- Name
- Carbon dioxide
- InChI
- InChI=1S/CO2/c2-1-3
- InChI Key
- CURLTUGMZLYLDI-UHFFFAOYSA-N
- Formula
- CO2
- SMILES
- O=C=O
- Mol. Weight (g/mol)
- 44.01
- CAS
- 124-38-9
- Name
- Water
- InChI
- InChI=1S/H2O/h1H2
- InChI Key
- XLYOFNOQVPJJNP-UHFFFAOYSA-N
- Formula
- H2O
- SMILES
- O
- Mol. Weight (g/mol)
- 18.02
- CAS
- 7732-18-5
- Name
- Sodium bicarbonate
- InChI
- InChI=1S/CH2O3.Na/c2-1(3)4;/h(H2,2,3,4);/q;+1/p-1
- InChI Key
- UIIMBOGNXHQVGW-UHFFFAOYSA-M
- Formula
- CHNaO3
- SMILES
- O=C(O)[O][Na]
- Mol. Weight (g/mol)
- 84.01
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Molality, mol/kg of Carbon dioxide (1) [ref]
| Fixed | Measured | ||
|---|---|---|---|
| Temperature, K - Liquid | Pressure, kPa - Liquid | Solvent: Molality, mol/kg of Sodium bicarbonate (3) - Liquid | Molality, mol/kg of Carbon dioxide (1) - Liquid |
| 313.00 | 310.00 | 0.1000 | 0.0725 |
| 313.00 | 357.00 | 0.0500 | 0.0806 |
| 313.00 | 369.00 | 0.0000 | 0.1006 |
| 313.00 | 371.00 | 0.5000 | 0.0725 |
| 313.00 | 376.00 | 1.0000 | 0.0793 |
| 313.00 | 708.00 | 0.0500 | 0.1595 |
| 313.00 | 792.00 | 0.0000 | 0.1798 |
| 313.00 | 824.00 | 0.5000 | 0.1617 |
| 313.00 | 826.00 | 1.0000 | 0.1529 |
| 313.00 | 856.00 | 0.1000 | 0.1950 |
| 313.00 | 913.00 | 0.0500 | 0.2104 |
| 313.00 | 1200.00 | 0.1000 | 0.2720 |
| 313.00 | 1204.00 | 0.0000 | 0.2751 |
| 313.00 | 1221.00 | 0.5000 | 0.2349 |
| 313.00 | 1222.00 | 1.0000 | 0.2161 |
| 313.00 | 1289.00 | 0.0500 | 0.3014 |
| 313.00 | 1595.00 | 0.0000 | 0.3916 |
| 313.00 | 1605.00 | 0.1000 | 0.3608 |
| 313.00 | 1605.00 | 0.5000 | 0.3082 |
| 313.00 | 1619.00 | 1.0000 | 0.2806 |
| 313.00 | 1901.00 | 0.1000 | 0.4344 |
| 313.00 | 1990.00 | 0.0500 | 0.4604 |
| 313.00 | 1990.00 | 0.5000 | 0.3900 |
| 313.00 | 1993.00 | 0.0000 | 0.4736 |
| 313.00 | 2035.00 | 1.0000 | 0.3462 |
| 323.00 | 105.00 | 0.0000 | 0.0208 |
| 323.00 | 346.00 | 1.0000 | 0.0667 |
| 323.00 | 362.00 | 0.1000 | 0.0655 |
| 323.00 | 392.00 | 0.0000 | 0.0673 |
| 323.00 | 399.00 | 0.5000 | 0.0769 |
| 323.00 | 579.00 | 0.0500 | 0.1091 |
| 323.00 | 793.00 | 0.1000 | 0.1440 |
| 323.00 | 798.00 | 0.0000 | 0.1487 |
| 323.00 | 807.00 | 0.5000 | 0.1417 |
| 323.00 | 830.00 | 1.0000 | 0.1331 |
| 323.00 | 939.00 | 0.0500 | 0.1745 |
| 323.00 | 1188.00 | 0.5000 | 0.2010 |
| 323.00 | 1196.00 | 0.0000 | 0.2330 |
| 323.00 | 1204.00 | 1.0000 | 0.1816 |
| 323.00 | 1210.00 | 0.1000 | 0.2257 |
| 323.00 | 1292.00 | 0.0500 | 0.2447 |
| 323.00 | 1599.00 | 0.1000 | 0.3024 |
| 323.00 | 1602.00 | 0.0000 | 0.3204 |
| 323.00 | 1603.00 | 1.0000 | 0.2380 |
| 323.00 | 1605.00 | 0.5000 | 0.2682 |
| 323.00 | 1695.00 | 0.0500 | 0.3223 |
| 323.00 | 1958.00 | 1.0000 | 0.2884 |
| 323.00 | 1975.00 | 0.0500 | 0.3816 |
| 323.00 | 1993.00 | 0.5000 | 0.3363 |
| 323.00 | 1997.00 | 0.0000 | 0.4014 |
| 323.00 | 2017.00 | 0.1000 | 0.3866 |
| 323.00 | 2502.00 | 0.0000 | 0.5111 |
| 333.00 | 342.00 | 1.0000 | 0.0418 |
| 333.00 | 369.00 | 0.0500 | 0.0565 |
| 333.00 | 378.00 | 0.1000 | 0.0471 |
| 333.00 | 380.00 | 0.0000 | 0.0598 |
| 333.00 | 404.00 | 0.5000 | 0.0516 |
| 333.00 | 762.00 | 0.0500 | 0.1196 |
| 333.00 | 784.00 | 0.0000 | 0.1281 |
| 333.00 | 790.00 | 0.5000 | 0.0984 |
| 333.00 | 822.00 | 0.1000 | 0.1117 |
| 333.00 | 853.00 | 1.0000 | 0.0964 |
| 333.00 | 1185.00 | 0.1000 | 0.1670 |
| 333.00 | 1191.00 | 0.5000 | 0.1460 |
| 333.00 | 1200.00 | 1.0000 | 0.1277 |
| 333.00 | 1209.00 | 0.0000 | 0.1948 |
| 333.00 | 1363.00 | 0.0500 | 0.2157 |
| 333.00 | 1592.00 | 0.0500 | 0.2539 |
| 333.00 | 1593.00 | 0.1000 | 0.2668 |
| 333.00 | 1595.00 | 1.0000 | 0.1663 |
| 333.00 | 1598.00 | 0.5000 | 0.1963 |
| 333.00 | 1602.00 | 0.0000 | 0.2626 |
| 333.00 | 1792.00 | 0.0500 | 0.2756 |
| 333.00 | 1955.00 | 1.0000 | 0.1959 |
| 333.00 | 1988.00 | 0.1000 | 0.2997 |
| 333.00 | 2000.00 | 0.0000 | 0.3198 |
| 333.00 | 2016.00 | 0.5000 | 0.2564 |
Sources
Note: These property values are available through the Cheméo API. A free account gives you an access key.