- Name
- Carbonic acid, dimethyl ester
- InChI
- InChI=1S/C3H6O3/c1-5-3(4)6-2/h1-2H3
- InChI Key
- IEJIGPNLZYLLBP-UHFFFAOYSA-N
- Formula
- C3H6O3
- SMILES
- COC(=O)OC
- Mol. Weight (g/mol)
- 90.08
- CAS
- 616-38-6
- Name
- 2-Propenoic acid, 2-methyl-, 2-propenyl ester
- InChI
- InChI=1S/C7H10O2/c1-4-5-9-7(8)6(2)3/h4H,1-2,5H2,3H3
- InChI Key
- FBCQUCJYYPMKRO-UHFFFAOYSA-N
- Formula
- C7H10O2
- SMILES
- C=CCOC(=O)C(=C)C
- Mol. Weight (g/mol)
- 126.15
- CAS
- 96-05-9
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Mass density, kg/m3 [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Carbonic acid, dimethyl ester (1) - Liquid | Mass density, kg/m3 - Liquid |
| 293.15 | 0.0000 | 932.965 |
| 293.15 | 0.0254 | 935.07 |
| 293.15 | 0.0498 | 937.164 |
| 293.15 | 0.1006 | 941.619 |
| 293.15 | 0.1507 | 946.22 |
| 293.15 | 0.2000 | 950.913 |
| 293.15 | 0.2505 | 955.966 |
| 293.15 | 0.2999 | 961.134 |
| 293.15 | 0.3499 | 966.623 |
| 293.15 | 0.4005 | 972.4 |
| 293.15 | 0.4490 | 978.208 |
| 293.15 | 0.5000 | 984.616 |
| 293.15 | 0.5499 | 991.215 |
| 293.15 | 0.5991 | 998.042 |
| 293.15 | 0.6502 | 1005.492 |
| 293.15 | 0.7000 | 1013.175 |
| 293.15 | 0.7502 | 1021.341 |
| 293.15 | 0.8001 | 1029.9 |
| 293.15 | 0.8499 | 1039.003 |
| 293.15 | 0.9002 | 1048.706 |
| 293.15 | 0.9499 | 1058.874 |
| 293.15 | 0.9750 | 1064.272 |
| 293.15 | 1.0000 | 1069.794 |
| 303.15 | 0.0000 | 922.525 |
| 303.15 | 0.0253 | 924.591 |
| 303.15 | 0.0501 | 926.656 |
| 303.15 | 0.1010 | 931.041 |
| 303.15 | 0.1500 | 935.458 |
| 303.15 | 0.1999 | 940.145 |
| 303.15 | 0.2505 | 945.101 |
| 303.15 | 0.2999 | 950.165 |
| 303.15 | 0.3499 | 955.527 |
| 303.15 | 0.4003 | 961.195 |
| 303.15 | 0.4470 | 966.662 |
| 303.15 | 0.5001 | 973.205 |
| 303.15 | 0.5501 | 979.68 |
| 303.15 | 0.5994 | 986.387 |
| 303.15 | 0.6502 | 993.661 |
| 303.15 | 0.7001 | 1001.189 |
| 303.15 | 0.7503 | 1009.19 |
| 303.15 | 0.8001 | 1017.583 |
| 303.15 | 0.8499 | 1026.466 |
| 303.15 | 0.9002 | 1035.995 |
| 303.15 | 0.9499 | 1046.001 |
| 303.15 | 0.9750 | 1051.3 |
| 303.15 | 1.0000 | 1056.75 |
| 313.15 | 0.0000 | 912.072 |
| 313.15 | 0.0247 | 914.028 |
| 313.15 | 0.0499 | 916.075 |
| 313.15 | 0.1002 | 920.29 |
| 313.15 | 0.1496 | 924.626 |
| 313.15 | 0.1997 | 929.2 |
| 313.15 | 0.2495 | 933.94 |
| 313.15 | 0.2999 | 938.979 |
| 313.15 | 0.3502 | 944.239 |
| 313.15 | 0.3999 | 949.688 |
| 313.15 | 0.4499 | 955.431 |
| 313.15 | 0.4997 | 961.436 |
| 313.15 | 0.5503 | 967.862 |
| 313.15 | 0.6001 | 974.504 |
| 313.15 | 0.6497 | 981.462 |
| 313.15 | 0.7001 | 988.916 |
| 313.15 | 0.7498 | 996.664 |
| 313.15 | 0.7998 | 1004.932 |
| 313.15 | 0.8500 | 1013.713 |
| 313.15 | 0.8998 | 1022.998 |
| 313.15 | 0.9498 | 1032.834 |
| 313.15 | 0.9746 | 1037.942 |
| 313.15 | 1.0000 | 1043.369 |
Sources
Note: These property values are available through the Cheméo API. A free account gives you an access key.