- Name
- 9,10-Anthracenedione, 1,4-bis(methylamino)-
- InChI
- InChI=1S/C16H14N2O2/c1-17-11-7-8-12(18-2)14-13(11)15(19)9-5-3-4-6-10(9)16(14)20/h3-8,17-18H,1-2H3
- InChI Key
- QOSTVEDABRQTSU-UHFFFAOYSA-N
- Formula
- C16H14N2O2
- SMILES
-
CNc1ccc(NC)c2c1C(=O)c1ccccc1C2
=O - Mol. Weight (g/mol)
- 266.30
- Name
- Carbon dioxide
- InChI
- InChI=1S/CO2/c2-1-3
- InChI Key
- CURLTUGMZLYLDI-UHFFFAOYSA-N
- Formula
- CO2
- SMILES
- O=C=O
- Mol. Weight (g/mol)
- 44.01
- CAS
- 124-38-9
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Amount concentration (molarity), mol/dm3 of 9,10-Anthracenedione, 1,4-bis(methylamino)- (1) [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Fluid (supercritical or subcritical phases) | Pressure, kPa - Fluid (supercritical or subcritical phases) | Amount concentration (molarity), mol/dm3 of 9,10-Anthracenedione, 1,4-bis(methylamino)- (1) - Fluid (supercritical or subcritical phases) |
| 299.00 | 6790.00 | 6.4700e-06 |
| 299.00 | 6860.00 | 6.3700e-06 |
| 299.00 | 7870.00 | 9.5600e-06 |
| 299.00 | 7910.00 | 9.7800e-06 |
| 299.00 | 8850.00 | 0.0000 |
| 299.00 | 8860.00 | 0.0000 |
| 299.00 | 9840.00 | 0.0000 |
| 299.00 | 10850.00 | 0.0000 |
| 299.00 | 11800.00 | 0.0000 |
| 299.00 | 12800.00 | 0.0000 |
| 299.00 | 13800.00 | 0.0000 |
| 299.00 | 14830.00 | 0.0000 |
| 299.00 | 15800.00 | 0.0000 |
| 299.00 | 16790.00 | 0.0000 |
| 299.00 | 17800.00 | 0.0000 |
| 299.00 | 18740.00 | 0.0000 |
| 305.00 | 7620.00 | 2.9500e-06 |
| 305.00 | 7660.00 | 2.9700e-06 |
| 305.00 | 8830.00 | 8.3800e-06 |
| 305.00 | 9770.00 | 0.0000 |
| 305.00 | 10830.00 | 0.0000 |
| 305.00 | 11770.00 | 0.0000 |
| 305.00 | 12750.00 | 0.0000 |
| 305.00 | 13750.00 | 0.0000 |
| 305.00 | 13760.00 | 0.0000 |
| 305.00 | 14550.00 | 0.0000 |
| 305.00 | 15600.00 | 0.0000 |
| 305.00 | 16720.00 | 0.0000 |
| 305.00 | 17790.00 | 0.0000 |
| 305.00 | 18730.00 | 0.0000 |
| 310.00 | 8800.00 | 3.6200e-06 |
| 310.00 | 9760.00 | 7.9400e-06 |
| 310.00 | 10760.00 | 0.0000 |
| 310.00 | 11760.00 | 0.0000 |
| 310.00 | 12550.00 | 0.0000 |
| 310.00 | 12660.00 | 0.0000 |
| 310.00 | 13600.00 | 0.0000 |
| 310.00 | 14650.00 | 0.0000 |
| 310.00 | 14700.00 | 0.0000 |
| 310.00 | 15650.00 | 0.0000 |
| 310.00 | 16690.00 | 0.0000 |
| 310.00 | 17580.00 | 0.0000 |
| 310.00 | 17590.00 | 0.0000 |
| 310.00 | 17780.00 | 0.0000 |
| 310.00 | 18000.00 | 0.0000 |
| 310.00 | 18690.00 | 0.0000 |
| 310.00 | 18800.00 | 0.0000 |
| 315.00 | 9810.00 | 3.3900e-06 |
| 315.00 | 10800.00 | 8.0100e-06 |
| 315.00 | 11760.00 | 0.0000 |
| 315.00 | 12750.00 | 0.0000 |
| 315.00 | 13810.00 | 0.0000 |
| 315.00 | 14840.00 | 0.0000 |
| 315.00 | 15670.00 | 0.0000 |
| 315.00 | 16750.00 | 0.0000 |
| 315.00 | 17720.00 | 0.0000 |
| 315.00 | 18720.00 | 0.0000 |
| 320.00 | 10720.00 | 3.5800e-06 |
| 320.00 | 11760.00 | 8.2900e-06 |
| 320.00 | 12790.00 | 0.0000 |
| 320.00 | 13720.00 | 0.0000 |
| 320.00 | 13780.00 | 0.0000 |
| 320.00 | 14700.00 | 0.0000 |
| 320.00 | 15740.00 | 0.0000 |
| 320.00 | 16490.00 | 0.0000 |
| 320.00 | 16700.00 | 0.0000 |
| 320.00 | 16830.00 | 0.0000 |
| 320.00 | 16840.00 | 0.0000 |
| 320.00 | 17710.00 | 0.0000 |
| 320.00 | 18560.00 | 0.0000 |
| 320.00 | 16700.00 | 0.0000 |
| 325.00 | 11740.00 | 4.1600e-06 |
| 325.00 | 12800.00 | 9.0700e-06 |
| 325.00 | 13750.00 | 0.0000 |
| 325.00 | 14720.00 | 0.0000 |
| 325.00 | 15700.00 | 0.0000 |
| 325.00 | 16720.00 | 0.0000 |
| 325.00 | 17640.00 | 0.0000 |
| 325.00 | 18790.00 | 0.0000 |
| 330.00 | 11700.00 | 1.9200e-06 |
| 330.00 | 12740.00 | 5.4400e-06 |
| 330.00 | 13750.00 | 0.0000 |
| 330.00 | 14690.00 | 0.0000 |
| 330.00 | 15690.00 | 0.0000 |
| 330.00 | 15710.00 | 0.0000 |
| 330.00 | 16720.00 | 0.0000 |
| 330.00 | 17680.00 | 0.0000 |
| 330.00 | 18740.00 | 0.0000 |
| 330.00 | 16720.00 | 0.0000 |
| 335.00 | 12770.00 | 3.0700e-06 |
| 335.00 | 13750.00 | 6.8000e-06 |
| 335.00 | 14740.00 | 0.0000 |
| 335.00 | 15660.00 | 0.0000 |
| 335.00 | 16780.00 | 0.0000 |
| 335.00 | 17740.00 | 0.0000 |
| 335.00 | 18810.00 | 0.0000 |
| 340.00 | 12700.00 | 1.8500e-06 |
| 340.00 | 13710.00 | 4.4800e-06 |
| 340.00 | 14700.00 | 8.5600e-06 |
| 340.00 | 15650.00 | 0.0000 |
| 340.00 | 16700.00 | 0.0000 |
| 340.00 | 17730.00 | 0.0000 |
| 340.00 | 18690.00 | 0.0000 |
| 345.00 | 13790.00 | 2.9700e-06 |
| 345.00 | 14770.00 | 6.3100e-06 |
| 345.00 | 15710.00 | 0.0000 |
| 345.00 | 16770.00 | 0.0000 |
| 345.00 | 17770.00 | 0.0000 |
| 345.00 | 18790.00 | 0.0000 |
Binary diffusion coefficient, m2/s [ref]
Operational condition: Mole fraction = 0 (Fluid (supercritical or subcritical phases))
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Fluid (supercritical or subcritical phases) | Pressure, kPa - Fluid (supercritical or subcritical phases) | Binary diffusion coefficient, m2/s - Fluid (supercritical or subcritical phases) |
| 310.00 | 20000.00 | 0.0000 |
| 310.00 | 21000.00 | 0.0000 |
| 310.00 | 24000.00 | 0.0000 |
| 310.00 | 25000.00 | 0.0000 |
| 310.00 | 26000.00 | 0.0000 |
| 310.00 | 26000.00 | 0.0000 |
| 310.00 | 27000.00 | 0.0000 |
| 310.00 | 28000.00 | 0.0000 |
| 310.00 | 28000.00 | 0.0000 |
| 310.00 | 28000.00 | 0.0000 |
| 310.00 | 29000.00 | 0.0000 |
| 310.00 | 30000.00 | 0.0000 |
| 310.00 | 30000.00 | 0.0000 |
| 310.00 | 30000.00 | 0.0000 |
| 310.00 | 30000.00 | 0.0000 |
| 310.00 | 31000.00 | 0.0000 |
| 310.00 | 31000.00 | 0.0000 |
| 313.20 | 20000.00 | 0.0000 |
| 313.20 | 21000.00 | 0.0000 |
| 313.20 | 22000.00 | 0.0000 |
| 313.20 | 22000.00 | 0.0000 |
| 313.20 | 23000.00 | 0.0000 |
| 313.20 | 24000.00 | 0.0000 |
| 313.20 | 24000.00 | 0.0000 |
| 313.20 | 25000.00 | 0.0000 |
| 313.20 | 26000.00 | 0.0000 |
| 313.20 | 27000.00 | 0.0000 |
| 313.20 | 28000.00 | 0.0000 |
| 313.20 | 29000.00 | 0.0000 |
| 313.20 | 30000.00 | 0.0000 |
| 313.20 | 31000.00 | 0.0000 |
| 320.00 | 22000.00 | 0.0000 |
| 320.00 | 22000.00 | 0.0000 |
| 320.00 | 23000.00 | 0.0000 |
| 320.00 | 24000.00 | 0.0000 |
| 320.00 | 24000.00 | 0.0000 |
| 320.00 | 25000.00 | 0.0000 |
| 320.00 | 26000.00 | 0.0000 |
| 320.00 | 26000.00 | 0.0000 |
| 320.00 | 27000.00 | 0.0000 |
| 320.00 | 28000.00 | 0.0000 |
| 320.00 | 29000.00 | 0.0000 |
| 320.00 | 30000.00 | 0.0000 |
| 320.00 | 31000.00 | 0.0000 |
| 320.00 | 32000.00 | 0.0000 |
| 320.00 | 33000.00 | 0.0000 |
| 320.00 | 34000.00 | 0.0000 |
Sources
- Measurement of binary diffusion coefficient and solubility estimation for dyes in supercritical carbon dioxide by CIR method
- Solubilities of a 1,4-Bis(alkylamino)-9,10-anthraquinone Series in Compressed Carbon Dioxide
Note: These property values are available through the Cheméo API. A free account gives you an access key.