | 0.8000 |
| 313.15 | 0.8730 |
| 333.15 | 0.9290 |
Sources
- Liquid-liquid equilibria for the ternary system (water + hexadecane + dipropylene glycol n-propyl ether)
- Mutual Solubility and Lower Critical Solution Temperature for Water + Glycol Ether Systems
Note: These property values are available through the Cheméo API. A free account gives you an access key.