- Name
- Trichloroethylene
- InChI
- InChI=1S/C2HCl3/c3-1-2(4)5/h1H
- InChI Key
- XSTXAVWGXDQKEL-UHFFFAOYSA-N
- Formula
- C2HCl3
- SMILES
- ClC=C(Cl)Cl
- Mol. Weight (g/mol)
- 131.39
- CAS
- 79-01-6
- Name
- Tributylamine
- InChI
- InChI=1S/C12H27N/c1-4-7-10-13(11-8-5-2)12-9-6-3/h4-12H2,1-3H3
- InChI Key
- IMFACGCPASFAPR-UHFFFAOYSA-N
- Formula
- C12H27N
- SMILES
- CCCCN(CCCC)CCCC
- Mol. Weight (g/mol)
- 185.35
- CAS
- 102-82-9
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- η - Viscosity, Pa*s (2)
- n0 - Refractive index (Na D-line) (2)
- ρl - Mass density, kg/m3 (2)
- csound,fluid - Speed of Sound, m/s (2)
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101.325 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Tributylamine (2) - Liquid | Viscosity, Pa*s - Liquid |
| 298.15 | 0.0000 | 0.0006 |
| 298.15 | 0.0996 | 0.0007 |
| 298.15 | 0.1953 | 0.0007 |
| 298.15 | 0.2913 | 0.0008 |
| 298.15 | 0.3902 | 0.0008 |
| 298.15 | 0.4875 | 0.0009 |
| 298.15 | 0.5906 | 0.0010 |
| 298.15 | 0.6843 | 0.0010 |
| 298.15 | 0.7846 | 0.0011 |
| 298.15 | 0.8835 | 0.0012 |
| 298.15 | 1.0000 | 0.0012 |
| 303.15 | 0.0000 | 0.0006 |
| 303.15 | 0.0996 | 0.0006 |
| 303.15 | 0.1953 | 0.0007 |
| 303.15 | 0.2913 | 0.0007 |
| 303.15 | 0.3902 | 0.0008 |
| 303.15 | 0.4875 | 0.0008 |
| 303.15 | 0.5906 | 0.0009 |
| 303.15 | 0.6843 | 0.0010 |
| 303.15 | 0.7846 | 0.0010 |
| 303.15 | 0.8835 | 0.0011 |
| 303.15 | 1.0000 | 0.0011 |
| 308.15 | 0.0000 | 0.0005 |
| 308.15 | 0.0996 | 0.0006 |
| 308.15 | 0.1953 | 0.0006 |
| 308.15 | 0.2913 | 0.0007 |
| 308.15 | 0.3902 | 0.0007 |
| 308.15 | 0.4875 | 0.0008 |
| 308.15 | 0.5906 | 0.0008 |
| 308.15 | 0.6843 | 0.0009 |
| 308.15 | 0.7846 | 0.0009 |
| 308.15 | 0.8835 | 0.0010 |
| 308.15 | 1.0000 | 0.0010 |
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101.325 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Tributylamine (2) - Liquid | Viscosity, Pa*s - Liquid |
| 298.15 | 0.0000 | 0.0006 |
| 298.15 | 0.0996 | 0.0007 |
| 298.15 | 0.1953 | 0.0007 |
| 298.15 | 0.2913 | 0.0008 |
| 298.15 | 0.3902 | 0.0008 |
| 298.15 | 0.4875 | 0.0009 |
| 298.15 | 0.5906 | 0.0010 |
| 298.15 | 0.6843 | 0.0010 |
| 298.15 | 0.7846 | 0.0011 |
| 298.15 | 0.8835 | 0.0012 |
| 298.15 | 1.0000 | 0.0012 |
| 303.15 | 0.0000 | 0.0006 |
| 303.15 | 0.0996 | 0.0006 |
| 303.15 | 0.1953 | 0.0007 |
| 303.15 | 0.2913 | 0.0007 |
| 303.15 | 0.3902 | 0.0008 |
| 303.15 | 0.4875 | 0.0008 |
| 303.15 | 0.5906 | 0.0009 |
| 303.15 | 0.6843 | 0.0010 |
| 303.15 | 0.7846 | 0.0010 |
| 303.15 | 0.8835 | 0.0011 |
| 303.15 | 1.0000 | 0.0011 |
| 308.15 | 0.0000 | 0.0005 |
| 308.15 | 0.0996 | 0.0006 |
| 308.15 | 0.1953 | 0.0006 |
| 308.15 | 0.2913 | 0.0007 |
| 308.15 | 0.3902 | 0.0007 |
| 308.15 | 0.4875 | 0.0008 |
| 308.15 | 0.5906 | 0.0008 |
| 308.15 | 0.6843 | 0.0009 |
| 308.15 | 0.7846 | 0.0009 |
| 308.15 | 0.8835 | 0.0010 |
| 308.15 | 1.0000 | 0.0010 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 101.325 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Tributylamine (2) - Liquid | Refractive index (Na D-line) - Liquid |
| 298.15 | 0.0000 | 1.4752 |
| 298.15 | 0.0996 | 1.4632 |
| 298.15 | 0.1953 | 1.4563 |
| 298.15 | 0.2913 | 1.4502 |
| 298.15 | 0.3902 | 1.4448 |
| 298.15 | 0.4875 | 1.4402 |
| 298.15 | 0.5906 | 1.437 |
| 298.15 | 0.6843 | 1.4346 |
| 298.15 | 0.7846 | 1.4318 |
| 298.15 | 0.8835 | 1.4298 |
| 298.15 | 1.0000 | 1.4276 |
| 303.15 | 0.0000 | 1.4722 |
| 303.15 | 0.0996 | 1.4604 |
| 303.15 | 0.1953 | 1.453 |
| 303.15 | 0.2913 | 1.4469 |
| 303.15 | 0.3902 | 1.4417 |
| 303.15 | 0.4875 | 1.4377 |
| 303.15 | 0.5906 | 1.4343 |
| 303.15 | 0.6843 | 1.4315 |
| 303.15 | 0.7846 | 1.4295 |
| 303.15 | 0.8835 | 1.4272 |
| 303.15 | 1.0000 | 1.4255 |
| 308.15 | 0.0000 | 1.469 |
| 308.15 | 0.0996 | 1.4576 |
| 308.15 | 0.1953 | 1.4495 |
| 308.15 | 0.2913 | 1.4436 |
| 308.15 | 0.3902 | 1.4386 |
| 308.15 | 0.4875 | 1.4352 |
| 308.15 | 0.5906 | 1.4317 |
| 308.15 | 0.6843 | 1.4284 |
| 308.15 | 0.7846 | 1.427 |
| 308.15 | 0.8835 | 1.4246 |
| 308.15 | 1.0000 | 1.4228 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 101.325 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Tributylamine (2) - Liquid | Refractive index (Na D-line) - Liquid |
| 298.15 | 0.0000 | 1.4752 |
| 298.15 | 0.0996 | 1.4632 |
| 298.15 | 0.1953 | 1.4563 |
| 298.15 | 0.2913 | 1.4502 |
| 298.15 | 0.3902 | 1.4448 |
| 298.15 | 0.4875 | 1.4402 |
| 298.15 | 0.5906 | 1.437 |
| 298.15 | 0.6843 | 1.4346 |
| 298.15 | 0.7846 | 1.4318 |
| 298.15 | 0.8835 | 1.4298 |
| 298.15 | 1.0000 | 1.4276 |
| 303.15 | 0.0000 | 1.4722 |
| 303.15 | 0.0996 | 1.4604 |
| 303.15 | 0.1953 | 1.453 |
| 303.15 | 0.2913 | 1.4469 |
| 303.15 | 0.3902 | 1.4417 |
| 303.15 | 0.4875 | 1.4377 |
| 303.15 | 0.5906 | 1.4343 |
| 303.15 | 0.6843 | 1.4315 |
| 303.15 | 0.7846 | 1.4295 |
| 303.15 | 0.8835 | 1.4272 |
| 303.15 | 1.0000 | 1.4255 |
| 308.15 | 0.0000 | 1.469 |
| 308.15 | 0.0996 | 1.4576 |
| 308.15 | 0.1953 | 1.4495 |
| 308.15 | 0.2913 | 1.4436 |
| 308.15 | 0.3902 | 1.4386 |
| 308.15 | 0.4875 | 1.4352 |
| 308.15 | 0.5906 | 1.4317 |
| 308.15 | 0.6843 | 1.4284 |
| 308.15 | 0.7846 | 1.427 |
| 308.15 | 0.8835 | 1.4246 |
| 308.15 | 1.0000 | 1.4228 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101.325 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Tributylamine (2) - Liquid | Mass density, kg/m3 - Liquid |
| 298.15 | 0.0000 | 1456.7 |
| 298.15 | 0.0996 | 1299.3 |
| 298.15 | 0.1953 | 1186.7 |
| 298.15 | 0.2913 | 1098.3 |
| 298.15 | 0.3902 | 1025.1 |
| 298.15 | 0.4875 | 966.3 |
| 298.15 | 0.5906 | 914.7 |
| 298.15 | 0.6843 | 875.0 |
| 298.15 | 0.7846 | 838.1 |
| 298.15 | 0.8835 | 806.5 |
| 298.15 | 1.0000 | 773.3 |
| 303.15 | 0.0000 | 1447.1 |
| 303.15 | 0.0996 | 1291.8 |
| 303.15 | 0.1953 | 1180.1 |
| 303.15 | 0.2913 | 1092.1 |
| 303.15 | 0.3902 | 1019.6 |
| 303.15 | 0.4875 | 961.0 |
| 303.15 | 0.5906 | 909.8 |
| 303.15 | 0.6843 | 870.3 |
| 303.15 | 0.7846 | 833.7 |
| 303.15 | 0.8835 | 802.2 |
| 303.15 | 1.0000 | 769.2 |
| 308.15 | 0.0000 | 1439.5 |
| 308.15 | 0.0996 | 1284.4 |
| 308.15 | 0.1953 | 1173.3 |
| 308.15 | 0.2913 | 1086.0 |
| 308.15 | 0.3902 | 1013.9 |
| 308.15 | 0.4875 | 955.8 |
| 308.15 | 0.5906 | 904.9 |
| 308.15 | 0.6843 | 865.7 |
| 308.15 | 0.7846 | 829.1 |
| 308.15 | 0.8835 | 797.8 |
| 308.15 | 1.0000 | 765.7 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101.325 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Tributylamine (2) - Liquid | Mass density, kg/m3 - Liquid |
| 298.15 | 0.0000 | 1456.7 |
| 298.15 | 0.0996 | 1299.3 |
| 298.15 | 0.1953 | 1186.7 |
| 298.15 | 0.2913 | 1098.3 |
| 298.15 | 0.3902 | 1025.1 |
| 298.15 | 0.4875 | 966.3 |
| 298.15 | 0.5906 | 914.7 |
| 298.15 | 0.6843 | 875.0 |
| 298.15 | 0.7846 | 838.1 |
| 298.15 | 0.8835 | 806.5 |
| 298.15 | 1.0000 | 773.3 |
| 303.15 | 0.0000 | 1447.1 |
| 303.15 | 0.0996 | 1291.8 |
| 303.15 | 0.1953 | 1180.1 |
| 303.15 | 0.2913 | 1092.1 |
| 303.15 | 0.3902 | 1019.6 |
| 303.15 | 0.4875 | 961.0 |
| 303.15 | 0.5906 | 909.8 |
| 303.15 | 0.6843 | 870.3 |
| 303.15 | 0.7846 | 833.7 |
| 303.15 | 0.8835 | 802.2 |
| 303.15 | 1.0000 | 769.2 |
| 308.15 | 0.0000 | 1439.5 |
| 308.15 | 0.0996 | 1284.4 |
| 308.15 | 0.1953 | 1173.3 |
| 308.15 | 0.2913 | 1086.0 |
| 308.15 | 0.3902 | 1013.9 |
| 308.15 | 0.4875 | 955.8 |
| 308.15 | 0.5906 | 904.9 |
| 308.15 | 0.6843 | 865.7 |
| 308.15 | 0.7846 | 829.1 |
| 308.15 | 0.8835 | 797.8 |
| 308.15 | 1.0000 | 765.7 |
Speed of sound, m/s [ref]
Operational conditions:
- Temperature, K = 298.15 (Liquid)
- Pressure, kPa = 101.325 (Liquid)
| Mole fraction of Tributylamine (2) - Liquid | Speed of sound, m/s - Liquid |
|---|---|
| 0.0000 | 1028.0 |
| 0.0996 | 1054.0 |
| 0.1953 | 1084.0 |
| 0.2913 | 1108.0 |
| 0.3902 | 1129.0 |
| 0.4875 | 1151.0 |
| 0.5906 | 1170.0 |
| 0.6843 | 1187.0 |
| 0.7846 | 1205.0 |
| 0.8835 | 1227.0 |
| 1.0000 | 1262.0 |
Speed of sound, m/s [ref]
Operational conditions:
- Temperature, K = 298.15 (Liquid)
- Pressure, kPa = 101.325 (Liquid)
| Mole fraction of Tributylamine (2) - Liquid | Speed of sound, m/s - Liquid |
|---|---|
| 0.0000 | 1028.0 |
| 0.0996 | 1054.0 |
| 0.1953 | 1084.0 |
| 0.2913 | 1108.0 |
| 0.3902 | 1129.0 |
| 0.4875 | 1151.0 |
| 0.5906 | 1170.0 |
| 0.6843 | 1187.0 |
| 0.7846 | 1205.0 |
| 0.8835 | 1227.0 |
| 1.0000 | 1262.0 |