- Name
- Tetra-N-butylammonium bromide
- InChI
- InChI=1S/C16H36N.BrH/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;/h5-16H2,1-4H3;1H/q+1;/p-1
- InChI Key
- JRMUNVKIHCOMHV-UHFFFAOYSA-M
- Formula
- C16H36BrN
- SMILES
- CCCC[N+](CCCC)(CCCC)CCCC.[Br-]
- Mol. Weight (g/mol)
- 322.37
- CAS
- 1643-19-2
- Name
- Water
- InChI
- InChI=1S/H2O/h1H2
- InChI Key
- XLYOFNOQVPJJNP-UHFFFAOYSA-N
- Formula
- H2O
- SMILES
- O
- Mol. Weight (g/mol)
- 18.02
- CAS
- 7732-18-5
- Name
- Potassium phosphate, tribasic
- InChI
- InChI=1S/3K.H3O4P/c;;;1-5(2,3)4/h;;;(H3,1,2,3,4)/q3*+1;/p-3
- InChI Key
- LWIHDJKSTIGBAC-UHFFFAOYSA-K
- Formula
- K3O4P
- SMILES
- O=P([O][K])([O][K])[O][K]
- Mol. Weight (g/mol)
- 212.27
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Mass fraction of Tetra-N-butylammonium bromide (1) [ref]
Operational condition: Pressure, kPa = 100 (Liquid mixture 1)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid mixture 1 | Mass fraction of Potassium phosphate, tribasic (3) - Liquid mixture 1 | Mass fraction of Tetra-N-butylammonium bromide (1) - Liquid mixture 1 |
| 298.15 | 0.0095 | 0.5389 |
| 298.15 | 0.0138 | 0.4898 |
| 298.15 | 0.0172 | 0.4702 |
| 298.15 | 0.0207 | 0.4478 |
| 298.15 | 0.0290 | 0.3967 |
| 298.15 | 0.0364 | 0.3617 |
| 298.15 | 0.0433 | 0.3394 |
| 298.15 | 0.0493 | 0.3198 |
| 298.15 | 0.0546 | 0.3019 |
| 298.15 | 0.0646 | 0.2749 |
| 298.15 | 0.0689 | 0.2630 |
| 298.15 | 0.0765 | 0.2422 |
| 298.15 | 0.0834 | 0.2259 |
| 298.15 | 0.0915 | 0.2078 |
| 298.15 | 0.1003 | 0.1893 |
| 298.15 | 0.1084 | 0.1722 |
| 298.15 | 0.1159 | 0.1573 |
| 298.15 | 0.1278 | 0.1341 |
| 298.15 | 0.1369 | 0.1200 |
| 298.15 | 0.1498 | 0.0987 |
| 298.15 | 0.1627 | 0.0910 |
| 298.15 | 0.1680 | 0.0812 |
| 298.15 | 0.1755 | 0.0719 |
| 298.15 | 0.1829 | 0.0570 |
| 298.15 | 0.1932 | 0.0468 |
| 298.15 | 0.1996 | 0.0409 |
| 298.15 | 0.2048 | 0.0372 |
| 298.15 | 0.2117 | 0.0314 |
| 298.15 | 0.2221 | 0.0254 |
| 298.15 | 0.2282 | 0.0199 |
| 298.15 | 0.2329 | 0.0179 |
| 298.15 | 0.2369 | 0.0162 |
| 308.15 | 0.0122 | 0.5254 |
| 308.15 | 0.0157 | 0.4955 |
| 308.15 | 0.0190 | 0.4712 |
| 308.15 | 0.0213 | 0.4495 |
| 308.15 | 0.0289 | 0.4081 |
| 308.15 | 0.0355 | 0.3779 |
| 308.15 | 0.0421 | 0.3537 |
| 308.15 | 0.0528 | 0.3178 |
| 308.15 | 0.0619 | 0.2909 |
| 308.15 | 0.0693 | 0.2681 |
| 308.15 | 0.0787 | 0.2412 |
| 308.15 | 0.0867 | 0.2199 |
| 308.15 | 0.0934 | 0.2024 |
| 308.15 | 0.1022 | 0.1839 |
| 308.15 | 0.1095 | 0.1683 |
| 308.15 | 0.1175 | 0.1509 |
| 308.15 | 0.1253 | 0.1366 |
| 308.15 | 0.1315 | 0.1248 |
| 308.15 | 0.1383 | 0.1116 |
| 308.15 | 0.1445 | 0.1013 |
| 308.15 | 0.1503 | 0.0934 |
| 308.15 | 0.1564 | 0.0849 |
| 308.15 | 0.1625 | 0.0767 |
| 308.15 | 0.1689 | 0.0691 |
| 318.15 | 0.0059 | 0.5479 |
| 318.15 | 0.0087 | 0.5100 |
| 318.15 | 0.0178 | 0.4429 |
| 318.15 | 0.0270 | 0.4001 |
| 318.15 | 0.0337 | 0.3682 |
| 318.15 | 0.0394 | 0.3456 |
| 318.15 | 0.0449 | 0.3284 |
| 318.15 | 0.0489 | 0.3098 |
| 318.15 | 0.0570 | 0.2789 |
| 318.15 | 0.0651 | 0.2584 |
| 318.15 | 0.0708 | 0.2389 |
| 318.15 | 0.0761 | 0.2233 |
| 318.15 | 0.0804 | 0.2085 |
| 318.15 | 0.0875 | 0.1916 |
| 318.15 | 0.0935 | 0.1776 |
| 318.15 | 0.1002 | 0.1615 |
| 318.15 | 0.1073 | 0.1456 |
| 318.15 | 0.1138 | 0.1329 |
| 318.15 | 0.1191 | 0.1223 |
| 318.15 | 0.1247 | 0.1096 |
| 318.15 | 0.1317 | 0.0992 |
| 318.15 | 0.1415 | 0.0850 |
| 318.15 | 0.1495 | 0.0747 |
| 318.15 | 0.1577 | 0.0647 |
| 318.15 | 0.1679 | 0.0532 |
Sources
Note: These property values are available through the Cheméo API. A free account gives you an access key.