- Name
- Carbon dioxide
- InChI
- InChI=1S/CO2/c2-1-3
- InChI Key
- CURLTUGMZLYLDI-UHFFFAOYSA-N
- Formula
- CO2
- SMILES
- O=C=O
- Mol. Weight (g/mol)
- 44.01
- CAS
- 124-38-9
- Name
- Benzene, 1,3-dinitro-
- InChI
- InChI=1S/C6H4N2O4/c9-7(10)5-2-1-3-6(4-5)8(11)12/h1-4H
- InChI Key
- WDCYWAQPCXBPJA-UHFFFAOYSA-N
- Formula
- C6H4N2O4
- SMILES
-
O=[N+]([O-])c1cccc([N+](=O)[O-
])c1 - Mol. Weight (g/mol)
- 168.11
- CAS
- 99-65-0
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Mole fraction of Benzene, 1,3-dinitro- (2) [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Fluid (supercritical or subcritical phases) | Pressure, kPa - Fluid (supercritical or subcritical phases) | Mole fraction of Benzene, 1,3-dinitro- (2) - Fluid (supercritical or subcritical phases) |
| 308.00 | 9500.00 | 0.0021 |
| 308.00 | 10500.00 | 0.0029 |
| 308.00 | 11500.00 | 0.0034 |
| 308.00 | 12500.00 | 0.0041 |
| 308.00 | 13500.00 | 0.0046 |
| 308.00 | 14500.00 | 0.0055 |
| 318.00 | 9500.00 | 0.0006 |
| 318.00 | 10500.00 | 0.0013 |
| 318.00 | 11500.00 | 0.0022 |
| 318.00 | 12500.00 | 0.0028 |
| 318.00 | 13500.00 | 0.0035 |
Mole fraction of Benzene, 1,3-dinitro- (2) [ref]
| Fixed | Measured | |
|---|---|---|
| Pressure, kPa - Fluid (supercritical or subcritical phases) | Temperature, K - Fluid (supercritical or subcritical phases) | Mole fraction of Benzene, 1,3-dinitro- (2) - Fluid (supercritical or subcritical phases) |
| 9500.00 | 308.00 | 0.0021 |
| 9500.00 | 318.00 | 0.0006 |
| 9500.00 | 328.00 | 0.0002 |
| 10500.00 | 308.00 | 0.0029 |
| 10500.00 | 318.00 | 0.0013 |
| 10500.00 | 328.00 | 0.0004 |
| 11500.00 | 308.00 | 0.0034 |
| 11500.00 | 318.00 | 0.0022 |
| 11500.00 | 328.00 | 0.0009 |
| 12500.00 | 308.00 | 0.0041 |
| 12500.00 | 318.00 | 0.0028 |
| 12500.00 | 328.00 | 0.0014 |
| 13500.00 | 308.00 | 0.0046 |
| 13500.00 | 318.00 | 0.0035 |
| 13500.00 | 328.00 | 0.0020 |
| 14500.00 | 308.00 | 0.0055 |
| 14500.00 | 318.00 | 0.0041 |
| 14500.00 | 328.00 | 0.0023 |
Mole fraction of Benzene, 1,3-dinitro- (2) [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Fluid (supercritical or subcritical phases) | Pressure, kPa - Fluid (supercritical or subcritical phases) | Mole fraction of Benzene, 1,3-dinitro- (2) - Fluid (supercritical or subcritical phases) |
| 308.00 | 9500.00 | 0.0021 |
| 308.00 | 10500.00 | 0.0029 |
| 308.00 | 11500.00 | 0.0034 |
| 308.00 | 12500.00 | 0.0041 |
| 308.00 | 13500.00 | 0.0046 |
| 308.00 | 14500.00 | 0.0055 |
| 318.00 | 9500.00 | 0.0006 |
| 318.00 | 10500.00 | 0.0013 |
| 318.00 | 11500.00 | 0.0022 |
| 318.00 | 12500.00 | 0.0028 |
| 318.00 | 13500.00 | 0.0035 |
Mole fraction of Benzene, 1,3-dinitro- (2) [ref]
| Fixed | Measured | |
|---|---|---|
| Pressure, kPa - Fluid (supercritical or subcritical phases) | Temperature, K - Fluid (supercritical or subcritical phases) | Mole fraction of Benzene, 1,3-dinitro- (2) - Fluid (supercritical or subcritical phases) |
| 9500.00 | 308.00 | 0.0021 |
| 9500.00 | 318.00 | 0.0006 |
| 9500.00 | 328.00 | 0.0002 |
| 10500.00 | 308.00 | 0.0029 |
| 10500.00 | 318.00 | 0.0013 |
| 10500.00 | 328.00 | 0.0004 |
| 11500.00 | 308.00 | 0.0034 |
| 11500.00 | 318.00 | 0.0022 |
| 11500.00 | 328.00 | 0.0009 |
| 12500.00 | 308.00 | 0.0041 |
| 12500.00 | 318.00 | 0.0028 |
| 12500.00 | 328.00 | 0.0014 |
| 13500.00 | 308.00 | 0.0046 |
| 13500.00 | 318.00 | 0.0035 |
| 13500.00 | 328.00 | 0.0020 |
| 14500.00 | 308.00 | 0.0055 |
| 14500.00 | 318.00 | 0.0041 |
| 14500.00 | 328.00 | 0.0023 |
Sources
- A new semi-empirical model for correlating the solubilities of solids in supercritical carbon dioxide with cosolvents
- Solubilities of Benzene Derivatives in Supercritical Carbon Dioxide
Note: These property values are available through the Cheméo API. A free account gives you an access key.