- Name
- 1-Ethyl-2-pyrrolidinone
- InChI
- InChI=1S/C6H11NO/c1-2-7-5-3-4-6(7)8/h2-5H2,1H3
- InChI Key
- ZFPGARUNNKGOBB-UHFFFAOYSA-N
- Formula
- C6H11NO
- SMILES
- CCN1CCCC1=O
- Mol. Weight (g/mol)
- 113.16
- CAS
- 2687-91-4
- Name
- Water
- InChI
- InChI=1S/H2O/h1H2
- InChI Key
- XLYOFNOQVPJJNP-UHFFFAOYSA-N
- Formula
- H2O
- SMILES
- O
- Mol. Weight (g/mol)
- 18.02
- CAS
- 7732-18-5
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- η - Viscosity, Pa*s (2)
- n0 - Refractive index (Na D-line)
- ρl - Mass density, kg/m3 (2)
- csound,fluid - Speed of Sound, m/s (2)
- γ - Surface tension liquid-gas, N/m
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101.325 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mass fraction of Water (2) - Liquid | Viscosity, Pa*s - Liquid |
| 323.15 | 0.9000 | 0.0007 |
| 313.15 | 0.9000 | 0.0009 |
| 323.15 | 0.8000 | 0.0009 |
| 303.15 | 0.9000 | 0.0011 |
| 313.15 | 0.8000 | 0.0012 |
| 323.15 | 0.7000 | 0.0012 |
| 293.15 | 0.9000 | 0.0015 |
| 313.15 | 0.7000 | 0.0015 |
| 303.15 | 0.8000 | 0.0015 |
| 293.15 | 0.8000 | 0.0021 |
| 303.15 | 0.7000 | 0.0020 |
| 293.15 | 0.7000 | 0.0029 |
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of 1-Ethyl-2-pyrrolidinone (1) - Liquid | Viscosity, Pa*s - Liquid |
| 293.00 | 0.0000 | 0.0010 |
| 293.00 | 0.0220 | 0.0016 |
| 293.00 | 0.0500 | 0.0024 |
| 293.00 | 0.1000 | 0.0041 |
| 293.00 | 0.2000 | 0.0062 |
| 293.00 | 0.3000 | 0.0062 |
| 293.00 | 0.4000 | 0.0053 |
| 293.00 | 0.5000 | 0.0045 |
| 293.00 | 0.6000 | 0.0036 |
| 293.00 | 0.7000 | 0.0031 |
| 293.00 | 0.8000 | 0.0027 |
| 293.00 | 0.9000 | 0.0025 |
| 293.00 | 1.0000 | 0.0021 |
| 298.00 | 0.0000 | 0.0009 |
| 298.00 | 0.0220 | 0.0014 |
| 298.00 | 0.0500 | 0.0020 |
| 298.00 | 0.1000 | 0.0034 |
| 298.00 | 0.2000 | 0.0048 |
| 298.00 | 0.3000 | 0.0050 |
| 298.00 | 0.4000 | 0.0044 |
| 298.00 | 0.5000 | 0.0039 |
| 298.00 | 0.6000 | 0.0032 |
| 298.00 | 0.7000 | 0.0028 |
| 298.00 | 0.8000 | 0.0024 |
| 298.00 | 0.9000 | 0.0022 |
| 298.00 | 1.0000 | 0.0020 |
| 303.00 | 0.0000 | 0.0008 |
| 303.00 | 0.0220 | 0.0013 |
| 303.00 | 0.0500 | 0.0018 |
| 303.00 | 0.1000 | 0.0028 |
| 303.00 | 0.2000 | 0.0041 |
| 303.00 | 0.3000 | 0.0042 |
| 303.00 | 0.4000 | 0.0036 |
| 303.00 | 0.5000 | 0.0033 |
| 303.00 | 0.6000 | 0.0029 |
| 303.00 | 0.7000 | 0.0025 |
| 303.00 | 0.8000 | 0.0022 |
| 303.00 | 0.9000 | 0.0020 |
| 303.00 | 1.0000 | 0.0018 |
| 313.00 | 0.0000 | 0.0007 |
| 313.00 | 0.0220 | 0.0010 |
| 313.00 | 0.0500 | 0.0013 |
| 313.00 | 0.1000 | 0.0021 |
| 313.00 | 0.2000 | 0.0029 |
| 313.00 | 0.3000 | 0.0030 |
| 313.00 | 0.4000 | 0.0026 |
| 313.00 | 0.5000 | 0.0025 |
| 313.00 | 0.6000 | 0.0023 |
| 313.00 | 0.7000 | 0.0020 |
| 313.00 | 0.8000 | 0.0018 |
| 313.00 | 0.9000 | 0.0017 |
| 313.00 | 1.0000 | 0.0016 |
| 323.00 | 0.0000 | 0.0006 |
| 323.00 | 0.0220 | 0.0008 |
| 323.00 | 0.0500 | 0.0011 |
| 323.00 | 0.1000 | 0.0014 |
| 323.00 | 0.2000 | 0.0022 |
| 323.00 | 0.3000 | 0.0022 |
| 323.00 | 0.4000 | 0.0020 |
| 323.00 | 0.5000 | 0.0020 |
| 323.00 | 0.6000 | 0.0019 |
| 323.00 | 0.7000 | 0.0017 |
| 323.00 | 0.8000 | 0.0015 |
| 323.00 | 0.9000 | 0.0014 |
| 323.00 | 1.0000 | 0.0014 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of 1-Ethyl-2-pyrrolidinone (1) - Liquid | Refractive index (Na D-line) - Liquid |
| 293.00 | 0.0000 | 1.333 |
| 293.00 | 0.0220 | 1.352 |
| 293.00 | 0.0500 | 1.3708 |
| 293.00 | 0.1000 | 1.3958 |
| 293.00 | 0.2000 | 1.426 |
| 293.00 | 0.3000 | 1.4413 |
| 293.00 | 0.4000 | 1.4498 |
| 293.00 | 0.5000 | 1.4551 |
| 293.00 | 0.6000 | 1.4586 |
| 293.00 | 0.7000 | 1.4612 |
| 293.00 | 0.8000 | 1.4633 |
| 293.00 | 0.9000 | 1.4648 |
| 293.00 | 1.0000 | 1.4646 |
| 298.00 | 0.0000 | 1.3325 |
| 298.00 | 0.0220 | 1.3514 |
| 298.00 | 0.0500 | 1.3701 |
| 298.00 | 0.1000 | 1.3948 |
| 298.00 | 0.2000 | 1.4243 |
| 298.00 | 0.3000 | 1.4398 |
| 298.00 | 0.4000 | 1.4478 |
| 298.00 | 0.5000 | 1.4531 |
| 298.00 | 0.6000 | 1.4565 |
| 298.00 | 0.7000 | 1.459 |
| 298.00 | 0.8000 | 1.461 |
| 298.00 | 0.9000 | 1.4623 |
| 298.00 | 1.0000 | 1.4619 |
| 303.00 | 0.0000 | 1.3319 |
| 303.00 | 0.0220 | 1.3495 |
| 303.00 | 0.0500 | 1.3694 |
| 303.00 | 0.1000 | 1.3929 |
| 303.00 | 0.2000 | 1.423 |
| 303.00 | 0.3000 | 1.4371 |
| 303.00 | 0.4000 | 1.4461 |
| 303.00 | 0.5000 | 1.4515 |
| 303.00 | 0.6000 | 1.4544 |
| 303.00 | 0.7000 | 1.4568 |
| 303.00 | 0.8000 | 1.4586 |
| 303.00 | 0.9000 | 1.4602 |
| 303.00 | 1.0000 | 1.4579 |
| 313.00 | 0.0000 | 1.3306 |
| 313.00 | 0.0220 | 1.3488 |
| 313.00 | 0.0500 | 1.3669 |
| 313.00 | 0.1000 | 1.3902 |
| 313.00 | 0.2000 | 1.4189 |
| 313.00 | 0.3000 | 1.4331 |
| 313.00 | 0.4000 | 1.4418 |
| 313.00 | 0.5000 | 1.4469 |
| 313.00 | 0.6000 | 1.4504 |
| 313.00 | 0.7000 | 1.4527 |
| 313.00 | 0.8000 | 1.455 |
| 313.00 | 0.9000 | 1.4564 |
| 313.00 | 1.0000 | 1.4542 |
| 323.00 | 0.0000 | 1.329 |
| 323.00 | 0.0220 | 1.3471 |
| 323.00 | 0.0500 | 1.3643 |
| 323.00 | 0.1000 | 1.3876 |
| 323.00 | 0.2000 | 1.4171 |
| 323.00 | 0.3000 | 1.4291 |
| 323.00 | 0.4000 | 1.4376 |
| 323.00 | 0.5000 | 1.4427 |
| 323.00 | 0.6000 | 1.4462 |
| 323.00 | 0.7000 | 1.4486 |
| 323.00 | 0.8000 | 1.4507 |
| 323.00 | 0.9000 | 1.4522 |
| 323.00 | 1.0000 | 1.4515 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101.325 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mass fraction of Water (2) - Liquid | Mass density, kg/m3 - Liquid |
| 313.15 | 0.7000 | 1001.9 |
| 293.15 | 0.7000 | 1013.82 |
| 323.15 | 0.7000 | 995.12 |
| 303.15 | 0.7000 | 1008.12 |
| 313.15 | 0.8000 | 998.11 |
| 293.15 | 0.8000 | 1007.67 |
| 323.15 | 0.8000 | 992.41 |
| 303.15 | 0.8000 | 1003.22 |
| 303.15 | 0.9000 | 998.33 |
| 323.15 | 0.9000 | 989.74 |
| 313.15 | 0.9000 | 994.6 |
| 293.15 | 0.9000 | 1002.08 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of 1-Ethyl-2-pyrrolidinone (1) - Liquid | Mass density, kg/m3 - Liquid |
| 293.00 | 0.0000 | 998.26 |
| 293.00 | 0.0220 | 1003.49 |
| 293.00 | 0.0500 | 1010.45 |
| 293.00 | 0.1000 | 1020.31 |
| 293.00 | 0.2000 | 1026.26 |
| 293.00 | 0.3000 | 1023.9 |
| 293.00 | 0.4000 | 1022.18 |
| 293.00 | 0.5000 | 1019.16 |
| 293.00 | 0.6000 | 1014.04 |
| 293.00 | 0.7000 | 1010.43 |
| 293.00 | 0.8000 | 1006.66 |
| 293.00 | 0.9000 | 1003.19 |
| 293.00 | 1.0000 | 1000.55 |
| 298.00 | 0.0000 | 997.1 |
| 298.00 | 0.0220 | 1001.76 |
| 298.00 | 0.0500 | 1007.34 |
| 298.00 | 0.1000 | 1016.76 |
| 298.00 | 0.2000 | 1021.82 |
| 298.00 | 0.3000 | 1019.33 |
| 298.00 | 0.4000 | 1016.58 |
| 298.00 | 0.5000 | 1014.6 |
| 298.00 | 0.6000 | 1009.45 |
| 298.00 | 0.7000 | 1005.98 |
| 298.00 | 0.8000 | 1002.26 |
| 298.00 | 0.9000 | 998.84 |
| 298.00 | 1.0000 | 996.24 |
| 303.00 | 0.0000 | 995.7 |
| 303.00 | 0.0220 | 999.83 |
| 303.00 | 0.0500 | 1002.82 |
| 303.00 | 0.1000 | 1013.12 |
| 303.00 | 0.2000 | 1017.34 |
| 303.00 | 0.3000 | 1014.71 |
| 303.00 | 0.4000 | 1012.16 |
| 303.00 | 0.5000 | 1010.0 |
| 303.00 | 0.6000 | 1004.1 |
| 303.00 | 0.7000 | 1001.5 |
| 303.00 | 0.8000 | 997.83 |
| 303.00 | 0.9000 | 994.48 |
| 303.00 | 1.0000 | 991.93 |
| 313.00 | 0.0000 | 992.26 |
| 313.00 | 0.0220 | 995.35 |
| 313.00 | 0.0500 | 997.46 |
| 313.00 | 0.1000 | 1005.63 |
| 313.00 | 0.2000 | 1008.28 |
| 313.00 | 0.3000 | 1005.38 |
| 313.00 | 0.4000 | 1001.82 |
| 313.00 | 0.5000 | 1000.71 |
| 313.00 | 0.6000 | 995.0 |
| 313.00 | 0.7000 | 992.48 |
| 313.00 | 0.8000 | 988.94 |
| 313.00 | 0.9000 | 985.71 |
| 313.00 | 1.0000 | 983.26 |
| 323.00 | 0.0000 | 988.08 |
| 323.00 | 0.0220 | 989.91 |
| 323.00 | 0.0500 | 991.01 |
| 323.00 | 0.1000 | 997.84 |
| 323.00 | 0.2000 | 999.06 |
| 323.00 | 0.3000 | 995.92 |
| 323.00 | 0.4000 | 992.73 |
| 323.00 | 0.5000 | 991.3 |
| 323.00 | 0.6000 | 985.81 |
| 323.00 | 0.7000 | 983.37 |
| 323.00 | 0.8000 | 979.96 |
| 323.00 | 0.9000 | 976.89 |
| 323.00 | 1.0000 | 974.56 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 101.325 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mass fraction of Water (2) - Liquid | Speed of sound, m/s - Liquid |
| 293.15 | 0.9000 | 1555.7 |
| 303.15 | 0.9000 | 1568.9 |
| 313.15 | 0.9000 | 1576.8 |
| 323.15 | 0.9000 | 1580.3 |
| 293.15 | 0.8000 | 1620.0 |
| 303.15 | 0.8000 | 1620.0 |
| 313.15 | 0.8000 | 1616.3 |
| 323.15 | 0.8000 | 1608.9 |
| 293.15 | 0.7000 | 1671.7 |
| 303.15 | 0.7000 | 1658.9 |
| 313.15 | 0.7000 | 1644.0 |
| 323.15 | 0.7000 | 1627.1 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of 1-Ethyl-2-pyrrolidinone (1) - Liquid | Speed of sound, m/s - Liquid |
| 293.00 | 0.0000 | 1482.72 |
| 293.00 | 0.0220 | 1574.75 |
| 293.00 | 0.0500 | 1651.86 |
| 293.00 | 0.1000 | 1711.89 |
| 293.00 | 0.2000 | 1712.15 |
| 293.00 | 0.3000 | 1677.6 |
| 293.00 | 0.4000 | 1640.39 |
| 293.00 | 0.5000 | 1610.72 |
| 293.00 | 0.6000 | 1583.14 |
| 293.00 | 0.7000 | 1562.07 |
| 293.00 | 0.8000 | 1541.71 |
| 293.00 | 0.9000 | 1526.12 |
| 293.00 | 1.0000 | 1511.62 |
| 298.00 | 0.0000 | 1496.94 |
| 298.00 | 0.0220 | 1579.97 |
| 298.00 | 0.0500 | 1648.9 |
| 298.00 | 0.1000 | 1699.44 |
| 298.00 | 0.2000 | 1694.15 |
| 298.00 | 0.3000 | 1658.56 |
| 298.00 | 0.4000 | 1621.15 |
| 298.00 | 0.5000 | 1591.48 |
| 298.00 | 0.6000 | 1563.96 |
| 298.00 | 0.7000 | 1542.94 |
| 298.00 | 0.8000 | 1522.58 |
| 298.00 | 0.9000 | 1507.05 |
| 298.00 | 1.0000 | 1492.47 |
| 303.00 | 0.0000 | 1509.36 |
| 303.00 | 0.0220 | 1583.92 |
| 303.00 | 0.0500 | 1645.06 |
| 303.00 | 0.1000 | 1686.65 |
| 303.00 | 0.2000 | 1675.85 |
| 303.00 | 0.3000 | 1639.26 |
| 303.00 | 0.4000 | 1601.66 |
| 303.00 | 0.5000 | 1572.12 |
| 303.00 | 0.6000 | 1544.64 |
| 303.00 | 0.7000 | 1523.64 |
| 303.00 | 0.8000 | 1503.38 |
| 303.00 | 0.9000 | 1487.86 |
| 303.00 | 1.0000 | 1473.32 |
| 313.00 | 0.0000 | 1529.06 |
| 313.00 | 0.0220 | 1588.33 |
| 313.00 | 0.0500 | 1634.83 |
| 313.00 | 0.1000 | 1660.41 |
| 313.00 | 0.2000 | 1639.14 |
| 313.00 | 0.3000 | 1600.65 |
| 313.00 | 0.4000 | 1562.77 |
| 313.00 | 0.5000 | 1533.29 |
| 313.00 | 0.6000 | 1505.96 |
| 313.00 | 0.7000 | 1485.26 |
| 313.00 | 0.8000 | 1465.2 |
| 313.00 | 0.9000 | 1449.87 |
| 313.00 | 1.0000 | 1435.35 |
| 323.00 | 0.0000 | 1542.73 |
| 323.00 | 0.0220 | 1588.35 |
| 323.00 | 0.0500 | 1622.28 |
| 323.00 | 0.1000 | 1633.15 |
| 323.00 | 0.2000 | 1602.06 |
| 323.00 | 0.3000 | 1561.88 |
| 323.00 | 0.4000 | 1523.7 |
| 323.00 | 0.5000 | 1494.43 |
| 323.00 | 0.6000 | 1467.52 |
| 323.00 | 0.7000 | 1447.09 |
| 323.00 | 0.8000 | 1427.34 |
| 323.00 | 0.9000 | 1412.23 |
| 323.00 | 1.0000 | 1397.96 |
Surface tension liquid-gas, N/m [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of 1-Ethyl-2-pyrrolidinone (1) - Liquid | Surface tension liquid-gas, N/m - Liquid |
| 293.15 | 0.0000 | 0.0727 |
| 293.15 | 0.0002 | 0.0652 |
| 293.15 | 0.0005 | 0.0596 |
| 293.15 | 0.0010 | 0.0563 |
| 293.15 | 0.0100 | 0.0486 |
| 293.15 | 0.0200 | 0.0441 |
| 293.15 | 0.0500 | 0.0435 |
| 293.15 | 0.1000 | 0.0421 |
| 293.15 | 0.2000 | 0.0409 |
| 293.15 | 0.3000 | 0.0403 |
| 293.15 | 0.4000 | 0.0396 |
| 293.15 | 0.5000 | 0.0393 |
| 293.15 | 0.6000 | 0.0386 |
| 293.15 | 0.7000 | 0.0380 |
| 293.15 | 0.8000 | 0.0377 |
| 293.15 | 0.9000 | 0.0371 |
| 293.15 | 1.0000 | 0.0365 |
| 298.15 | 0.0000 | 0.0721 |
| 298.15 | 0.0002 | 0.0628 |
| 298.15 | 0.0005 | 0.0578 |
| 298.15 | 0.0010 | 0.0548 |
| 298.15 | 0.0100 | 0.0475 |
| 298.15 | 0.0200 | 0.0433 |
| 298.15 | 0.0500 | 0.0425 |
| 298.15 | 0.1000 | 0.0412 |
| 298.15 | 0.2000 | 0.0401 |
| 298.15 | 0.3000 | 0.0394 |
| 298.15 | 0.4000 | 0.0387 |
| 298.15 | 0.5000 | 0.0382 |
| 298.15 | 0.6000 | 0.0379 |
| 298.15 | 0.7000 | 0.0370 |
| 298.15 | 0.8000 | 0.0366 |
| 298.15 | 0.9000 | 0.0362 |
| 298.15 | 1.0000 | 0.0357 |
| 303.15 | 0.0000 | 0.0712 |
| 303.15 | 0.0002 | 0.0608 |
| 303.15 | 0.0005 | 0.0559 |
| 303.15 | 0.0010 | 0.0532 |
| 303.15 | 0.0100 | 0.0466 |
| 303.15 | 0.0200 | 0.0425 |
| 303.15 | 0.0500 | 0.0418 |
| 303.15 | 0.1000 | 0.0404 |
| 303.15 | 0.2000 | 0.0394 |
| 303.15 | 0.3000 | 0.0385 |
| 303.15 | 0.4000 | 0.0379 |
| 303.15 | 0.5000 | 0.0373 |
| 303.15 | 0.6000 | 0.0369 |
| 303.15 | 0.7000 | 0.0364 |
| 303.15 | 0.8000 | 0.0359 |
| 303.15 | 0.9000 | 0.0356 |
| 303.15 | 1.0000 | 0.0350 |
| 313.15 | 0.0000 | 0.0695 |
| 313.15 | 0.0002 | 0.0581 |
| 313.15 | 0.0005 | 0.0531 |
| 313.15 | 0.0010 | 0.0510 |
| 313.15 | 0.0100 | 0.0451 |
| 313.15 | 0.0200 | 0.0414 |
| 313.15 | 0.0500 | 0.0403 |
| 313.15 | 0.1000 | 0.0393 |
| 313.15 | 0.2000 | 0.0384 |
| 313.15 | 0.3000 | 0.0376 |
| 313.15 | 0.4000 | 0.0369 |
| 313.15 | 0.5000 | 0.0362 |
| 313.15 | 0.6000 | 0.0358 |
| 313.15 | 0.7000 | 0.0353 |
| 313.15 | 0.8000 | 0.0351 |
| 313.15 | 0.9000 | 0.0347 |
| 313.15 | 1.0000 | 0.0343 |
| 323.15 | 0.0000 | 0.0679 |
| 323.15 | 0.0002 | 0.0534 |
| 323.15 | 0.0005 | 0.0501 |
| 323.15 | 0.0010 | 0.0490 |
| 323.15 | 0.0100 | 0.0438 |
| 323.15 | 0.0200 | 0.0402 |
| 323.15 | 0.0500 | 0.0393 |
| 323.15 | 0.1000 | 0.0383 |
| 323.15 | 0.2000 | 0.0372 |
| 323.15 | 0.3000 | 0.0365 |
| 323.15 | 0.4000 | 0.0357 |
| 323.15 | 0.5000 | 0.0353 |
| 323.15 | 0.6000 | 0.0349 |
| 323.15 | 0.7000 | 0.0347 |
| 323.15 | 0.8000 | 0.0343 |
| 323.15 | 0.9000 | 0.0340 |
| 323.15 | 1.0000 | 0.0336 |
Sources
- Density, Speed of Sound, and Viscosity of Monoethanolamine + Water + N-Ethyl-2-pyrrolidone from T = (293.15 to 323.15) K
- Surface Tension of Aqueous Solutions of Short N-Alkyl-2-pyrrolidinones
- Influence of Temperature and Composition upon Density, Viscosity, Speed of Sound, and Refractive Index of Aqueous Solutions of 1-Ethyl-2-pyrrolidinone
Note: These property values are available through the Cheméo API. A free account gives you an access key.