- Name
- DL-Norvaline
- InChI
- InChI=1S/C5H11NO2/c1-2-3-4(6)5(7)8/h4H,2-3,6H2,1H3,(H,7,8)
- InChI Key
- SNDPXSYFESPGGJ-UHFFFAOYSA-N
- Formula
- C5H11NO2
- SMILES
- CCCC(N)C(=O)O
- Mol. Weight (g/mol)
- 117.15
- CAS
- 760-78-1
- Name
- Water
- InChI
- InChI=1S/H2O/h1H2
- InChI Key
- XLYOFNOQVPJJNP-UHFFFAOYSA-N
- Formula
- H2O
- SMILES
- O
- Mol. Weight (g/mol)
- 18.02
- CAS
- 7732-18-5
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of DL-Norvaline (1) - Liquid | Mass density, kg/m3 - Liquid |
| 288.15 | 0.0000 | 999.107 |
| 288.15 | 0.0450 | 1000.312 |
| 288.15 | 0.0600 | 1000.711 |
| 288.15 | 0.0800 | 1001.24 |
| 288.15 | 0.0950 | 1001.635 |
| 288.15 | 0.1100 | 1002.029 |
| 288.15 | 0.1250 | 1002.42 |
| 288.15 | 0.1400 | 1002.811 |
| 288.15 | 0.1550 | 1003.201 |
| 288.15 | 0.1700 | 1003.587 |
| 288.15 | 0.1850 | 1003.975 |
| 288.15 | 0.2000 | 1004.361 |
| 298.15 | 0.0000 | 997.049 |
| 298.15 | 0.0450 | 998.222 |
| 298.15 | 0.0600 | 998.611 |
| 298.15 | 0.0800 | 999.126 |
| 298.15 | 0.0950 | 999.511 |
| 298.15 | 0.1100 | 999.895 |
| 298.15 | 0.1250 | 1000.277 |
| 298.15 | 0.1400 | 1000.658 |
| 298.15 | 0.1550 | 1001.038 |
| 298.15 | 0.1700 | 1001.416 |
| 298.15 | 0.1850 | 1001.792 |
| 298.15 | 0.2000 | 1002.166 |
| 308.15 | 0.0000 | 994.033 |
| 308.15 | 0.0450 | 995.183 |
| 308.15 | 0.0600 | 995.564 |
| 308.15 | 0.0800 | 996.069 |
| 308.15 | 0.0950 | 996.447 |
| 308.15 | 0.1100 | 996.823 |
| 308.15 | 0.1250 | 997.197 |
| 308.15 | 0.1400 | 997.57 |
| 308.15 | 0.1550 | 997.943 |
| 308.15 | 0.1700 | 998.314 |
| 308.15 | 0.1850 | 998.684 |
| 308.15 | 0.2000 | 999.053 |
| 318.15 | 0.0000 | 990.214 |
| 318.15 | 0.0450 | 991.346 |
| 318.15 | 0.0600 | 991.721 |
| 318.15 | 0.0800 | 992.218 |
| 318.15 | 0.0950 | 992.59 |
| 318.15 | 0.1100 | 992.961 |
| 318.15 | 0.1250 | 993.329 |
| 318.15 | 0.1400 | 993.697 |
| 318.15 | 0.1550 | 994.064 |
| 318.15 | 0.1700 | 994.429 |
| 318.15 | 0.1850 | 994.793 |
| 318.15 | 0.2000 | 995.156 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of DL-Norvaline (1) - Liquid | Speed of sound, m/s - Liquid |
| 288.15 | 0.0000 | 1466.4 |
| 288.15 | 0.0450 | 1471.32 |
| 288.15 | 0.0600 | 1472.95 |
| 288.15 | 0.0800 | 1475.11 |
| 288.15 | 0.0950 | 1476.69 |
| 288.15 | 0.1100 | 1478.31 |
| 288.15 | 0.1250 | 1479.87 |
| 288.15 | 0.1400 | 1481.49 |
| 288.15 | 0.1550 | 1483.08 |
| 288.15 | 0.1700 | 1484.6 |
| 288.15 | 0.1850 | 1486.2 |
| 288.15 | 0.2000 | 1487.78 |
| 298.15 | 0.0000 | 1496.79 |
| 298.15 | 0.0450 | 1501.21 |
| 298.15 | 0.0600 | 1502.68 |
| 298.15 | 0.0800 | 1504.62 |
| 298.15 | 0.0950 | 1506.06 |
| 298.15 | 0.1100 | 1507.51 |
| 298.15 | 0.1250 | 1508.97 |
| 298.15 | 0.1400 | 1510.42 |
| 298.15 | 0.1550 | 1511.86 |
| 298.15 | 0.1700 | 1513.3 |
| 298.15 | 0.1850 | 1514.7 |
| 298.15 | 0.2000 | 1516.06 |
| 308.15 | 0.0000 | 1519.75 |
| 308.15 | 0.0450 | 1523.8 |
| 308.15 | 0.0600 | 1525.13 |
| 308.15 | 0.0800 | 1526.91 |
| 308.15 | 0.0950 | 1528.25 |
| 308.15 | 0.1100 | 1529.56 |
| 308.15 | 0.1250 | 1530.88 |
| 308.15 | 0.1400 | 1532.2 |
| 308.15 | 0.1550 | 1533.52 |
| 308.15 | 0.1700 | 1534.85 |
| 308.15 | 0.1850 | 1536.17 |
| 308.15 | 0.2000 | 1537.49 |
| 318.15 | 0.0000 | 1536.29 |
| 318.15 | 0.0450 | 1539.96 |
| 318.15 | 0.0600 | 1541.17 |
| 318.15 | 0.0800 | 1542.78 |
| 318.15 | 0.0950 | 1543.99 |
| 318.15 | 0.1100 | 1545.21 |
| 318.15 | 0.1250 | 1546.41 |
| 318.15 | 0.1400 | 1547.61 |
| 318.15 | 0.1550 | 1548.81 |
| 318.15 | 0.1700 | 1550.02 |
| 318.15 | 0.1850 | 1551.21 |
| 318.15 | 0.2000 | 1552.43 |
Surface tension liquid-gas, N/m [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of DL-Norvaline (1) - Liquid | Surface tension liquid-gas, N/m - Liquid |
| 293.15 | 0.0000 | 0.0726 |
| 293.15 | 0.0002 | 0.0726 |
| 293.15 | 0.0003 | 0.0725 |
| 293.15 | 0.0006 | 0.0724 |
| 293.15 | 0.0010 | 0.0724 |
| 293.15 | 0.0014 | 0.0723 |
| 293.15 | 0.0017 | 0.0722 |
| 293.15 | 0.0021 | 0.0722 |
| 293.15 | 0.0026 | 0.0721 |
| 298.15 | 0.0000 | 0.0717 |
| 298.15 | 0.0002 | 0.0718 |
| 298.15 | 0.0003 | 0.0718 |
| 298.15 | 0.0006 | 0.0717 |
| 298.15 | 0.0010 | 0.0716 |
| 298.15 | 0.0014 | 0.0715 |
| 298.15 | 0.0017 | 0.0715 |
| 298.15 | 0.0021 | 0.0714 |
| 298.15 | 0.0026 | 0.0712 |
| 303.15 | 0.0000 | 0.0712 |
| 303.15 | 0.0002 | 0.0712 |
| 303.15 | 0.0003 | 0.0711 |
| 303.15 | 0.0006 | 0.0710 |
| 303.15 | 0.0010 | 0.0709 |
| 303.15 | 0.0014 | 0.0708 |
| 303.15 | 0.0017 | 0.0707 |
| 303.15 | 0.0021 | 0.0707 |
| 303.15 | 0.0026 | 0.0705 |
| 308.15 | 0.0000 | 0.0704 |
| 308.15 | 0.0002 | 0.0703 |
| 308.15 | 0.0003 | 0.0703 |
| 308.15 | 0.0006 | 0.0702 |
| 308.15 | 0.0010 | 0.0701 |
| 308.15 | 0.0014 | 0.0700 |
| 308.15 | 0.0017 | 0.0698 |
| 308.15 | 0.0021 | 0.0698 |
| 308.15 | 0.0026 | 0.0696 |
| 313.15 | 0.0000 | 0.0695 |
| 313.15 | 0.0002 | 0.0694 |
| 313.15 | 0.0003 | 0.0693 |
| 313.15 | 0.0006 | 0.0692 |
| 313.15 | 0.0010 | 0.0691 |
| 313.15 | 0.0014 | 0.0690 |
| 313.15 | 0.0017 | 0.0689 |
| 313.15 | 0.0021 | 0.0688 |
| 313.15 | 0.0026 | 0.0686 |
Sources
- Surface Tension of Glycine, Alanine, Aminobutyric Acid, Norvaline, and Norleucine in Water and in Aqueous Solutions of Strong Electrolytes at Temperatures from (293.15 to 313.15) K
- Excess Volume of Water in Hydrate Complexes of Some alpha-Amino Acids
Note: These property values are available through the Cheméo API. A free account gives you an access key.