- Name
- 1-Octanol
- InChI
- InChI=1S/C8H18O/c1-2-3-4-5-6-7-8-9/h9H,2-8H2,1H3
- InChI Key
- KBPLFHHGFOOTCA-UHFFFAOYSA-N
- Formula
- C8H18O
- SMILES
- CCCCCCCCO
- Mol. Weight (g/mol)
- 130.23
- CAS
- 111-87-5
- Name
- 1,3-Butanediol
- InChI
- InChI=1S/C4H10O2/c1-4(6)2-3-5/h4-6H,2-3H2,1H3
- InChI Key
- PUPZLCDOIYMWBV-UHFFFAOYSA-N
- Formula
- C4H10O2
- SMILES
- CC(O)CCO
- Mol. Weight (g/mol)
- 90.12
- CAS
- 107-88-0
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of 1,3-Butanediol (2) - Liquid | Refractive index (Na D-line) - Liquid |
| 298.20 | 0.0000 | 1.4276 |
| 298.20 | 0.1050 | 1.4279 |
| 298.20 | 0.2000 | 1.4283 |
| 298.20 | 0.3010 | 1.4288 |
| 298.20 | 0.4010 | 1.4295 |
| 298.20 | 0.4500 | 1.43 |
| 298.20 | 0.5010 | 1.4305 |
| 298.20 | 0.5500 | 1.4311 |
| 298.20 | 0.6000 | 1.4316 |
| 298.20 | 0.6600 | 1.4325 |
| 298.20 | 0.7000 | 1.4331 |
| 298.20 | 0.8010 | 1.4347 |
| 298.20 | 0.9000 | 1.4364 |
| 298.20 | 0.9500 | 1.4373 |
| 298.20 | 1.0000 | 1.4384 |
| 303.20 | 0.0000 | 1.4254 |
| 303.20 | 0.1050 | 1.4257 |
| 303.20 | 0.2000 | 1.4261 |
| 303.20 | 0.3010 | 1.4268 |
| 303.20 | 0.4010 | 1.4275 |
| 303.20 | 0.4500 | 1.4281 |
| 303.20 | 0.5010 | 1.4286 |
| 303.20 | 0.5500 | 1.4292 |
| 303.20 | 0.6000 | 1.4298 |
| 303.20 | 0.6600 | 1.4307 |
| 303.20 | 0.7000 | 1.4314 |
| 303.20 | 0.8010 | 1.4331 |
| 303.20 | 0.9000 | 1.4349 |
| 303.20 | 0.9500 | 1.4359 |
| 303.20 | 1.0000 | 1.4371 |
| 308.20 | 0.0000 | 1.423 |
| 308.20 | 0.1050 | 1.4233 |
| 308.20 | 0.2000 | 1.4238 |
| 308.20 | 0.3010 | 1.4245 |
| 308.20 | 0.4010 | 1.4253 |
| 308.20 | 0.4500 | 1.4259 |
| 308.20 | 0.5010 | 1.4265 |
| 308.20 | 0.5500 | 1.4272 |
| 308.20 | 0.6000 | 1.4278 |
| 308.20 | 0.6600 | 1.4288 |
| 308.20 | 0.7000 | 1.4295 |
| 308.20 | 0.8010 | 1.4313 |
| 308.20 | 0.9000 | 1.4332 |
| 308.20 | 0.9500 | 1.4343 |
| 308.20 | 1.0000 | 1.4356 |
| 313.20 | 0.0000 | 1.4205 |
| 313.20 | 0.1050 | 1.4209 |
| 313.20 | 0.2000 | 1.4215 |
| 313.20 | 0.3010 | 1.4223 |
| 313.20 | 0.4010 | 1.4232 |
| 313.20 | 0.4500 | 1.4239 |
| 313.20 | 0.5010 | 1.4245 |
| 313.20 | 0.5500 | 1.4253 |
| 313.20 | 0.6000 | 1.426 |
| 313.20 | 0.6600 | 1.427 |
| 313.20 | 0.7000 | 1.4278 |
| 313.20 | 0.8010 | 1.4298 |
| 313.20 | 0.9000 | 1.4318 |
| 313.20 | 0.9500 | 1.4329 |
| 313.20 | 1.0000 | 1.4341 |
| 318.20 | 0.0000 | 1.4184 |
| 318.20 | 0.1050 | 1.4189 |
| 318.20 | 0.2000 | 1.4195 |
| 318.20 | 0.3010 | 1.4204 |
| 318.20 | 0.4010 | 1.4213 |
| 318.20 | 0.4500 | 1.4221 |
| 318.20 | 0.5010 | 1.4227 |
| 318.20 | 0.5500 | 1.4236 |
| 318.20 | 0.6000 | 1.4245 |
| 318.20 | 0.6600 | 1.4255 |
| 318.20 | 0.7000 | 1.4262 |
| 318.20 | 0.8010 | 1.4283 |
| 318.20 | 0.9000 | 1.4304 |
| 318.20 | 0.9500 | 1.4315 |
| 318.20 | 1.0000 | 1.4328 |
Sources
Note: These property values are available through the Cheméo API. A free account gives you an access key.