- Name
- Benzene, 1-methyl-2-nitro-
- InChI
- InChI=1S/C7H7NO2/c1-6-4-2-3-5-7(6)8(9)10/h2-5H,1H3
- InChI Key
- PLAZTCDQAHEYBI-UHFFFAOYSA-N
- Formula
- C7H7NO2
- SMILES
- Cc1ccccc1[N+](=O)[O-]
- Mol. Weight (g/mol)
- 137.14
- CAS
- 88-72-2
- Name
- Water
- InChI
- InChI=1S/H2O/h1H2
- InChI Key
- XLYOFNOQVPJJNP-UHFFFAOYSA-N
- Formula
- H2O
- SMILES
- O
- Mol. Weight (g/mol)
- 18.02
- CAS
- 7732-18-5
Datasets
Mass concentration, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Temperature, K - Liquid | Mass concentration, kg/m3 - Liquid |
|---|---|
| 277.80 | 0.4870 |
| 287.20 | 0.5510 |
| 294.20 | 0.5750 |
| 297.00 | 0.4250 |
| 303.80 | 0.6610 |
| 308.50 | 0.7210 |
| 313.40 | 0.7570 |
Mass fraction of Benzene, 1-methyl-2-nitro- (1) [ref]
Operational condition: Pressure, kPa = 2500 (Liquid mixture 1)
| Temperature, K - Liquid mixture 1 | Mass fraction of Benzene, 1-methyl-2-nitro- (1) - Liquid mixture 2 |
|---|---|
| 383.15 | 0.0026 |
| 393.15 | 0.0031 |
| 403.15 | 0.0041 |
| 413.15 | 0.0051 |
| 423.15 | 0.0065 |
| 433.15 | 0.0087 |
| 443.15 | 0.0116 |
| 453.15 | 0.0155 |
| 463.15 | 0.0210 |
| 473.15 | 0.0280 |
| 483.15 | 0.0367 |
Mass fraction of Water (2) [ref]
Operational condition: Pressure, kPa = 2500 (Liquid mixture 1)
| Temperature, K - Liquid mixture 1 | Mass fraction of Water (2) - Liquid mixture 1 |
|---|---|
| 383.15 | 0.0074 |
| 393.15 | 0.0095 |
| 403.15 | 0.0112 |
| 413.15 | 0.0132 |
| 423.15 | 0.0156 |
| 433.15 | 0.0187 |
| 443.15 | 0.0224 |
| 453.15 | 0.0275 |
| 463.15 | 0.0337 |
| 473.15 | 0.0412 |
| 483.15 | 0.0513 |
Mass concentration, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Temperature, K - Liquid | Mass concentration, kg/m3 - Liquid |
|---|---|
| 277.80 | 0.4870 |
| 287.20 | 0.5510 |
| 294.20 | 0.5750 |
| 297.00 | 0.4250 |
| 303.80 | 0.6610 |
| 308.50 | 0.7210 |
| 313.40 | 0.7570 |
Mass fraction of Benzene, 1-methyl-2-nitro- (1) [ref]
Operational condition: Pressure, kPa = 2500 (Liquid mixture 1)
| Temperature, K - Liquid mixture 1 | Mass fraction of Benzene, 1-methyl-2-nitro- (1) - Liquid mixture 2 |
|---|---|
| 383.15 | 0.0026 |
| 393.15 | 0.0031 |
| 403.15 | 0.0041 |
| 413.15 | 0.0051 |
| 423.15 | 0.0065 |
| 433.15 | 0.0087 |
| 443.15 | 0.0116 |
| 453.15 | 0.0155 |
| 463.15 | 0.0210 |
| 473.15 | 0.0280 |
| 483.15 | 0.0367 |
Mass fraction of Water (2) [ref]
Operational condition: Pressure, kPa = 2500 (Liquid mixture 1)
| Temperature, K - Liquid mixture 1 | Mass fraction of Water (2) - Liquid mixture 1 |
|---|---|
| 383.15 | 0.0074 |
| 393.15 | 0.0095 |
| 403.15 | 0.0112 |
| 413.15 | 0.0132 |
| 423.15 | 0.0156 |
| 433.15 | 0.0187 |
| 443.15 | 0.0224 |
| 453.15 | 0.0275 |
| 463.15 | 0.0337 |
| 473.15 | 0.0412 |
| 483.15 | 0.0513 |
Sources
- Mutual Solubilities for Water-o-Nitrotoluene System and Distribution Coefficients for Furfural and Acetic Acid in Water-o-Nitrotoluene System
- Assessing the Salting-Out Behavior of Nitrobenzene, 2-Nitrotoluene, and 3-Nitrotoluene from Solubility Values in Pure Water and Seawater at Temperatures between (277 and 314) K
Note: These property values are available through the Cheméo API. A free account gives you an access key.