- Name
- ETHANOL, 2,2'-IMINOBIS-
- InChI
- InChI=1S/C4H11NO2/c6-3-1-5-2-4-7/h5-7H,1-4H2
- InChI Key
- ZBCBWPMODOFKDW-UHFFFAOYSA-N
- Formula
- C4H11NO2
- SMILES
- OCCNCCO
- Mol. Weight (g/mol)
- 105.14
- CAS
- 111-42-2
- Name
- 2-Pyrrolidinone, 1-methyl-
- InChI
- InChI=1S/C5H9NO/c1-6-4-2-3-5(6)7/h2-4H2,1H3
- InChI Key
- SECXISVLQFMRJM-UHFFFAOYSA-N
- Formula
- C5H9NO
- SMILES
- CN1CCCC1=O
- Mol. Weight (g/mol)
- 99.13
- CAS
- 872-50-4
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- η - Viscosity, Pa*s (2)
- n0 - Refractive index (Na D-line)
- ρl - Mass density, kg/m3 (2)
- csound,fluid - Speed of Sound, m/s
- γ - Surface tension liquid-gas, N/m
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of 2-Pyrrolidinone, 1-methyl- (2) - Liquid | Viscosity, Pa*s - Liquid |
| 293.15 | 0.0000 | 0.8415 |
| 293.15 | 0.1012 | 0.4572 |
| 293.15 | 0.2002 | 0.2222 |
| 293.15 | 0.3004 | 0.0853 |
| 293.15 | 0.4003 | 0.0537 |
| 293.15 | 0.4998 | 0.0278 |
| 293.15 | 0.6003 | 0.0162 |
| 293.15 | 0.7000 | 0.0076 |
| 293.15 | 0.7997 | 0.0043 |
| 293.15 | 0.8994 | 0.0028 |
| 293.15 | 1.0000 | 0.0019 |
| 303.15 | 0.0000 | 0.3657 |
| 303.15 | 0.1012 | 0.2116 |
| 303.15 | 0.2002 | 0.1062 |
| 303.15 | 0.3004 | 0.0474 |
| 303.15 | 0.4003 | 0.0312 |
| 303.15 | 0.4998 | 0.0167 |
| 303.15 | 0.6003 | 0.0095 |
| 303.15 | 0.7000 | 0.0055 |
| 303.15 | 0.7997 | 0.0034 |
| 303.15 | 0.8994 | 0.0023 |
| 303.15 | 1.0000 | 0.0016 |
| 313.15 | 0.0000 | 0.1798 |
| 313.15 | 0.1012 | 0.1002 |
| 313.15 | 0.2002 | 0.0605 |
| 313.15 | 0.3004 | 0.0283 |
| 313.15 | 0.4003 | 0.0193 |
| 313.15 | 0.4998 | 0.0106 |
| 313.15 | 0.6003 | 0.0057 |
| 313.15 | 0.7000 | 0.0041 |
| 313.15 | 0.7997 | 0.0027 |
| 313.15 | 0.8994 | 0.0019 |
| 313.15 | 1.0000 | 0.0014 |
| 323.15 | 0.0000 | 0.0897 |
| 323.15 | 0.1012 | 0.0384 |
| 323.15 | 0.2002 | 0.0249 |
| 323.15 | 0.3004 | 0.0176 |
| 323.15 | 0.4003 | 0.0124 |
| 323.15 | 0.4998 | 0.0075 |
| 323.15 | 0.6003 | 0.0040 |
| 323.15 | 0.7000 | 0.0032 |
| 323.15 | 0.7997 | 0.0023 |
| 323.15 | 0.8994 | 0.0016 |
| 323.15 | 1.0000 | 0.0012 |
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of 2-Pyrrolidinone, 1-methyl- (2) - Liquid | Viscosity, Pa*s - Liquid |
| 303.15 | 0.1941 | 0.1038 |
| 303.15 | 0.4024 | 0.0318 |
| 303.15 | 0.5851 | 0.0163 |
| 303.15 | 0.7962 | 0.0084 |
| 313.15 | 0.1941 | 0.0433 |
| 313.15 | 0.4024 | 0.0150 |
| 313.15 | 0.5851 | 0.0074 |
| 313.15 | 0.7962 | 0.0040 |
| 323.15 | 0.1941 | 0.0270 |
| 323.15 | 0.4024 | 0.0103 |
| 323.15 | 0.5851 | 0.0063 |
| 323.15 | 0.7962 | 0.0032 |
| 333.15 | 0.1941 | 0.0214 |
| 333.15 | 0.4024 | 0.0077 |
| 333.15 | 0.5851 | 0.0049 |
| 333.15 | 0.7962 | 0.0026 |
| 343.15 | 0.1941 | 0.0156 |
| 343.15 | 0.4024 | 0.0070 |
| 343.15 | 0.5851 | 0.0033 |
| 343.15 | 0.7962 | 0.0019 |
| 353.15 | 0.1941 | 0.0110 |
| 353.15 | 0.4024 | 0.0051 |
| 353.15 | 0.5851 | 0.0027 |
| 353.15 | 0.7962 | 0.0015 |
| 363.15 | 0.1941 | 0.0080 |
| 363.15 | 0.4024 | 0.0040 |
| 363.15 | 0.5851 | 0.0022 |
| 363.15 | 0.7962 | 0.0012 |
| 373.15 | 0.1941 | 0.0060 |
| 373.15 | 0.4024 | 0.0031 |
| 373.15 | 0.5851 | 0.0016 |
| 373.15 | 0.7962 | 0.0011 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of 2-Pyrrolidinone, 1-methyl- (2) - Liquid | Refractive index (Na D-line) - Liquid |
| 293.15 | 0.0000 | 1.477 |
| 293.15 | 0.1012 | 1.4764 |
| 293.15 | 0.2002 | 1.4758 |
| 293.15 | 0.3004 | 1.4749 |
| 293.15 | 0.4003 | 1.4742 |
| 293.15 | 0.4998 | 1.4735 |
| 293.15 | 0.6003 | 1.4728 |
| 293.15 | 0.7000 | 1.4722 |
| 293.15 | 0.7997 | 1.4713 |
| 293.15 | 0.8994 | 1.4706 |
| 293.15 | 1.0000 | 1.4698 |
| 303.15 | 0.0000 | 1.4742 |
| 303.15 | 0.1012 | 1.4737 |
| 303.15 | 0.2002 | 1.473 |
| 303.15 | 0.3004 | 1.472 |
| 303.15 | 0.4003 | 1.471 |
| 303.15 | 0.4998 | 1.4703 |
| 303.15 | 0.6003 | 1.4692 |
| 303.15 | 0.7000 | 1.4684 |
| 303.15 | 0.7997 | 1.4675 |
| 303.15 | 0.8994 | 1.4666 |
| 303.15 | 1.0000 | 1.4657 |
| 313.15 | 0.0000 | 1.472 |
| 313.15 | 0.1012 | 1.4702 |
| 313.15 | 0.2002 | 1.4694 |
| 313.15 | 0.3004 | 1.4682 |
| 313.15 | 0.4003 | 1.467 |
| 313.15 | 0.4998 | 1.4659 |
| 313.15 | 0.6003 | 1.4651 |
| 313.15 | 0.7000 | 1.464 |
| 313.15 | 0.7997 | 1.4629 |
| 313.15 | 0.8994 | 1.4621 |
| 313.15 | 1.0000 | 1.4614 |
| 323.15 | 0.0000 | 1.4679 |
| 323.15 | 0.1012 | 1.4669 |
| 323.15 | 0.2002 | 1.4661 |
| 323.15 | 0.3004 | 1.4649 |
| 323.15 | 0.4003 | 1.4635 |
| 323.15 | 0.4998 | 1.4624 |
| 323.15 | 0.6003 | 1.4616 |
| 323.15 | 0.7000 | 1.4602 |
| 323.15 | 0.7997 | 1.4591 |
| 323.15 | 0.8994 | 1.458 |
| 323.15 | 1.0000 | 1.4569 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of 2-Pyrrolidinone, 1-methyl- (2) - Liquid | Mass density, kg/m3 - Liquid |
| 293.15 | 0.0000 | 1096.4 |
| 293.15 | 0.1012 | 1089.2 |
| 293.15 | 0.2002 | 1082.4 |
| 293.15 | 0.3004 | 1075.4 |
| 293.15 | 0.4003 | 1068.7 |
| 293.15 | 0.4998 | 1062.1 |
| 293.15 | 0.6003 | 1055.6 |
| 293.15 | 0.7000 | 1049.4 |
| 293.15 | 0.7997 | 1043.6 |
| 293.15 | 0.8994 | 1038.6 |
| 293.15 | 1.0000 | 1033.6 |
| 303.15 | 0.0000 | 1090.0 |
| 303.15 | 0.1012 | 1082.4 |
| 303.15 | 0.2002 | 1075.4 |
| 303.15 | 0.3004 | 1068.2 |
| 303.15 | 0.4003 | 1061.2 |
| 303.15 | 0.4998 | 1054.3 |
| 303.15 | 0.6003 | 1047.6 |
| 303.15 | 0.7000 | 1041.1 |
| 303.15 | 0.7997 | 1035.1 |
| 303.15 | 0.8994 | 1029.9 |
| 303.15 | 1.0000 | 1024.7 |
| 313.15 | 0.0000 | 1083.5 |
| 313.15 | 0.1012 | 1075.7 |
| 313.15 | 0.2002 | 1068.3 |
| 313.15 | 0.3004 | 1060.8 |
| 313.15 | 0.4003 | 1053.5 |
| 313.15 | 0.4998 | 1046.4 |
| 313.15 | 0.6003 | 1039.5 |
| 313.15 | 0.7000 | 1032.7 |
| 313.15 | 0.7997 | 1026.6 |
| 313.15 | 0.8994 | 1021.2 |
| 313.15 | 1.0000 | 1015.7 |
| 323.15 | 0.0000 | 1077.0 |
| 323.15 | 0.1012 | 1068.8 |
| 323.15 | 0.2002 | 1061.3 |
| 323.15 | 0.3004 | 1053.4 |
| 323.15 | 0.4003 | 1045.8 |
| 323.15 | 0.4998 | 1038.5 |
| 323.15 | 0.6003 | 1031.4 |
| 323.15 | 0.7000 | 1024.4 |
| 323.15 | 0.7997 | 1018.0 |
| 323.15 | 0.8994 | 1012.5 |
| 323.15 | 1.0000 | 1006.8 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of 2-Pyrrolidinone, 1-methyl- (2) - Liquid | Mass density, kg/m3 - Liquid |
| 303.15 | 0.1941 | 1088.8 |
| 303.15 | 0.4024 | 1080.2 |
| 303.15 | 0.5851 | 1068.0 |
| 303.15 | 0.7962 | 1047.8 |
| 313.15 | 0.1941 | 1081.7 |
| 313.15 | 0.4024 | 1073.8 |
| 313.15 | 0.5851 | 1061.3 |
| 313.15 | 0.7962 | 1040.4 |
| 323.15 | 0.1941 | 1075.4 |
| 323.15 | 0.4024 | 1067.5 |
| 323.15 | 0.5851 | 1054.7 |
| 323.15 | 0.7962 | 1033.1 |
| 333.15 | 0.1941 | 1069.1 |
| 333.15 | 0.4024 | 1061.1 |
| 333.15 | 0.5851 | 1048.0 |
| 333.15 | 0.7962 | 1025.7 |
| 343.15 | 0.1941 | 1062.8 |
| 343.15 | 0.4024 | 1054.8 |
| 343.15 | 0.5851 | 1041.4 |
| 343.15 | 0.7962 | 1018.4 |
| 353.15 | 0.1941 | 1056.5 |
| 353.15 | 0.4024 | 1048.4 |
| 353.15 | 0.5851 | 1034.7 |
| 353.15 | 0.7962 | 1011.0 |
| 363.15 | 0.1941 | 1050.2 |
| 363.15 | 0.4024 | 1042.1 |
| 363.15 | 0.5851 | 1028.1 |
| 363.15 | 0.7962 | 1003.7 |
| 373.15 | 0.1941 | 1043.9 |
| 373.15 | 0.4024 | 1035.7 |
| 373.15 | 0.5851 | 1021.4 |
| 373.15 | 0.7962 | 996.3 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of 2-Pyrrolidinone, 1-methyl- (2) - Liquid | Speed of sound, m/s - Liquid |
| 293.15 | 0.0000 | 1739.0 |
| 293.15 | 0.1012 | 1710.4 |
| 293.15 | 0.2002 | 1686.3 |
| 293.15 | 0.3004 | 1663.3 |
| 293.15 | 0.4003 | 1643.5 |
| 293.15 | 0.4998 | 1626.3 |
| 293.15 | 0.6003 | 1608.7 |
| 293.15 | 0.7000 | 1592.9 |
| 293.15 | 0.7997 | 1582.3 |
| 293.15 | 0.8994 | 1575.0 |
| 293.15 | 1.0000 | 1567.9 |
| 303.15 | 0.0000 | 1711.0 |
| 303.15 | 0.1012 | 1682.5 |
| 303.15 | 0.2002 | 1658.8 |
| 303.15 | 0.3004 | 1633.8 |
| 303.15 | 0.4003 | 1612.6 |
| 303.15 | 0.4998 | 1594.1 |
| 303.15 | 0.6003 | 1575.9 |
| 303.15 | 0.7000 | 1558.1 |
| 303.15 | 0.7997 | 1546.8 |
| 303.15 | 0.8994 | 1538.0 |
| 303.15 | 1.0000 | 1529.7 |
| 313.15 | 0.0000 | 1685.3 |
| 313.15 | 0.1012 | 1656.3 |
| 313.15 | 0.2002 | 1631.3 |
| 313.15 | 0.3004 | 1604.8 |
| 313.15 | 0.4003 | 1582.3 |
| 313.15 | 0.4998 | 1562.4 |
| 313.15 | 0.6003 | 1543.2 |
| 313.15 | 0.7000 | 1524.2 |
| 313.15 | 0.7997 | 1511.1 |
| 313.15 | 0.8994 | 1500.8 |
| 313.15 | 1.0000 | 1491.2 |
| 323.15 | 0.0000 | 1660.7 |
| 323.15 | 0.1012 | 1630.7 |
| 323.15 | 0.2002 | 1603.5 |
| 323.15 | 0.3004 | 1575.7 |
| 323.15 | 0.4003 | 1552.1 |
| 323.15 | 0.4998 | 1531.0 |
| 323.15 | 0.6003 | 1510.5 |
| 323.15 | 0.7000 | 1490.0 |
| 323.15 | 0.7997 | 1476.5 |
| 323.15 | 0.8994 | 1464.5 |
| 323.15 | 1.0000 | 1454.6 |
Surface tension liquid-gas, N/m [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of 2-Pyrrolidinone, 1-methyl- (2) - Liquid | Surface tension liquid-gas, N/m - Liquid |
| 293.15 | 0.0000 | 0.0472 |
| 293.15 | 0.1012 | 0.0464 |
| 293.15 | 0.2002 | 0.0456 |
| 293.15 | 0.3004 | 0.0449 |
| 293.15 | 0.4003 | 0.0442 |
| 293.15 | 0.4998 | 0.0436 |
| 293.15 | 0.6003 | 0.0431 |
| 293.15 | 0.7000 | 0.0425 |
| 293.15 | 0.7997 | 0.0421 |
| 293.15 | 0.8994 | 0.0416 |
| 293.15 | 1.0000 | 0.0413 |
| 303.15 | 0.0000 | 0.0465 |
| 303.15 | 0.1012 | 0.0457 |
| 303.15 | 0.2002 | 0.0449 |
| 303.15 | 0.3004 | 0.0442 |
| 303.15 | 0.4003 | 0.0437 |
| 303.15 | 0.4998 | 0.0428 |
| 303.15 | 0.6003 | 0.0422 |
| 303.15 | 0.7000 | 0.0417 |
| 303.15 | 0.7997 | 0.0413 |
| 303.15 | 0.8994 | 0.0408 |
| 303.15 | 1.0000 | 0.0404 |
| 313.15 | 0.0000 | 0.0460 |
| 313.15 | 0.1012 | 0.0453 |
| 313.15 | 0.2002 | 0.0444 |
| 313.15 | 0.3004 | 0.0436 |
| 313.15 | 0.4003 | 0.0429 |
| 313.15 | 0.4998 | 0.0422 |
| 313.15 | 0.6003 | 0.0417 |
| 313.15 | 0.7000 | 0.0411 |
| 313.15 | 0.7997 | 0.0405 |
| 313.15 | 0.8994 | 0.0400 |
| 313.15 | 1.0000 | 0.0396 |
| 323.15 | 0.0000 | 0.0454 |
| 323.15 | 0.1012 | 0.0446 |
| 323.15 | 0.2002 | 0.0437 |
| 323.15 | 0.3004 | 0.0430 |
| 323.15 | 0.4003 | 0.0423 |
| 323.15 | 0.4998 | 0.0415 |
| 323.15 | 0.6003 | 0.0407 |
| 323.15 | 0.7000 | 0.0401 |
| 323.15 | 0.7997 | 0.0395 |
| 323.15 | 0.8994 | 0.0391 |
| 323.15 | 1.0000 | 0.0387 |
Sources
- Viscometric and volumetric behaviour of binary mixtures of sulfolane and N-methylpyrrolidone with monoethanolamine and diethanolamine in the range 303 373 K
- Density, speed of sound, viscosity, refractive index and surface tension of N-methyl-2-pyrrolidone + diethanolamine (or triethanolamine) from T = (293.15 to 323.15) K
Note: These property values are available through the Cheméo API. A free account gives you an access key.