- Name
- Carbon dioxide
- InChI
- InChI=1S/CO2/c2-1-3
- InChI Key
- CURLTUGMZLYLDI-UHFFFAOYSA-N
- Formula
- CO2
- SMILES
- O=C=O
- Mol. Weight (g/mol)
- 44.01
- CAS
- 124-38-9
- Name
- n-Hexadecanoic acid
- InChI
- InChI=1S/C16H32O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18/h2-15H2,1H3,(H,17,18)
- InChI Key
- IPCSVZSSVZVIGE-UHFFFAOYSA-N
- Formula
- C16H32O2
- SMILES
- CCCCCCCCCCCCCCCC(=O)O
- Mol. Weight (g/mol)
- 256.42
- CAS
- 57-10-3
- Name
- Capsaicin
- InChI
- InChI=1S/C18H27NO3/c1-14(2)8-6-4-5-7-9-18(21)19-13-15-10-11-16(20)17(12-15)22-3/h6,8,10-12,14,20H,4-5,7,9,13H2,1-3H3,(H,19,21)/b8-6+
- InChI Key
- YKPUWZUDDOIDPM-SOFGYWHQSA-N
- Formula
- C18H27NO3
- SMILES
-
COc1cc(CN=C(O)CCCCC=CC(C)C)ccc
1O - Mol. Weight (g/mol)
- 305.41
- CAS
- 404-86-4
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Mole fraction of n-Hexadecanoic acid (2) [ref]
Operational condition: Temperature, K = 308.15 (Fluid (supercritical or subcritical phases))
| Pressure, kPa - Fluid (supercritical or subcritical phases) | Mole fraction of n-Hexadecanoic acid (2) - Fluid (supercritical or subcritical phases) |
|---|---|
| 10270.00 | 0.0002 |
| 12190.00 | 0.0003 |
| 14290.00 | 0.0004 |
| 16340.00 | 0.0004 |
| 18130.00 | 0.0005 |
| 20150.00 | 0.0005 |
| 22230.00 | 0.0006 |
| 24370.00 | 0.0006 |
| 26370.00 | 0.0006 |
| 28400.00 | 0.0007 |
| 30220.00 | 0.0007 |
| 32410.00 | 0.0008 |
| 35030.00 | 0.0008 |
Mole fraction of Capsaicin (3) [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Fluid (supercritical or subcritical phases) | Pressure, kPa - Fluid (supercritical or subcritical phases) | Mole fraction of Capsaicin (3) - Fluid (supercritical or subcritical phases) |
| 308.15 | 10270.00 | 0.0000 |
| 308.15 | 12190.00 | 0.0000 |
| 308.15 | 14290.00 | 0.0000 |
| 308.15 | 16340.00 | 0.0001 |
| 308.15 | 18130.00 | 0.0001 |
| 308.15 | 20150.00 | 0.0001 |
| 308.15 | 22230.00 | 0.0001 |
| 308.15 | 24370.00 | 0.0001 |
| 308.15 | 26370.00 | 0.0001 |
| 308.15 | 28400.00 | 0.0001 |
| 308.15 | 30220.00 | 0.0001 |
| 308.15 | 32410.00 | 0.0001 |
| 308.15 | 35030.00 | 0.0001 |
| 328.15 | 10350.00 | 0.0001 |
| 328.15 | 12310.00 | 0.0001 |
| 328.15 | 14310.00 | 0.0002 |
| 328.15 | 16370.00 | 0.0002 |
| 328.15 | 18140.00 | 0.0003 |
| 328.15 | 20270.00 | 0.0003 |
| 328.15 | 22180.00 | 0.0003 |
| 328.15 | 24380.00 | 0.0004 |
| 328.15 | 26400.00 | 0.0004 |
| 328.15 | 28180.00 | 0.0005 |
| 328.15 | 30400.00 | 0.0005 |
| 328.15 | 32390.00 | 0.0005 |
| 328.15 | 35260.00 | 0.0005 |
Mole fraction of n-Hexadecanoic acid (2) [ref]
Operational conditions:
- Temperature, K = 328.15 (Fluid (supercritical or subcritical phases))
- Solvent: Mole fraction = 0.5 (Liquid)
| Pressure, kPa - Fluid (supercritical or subcritical phases) | Mole fraction of n-Hexadecanoic acid (2) - Fluid (supercritical or subcritical phases) |
|---|---|
| 10350.00 | 0.0004 |
| 12310.00 | 0.0005 |
| 14310.00 | 0.0009 |
| 16370.00 | 0.0010 |
| 18140.00 | 0.0015 |
| 20270.00 | 0.0028 |
| 22180.00 | 0.0048 |
| 24380.00 | 0.0073 |
| 26400.00 | 0.0087 |
| 28180.00 | 0.0099 |
| 30400.00 | 0.0116 |
| 32390.00 | 0.0130 |
| 35260.00 | 0.0154 |
Mole fraction of Capsaicin (3) [ref]
Operational conditions:
- Temperature, K = 328.15 (Fluid (supercritical or subcritical phases))
- Solvent: Mole fraction = 0.5 (Liquid)
| Pressure, kPa - Fluid (supercritical or subcritical phases) | Mole fraction of Capsaicin (3) - Fluid (supercritical or subcritical phases) |
|---|---|
| 10350.00 | 0.0001 |
| 12310.00 | 0.0001 |
| 14310.00 | 0.0002 |
| 16370.00 | 0.0002 |
| 18140.00 | 0.0003 |
| 20270.00 | 0.0003 |
| 22180.00 | 0.0003 |
| 24380.00 | 0.0004 |
| 26400.00 | 0.0004 |
| 28180.00 | 0.0005 |
| 30400.00 | 0.0005 |
| 32390.00 | 0.0005 |
| 35260.00 | 0.0005 |
Sources
Note: These property values are available through the Cheméo API. A free account gives you an access key.