- Name
- Monoethanolamine
- InChI
- InChI=1S/C2H7NO/c3-1-2-4/h4H,1-3H2
- InChI Key
- HZAXFHJVJLSVMW-UHFFFAOYSA-N
- Formula
- C2H7NO
- SMILES
- NCCO
- Mol. Weight (g/mol)
- 61.08
- CAS
- 141-43-5
- Name
- 1-Ethyl-2-pyrrolidinone
- InChI
- InChI=1S/C6H11NO/c1-2-7-5-3-4-6(7)8/h2-5H2,1H3
- InChI Key
- ZFPGARUNNKGOBB-UHFFFAOYSA-N
- Formula
- C6H11NO
- SMILES
- CCN1CCCC1=O
- Mol. Weight (g/mol)
- 113.16
- CAS
- 2687-91-4
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- η - Viscosity, Pa*s (2)
- ρl - Mass density, kg/m3 (2)
- csound,fluid - Speed of Sound, m/s (2)
- γ - Surface tension liquid-gas, N/m
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101.325 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mass fraction of Monoethanolamine (1) - Liquid | Viscosity, Pa*s - Liquid |
| 323.15 | 0.7000 | 0.0042 |
| 323.15 | 0.8000 | 0.0050 |
| 313.15 | 0.7000 | 0.0057 |
| 323.15 | 0.9000 | 0.0059 |
| 313.15 | 0.8000 | 0.0070 |
| 303.15 | 0.7000 | 0.0081 |
| 313.15 | 0.9000 | 0.0083 |
| 303.15 | 0.8000 | 0.0103 |
| 303.15 | 0.9000 | 0.0125 |
| 293.15 | 0.7000 | 0.0123 |
| 293.15 | 0.8000 | 0.0160 |
| 293.15 | 0.9000 | 0.0199 |
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of 1-Ethyl-2-pyrrolidinone (2) - Liquid | Viscosity, Pa*s - Liquid |
| 293.15 | 0.0000 | 0.0242 |
| 293.15 | 0.1000 | 0.0166 |
| 293.15 | 0.2002 | 0.0116 |
| 293.15 | 0.2999 | 0.0083 |
| 293.15 | 0.4002 | 0.0063 |
| 293.15 | 0.4999 | 0.0047 |
| 293.15 | 0.5996 | 0.0038 |
| 293.15 | 0.7002 | 0.0031 |
| 293.15 | 0.7999 | 0.0026 |
| 293.15 | 0.8997 | 0.0023 |
| 293.15 | 1.0000 | 0.0021 |
| 303.15 | 0.0000 | 0.0150 |
| 303.15 | 0.1000 | 0.0107 |
| 303.15 | 0.2002 | 0.0077 |
| 303.15 | 0.2999 | 0.0061 |
| 303.15 | 0.4002 | 0.0048 |
| 303.15 | 0.4999 | 0.0035 |
| 303.15 | 0.5996 | 0.0029 |
| 303.15 | 0.7002 | 0.0024 |
| 303.15 | 0.7999 | 0.0021 |
| 303.15 | 0.8997 | 0.0019 |
| 303.15 | 1.0000 | 0.0018 |
| 313.15 | 0.0000 | 0.0098 |
| 313.15 | 0.1000 | 0.0072 |
| 313.15 | 0.2002 | 0.0055 |
| 313.15 | 0.2999 | 0.0044 |
| 313.15 | 0.4002 | 0.0036 |
| 313.15 | 0.4999 | 0.0027 |
| 313.15 | 0.5996 | 0.0023 |
| 313.15 | 0.7002 | 0.0020 |
| 313.15 | 0.7999 | 0.0018 |
| 313.15 | 0.8997 | 0.0016 |
| 313.15 | 1.0000 | 0.0015 |
| 323.15 | 0.0000 | 0.0068 |
| 323.15 | 0.1000 | 0.0052 |
| 323.15 | 0.2002 | 0.0040 |
| 323.15 | 0.2999 | 0.0033 |
| 323.15 | 0.4002 | 0.0027 |
| 323.15 | 0.4999 | 0.0022 |
| 323.15 | 0.5996 | 0.0019 |
| 323.15 | 0.7002 | 0.0017 |
| 323.15 | 0.7999 | 0.0015 |
| 323.15 | 0.8997 | 0.0014 |
| 323.15 | 1.0000 | 0.0013 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101.325 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mass fraction of Monoethanolamine (1) - Liquid | Mass density, kg/m3 - Liquid |
| 293.15 | 0.9000 | 1014.01 |
| 293.15 | 0.8000 | 1011.7 |
| 293.15 | 0.7000 | 1009.04 |
| 303.15 | 0.9000 | 1005.95 |
| 303.15 | 0.8000 | 1003.49 |
| 303.15 | 0.7000 | 1000.7 |
| 313.15 | 0.9000 | 997.83 |
| 313.15 | 0.8000 | 995.23 |
| 313.15 | 0.7000 | 992.31 |
| 323.15 | 0.9000 | 989.65 |
| 323.15 | 0.8000 | 986.93 |
| 323.15 | 0.7000 | 983.87 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of 1-Ethyl-2-pyrrolidinone (2) - Liquid | Mass density, kg/m3 - Liquid |
| 293.15 | 0.0000 | 1015.93 |
| 293.15 | 0.1000 | 1014.83 |
| 293.15 | 0.2002 | 1012.06 |
| 293.15 | 0.2999 | 1008.77 |
| 293.15 | 0.4002 | 1006.13 |
| 293.15 | 0.4999 | 1002.53 |
| 293.15 | 0.5996 | 999.47 |
| 293.15 | 0.7002 | 998.41 |
| 293.15 | 0.7999 | 997.76 |
| 293.15 | 0.8997 | 997.35 |
| 293.15 | 1.0000 | 997.91 |
| 303.15 | 0.0000 | 1008.02 |
| 303.15 | 0.1000 | 1006.71 |
| 303.15 | 0.2002 | 1003.8 |
| 303.15 | 0.2999 | 1000.38 |
| 303.15 | 0.4002 | 997.65 |
| 303.15 | 0.4999 | 993.9 |
| 303.15 | 0.5996 | 990.78 |
| 303.15 | 0.7002 | 989.74 |
| 303.15 | 0.7999 | 989.12 |
| 303.15 | 0.8997 | 988.75 |
| 303.15 | 1.0000 | 989.34 |
| 313.15 | 0.0000 | 1000.06 |
| 313.15 | 0.1000 | 998.53 |
| 313.15 | 0.2002 | 995.42 |
| 313.15 | 0.2999 | 991.88 |
| 313.15 | 0.4002 | 989.14 |
| 313.15 | 0.4999 | 985.23 |
| 313.15 | 0.5996 | 982.08 |
| 313.15 | 0.7002 | 981.06 |
| 313.15 | 0.7999 | 980.46 |
| 313.15 | 0.8997 | 980.14 |
| 313.15 | 1.0000 | 980.76 |
| 323.15 | 0.0000 | 992.05 |
| 323.15 | 0.1000 | 990.31 |
| 323.15 | 0.2002 | 986.95 |
| 323.15 | 0.2999 | 983.29 |
| 323.15 | 0.4002 | 980.53 |
| 323.15 | 0.4999 | 976.53 |
| 323.15 | 0.5996 | 973.35 |
| 323.15 | 0.7002 | 972.34 |
| 323.15 | 0.7999 | 971.78 |
| 323.15 | 0.8997 | 971.5 |
| 323.15 | 1.0000 | 972.16 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 101.325 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mass fraction of Monoethanolamine (1) - Liquid | Speed of sound, m/s - Liquid |
| 293.15 | 0.9000 | 1706.9 |
| 303.15 | 0.9000 | 1674.0 |
| 313.15 | 0.9000 | 1641.2 |
| 323.15 | 0.9000 | 1608.0 |
| 293.15 | 0.8000 | 1679.7 |
| 303.15 | 0.8000 | 1645.9 |
| 313.15 | 0.8000 | 1611.7 |
| 323.15 | 0.8000 | 1578.2 |
| 293.15 | 0.7000 | 1653.3 |
| 303.15 | 0.7000 | 1618.6 |
| 313.15 | 0.7000 | 1584.0 |
| 323.15 | 0.7000 | 1549.5 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of 1-Ethyl-2-pyrrolidinone (2) - Liquid | Speed of sound, m/s - Liquid |
| 293.15 | 0.0000 | 1734.4 |
| 293.15 | 0.1000 | 1694.5 |
| 293.15 | 0.2002 | 1652.1 |
| 293.15 | 0.2999 | 1621.1 |
| 293.15 | 0.4002 | 1596.0 |
| 293.15 | 0.4999 | 1575.8 |
| 293.15 | 0.5996 | 1554.4 |
| 293.15 | 0.7002 | 1540.5 |
| 293.15 | 0.7999 | 1529.1 |
| 293.15 | 0.8997 | 1519.5 |
| 293.15 | 1.0000 | 1513.2 |
| 303.15 | 0.0000 | 1702.1 |
| 303.15 | 0.1000 | 1661.1 |
| 303.15 | 0.2002 | 1617.0 |
| 303.15 | 0.2999 | 1582.4 |
| 303.15 | 0.4002 | 1560.4 |
| 303.15 | 0.4999 | 1539.5 |
| 303.15 | 0.5996 | 1517.3 |
| 303.15 | 0.7002 | 1503.1 |
| 303.15 | 0.7999 | 1491.9 |
| 303.15 | 0.8997 | 1481.7 |
| 303.15 | 1.0000 | 1475.0 |
| 313.15 | 0.0000 | 1670.1 |
| 313.15 | 0.1000 | 1628.0 |
| 313.15 | 0.2002 | 1582.8 |
| 313.15 | 0.2999 | 1552.5 |
| 313.15 | 0.4002 | 1527.9 |
| 313.15 | 0.4999 | 1502.9 |
| 313.15 | 0.5996 | 1480.5 |
| 313.15 | 0.7002 | 1466.1 |
| 313.15 | 0.7999 | 1454.9 |
| 313.15 | 0.8997 | 1444.2 |
| 313.15 | 1.0000 | 1437.6 |
| 323.15 | 0.0000 | 1637.2 |
| 323.15 | 0.1000 | 1594.2 |
| 323.15 | 0.2002 | 1549.2 |
| 323.15 | 0.2999 | 1517.9 |
| 323.15 | 0.4002 | 1493.2 |
| 323.15 | 0.4999 | 1467.0 |
| 323.15 | 0.5996 | 1443.8 |
| 323.15 | 0.7002 | 1429.5 |
| 323.15 | 0.7999 | 1418.0 |
| 323.15 | 0.8997 | 1407.6 |
| 323.15 | 1.0000 | 1400.6 |
Surface tension liquid-gas, N/m [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of 1-Ethyl-2-pyrrolidinone (2) - Liquid | Surface tension liquid-gas, N/m - Liquid |
| 293.15 | 0.0000 | 0.0497 |
| 293.15 | 0.1000 | 0.0449 |
| 293.15 | 0.2002 | 0.0424 |
| 293.15 | 0.2999 | 0.0411 |
| 293.15 | 0.4002 | 0.0398 |
| 293.15 | 0.4999 | 0.0391 |
| 293.15 | 0.5996 | 0.0383 |
| 293.15 | 0.7002 | 0.0377 |
| 293.15 | 0.7999 | 0.0373 |
| 293.15 | 0.8997 | 0.0371 |
| 293.15 | 1.0000 | 0.0365 |
| 303.15 | 0.0000 | 0.0478 |
| 303.15 | 0.1000 | 0.0437 |
| 303.15 | 0.2002 | 0.0412 |
| 303.15 | 0.2999 | 0.0398 |
| 303.15 | 0.4002 | 0.0385 |
| 303.15 | 0.4999 | 0.0376 |
| 303.15 | 0.5996 | 0.0367 |
| 303.15 | 0.7002 | 0.0361 |
| 303.15 | 0.7999 | 0.0362 |
| 303.15 | 0.8997 | 0.0357 |
| 303.15 | 1.0000 | 0.0352 |
| 313.15 | 0.0000 | 0.0471 |
| 313.15 | 0.1000 | 0.0427 |
| 313.15 | 0.2002 | 0.0402 |
| 313.15 | 0.2999 | 0.0387 |
| 313.15 | 0.4002 | 0.0370 |
| 313.15 | 0.4999 | 0.0359 |
| 313.15 | 0.5996 | 0.0349 |
| 313.15 | 0.7002 | 0.0345 |
| 313.15 | 0.7999 | 0.0350 |
| 313.15 | 0.8997 | 0.0346 |
| 313.15 | 1.0000 | 0.0342 |
Sources
- Density, Speed of Sound, Viscosity, Surface Tension, and Excess Volume of N-Ethyl-2-pyrrolidone + Ethanolamine (or Diethanolamine or Triethanolamine) from T = (293.15 to 323.15) K
- Density, Speed of Sound, and Viscosity of Monoethanolamine + Water + N-Ethyl-2-pyrrolidone from T = (293.15 to 323.15) K
Note: These property values are available through the Cheméo API. A free account gives you an access key.