- Name
- 2-Propanol
- InChI
- InChI=1S/C3H8O/c1-3(2)4/h3-4H,1-2H3
- InChI Key
- KFZMGEQAYNKOFK-UHFFFAOYSA-N
- Formula
- C3H8O
- SMILES
- CC(C)O
- Mol. Weight (g/mol)
- 60.10
- CAS
- 67-63-0
- Name
- Acetic acid, sodium salt
- InChI
- InChI=1S/C2H4O2.Na/c1-2(3)4;/h1H3,(H,3,4);/q;+1/p-1
- InChI Key
- VMHLLURERBWHNL-UHFFFAOYSA-M
- Formula
- C2H3NaO2
- SMILES
- CC(=O)[O][Na]
- Mol. Weight (g/mol)
- 82.03
- CAS
- 127-09-3
- Name
- Water
- InChI
- InChI=1S/H2O/h1H2
- InChI Key
- XLYOFNOQVPJJNP-UHFFFAOYSA-N
- Formula
- H2O
- SMILES
- O
- Mol. Weight (g/mol)
- 18.02
- CAS
- 7732-18-5
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Mass fraction of Acetic acid, sodium salt (2) [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid mixture 1)
- Temperature, K = 297.15 (Liquid mixture 1)
| Mass fraction of 2-Propanol (1) - Liquid mixture 1 | Mass fraction of Acetic acid, sodium salt (2) - Liquid mixture 1 |
|---|---|
| 0.8714 | 0.0396 |
| 0.8640 | 0.0401 |
| 0.8322 | 0.0436 |
| 0.7941 | 0.0496 |
| 0.7897 | 0.0528 |
| 0.7679 | 0.0555 |
| 0.6433 | 0.0792 |
| 0.4988 | 0.1197 |
| 0.4439 | 0.1381 |
| 0.2938 | 0.1958 |
| 0.2290 | 0.2290 |
| 0.1910 | 0.2503 |
| 0.1794 | 0.2584 |
| 0.1664 | 0.2659 |
| 0.1442 | 0.2825 |
Mass fraction [ref]
Operational conditions:
- Temperature, K = 297.15 (Liquid mixture 2)
- Pressure, kPa = 101 (Liquid mixture 2)
| Fixed | Measured | ||
|---|---|---|---|
| Mass fraction of 2-Propanol (1) - Liquid mixture 2 | Mass fraction of Acetic acid, sodium salt (2) - Liquid mixture 2 | Mass fraction of Acetic acid, sodium salt (2) - Liquid mixture 1 | Mass fraction of 2-Propanol (1) - Liquid mixture 1 |
| 0.1910 | 0.2503 | 0.0555 | 0.7679 |
| 0.1794 | 0.2584 | 0.0528 | 0.7897 |
| 0.1664 | 0.2659 | 0.0436 | 0.8322 |
| 0.1442 | 0.2825 | 0.0401 | 0.8640 |
Electrical conductivity, S/m [ref]
Operational conditions:
- Pressure, kPa = 100 (Liquid)
- Temperature, K = 297.15 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Mass fraction of 2-Propanol (1) - Liquid | Mass fraction of Acetic acid, sodium salt (2) - Liquid | Electrical conductivity, S/m - Liquid |
| 0.0000 | 0.0470 | 0.0441 |
| 0.0100 | 0.0400 | 0.0372 |
| 0.0200 | 0.3500 | 0.0331 |
| 0.0300 | 0.3000 | 0.0289 |
| 0.0400 | 0.2500 | 0.0242 |
| 0.0500 | 0.2000 | 0.0190 |
| 0.0600 | 0.1500 | 0.0144 |
| 0.0700 | 0.1000 | 0.0096 |
| 0.0800 | 0.0500 | 0.0053 |
| 0.0970 | 0.0000 | 0.0001 |
Boiling temperature at pressure P, K [ref]
| Fixed | Measured | ||
|---|---|---|---|
| Pressure, kPa - Liquid | Mole fraction of Acetic acid, sodium salt (2) - Liquid | Mole fraction of 2-Propanol (1) - Liquid | Boiling temperature at pressure P, K - Liquid |
| 407.00 | 0.0807 | 0.0105 | 405.76 |
| 408.00 | 0.0474 | 0.0500 | 396.31 |
| 418.00 | 0.0815 | 0.0161 | 405.82 |
| 430.00 | 0.0497 | 0.0041 | 415.54 |
| 433.00 | 0.0491 | 0.0161 | 405.74 |
| 434.00 | 0.0815 | 0.0000 | 425.37 |
| 437.00 | 0.0499 | 0.0000 | 420.49 |
| 438.00 | 0.0808 | 0.0042 | 415.56 |
| 447.00 | 0.0807 | 0.0105 | 410.65 |
| 461.00 | 0.0501 | 0.0224 | 405.82 |
| 463.00 | 0.0474 | 0.0500 | 400.99 |
| 473.00 | 0.0815 | 0.0161 | 410.75 |
| 480.00 | 0.0497 | 0.0041 | 420.41 |
| 483.00 | 0.0808 | 0.0042 | 420.41 |
| 488.00 | 0.0491 | 0.0161 | 410.65 |
| 489.00 | 0.0815 | 0.0000 | 430.22 |
| 492.00 | 0.0499 | 0.0000 | 425.34 |
| 512.00 | 0.0807 | 0.0105 | 415.54 |
| 516.00 | 0.0501 | 0.0224 | 410.65 |
| 528.00 | 0.0474 | 0.0500 | 405.87 |
| 533.00 | 0.0815 | 0.0161 | 415.56 |
| 545.00 | 0.0497 | 0.0041 | 425.26 |
| 548.00 | 0.0491 | 0.0161 | 415.51 |
| 549.00 | 0.0815 | 0.0000 | 435.09 |
| 552.00 | 0.0499 | 0.0000 | 430.17 |
| 553.00 | 0.0808 | 0.0042 | 425.31 |
| 562.00 | 0.0807 | 0.0105 | 420.41 |
| 581.00 | 0.0501 | 0.0224 | 415.56 |
| 603.00 | 0.0474 | 0.0500 | 410.75 |
| 608.00 | 0.0815 | 0.0161 | 420.41 |
| 610.00 | 0.0497 | 0.0041 | 430.14 |
| 613.00 | 0.0808 | 0.0042 | 430.17 |
| 617.00 | 0.0499 | 0.0000 | 435.01 |
| 623.00 | 0.0491 | 0.0161 | 420.41 |
| 624.00 | 0.0815 | 0.0000 | 439.94 |
| 627.00 | 0.0807 | 0.0105 | 425.29 |
| 656.00 | 0.0501 | 0.0224 | 420.49 |
| 678.00 | 0.0808 | 0.0042 | 435.01 |
| 680.00 | 0.0497 | 0.0041 | 435.04 |
| 683.00 | 0.0474 | 0.0500 | 415.59 |
| 683.00 | 0.0815 | 0.0161 | 425.23 |
| 687.00 | 0.0499 | 0.0000 | 439.94 |
| 693.00 | 0.0491 | 0.0161 | 425.31 |
| 699.00 | 0.0815 | 0.0000 | 444.87 |
| 707.00 | 0.0807 | 0.0105 | 430.14 |
| 741.00 | 0.0501 | 0.0224 | 425.34 |
| 758.00 | 0.0808 | 0.0042 | 439.88 |
| 763.00 | 0.0815 | 0.0161 | 430.17 |
| 768.00 | 0.0474 | 0.0500 | 420.46 |
| 770.00 | 0.0497 | 0.0041 | 439.94 |
| 772.00 | 0.0499 | 0.0000 | 444.85 |
| 777.00 | 0.0491 | 0.0161 | 430.20 |
| 779.00 | 0.0815 | 0.0000 | 449.71 |
| 782.00 | 0.0807 | 0.0105 | 434.98 |
| 831.00 | 0.0501 | 0.0224 | 430.22 |
| 838.00 | 0.0808 | 0.0042 | 444.82 |
| 858.00 | 0.0815 | 0.0161 | 435.01 |
| 860.00 | 0.0497 | 0.0041 | 444.82 |
| 862.00 | 0.0499 | 0.0000 | 449.79 |
| 867.00 | 0.0491 | 0.0161 | 435.09 |
| 868.00 | 0.0474 | 0.0500 | 425.34 |
| 872.00 | 0.0807 | 0.0105 | 439.91 |
| 874.00 | 0.0815 | 0.0000 | 454.58 |
| 931.00 | 0.0501 | 0.0224 | 435.12 |
| 933.00 | 0.0808 | 0.0042 | 449.68 |
| 955.00 | 0.0497 | 0.0041 | 449.71 |
| 957.00 | 0.0499 | 0.0000 | 454.66 |
| 958.00 | 0.0815 | 0.0161 | 439.83 |
| 962.00 | 0.0807 | 0.0105 | 444.74 |
| 967.00 | 0.0491 | 0.0161 | 439.99 |
| 973.00 | 0.0474 | 0.0500 | 430.25 |
| 974.00 | 0.0815 | 0.0000 | 459.43 |
| 1036.00 | 0.0501 | 0.0224 | 440.02 |
| 1037.00 | 0.0808 | 0.0042 | 454.52 |
| 1063.00 | 0.0815 | 0.0161 | 444.74 |
| 1065.00 | 0.0497 | 0.0041 | 454.63 |
| 1067.00 | 0.0499 | 0.0000 | 459.51 |
| 1072.00 | 0.0807 | 0.0105 | 449.57 |
| 1082.00 | 0.0491 | 0.0161 | 444.85 |
| 1093.00 | 0.0474 | 0.0500 | 435.12 |
| 1137.00 | 0.0808 | 0.0042 | 459.43 |
| 1146.00 | 0.0501 | 0.0224 | 444.76 |
| 1178.00 | 0.0815 | 0.0161 | 449.65 |
| 1180.00 | 0.0497 | 0.0041 | 459.51 |
| 1182.00 | 0.0807 | 0.0105 | 454.47 |
| 1187.00 | 0.0491 | 0.0161 | 449.68 |
| 1213.00 | 0.0474 | 0.0500 | 439.96 |
| 1281.00 | 0.0501 | 0.0224 | 449.71 |
| 1307.00 | 0.0807 | 0.0105 | 459.51 |
| 1308.00 | 0.0815 | 0.0161 | 454.58 |
| 1322.00 | 0.0491 | 0.0161 | 454.52 |
| 1348.00 | 0.0474 | 0.0500 | 444.82 |
| 1416.00 | 0.0501 | 0.0224 | 454.60 |
| 1443.00 | 0.0815 | 0.0161 | 459.45 |
| 1462.00 | 0.0491 | 0.0161 | 459.40 |
| 1498.00 | 0.0474 | 0.0500 | 449.71 |
| 1561.00 | 0.0501 | 0.0224 | 459.53 |
| 1653.00 | 0.0474 | 0.0500 | 454.60 |
| 1828.00 | 0.0474 | 0.0500 | 459.48 |
Sources
- Bubble points of the systems isopropanol-water, isopropanol-water-sodium acetate and isopropanol-water-sodium oleate at high pressure
- Liquid-Liquid Equilibrium of Alcohols + Ammonium/Potassium/Sodium Acetate + Water Systems: Experimental and Correlation
Note: These property values are available through the Cheméo API. A free account gives you an access key.