- Name
- Trichloroethylene
- InChI
- InChI=1S/C2HCl3/c3-1-2(4)5/h1H
- InChI Key
- XSTXAVWGXDQKEL-UHFFFAOYSA-N
- Formula
- C2HCl3
- SMILES
- ClC=C(Cl)Cl
- Mol. Weight (g/mol)
- 131.39
- CAS
- 79-01-6
- Name
- 1,4-Dioxane
- InChI
- InChI=1S/C4H8O2/c1-2-6-4-3-5-1/h1-4H2
- InChI Key
- RYHBNJHYFVUHQT-UHFFFAOYSA-N
- Formula
- C4H8O2
- SMILES
- C1COCCO1
- Mol. Weight (g/mol)
- 88.11
- CAS
- 123-91-1
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- η - Viscosity, Pa*s (2)
- n0 - Refractive index (Na D-line) (2)
- ρl - Mass density, kg/m3 (2)
- csound,fluid - Speed of Sound, m/s (2)
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of 1,4-Dioxane (2) - Liquid | Viscosity, Pa*s - Liquid |
| 298.15 | 0.0000 | 0.0006 |
| 298.15 | 0.1006 | 0.0006 |
| 298.15 | 0.2010 | 0.0007 |
| 298.15 | 0.2983 | 0.0008 |
| 298.15 | 0.3995 | 0.0008 |
| 298.15 | 0.5070 | 0.0009 |
| 298.15 | 0.5993 | 0.0009 |
| 298.15 | 0.6969 | 0.0010 |
| 298.15 | 0.8020 | 0.0011 |
| 298.15 | 0.9003 | 0.0011 |
| 298.15 | 1.0000 | 0.0012 |
| 303.15 | 0.0000 | 0.0005 |
| 303.15 | 0.1006 | 0.0006 |
| 303.15 | 0.2010 | 0.0007 |
| 303.15 | 0.2983 | 0.0007 |
| 303.15 | 0.3995 | 0.0008 |
| 303.15 | 0.5070 | 0.0008 |
| 303.15 | 0.5993 | 0.0009 |
| 303.15 | 0.6969 | 0.0009 |
| 303.15 | 0.8020 | 0.0010 |
| 303.15 | 0.9003 | 0.0010 |
| 303.15 | 1.0000 | 0.0011 |
| 308.15 | 0.0000 | 0.0005 |
| 308.15 | 0.1006 | 0.0006 |
| 308.15 | 0.2010 | 0.0006 |
| 308.15 | 0.2983 | 0.0007 |
| 308.15 | 0.3995 | 0.0007 |
| 308.15 | 0.5070 | 0.0008 |
| 308.15 | 0.5993 | 0.0008 |
| 308.15 | 0.6969 | 0.0009 |
| 308.15 | 0.8020 | 0.0009 |
| 308.15 | 0.9003 | 0.0010 |
| 308.15 | 1.0000 | 0.0010 |
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of 1,4-Dioxane (2) - Liquid | Viscosity, Pa*s - Liquid |
| 298.15 | 0.0000 | 0.0006 |
| 298.15 | 0.1006 | 0.0006 |
| 298.15 | 0.2010 | 0.0007 |
| 298.15 | 0.2983 | 0.0008 |
| 298.15 | 0.3995 | 0.0008 |
| 298.15 | 0.5070 | 0.0009 |
| 298.15 | 0.5993 | 0.0009 |
| 298.15 | 0.6969 | 0.0010 |
| 298.15 | 0.8020 | 0.0011 |
| 298.15 | 0.9003 | 0.0011 |
| 298.15 | 1.0000 | 0.0012 |
| 303.15 | 0.0000 | 0.0005 |
| 303.15 | 0.1006 | 0.0006 |
| 303.15 | 0.2010 | 0.0007 |
| 303.15 | 0.2983 | 0.0007 |
| 303.15 | 0.3995 | 0.0008 |
| 303.15 | 0.5070 | 0.0008 |
| 303.15 | 0.5993 | 0.0009 |
| 303.15 | 0.6969 | 0.0009 |
| 303.15 | 0.8020 | 0.0010 |
| 303.15 | 0.9003 | 0.0010 |
| 303.15 | 1.0000 | 0.0011 |
| 308.15 | 0.0000 | 0.0005 |
| 308.15 | 0.1006 | 0.0006 |
| 308.15 | 0.2010 | 0.0006 |
| 308.15 | 0.2983 | 0.0007 |
| 308.15 | 0.3995 | 0.0007 |
| 308.15 | 0.5070 | 0.0008 |
| 308.15 | 0.5993 | 0.0008 |
| 308.15 | 0.6969 | 0.0009 |
| 308.15 | 0.8020 | 0.0009 |
| 308.15 | 0.9003 | 0.0010 |
| 308.15 | 1.0000 | 0.0010 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of 1,4-Dioxane (2) - Liquid | Refractive index (Na D-line) - Liquid |
| 298.15 | 0.0000 | 1.476 |
| 298.15 | 0.1006 | 1.4704 |
| 298.15 | 0.2010 | 1.4648 |
| 298.15 | 0.2983 | 1.4592 |
| 298.15 | 0.3995 | 1.4536 |
| 298.15 | 0.5070 | 1.4476 |
| 298.15 | 0.5993 | 1.4426 |
| 298.15 | 0.6969 | 1.4373 |
| 298.15 | 0.8020 | 1.4314 |
| 298.15 | 0.9003 | 1.426 |
| 298.15 | 1.0000 | 1.4203 |
| 303.15 | 0.0000 | 1.4729 |
| 303.15 | 0.1006 | 1.4673 |
| 303.15 | 0.2010 | 1.4618 |
| 303.15 | 0.2983 | 1.4562 |
| 303.15 | 0.3995 | 1.4507 |
| 303.15 | 0.5070 | 1.4446 |
| 303.15 | 0.5993 | 1.4396 |
| 303.15 | 0.6969 | 1.4344 |
| 303.15 | 0.8020 | 1.4285 |
| 303.15 | 0.9003 | 1.4231 |
| 303.15 | 1.0000 | 1.4164 |
| 308.15 | 0.0000 | 1.4698 |
| 308.15 | 0.1006 | 1.4643 |
| 308.15 | 0.2010 | 1.4587 |
| 308.15 | 0.2983 | 1.4532 |
| 308.15 | 0.3995 | 1.4477 |
| 308.15 | 0.5070 | 1.4417 |
| 308.15 | 0.5993 | 1.4366 |
| 308.15 | 0.6969 | 1.4315 |
| 308.15 | 0.8020 | 1.4256 |
| 308.15 | 0.9003 | 1.4202 |
| 308.15 | 1.0000 | 1.4145 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of 1,4-Dioxane (2) - Liquid | Refractive index (Na D-line) - Liquid |
| 298.15 | 0.0000 | 1.476 |
| 298.15 | 0.1006 | 1.4704 |
| 298.15 | 0.2010 | 1.4648 |
| 298.15 | 0.2983 | 1.4592 |
| 298.15 | 0.3995 | 1.4536 |
| 298.15 | 0.5070 | 1.4476 |
| 298.15 | 0.5993 | 1.4426 |
| 298.15 | 0.6969 | 1.4373 |
| 298.15 | 0.8020 | 1.4314 |
| 298.15 | 0.9003 | 1.426 |
| 298.15 | 1.0000 | 1.4203 |
| 303.15 | 0.0000 | 1.4729 |
| 303.15 | 0.1006 | 1.4673 |
| 303.15 | 0.2010 | 1.4618 |
| 303.15 | 0.2983 | 1.4562 |
| 303.15 | 0.3995 | 1.4507 |
| 303.15 | 0.5070 | 1.4446 |
| 303.15 | 0.5993 | 1.4396 |
| 303.15 | 0.6969 | 1.4344 |
| 303.15 | 0.8020 | 1.4285 |
| 303.15 | 0.9003 | 1.4231 |
| 303.15 | 1.0000 | 1.4164 |
| 308.15 | 0.0000 | 1.4698 |
| 308.15 | 0.1006 | 1.4643 |
| 308.15 | 0.2010 | 1.4587 |
| 308.15 | 0.2983 | 1.4532 |
| 308.15 | 0.3995 | 1.4477 |
| 308.15 | 0.5070 | 1.4417 |
| 308.15 | 0.5993 | 1.4366 |
| 308.15 | 0.6969 | 1.4315 |
| 308.15 | 0.8020 | 1.4256 |
| 308.15 | 0.9003 | 1.4202 |
| 308.15 | 1.0000 | 1.4145 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of 1,4-Dioxane (2) - Liquid | Mass density, kg/m3 - Liquid |
| 298.15 | 0.0000 | 1455.4 |
| 298.15 | 0.1006 | 1412.7 |
| 298.15 | 0.2010 | 1370.1 |
| 298.15 | 0.2983 | 1327.9 |
| 298.15 | 0.3995 | 1284.4 |
| 298.15 | 0.5070 | 1238.6 |
| 298.15 | 0.5993 | 1199.3 |
| 298.15 | 0.6969 | 1158.5 |
| 298.15 | 0.8020 | 1114.0 |
| 298.15 | 0.9003 | 1072.1 |
| 298.15 | 1.0000 | 1028.6 |
| 303.15 | 0.0000 | 1447.0 |
| 303.15 | 0.1006 | 1404.6 |
| 303.15 | 0.2010 | 1362.2 |
| 303.15 | 0.2983 | 1320.3 |
| 303.15 | 0.3995 | 1277.2 |
| 303.15 | 0.5070 | 1231.5 |
| 303.15 | 0.5993 | 1192.5 |
| 303.15 | 0.6969 | 1152.1 |
| 303.15 | 0.8020 | 1107.7 |
| 303.15 | 0.9003 | 1066.2 |
| 303.15 | 1.0000 | 1022.9 |
| 308.15 | 0.0000 | 1438.5 |
| 308.15 | 0.1006 | 1396.4 |
| 308.15 | 0.2010 | 1354.2 |
| 308.15 | 0.2983 | 1312.8 |
| 308.15 | 0.3995 | 1270.0 |
| 308.15 | 0.5070 | 1224.5 |
| 308.15 | 0.5993 | 1185.7 |
| 308.15 | 0.6969 | 1145.6 |
| 308.15 | 0.8020 | 1101.5 |
| 308.15 | 0.9003 | 1060.0 |
| 308.15 | 1.0000 | 1017.2 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of 1,4-Dioxane (2) - Liquid | Mass density, kg/m3 - Liquid |
| 298.15 | 0.0000 | 1455.4 |
| 298.15 | 0.1006 | 1412.7 |
| 298.15 | 0.2010 | 1370.1 |
| 298.15 | 0.2983 | 1327.9 |
| 298.15 | 0.3995 | 1284.4 |
| 298.15 | 0.5070 | 1238.6 |
| 298.15 | 0.5993 | 1199.3 |
| 298.15 | 0.6969 | 1158.5 |
| 298.15 | 0.8020 | 1114.0 |
| 298.15 | 0.9003 | 1072.1 |
| 298.15 | 1.0000 | 1028.6 |
| 303.15 | 0.0000 | 1447.0 |
| 303.15 | 0.1006 | 1404.6 |
| 303.15 | 0.2010 | 1362.2 |
| 303.15 | 0.2983 | 1320.3 |
| 303.15 | 0.3995 | 1277.2 |
| 303.15 | 0.5070 | 1231.5 |
| 303.15 | 0.5993 | 1192.5 |
| 303.15 | 0.6969 | 1152.1 |
| 303.15 | 0.8020 | 1107.7 |
| 303.15 | 0.9003 | 1066.2 |
| 303.15 | 1.0000 | 1022.9 |
| 308.15 | 0.0000 | 1438.5 |
| 308.15 | 0.1006 | 1396.4 |
| 308.15 | 0.2010 | 1354.2 |
| 308.15 | 0.2983 | 1312.8 |
| 308.15 | 0.3995 | 1270.0 |
| 308.15 | 0.5070 | 1224.5 |
| 308.15 | 0.5993 | 1185.7 |
| 308.15 | 0.6969 | 1145.6 |
| 308.15 | 0.8020 | 1101.5 |
| 308.15 | 0.9003 | 1060.0 |
| 308.15 | 1.0000 | 1017.2 |
Speed of sound, m/s [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Temperature, K = 298.15 (Liquid)
| Mole fraction of 1,4-Dioxane (2) - Liquid | Speed of sound, m/s - Liquid |
|---|---|
| 0.0000 | 1027.0 |
| 0.1006 | 1059.0 |
| 0.2010 | 1091.0 |
| 0.2983 | 1122.0 |
| 0.3995 | 1152.0 |
| 0.5070 | 1187.0 |
| 0.5993 | 1215.0 |
| 0.6969 | 1246.0 |
| 0.8020 | 1276.0 |
| 0.9003 | 1307.0 |
| 1.0000 | 1345.0 |
Speed of sound, m/s [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Temperature, K = 298.15 (Liquid)
| Mole fraction of 1,4-Dioxane (2) - Liquid | Speed of sound, m/s - Liquid |
|---|---|
| 0.0000 | 1027.0 |
| 0.1006 | 1059.0 |
| 0.2010 | 1091.0 |
| 0.2983 | 1122.0 |
| 0.3995 | 1152.0 |
| 0.5070 | 1187.0 |
| 0.5993 | 1215.0 |
| 0.6969 | 1246.0 |
| 0.8020 | 1276.0 |
| 0.9003 | 1307.0 |
| 1.0000 | 1345.0 |