- Name
- 1,4-Dioxane
- InChI
- InChI=1S/C4H8O2/c1-2-6-4-3-5-1/h1-4H2
- InChI Key
- RYHBNJHYFVUHQT-UHFFFAOYSA-N
- Formula
- C4H8O2
- SMILES
- C1COCCO1
- Mol. Weight (g/mol)
- 88.11
- CAS
- 123-91-1
- Name
- 1,3-Butanediol
- InChI
- InChI=1S/C4H10O2/c1-4(6)2-3-5/h4-6H,2-3H2,1H3
- InChI Key
- PUPZLCDOIYMWBV-UHFFFAOYSA-N
- Formula
- C4H10O2
- SMILES
- CC(O)CCO
- Mol. Weight (g/mol)
- 90.12
- CAS
- 107-88-0
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of 1,3-Butanediol (2) - Liquid | Refractive index (Na D-line) - Liquid |
| 298.20 | 0.0000 | 1.4201 |
| 298.20 | 0.1030 | 1.4217 |
| 298.20 | 0.2040 | 1.4235 |
| 298.20 | 0.3010 | 1.425 |
| 298.20 | 0.4010 | 1.4268 |
| 298.20 | 0.4510 | 1.4279 |
| 298.20 | 0.5000 | 1.4287 |
| 298.20 | 0.5480 | 1.4296 |
| 298.20 | 0.6100 | 1.431 |
| 298.20 | 0.6990 | 1.4325 |
| 298.20 | 0.7880 | 1.4342 |
| 298.20 | 0.8970 | 1.4363 |
| 298.20 | 0.9510 | 1.4374 |
| 298.20 | 1.0000 | 1.4384 |
| 303.20 | 0.0000 | 1.4174 |
| 303.20 | 0.1030 | 1.4195 |
| 303.20 | 0.2040 | 1.4213 |
| 303.20 | 0.3010 | 1.423 |
| 303.20 | 0.4010 | 1.425 |
| 303.20 | 0.4510 | 1.4258 |
| 303.20 | 0.5000 | 1.4267 |
| 303.20 | 0.5480 | 1.4275 |
| 303.20 | 0.6100 | 1.4285 |
| 303.20 | 0.6990 | 1.4308 |
| 303.20 | 0.7880 | 1.4326 |
| 303.20 | 0.8970 | 1.4348 |
| 303.20 | 0.9510 | 1.4361 |
| 303.20 | 1.0000 | 1.4371 |
| 308.20 | 0.0000 | 1.4145 |
| 308.20 | 0.1030 | 1.4165 |
| 308.20 | 0.2040 | 1.4183 |
| 308.20 | 0.3010 | 1.4202 |
| 308.20 | 0.4010 | 1.4222 |
| 308.20 | 0.4510 | 1.4233 |
| 308.20 | 0.5000 | 1.4243 |
| 308.20 | 0.5480 | 1.4255 |
| 308.20 | 0.6100 | 1.4262 |
| 308.20 | 0.6990 | 1.4285 |
| 308.20 | 0.7880 | 1.4303 |
| 308.20 | 0.8970 | 1.4333 |
| 308.20 | 0.9510 | 1.4347 |
| 308.20 | 1.0000 | 1.4356 |
| 313.20 | 0.0000 | 1.4118 |
| 313.20 | 0.1030 | 1.414 |
| 313.20 | 0.2040 | 1.4161 |
| 313.20 | 0.3010 | 1.418 |
| 313.20 | 0.4010 | 1.4202 |
| 313.20 | 0.4510 | 1.4213 |
| 313.20 | 0.5000 | 1.4222 |
| 313.20 | 0.5480 | 1.423 |
| 313.20 | 0.6100 | 1.4242 |
| 313.20 | 0.6990 | 1.4267 |
| 313.20 | 0.7880 | 1.4287 |
| 313.20 | 0.8970 | 1.4314 |
| 313.20 | 0.9510 | 1.4329 |
| 313.20 | 1.0000 | 1.4341 |
| 318.20 | 0.0000 | 1.4088 |
| 318.20 | 0.1030 | 1.4112 |
| 318.20 | 0.2040 | 1.4136 |
| 318.20 | 0.3010 | 1.4155 |
| 318.20 | 0.4010 | 1.4177 |
| 318.20 | 0.4510 | 1.419 |
| 318.20 | 0.5000 | 1.42 |
| 318.20 | 0.5480 | 1.4209 |
| 318.20 | 0.6100 | 1.4221 |
| 318.20 | 0.6990 | 1.4247 |
| 318.20 | 0.7880 | 1.4269 |
| 318.20 | 0.8970 | 1.4297 |
| 318.20 | 0.9510 | 1.4313 |
| 318.20 | 1.0000 | 1.4328 |
Refractive index (Na D-line) [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Temperature, K = 298.2 (Liquid)
| Mole fraction of 1,3-Butanediol (2) - Liquid | Refractive index (Na D-line) - Liquid |
|---|---|
| 0.0290 | 1.4206 |
| 0.0980 | 1.4217 |
| 0.2000 | 1.4233 |
| 0.2930 | 1.4251 |
| 0.4000 | 1.4265 |
| 0.4910 | 1.4282 |
| 0.6000 | 1.4301 |
| 0.6930 | 1.4319 |
| 0.8000 | 1.4343 |
| 0.9000 | 1.4362 |
Sources
- Dielectric properties of binary mixtures of three butanediols with 1,4-dioxane and 2-ethyl-1-hexanol at T = 298.2 K
- Temperature and concentration dependence of the relative permittivity of (1,3-butanediol + 1-octanol or 1,4-dioxane) binary liquid mixtures
Note: These property values are available through the Cheméo API. A free account gives you an access key.