- Name
- Aniline, N-methyl-
- InChI
- InChI=1S/C7H9N/c1-8-7-5-3-2-4-6-7/h2-6,8H,1H3
- InChI Key
- AFBPFSWMIHJQDM-UHFFFAOYSA-N
- Formula
- C7H9N
- SMILES
- CNc1ccccc1
- Mol. Weight (g/mol)
- 107.15
- CAS
- 100-61-8
- Name
- Acetone
- InChI
- InChI=1S/C3H6O/c1-3(2)4/h1-2H3
- InChI Key
- CSCPPACGZOOCGX-UHFFFAOYSA-N
- Formula
- C3H6O
- SMILES
- CC(C)=O
- Mol. Weight (g/mol)
- 58.08
- CAS
- 67-64-1
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Excess molar enthalpy (molar enthalpy of mixing), kJ/mol [ref]
Operational conditions:
- Temperature, K = 298.15 (Liquid)
- Pressure, kPa = 101 (Liquid)
| Mole fraction of Acetone (2) - Liquid | Excess molar enthalpy (molar enthalpy of mixing), kJ/mol - Liquid |
|---|---|
| 0.1286 | -0.3350 |
| 0.2316 | -0.5000 |
| 0.3191 | -0.5980 |
| 0.4089 | -0.6660 |
| 0.5086 | -0.6720 |
| 0.6075 | -0.6220 |
| 0.7097 | -0.5250 |
| 0.8055 | -0.3810 |
| 0.9012 | -0.2040 |
Excess molar enthalpy (molar enthalpy of mixing), kJ/mol [ref]
Operational conditions:
- Temperature, K = 298.15 (Liquid)
- Pressure, kPa = 101 (Liquid)
| Mole fraction of Acetone (2) - Liquid | Excess molar enthalpy (molar enthalpy of mixing), kJ/mol - Liquid |
|---|---|
| 0.1286 | -0.3350 |
| 0.2316 | -0.5000 |
| 0.3191 | -0.5980 |
| 0.4089 | -0.6660 |
| 0.5086 | -0.6720 |
| 0.6075 | -0.6220 |
| 0.7097 | -0.5250 |
| 0.8055 | -0.3810 |
| 0.9012 | -0.2040 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Acetone (2) - Liquid | Mass density, kg/m3 - Liquid |
| 293.15 | 0.0565 | 979.562 |
| 293.15 | 0.1032 | 973.934 |
| 293.15 | 0.1494 | 968.145 |
| 293.15 | 0.1916 | 962.605 |
| 293.15 | 0.2510 | 954.413 |
| 293.15 | 0.2952 | 948.053 |
| 293.15 | 0.3555 | 938.912 |
| 293.15 | 0.4039 | 931.04 |
| 293.15 | 0.4478 | 923.576 |
| 293.15 | 0.4981 | 914.659 |
| 293.15 | 0.5489 | 905.091 |
| 293.15 | 0.5965 | 895.722 |
| 293.15 | 0.6485 | 884.852 |
| 293.15 | 0.7018 | 873.046 |
| 293.15 | 0.7472 | 862.27 |
| 293.15 | 0.8020 | 848.69 |
| 293.15 | 0.8563 | 834.277 |
| 293.15 | 0.9053 | 820.343 |
| 293.15 | 0.9548 | 805.391 |
| 298.15 | 0.0440 | 977.005 |
| 298.15 | 0.0984 | 970.455 |
| 298.15 | 0.1447 | 964.607 |
| 298.15 | 0.1996 | 957.353 |
| 298.15 | 0.2503 | 950.29 |
| 298.15 | 0.2919 | 944.327 |
| 298.15 | 0.3511 | 935.283 |
| 298.15 | 0.3924 | 928.532 |
| 298.15 | 0.4520 | 918.415 |
| 298.15 | 0.4948 | 910.794 |
| 298.15 | 0.5563 | 899.086 |
| 298.15 | 0.6004 | 890.231 |
| 298.15 | 0.6473 | 880.387 |
| 298.15 | 0.6962 | 869.434 |
| 298.15 | 0.7506 | 856.501 |
| 298.15 | 0.8009 | 843.758 |
| 298.15 | 0.8518 | 830.205 |
| 298.15 | 0.8986 | 816.915 |
| 298.15 | 0.9488 | 801.799 |
| 303.15 | 0.0461 | 972.638 |
| 303.15 | 0.0934 | 966.889 |
| 303.15 | 0.1524 | 959.343 |
| 303.15 | 0.1937 | 953.815 |
| 303.15 | 0.2442 | 946.596 |
| 303.15 | 0.3357 | 933.026 |
| 303.15 | 0.3991 | 922.737 |
| 303.15 | 0.4904 | 906.677 |
| 303.15 | 0.5507 | 895.228 |
| 303.15 | 0.5949 | 886.274 |
| 303.15 | 0.6467 | 875.21 |
| 303.15 | 0.6928 | 864.807 |
| 303.15 | 0.7424 | 852.961 |
| 303.15 | 0.7993 | 838.524 |
| 303.15 | 0.8469 | 825.646 |
| 303.15 | 0.8977 | 811.117 |
| 303.15 | 0.9484 | 795.598 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Acetone (2) - Liquid | Mass density, kg/m3 - Liquid |
| 293.15 | 0.0565 | 979.562 |
| 293.15 | 0.1032 | 973.934 |
| 293.15 | 0.1494 | 968.145 |
| 293.15 | 0.1916 | 962.605 |
| 293.15 | 0.2510 | 954.413 |
| 293.15 | 0.2952 | 948.053 |
| 293.15 | 0.3555 | 938.912 |
| 293.15 | 0.4039 | 931.04 |
| 293.15 | 0.4478 | 923.576 |
| 293.15 | 0.4981 | 914.659 |
| 293.15 | 0.5489 | 905.091 |
| 293.15 | 0.5965 | 895.722 |
| 293.15 | 0.6485 | 884.852 |
| 293.15 | 0.7018 | 873.046 |
| 293.15 | 0.7472 | 862.27 |
| 293.15 | 0.8020 | 848.69 |
| 293.15 | 0.8563 | 834.277 |
| 293.15 | 0.9053 | 820.343 |
| 293.15 | 0.9548 | 805.391 |
| 298.15 | 0.0440 | 977.005 |
| 298.15 | 0.0984 | 970.455 |
| 298.15 | 0.1447 | 964.607 |
| 298.15 | 0.1996 | 957.353 |
| 298.15 | 0.2503 | 950.29 |
| 298.15 | 0.2919 | 944.327 |
| 298.15 | 0.3511 | 935.283 |
| 298.15 | 0.3924 | 928.532 |
| 298.15 | 0.4520 | 918.415 |
| 298.15 | 0.4948 | 910.794 |
| 298.15 | 0.5563 | 899.086 |
| 298.15 | 0.6004 | 890.231 |
| 298.15 | 0.6473 | 880.387 |
| 298.15 | 0.6962 | 869.434 |
| 298.15 | 0.7506 | 856.501 |
| 298.15 | 0.8009 | 843.758 |
| 298.15 | 0.8518 | 830.205 |
| 298.15 | 0.8986 | 816.915 |
| 298.15 | 0.9488 | 801.799 |
| 303.15 | 0.0461 | 972.638 |
| 303.15 | 0.0934 | 966.889 |
| 303.15 | 0.1524 | 959.343 |
| 303.15 | 0.1937 | 953.815 |
| 303.15 | 0.2442 | 946.596 |
| 303.15 | 0.3357 | 933.026 |
| 303.15 | 0.3991 | 922.737 |
| 303.15 | 0.4904 | 906.677 |
| 303.15 | 0.5507 | 895.228 |
| 303.15 | 0.5949 | 886.274 |
| 303.15 | 0.6467 | 875.21 |
| 303.15 | 0.6928 | 864.807 |
| 303.15 | 0.7424 | 852.961 |
| 303.15 | 0.7993 | 838.524 |
| 303.15 | 0.8469 | 825.646 |
| 303.15 | 0.8977 | 811.117 |
| 303.15 | 0.9484 | 795.598 |
Sources
- Thermodynamics of Ketone + Amine Mixtures. Part VIII. Molar Excess Enthalpies at 298.15 K for n-Alkanone + Aniline or + N-Methylaniline Systems
- Thermodynamics of Ketone + Amine Mixtures. I. Volumetric and Speed of Sound Data at (293.15, 298.15, and 303.15) K for 2-Propanone + Aniline, + N-Methylaniline, or + Pyridine Systems
Note: These property values are available through the Cheméo API. A free account gives you an access key.