- Name
- 2(3H)-Furanone, dihydro-5-methyl-
- InChI
- InChI=1S/C5H8O2/c1-4-2-3-5(6)7-4/h4H,2-3H2,1H3
- InChI Key
- GAEKPEKOJKCEMS-UHFFFAOYSA-N
- Formula
- C5H8O2
- SMILES
- CC1CCC(=O)O1
- Mol. Weight (g/mol)
- 100.12
- CAS
- 108-29-2
- Name
- Sulfur dioxide
- InChI
- InChI=1S/O2S/c1-3-2
- InChI Key
- RAHZWNYVWXNFOC-UHFFFAOYSA-N
- Formula
- O2S
- SMILES
- O=S=O
- Mol. Weight (g/mol)
- 64.06
- CAS
- 7446-09-5
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Molality, mol/kg of Sulfur dioxide (2) [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Pressure, kPa - Liquid | Molality, mol/kg of Sulfur dioxide (2) - Liquid |
| 293.15 | 3.20 | 0.4420 |
| 293.15 | 5.90 | 0.7980 |
| 293.15 | 8.60 | 1.157 |
| 293.15 | 12.80 | 1.667 |
| 293.15 | 19.10 | 2.384 |
| 293.15 | 27.10 | 3.232 |
| 293.15 | 35.60 | 4.097 |
| 293.15 | 43.10 | 4.847 |
| 293.15 | 52.60 | 5.772 |
| 293.15 | 63.00 | 6.778 |
| 293.15 | 71.30 | 7.58 |
| 293.15 | 81.70 | 8.613 |
| 293.15 | 89.40 | 9.387 |
| 293.15 | 98.60 | 10.355 |
| 293.15 | 107.50 | 11.313 |
| 293.15 | 115.50 | 12.226 |
| 303.15 | 2.70 | 0.2430 |
| 303.15 | 5.80 | 0.5150 |
| 303.15 | 8.80 | 0.7680 |
| 303.15 | 15.10 | 1.27 |
| 303.15 | 19.70 | 1.628 |
| 303.15 | 29.90 | 2.378 |
| 303.15 | 40.20 | 3.111 |
| 303.15 | 50.60 | 3.816 |
| 303.15 | 60.60 | 4.491 |
| 303.15 | 70.30 | 5.146 |
| 303.15 | 80.20 | 5.797 |
| 303.15 | 90.30 | 6.465 |
| 303.15 | 99.90 | 7.119 |
| 303.15 | 109.80 | 7.789 |
| 303.15 | 119.80 | 8.486 |
| 313.15 | 3.40 | 0.2140 |
| 313.15 | 7.10 | 0.4450 |
| 313.15 | 11.10 | 0.6810 |
| 313.15 | 15.50 | 0.9420 |
| 313.15 | 20.50 | 1.228 |
| 313.15 | 30.30 | 1.777 |
| 313.15 | 40.50 | 2.319 |
| 313.15 | 51.10 | 2.861 |
| 313.15 | 61.80 | 3.396 |
| 313.15 | 72.40 | 3.925 |
| 313.15 | 81.90 | 4.394 |
| 313.15 | 92.20 | 4.899 |
| 313.15 | 100.40 | 5.295 |
| 313.15 | 110.30 | 5.785 |
| 313.15 | 119.80 | 6.25 |
| 323.15 | 3.00 | 0.1390 |
| 323.15 | 6.30 | 0.2800 |
| 323.15 | 9.30 | 0.4120 |
| 323.15 | 14.70 | 0.6440 |
| 323.15 | 19.90 | 0.8610 |
| 323.15 | 30.20 | 1.28 |
| 323.15 | 40.00 | 1.674 |
| 323.15 | 49.90 | 2.059 |
| 323.15 | 60.00 | 2.448 |
| 323.15 | 70.40 | 2.836 |
| 323.15 | 80.20 | 3.197 |
| 323.15 | 91.60 | 3.619 |
| 323.15 | 101.40 | 3.983 |
| 323.15 | 111.60 | 4.36 |
| 323.15 | 119.70 | 4.663 |
| 333.15 | 2.30 | 0.0750 |
| 333.15 | 5.70 | 0.1830 |
| 333.15 | 9.40 | 0.3050 |
| 333.15 | 14.50 | 0.4680 |
| 333.15 | 19.50 | 0.6210 |
| 333.15 | 29.60 | 0.9310 |
| 333.15 | 40.40 | 1.258 |
| 333.15 | 49.60 | 1.527 |
| 333.15 | 59.50 | 1.815 |
| 333.15 | 69.90 | 2.177 |
| 333.15 | 79.10 | 2.44 |
| 333.15 | 89.70 | 2.738 |
| 333.15 | 99.40 | 3.008 |
| 333.15 | 110.20 | 3.31 |
| 333.15 | 120.70 | 3.604 |
Sources
Note: These property values are available through the Cheméo API. A free account gives you an access key.