- Name
- Carbon dioxide
- InChI
- InChI=1S/CO2/c2-1-3
- InChI Key
- CURLTUGMZLYLDI-UHFFFAOYSA-N
- Formula
- CO2
- SMILES
- O=C=O
- Mol. Weight (g/mol)
- 44.01
- CAS
- 124-38-9
- Name
- Pentanoic acid, 4-oxo-, butyl ester
- InChI
- InChI=1S/C9H16O3/c1-3-4-7-12-9(11)6-5-8(2)10/h3-7H2,1-2H3
- InChI Key
- ISBWNEKJSSLXOD-UHFFFAOYSA-N
- Formula
- C9H16O3
- SMILES
- CCCCOC(=O)CCC(C)=O
- Mol. Weight (g/mol)
- 172.22
- CAS
- 2052-15-5
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Molality, mol/kg of Carbon dioxide (1) [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Pressure, kPa - Liquid | Molality, mol/kg of Carbon dioxide (1) - Liquid |
| 283.15 | 39.00 | 0.0738 |
| 283.15 | 90.00 | 0.1683 |
| 283.15 | 156.80 | 0.2938 |
| 283.15 | 242.00 | 0.4671 |
| 283.15 | 350.20 | 0.6708 |
| 283.15 | 426.80 | 0.8234 |
| 283.15 | 472.80 | 0.9224 |
| 283.15 | 539.70 | 1.055 |
| 293.15 | 40.60 | 0.0631 |
| 293.15 | 83.10 | 0.1312 |
| 293.15 | 143.70 | 0.2279 |
| 293.15 | 212.30 | 0.3398 |
| 293.15 | 334.50 | 0.5461 |
| 293.15 | 434.20 | 0.7187 |
| 293.15 | 494.20 | 0.8234 |
| 293.15 | 542.20 | 0.9047 |
| 303.15 | 62.30 | 0.0803 |
| 303.15 | 134.00 | 0.1729 |
| 303.15 | 197.60 | 0.2554 |
| 303.15 | 309.20 | 0.3955 |
| 303.15 | 401.20 | 0.5287 |
| 303.15 | 500.50 | 0.6502 |
| 303.15 | 555.70 | 0.7550 |
| 313.15 | 53.60 | 0.0578 |
| 313.15 | 110.00 | 0.1194 |
| 313.15 | 188.10 | 0.2093 |
| 313.15 | 275.80 | 0.3045 |
| 313.15 | 363.10 | 0.3980 |
| 313.15 | 431.00 | 0.4890 |
| 313.15 | 497.50 | 0.5539 |
| 313.15 | 521.00 | 0.5936 |
| 323.15 | 56.30 | 0.0515 |
| 323.15 | 114.60 | 0.1042 |
| 323.15 | 190.20 | 0.1741 |
| 323.15 | 302.00 | 0.2770 |
| 323.15 | 390.60 | 0.3563 |
| 323.15 | 453.80 | 0.4147 |
| 323.15 | 533.80 | 0.4915 |
Sources
Note: These property values are available through the Cheméo API. A free account gives you an access key.