- InChI
- InChI=1S/C2HCl3/c3-1-2(4)5/h1H
- InChI Key
- XSTXAVWGXDQKEL-UHFFFAOYSA-N
- Formula
- C2HCl3
- SMILES
- ClC=C(Cl)Cl
- Molecular Weight1
- 131.39
- CAS
- 79-01-6
- Other Names
-
- 1,1,2-Trichloroethene
- 1,1,2-Trichloroethylene
- 1,1-Dichloro-2-chloroethylene
- 1,2,2-Trichloroethylene
- 1-Chloro-2,2-dichloroethylene
- Acetylene trichloride
- Algylen
- Anamenth
- Benzinol
- Blacosolv
- Blancosolv
- C2HCl3
- CHLORYLEN
- Cecolene
- Chlorilen
- Chlorylea
- Chorylen
- Circosolv
- Crawhaspol
- Densinfluat
- Distillex DS2
- Dow-tri
- Dukeron
- Ethene, 1,1,2-trichloro-
- Ethene, trichloro-
- Ethinyl trichloride
- Ethylene trichloride
- Ethylene, trichloro-
- FLUATE
- Fleck-flip
- Flock FLIP
- Gemalgene
- Germalgene
- Lanadin
- Lethurin
- NCI-C04546
- Narcogen
- Narkogen
- Narkosoid
- Nialk
- Perm-A-chlor
- Perm-A-clor
- Petzinol
- Philex
- R 1120
- RCRA Waste number U228
- TCE
- TRICHLOROETHENE
- Threthylen
- Threthylene
- Trethylene
- Tri
- Tri-Clene
- Tri-plus
- Tri-plus M
- Triad
- Trial
- Triasol
- Trichlooretheen
- Trichloorethyleen, tri
- Trichloraethen
- Trichloraethylen, tri
- Trichloran
- Trichloren
- Trichlorethene
- Trichlorethylene
- Trichlorethylene, tri
- Tricloretene
- Tricloroetilene
- Trielene
- Trielin
- Trielina
- Trieline
- Triklone
- Triklone N
- Trilen
- Trilene
- Triline
- Trimar
- Triol
- UN 1710
- Vestrol
- Vitran
- Westrosol
- ω : Acentric Factor.
- ΔcH°liquid : Standard liquid enthalpy of combustion (kJ/mol).
- Cp,gas : Ideal gas heat capacity (J/mol×K).
- Cp,liquid : Liquid phase heat capacity (J/mol×K).
- μ : Dipole Moment (debye).
- η : Dynamic viscosity (Pa×s).
- EA : Electron affinity (eV).
- ΔfG° : Standard Gibbs free energy of formation (kJ/mol).
- Rg : Radius of Gyration.
- ΔfH°gas : Enthalpy of formation at standard conditions (kJ/mol).
- ΔfH°liquid : Liquid phase enthalpy of formation at standard conditions (kJ/mol).
- ΔfusH° : Enthalpy of fusion at standard conditions (kJ/mol).
- ΔfusH : Enthalpy of fusion at a given temperature (kJ/mol).
- ΔvapH° : Enthalpy of vaporization at standard conditions (kJ/mol).
- ΔvapH : Enthalpy of vaporization at a given temperature (kJ/mol).
- IE : Ionization energy (eV).
- log10WS : Log10 of Water solubility in mol/l.
- logPoct/wat : Octanol/Water partition coefficient.
- McVol : McGowan's characteristic volume (ml/mol).
- NFPA Fire : NFPA Fire Rating.
- NFPA Health : NFPA Health Rating.
- NFPA Safety : NFPA Safety Rating.
- Pc : Critical Pressure (kPa).
- Pvap : Vapor pressure (kPa).
- n0 : Refractive Index.
- ρl : Liquid Density (kg/m3).
- Inp : Non-polar retention indices.
- I : Polar retention indices.
- ΔfusS : Entropy of fusion at a given temperature (J/mol×K).
- γ : Surface Tension (N/m).
- Tboil : Normal Boiling Point Temperature (K).
- Tc : Critical Temperature (K).
- Tfus : Normal melting (fusion) point (K).
- Vc : Critical Volume (m3/kmol).
- Zc : Critical Compressibility.
- Zra : Rackett Parameter.
- 1: Molecular weight from the IUPAC atomic weights tables.
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Physical Properties
| Property | Value | Unit | Source |
|---|---|---|---|
| ω | 0.2130 | KDB | |
| ΔcH°liquid | [-956.50; -947.70] | kJ/mol |
|
| ΔcH°liquid | -947.70 ± 2.90 | kJ/mol | NIST |
| ΔcH°liquid | -956.50 ± 8.40 | kJ/mol | NIST |
| μ | 0.90 | debye | KDB |
| η | 0.0005510 | Pa×s | Densiti... |
| EA | [0.30; 0.40] | eV |
|
| EA | 0.40 ± 0.22 | eV | NIST |
| EA | 0.30 | eV | NIST |
| ΔfG° | 19.89 | kJ/mol | KDB |
| Rg | 3.7590 | KDB | |
| ΔfH°gas | [-19.10; -5.86] | kJ/mol |
|
| ΔfH°gas | -5.86 | kJ/mol | KDB |
| ΔfH°gas | -18.00 ± 2.00 | kJ/mol | NIST |
| ΔfH°gas | -19.10 ± 3.00 | kJ/mol | NIST |
| ΔfH°gas | -5.90 | kJ/mol | NIST |
| ΔfH°liquid | [-53.10; -41.00] | kJ/mol |
|
| ΔfH°liquid | -52.00 ± 3.00 | kJ/mol | NIST |
| ΔfH°liquid | -53.10 ± 3.00 | kJ/mol | NIST |
| ΔfH°liquid | -41.00 | kJ/mol | NIST |
| ΔfusH° | 12.42 | kJ/mol | Joback Calculated Property |
| ΔvapH° | [33.97; 34.70] | kJ/mol |
|
| ΔvapH° | 34.62 | kJ/mol | NIST |
| ΔvapH° | 34.57 ± 0.09 | kJ/mol | NIST |
| ΔvapH° | 33.97 ± 0.13 | kJ/mol | NIST |
| ΔvapH° | 34.50 ± 0.10 | kJ/mol | NIST |
| ΔvapH° | 34.70 ± 0.42 | kJ/mol | NIST |
| IE | [9.45; 9.68] | eV |
|
| IE | 9.46 ± 0.02 | eV | NIST |
| IE | 9.68 | eV | NIST |
| IE | 9.48 | eV | NIST |
| IE | 9.45 ± 0.01 | eV | NIST |
| IE | 9.45 | eV | NIST |
| IE | 9.47 ± 0.01 | eV | NIST |
| IE | 9.60 | eV | NIST |
| log10WS | [-1.96; -1.95] |
|
|
| log10WS | -1.95 | Aq. Sol... | |
| log10WS | -1.96 | Estimat... | |
| logPoct/wat | 2.502 | Crippen Calculated Property | |
| McVol | 71.460 | ml/mol | McGowan Calculated Property |
| NFPA Fire | 1 | KDB | |
| NFPA Health | 2 | KDB | |
| NFPA Safety | 1 | KDB | |
| Pc | 5020.00 | kPa | KDB |
| Inp | [672.00; 722.00] |
|
|
| Inp | 694.00 | NIST | |
| Inp | 691.00 | NIST | |
| Inp | 688.00 | NIST | |
| Inp | 675.00 | NIST | |
| Inp | 696.00 | NIST | |
| Inp | 702.00 | NIST | |
| Inp | 691.00 | NIST | |
| Inp | 686.00 | NIST | |
| Inp | 710.00 | NIST | |
| Inp | 698.00 | NIST | |
| Inp | 690.00 | NIST | |
| Inp | 693.00 | NIST | |
| Inp | 703.00 | NIST | |
| Inp | 702.10 | NIST | |
| Inp | 683.00 | NIST | |
| Inp | 702.00 | NIST | |
| Inp | 687.00 | NIST | |
| Inp | 691.00 | NIST | |
| Inp | 690.00 | NIST | |
| Inp | 701.00 | NIST | |
| Inp | 680.00 | NIST | |
| Inp | 680.00 | NIST | |
| Inp | 691.00 | NIST | |
| Inp | Outlier 722.00 | NIST | |
| Inp | 686.00 | NIST | |
| Inp | 690.00 | NIST | |
| Inp | 702.00 | NIST | |
| Inp | 693.00 | NIST | |
| Inp | 694.00 | NIST | |
| Inp | 691.00 | NIST | |
| Inp | 701.00 | NIST | |
| Inp | 681.00 | NIST | |
| Inp | 681.00 | NIST | |
| Inp | 691.00 | NIST | |
| Inp | 710.00 | NIST | |
| Inp | 700.00 | NIST | |
| Inp | 686.00 | NIST | |
| Inp | 689.00 | NIST | |
| Inp | 672.00 | NIST | |
| Inp | 686.00 | NIST | |
| Inp | 673.00 | NIST | |
| Inp | 680.00 | NIST | |
| Inp | 689.00 | NIST | |
| Inp | 710.00 | NIST | |
| Inp | 683.00 | NIST | |
| Inp | 691.00 | NIST | |
| Inp | 702.00 | NIST | |
| Inp | 681.00 | NIST | |
| Inp | 686.00 | NIST | |
| Inp | 680.00 | NIST | |
| I | [964.00; 1028.00] |
|
|
| I | 1008.00 | NIST | |
| I | 1019.00 | NIST | |
| I | 1010.00 | NIST | |
| I | 1010.70 | NIST | |
| I | 1012.45 | NIST | |
| I | 1007.14 | NIST | |
| I | 999.00 | NIST | |
| I | 993.00 | NIST | |
| I | 1010.00 | NIST | |
| I | 1010.00 | NIST | |
| I | 1010.00 | NIST | |
| I | 993.00 | NIST | |
| I | 984.00 | NIST | |
| I | 970.00 | NIST | |
| I | 993.00 | NIST | |
| I | 1028.00 | NIST | |
| I | 999.00 | NIST | |
| I | 1028.00 | NIST | |
| I | Outlier 964.00 | NIST | |
| I | 970.00 | NIST | |
| I | Outlier 964.00 | NIST | |
| I | 993.00 | NIST | |
| I | 1010.00 | NIST | |
| I | 1008.00 | NIST | |
| I | 1007.14 | NIST | |
| Tboil | [360.00; 360.55] | K |
|
| Tboil | 360.36 | K | KDB |
| Tboil | 360.40 | K | Excess ... |
| Tboil | 360.25 | K | Excess ... |
| Tboil | 360.25 | K | Vapor-L... |
| Tboil | 360.25 | K | Isobari... |
| Tboil | 360.40 ± 0.30 | K | NIST |
| Tboil | Outlier 360.55 ± 0.40 | K | NIST |
| Tboil | 360.20 ± 0.40 | K | NIST |
| Tboil | 360.20 | K | NIST |
| Tboil | 360.00 ± 0.40 | K | NIST |
| Tboil | 360.22 ± 0.30 | K | NIST |
| Tboil | 360.40 | K | NIST |
| Tboil | 360.05 ± 0.20 | K | NIST |
| Tboil | 360.40 ± 0.70 | K | NIST |
| Tboil | 360.05 ± 0.30 | K | NIST |
| Tboil | 360.10 ± 0.50 | K | NIST |
| Tboil | 360.10 ± 0.50 | K | NIST |
| Tboil | 360.25 ± 0.30 | K | NIST |
| Tc | [544.20; 571.00] | K |
|
| Tc | 544.20 | K | KDB |
| Tc | 571.00 | K | NIST |
| Tfus | [188.25; 188.50] | K |
|
| Tfus | 188.40 | K | KDB |
| Tfus | 188.25 | K | Aq. Sol... |
| Tfus | 188.50 ± 0.20 | K | NIST |
| Tfus | 188.35 ± 0.30 | K | NIST |
| Vc | 0.256 | m3/kmol | KDB |
| Zc | 0.2840200 | KDB | |
| Zra | 0.27 | KDB |
Temperature Dependent Properties
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| Cp,gas | [84.33; 100.24] | J/mol×K | [361.49; 569.29] |
|
| Cp,gas | 84.33 | J/mol×K | 361.49 | Joback Calculated Property |
| Cp,gas | 87.67 | J/mol×K | 396.12 | Joback Calculated Property |
| Cp,gas | 90.70 | J/mol×K | 430.76 | Joback Calculated Property |
| Cp,gas | 93.46 | J/mol×K | 465.39 | Joback Calculated Property |
| Cp,gas | 95.95 | J/mol×K | 500.02 | Joback Calculated Property |
| Cp,gas | 98.20 | J/mol×K | 534.65 | Joback Calculated Property |
| Cp,gas | 100.24 | J/mol×K | 569.29 | Joback Calculated Property |
| Cp,liquid | [120.10; 131.12] | J/mol×K | [260.64; 329.56] |
|
| Cp,liquid | 126.63 | J/mol×K | 260.64 | Heat ca... |
| Cp,liquid | 126.63 | J/mol×K | 260.64 | Heat ca... |
| Cp,liquid | 126.63 | J/mol×K | 260.64 | Heat ca... |
| Cp,liquid | 126.71 | J/mol×K | 260.64 | Heat ca... |
| Cp,liquid | 126.80 | J/mol×K | 265.75 | Heat ca... |
| Cp,liquid | 126.71 | J/mol×K | 265.75 | Heat ca... |
| Cp,liquid | 126.71 | J/mol×K | 265.75 | Heat ca... |
| Cp,liquid | 126.96 | J/mol×K | 265.75 | Heat ca... |
| Cp,liquid | 126.71 | J/mol×K | 270.85 | Heat ca... |
| Cp,liquid | 126.96 | J/mol×K | 270.85 | Heat ca... |
| Cp,liquid | 126.63 | J/mol×K | 270.85 | Heat ca... |
| Cp,liquid | 127.04 | J/mol×K | 270.85 | Heat ca... |
| Cp,liquid | 127.13 | J/mol×K | 275.96 | Heat ca... |
| Cp,liquid | 127.04 | J/mol×K | 275.96 | Heat ca... |
| Cp,liquid | 126.96 | J/mol×K | 275.96 | Heat ca... |
| Cp,liquid | 127.38 | J/mol×K | 275.96 | Heat ca... |
| Cp,liquid | 127.38 | J/mol×K | 281.06 | Heat ca... |
| Cp,liquid | 127.38 | J/mol×K | 281.06 | Heat ca... |
| Cp,liquid | 127.46 | J/mol×K | 281.06 | Heat ca... |
| Cp,liquid | 127.79 | J/mol×K | 281.06 | Heat ca... |
| Cp,liquid | 127.96 | J/mol×K | 286.17 | Heat ca... |
| Cp,liquid | 127.96 | J/mol×K | 286.17 | Heat ca... |
| Cp,liquid | 127.88 | J/mol×K | 286.17 | Heat ca... |
| Cp,liquid | 128.38 | J/mol×K | 286.17 | Heat ca... |
| Cp,liquid | 128.21 | J/mol×K | 291.27 | Heat ca... |
| Cp,liquid | 128.38 | J/mol×K | 291.27 | Heat ca... |
| Cp,liquid | 128.29 | J/mol×K | 291.27 | Heat ca... |
| Cp,liquid | 128.46 | J/mol×K | 291.27 | Heat ca... |
| Cp,liquid | 128.54 | J/mol×K | 296.38 | Heat ca... |
| Cp,liquid | 128.38 | J/mol×K | 296.38 | Heat ca... |
| Cp,liquid | 128.46 | J/mol×K | 296.38 | Heat ca... |
| Cp,liquid | 128.96 | J/mol×K | 296.38 | Heat ca... |
| Cp,liquid | 124.70 | J/mol×K | 298.00 | NIST |
| Cp,liquid | 120.10 | J/mol×K | 298.00 | NIST |
| Cp,liquid | 128.54 | J/mol×K | 301.48 | Heat ca... |
| Cp,liquid | 128.96 | J/mol×K | 301.48 | Heat ca... |
| Cp,liquid | 128.79 | J/mol×K | 301.48 | Heat ca... |
| Cp,liquid | 129.04 | J/mol×K | 301.48 | Heat ca... |
| Cp,liquid | 130.29 | J/mol×K | 309.14 | Heat ca... |
| Cp,liquid | 129.04 | J/mol×K | 309.14 | Heat ca... |
| Cp,liquid | 129.21 | J/mol×K | 309.14 | Heat ca... |
| Cp,liquid | 130.29 | J/mol×K | 319.35 | Heat ca... |
| Cp,liquid | 131.12 | J/mol×K | 319.35 | Heat ca... |
| Cp,liquid | 130.29 | J/mol×K | 319.35 | Heat ca... |
| Cp,liquid | 130.95 | J/mol×K | 329.56 | Heat ca... |
| Cp,liquid | 131.12 | J/mol×K | 329.56 | Heat ca... |
| ΔfusH | [8.45; 8.45] | kJ/mol | [188.50; 188.50] |
|
| ΔfusH | 8.45 | kJ/mol | 188.50 | NIST |
| ΔfusH | 8.45 | kJ/mol | 188.50 | NIST |
| ΔfusH | 8.45 | kJ/mol | 188.50 | NIST |
| ΔvapH | [31.38; 36.20] | kJ/mol | [324.50; 361.20] |
|
| ΔvapH | 36.20 | kJ/mol | 324.50 | NIST |
| ΔvapH | 34.20 | kJ/mol | 328.50 | NIST |
| ΔvapH | 35.60 | kJ/mol | 329.00 | NIST |
| ΔvapH | 34.60 | kJ/mol | 354.00 | NIST |
| ΔvapH | 32.13 | kJ/mol | 360.19 | NIST |
| ΔvapH | 31.40 | kJ/mol | 360.40 | NIST |
| ΔvapH | 31.38 | kJ/mol | 361.20 | KDB |
| n0 | [1.46900; 1.47820] | [293.15; 308.15] |
|
|
| n0 | 1.47820 | 293.15 | Excess ... | |
| n0 | 1.47820 | 293.15 | Bubble ... | |
| n0 | 1.47600 | 298.15 | Density... | |
| n0 | 1.47820 | 298.15 | Bubble ... | |
| n0 | 1.47820 | 298.15 | Activit... | |
| n0 | 1.47820 | 298.15 | Bubble ... | |
| n0 | 1.47500 | 298.15 | Bubble-... | |
| n0 | 1.47520 | 298.15 | Density... | |
| n0 | 1.47500 | 298.15 | Densiti... | |
| n0 | 1.47220 | 303.15 | Density... | |
| n0 | 1.47290 | 303.15 | Density... | |
| n0 | 1.47500 | 303.15 | Vapor-L... | |
| n0 | 1.46980 | 308.15 | Density... | |
| n0 | 1.46900 | 308.15 | Density... | |
| ρl | [1430.40; 1462.00] | kg/m3 | [293.00; 313.15] |
|
| ρl | 1462.00 | kg/m3 | 293.00 | KDB |
| ρl | 1455.90 | kg/m3 | 298.15 | Excess ... |
| ρl | 1450.90 | kg/m3 | 303.15 | Excess ... |
| ρl | 1447.50 | kg/m3 | 303.15 | Excess ... |
| ρl | 1437.80 | kg/m3 | 308.15 | Excess ... |
| ρl | 1430.40 | kg/m3 | 313.15 | Excess ... |
| ΔfusS | 44.80 | J/mol×K | 188.50 | NIST |
| γ | 0.03 | N/m | 293.20 | KDB |
Datasets
Viscosity, Pa*s
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Pressure, kPa - Liquid | Viscosity, Pa*s - Liquid |
| 308.15 | 101.00 | 0.0005 |
| Reference | ||
Correlations
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| Pvap | [1.33; 202.63] | kPa | [267.49; 383.80] |
The Yaw...
|
| Equation | ln(Pvp) = A + B/(T + C) | |||
| Coefficient A | 1.38164e+01 | |||
| Coefficient B | -2.66405e+03 | |||
| Coefficient C | -7.05700e+01 | |||
| Temperature range, min. | 267.49 | |||
| Temperature range, max. | 383.80 | |||
| Pvap | 1.33 | kPa | 267.49 | Calculated Property |
| Pvap | 3.07 | kPa | 280.41 | Calculated Property |
| Pvap | 6.41 | kPa | 293.34 | Calculated Property |
| Pvap | 12.35 | kPa | 306.26 | Calculated Property |
| Pvap | 22.22 | kPa | 319.18 | Calculated Property |
| Pvap | 37.72 | kPa | 332.11 | Calculated Property |
| Pvap | 60.94 | kPa | 345.03 | Calculated Property |
| Pvap | 94.30 | kPa | 357.95 | Calculated Property |
| Pvap | 140.52 | kPa | 370.88 | Calculated Property |
| Pvap | 202.63 | kPa | 383.80 | Calculated Property |
| Pvap | [2.02e-03; 4903.43] | kPa | [188.40; 571.00] |
KDB Vap...
|
| Equation | ln(Pvp) = A + B/T + C*ln(T) + D*T^2 | |||
| Coefficient A | 3.98315e+01 | |||
| Coefficient B | -5.14297e+03 | |||
| Coefficient C | -3.58643e+00 | |||
| Coefficient D | 1.34232e-06 | |||
| Temperature range, min. | 188.40 | |||
| Temperature range, max. | 571.00 | |||
| Pvap | 2.02e-03 | kPa | 188.40 | Calculated Property |
| Pvap | 0.15 | kPa | 230.91 | Calculated Property |
| Pvap | 2.71 | kPa | 273.42 | Calculated Property |
| Pvap | 21.01 | kPa | 315.93 | Calculated Property |
| Pvap | 95.71 | kPa | 358.44 | Calculated Property |
| Pvap | 306.11 | kPa | 400.96 | Calculated Property |
| Pvap | 765.33 | kPa | 443.47 | Calculated Property |
| Pvap | 1602.81 | kPa | 485.98 | Calculated Property |
| Pvap | 2945.14 | kPa | 528.49 | Calculated Property |
| Pvap | 4903.43 | kPa | 571.00 | Calculated Property |
Similar Compounds
Find more compounds similar to Trichloroethylene.
Mixtures
- Trichloroethylene + Ethyl Acetate
- Trichloroethylene + n-Propyl acetate
- Trichloroethylene + Acetic acid, butyl ester
- Trichloroethylene + Phenol, 2-methyl-
- Trichloroethylene + Formamide, N,N-dimethyl-
- Trichloroethylene + Ethane, 1,2-dibromo-
- Trichloroethylene + Ethylbenzene
- Trichloroethylene + Acetamide, N-methyl-
- Trichloroethylene + p-Cresol
- Trichloroethylene + Dimethyl Sulfoxide
- Trichloroethylene + 2-Pyrrolidinone, 1-methyl-
- Trichloroethylene + Heptane
- Benzene, nitro- + Trichloroethylene
- Trichloroethylene + Benzene, chloro-
- Trichloroethylene + Tetrahydrofuran
- Trichloroethylene + Tributylamine
- Trichloroethylene + Methyl Alcohol
- Trichloroethylene + Ethanol
- 1-Propanol + Trichloroethylene
- Trichloroethylene + Isopropyl Alcohol
Find more mixtures with Trichloroethylene.
Sources
- KDB Pure (Korean Thermophysical Properties Databank)
- KDB Vapor Pressure Data
- Crippen Method
- Excess Volumes and Excess Isentropic Compressibilities of Binary Liquid Mixtures of Trichloroethylene with Esters at 303.15 K
- Bubble points of some binary mixtures formed by o-cresol at 95.75 kPa
- Excess Gibbs energies of selected binary mixtures formed by N,N-dimethyl formamide at 95.5 kPa
- Determination of vapour-liquid and vapour-liquid-liquid equilibrium of the chloroform-water and trichloroethylene-water binary mixtures
- Heat capacities of selected chlorohydrocarbons
- Using binary mixtures of dicationic ionic liquids for determination ofactivity coefficients at infinite dilution by gas-liquid chromatography
- Excess volumes and speeds of sound of mixtures of 1,2-dibromoethane with chlorinated ethanes and ethenes at 303.15 K
- Bubble points of the binary mixtures formed by ethylbenzene with some chloroaliphatics and substituted benzenes at p = 94.7 kPa
- Densities and viscosities of binary liquid mixtures of N-methylacetamide with some chloroethanes and chloroethenes at T = 308.15 K
- Activity coefficients and excess Gibbs free energy of some binary mixtures formed by p-cresol at 95.23 kPa
- Activity coefficient at infinite dilution measurements for organic solutes (polar and non-polar) in fatty compounds: Saturated fatty acids
- Activity coefficient at infinite dilution measurements for organic solutes (polar and non-polar) in fatty compounds Part II: C18 fatty acids
- Excess molar enthalpies of dimethylsulfoxide with chloroethanes and chloroethenes at 298.15K
- Vapor-Liquid Equilibria and Excess Molar Enthalpies for N-Methyl-2-pyrrolidone with Chloroethanes and Chloroethenes
- Bubble Temperature Measurements on the Binary Mixtures of n-Heptane or Nitrobenzene or Chlorobenzene with Some Chloroethanes and Chloroethylenes at (94.6 to 95.8) kPa
- Bubble-Temperature Measurements on Some Binary Mixtures Formed by Tetrahydrofuran or Amyl Alcohol with Hydrocarbons, Chlorohydrocarbons, or Butanols at (94.6 or 95.8) kPa
- Density, Viscosity, Refractive Index, and Speed of Sound in the Binary Mixtures of Tri-n-butylamine + Triethylamine, + Tetrahydrofuran, + Tetradecane, + Tetrachloroethylene, + Pyridine, or + Trichloroethylene at (298.15, 303.15, and 308.15) K
- Densities and Viscosities of Binary Liquid Mixtures of Trichloroethylene and Tetrachloroethylene with Some Polar and Nonpolar Solvents
- Density, Viscosity, Refractive Index, and Speed of Sound for Binary Mixtures of 1,4-Dioxane with Different Organic Liquids at (298.15, 303.15, and 308.15) K
- Liquid-Liquid Equilibria for the Ternary Systems of (Water + Tetrahydrofuran + Polar Solvent) at 298.15 K
- Activity Coefficients at Infinite Dilution in 1-Alkyl-3-methylimidazolium Tetrafluoroborate Ionic Liquids
- Activity Coefficients at Infinite Dilution in Methylimidazolium Nitrate Ionic Liquids
- Densities, Excess Molar Volumes, Viscosity, and Refractive Indices of Binary Mixtures of Ethanoic Acid and Trichloroethylene with Dimethylbenzenes at Different Temperatures
- Determination of Henry's Law Constants Using Internal Standards with Benchmark Values
- Isobaric Vapor Liquid Equilibrium for Dimethylsulfoxide with Chloroethanes and Chloroethenes
- Solubilities of Stearic Acid in Organic Solvents and in Azeotropic Solvent Mixtures
- Solubilities of Palmitic Acid in Pure Solvents and Its Mixtures
- Solubilities of Lauric Acid in n-Hexane, Acetone, Propanol, 2-Propanol, 1-Bromopropane, and Trichloroethylene from (279.0 to 315.3) K
- Vapor-Liquid Equilibria of Binary Mixtures Formed by Hexan-1-ol with Chloroethanes and Chloroethenes at 95.6 kPa
- Excess Molar Volumes and Sound Speed in (Phenylacetonitrile + 1,2-Dichloroethane), (Phenylacetonitrile + 1,1,2-Trichloroethane), (Phenylacetonitrile + 1,1,2,2-Tetrachloroethane), (Phenylacetonitrile + Trichloroethene), and (Phenylacetonitrile + Tetrachloroethene) at Temperatures of (303.15, 308.15, and 313.15) K
- Joback Method
- KDB
- Aqueous Solubility Prediction Method
- Estimated Solubility Method
- McGowan Method
- NIST Webbook
- The Yaws Handbook of Vapor Pressure
Note: Cheméo is only indexing the data, follow the source links to retrieve the latest data. The source is also providing more information like the publication year, authors and more.
Take the time to validate and double check the source of the data.
Outlier This icon means
that the value is more than 2 standard deviations away from the
property mean.