- Name
- L-Phenylalanine
- InChI
- InChI=1S/C9H11NO2/c10-8(9(11)12)6-7-4-2-1-3-5-7/h1-5,8H,6,10H2,(H,11,12)/t8-/m0/s1
- InChI Key
- COLNVLDHVKWLRT-QMMMGPOBSA-N
- Formula
- C9H11NO2
- SMILES
- N[C@@H](Cc1ccccc1)C(=O)O
- Mol. Weight (g/mol)
- 165.19
- CAS
- 63-91-2
- Name
- Water
- InChI
- InChI=1S/H2O/h1H2
- InChI Key
- XLYOFNOQVPJJNP-UHFFFAOYSA-N
- Formula
- H2O
- SMILES
- O
- Mol. Weight (g/mol)
- 18.02
- CAS
- 7732-18-5
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- Mass fraction
- η - Viscosity, Pa*s
- Molar enthalpy
- ρl - Mass density, kg/m3 (5)
- csound,fluid - Speed of Sound, m/s (2)
- γ - Surface tension liquid-gas, N/m
- Binary diffusion coefficient, m2/s
Mass fraction of L-Phenylalanine (1) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Temperature, K - Liquid | Mass fraction of L-Phenylalanine (1) - Liquid |
|---|---|
| 283.15 | 0.0254 |
| 293.15 | 0.0281 |
| 298.15 | 0.0297 |
| 303.15 | 0.0322 |
| 313.15 | 0.0365 |
| 318.15 | 0.0417 |
| 323.15 | 0.0443 |
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101.325 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of L-Phenylalanine (1) - Liquid | Viscosity, Pa*s - Liquid |
| 298.15 | 0.0000 | 0.0009 |
| 298.15 | 0.0249 | 0.0009 |
| 298.15 | 0.0498 | 0.0009 |
| 298.15 | 0.0749 | 0.0009 |
| 298.15 | 0.0999 | 0.0009 |
| 298.15 | 0.1250 | 0.0010 |
| 298.15 | 0.1499 | 0.0010 |
| 303.15 | 0.0000 | 0.0008 |
| 303.15 | 0.0249 | 0.0008 |
| 303.15 | 0.0498 | 0.0008 |
| 303.15 | 0.0749 | 0.0008 |
| 303.15 | 0.0999 | 0.0008 |
| 303.15 | 0.1250 | 0.0009 |
| 303.15 | 0.1499 | 0.0009 |
| 308.15 | 0.0000 | 0.0007 |
| 308.15 | 0.0249 | 0.0007 |
| 308.15 | 0.0498 | 0.0007 |
| 308.15 | 0.0749 | 0.0007 |
| 308.15 | 0.0999 | 0.0008 |
| 308.15 | 0.1250 | 0.0008 |
| 308.15 | 0.1499 | 0.0008 |
| 313.15 | 0.0000 | 0.0007 |
| 313.15 | 0.0249 | 0.0007 |
| 313.15 | 0.0498 | 0.0007 |
| 313.15 | 0.0749 | 0.0007 |
| 313.15 | 0.0999 | 0.0007 |
| 313.15 | 0.1250 | 0.0007 |
| 313.15 | 0.1499 | 0.0007 |
| 318.15 | 0.0000 | 0.0006 |
| 318.15 | 0.0249 | 0.0006 |
| 318.15 | 0.0498 | 0.0006 |
| 318.15 | 0.0749 | 0.0006 |
| 318.15 | 0.0999 | 0.0006 |
| 318.15 | 0.1250 | 0.0006 |
| 318.15 | 0.1499 | 0.0006 |
Molar enthalpy of dilution, kJ/mol [ref]
| Fixed | Measured | |||
|---|---|---|---|---|
| Initial molality of solute, mol/kg - Liquid | Temperature, K - Liquid | Pressure, kPa - Liquid | Final molality of solute, mol/kg - Liquid | Molar enthalpy of dilution, kJ/mol - Liquid |
| 0.0016 | 298.15 | 101.00 | 0.0008 | 0.7500 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of L-Phenylalanine (1) - Liquid | Mass density, kg/m3 - Liquid |
| 283.15 | 0.0102 | 1000.19 |
| 283.15 | 0.0203 | 1000.64 |
| 283.15 | 0.0293 | 1001.05 |
| 283.15 | 0.0398 | 1001.53 |
| 283.15 | 0.0509 | 1002.02 |
| 283.15 | 0.0606 | 1002.47 |
| 283.15 | 0.0610 | 1002.49 |
| 283.15 | 0.0736 | 1003.05 |
| 283.15 | 0.0915 | 1003.87 |
| 283.15 | 0.1028 | 1004.36 |
| 288.15 | 0.0102 | 999.59 |
| 288.15 | 0.0203 | 1000.04 |
| 288.15 | 0.0293 | 1000.44 |
| 288.15 | 0.0398 | 1000.91 |
| 288.15 | 0.0509 | 1001.39 |
| 288.15 | 0.0606 | 1001.83 |
| 288.15 | 0.0610 | 1001.85 |
| 288.15 | 0.0736 | 1002.4 |
| 288.15 | 0.0915 | 1003.2 |
| 288.15 | 0.1028 | 1003.69 |
| 293.15 | 0.0102 | 998.69 |
| 293.15 | 0.0203 | 999.13 |
| 293.15 | 0.0293 | 999.52 |
| 293.15 | 0.0398 | 999.98 |
| 293.15 | 0.0509 | 1000.46 |
| 293.15 | 0.0606 | 1000.9 |
| 293.15 | 0.0610 | 1000.91 |
| 293.15 | 0.0736 | 1001.45 |
| 293.15 | 0.0915 | 1002.24 |
| 293.15 | 0.1028 | 1002.73 |
| 298.15 | 0.0102 | 997.52 |
| 298.15 | 0.0203 | 997.95 |
| 298.15 | 0.0293 | 998.35 |
| 298.15 | 0.0398 | 998.8 |
| 298.15 | 0.0509 | 999.27 |
| 298.15 | 0.0606 | 999.7 |
| 298.15 | 0.0610 | 999.71 |
| 298.15 | 0.0736 | 1000.25 |
| 298.15 | 0.0915 | 1001.03 |
| 298.15 | 0.1028 | 1001.5 |
| 303.15 | 0.0102 | 996.12 |
| 303.15 | 0.0203 | 996.54 |
| 303.15 | 0.0293 | 996.93 |
| 303.15 | 0.0398 | 997.38 |
| 303.15 | 0.0509 | 997.85 |
| 303.15 | 0.0606 | 998.27 |
| 303.15 | 0.0610 | 998.28 |
| 303.15 | 0.0736 | 998.81 |
| 303.15 | 0.0915 | 999.58 |
| 303.15 | 0.1028 | 1000.05 |
| 283.15 | 0.0000 | 999.72 |
| 288.15 | 0.0000 | 999.14 |
| 293.15 | 0.0000 | 998.24 |
| 298.15 | 0.0000 | 997.08 |
| 303.15 | 0.0000 | 995.68 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101.325 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of L-Phenylalanine (1) - Liquid | Mass density, kg/m3 - Liquid |
| 293.15 | 0.0000 | 998.24 |
| 293.15 | 0.0249 | 999.4 |
| 293.15 | 0.0498 | 1000.55 |
| 293.15 | 0.0749 | 1001.71 |
| 293.15 | 0.0999 | 1002.88 |
| 293.15 | 0.1250 | 1004.04 |
| 293.15 | 0.1499 | 1005.2 |
| 298.15 | 0.0000 | 997.07 |
| 298.15 | 0.0249 | 998.23 |
| 298.15 | 0.0498 | 999.39 |
| 298.15 | 0.0749 | 1000.55 |
| 298.15 | 0.0999 | 1001.72 |
| 298.15 | 0.1250 | 1002.88 |
| 298.15 | 0.1499 | 1004.05 |
| 303.15 | 0.0000 | 995.68 |
| 303.15 | 0.0249 | 996.84 |
| 303.15 | 0.0498 | 998.0 |
| 303.15 | 0.0749 | 999.17 |
| 303.15 | 0.0999 | 1000.34 |
| 303.15 | 0.1250 | 1001.51 |
| 303.15 | 0.1499 | 1002.68 |
| 308.15 | 0.0000 | 994.07 |
| 308.15 | 0.0249 | 995.24 |
| 308.15 | 0.0498 | 996.4 |
| 308.15 | 0.0749 | 997.58 |
| 308.15 | 0.0999 | 998.75 |
| 308.15 | 0.1250 | 999.92 |
| 308.15 | 0.1499 | 1001.09 |
| 313.15 | 0.0000 | 992.25 |
| 313.15 | 0.0249 | 993.43 |
| 313.15 | 0.0498 | 994.6 |
| 313.15 | 0.0749 | 995.78 |
| 313.15 | 0.0999 | 996.96 |
| 313.15 | 0.1250 | 998.14 |
| 313.15 | 0.1499 | 999.32 |
| 318.15 | 0.0000 | 990.24 |
| 318.15 | 0.0249 | 991.43 |
| 318.15 | 0.0498 | 992.61 |
| 318.15 | 0.0749 | 993.8 |
| 318.15 | 0.0999 | 994.98 |
| 318.15 | 0.1250 | 996.17 |
| 318.15 | 0.1499 | 997.36 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of L-Phenylalanine (1) - Liquid | Mass density, kg/m3 - Liquid |
| 283.15 | 0.0036 | 999.87 |
| 282.65 | 0.0036 | 999.913 |
| 282.15 | 0.0036 | 999.952 |
| 281.65 | 0.0036 | 999.986 |
| 281.15 | 0.0036 | 1000.02 |
| 280.65 | 0.0036 | 1000.045 |
| 280.15 | 0.0036 | 1000.071 |
| 279.65 | 0.0036 | 1000.094 |
| 279.15 | 0.0036 | 1000.11 |
| 278.65 | 0.0036 | 1000.124 |
| 278.15 | 0.0036 | 1000.133 |
| 277.65 | 0.0036 | 1000.141 |
| 277.15 | 0.0036 | 1000.143 |
| 276.65 | 0.0036 | 1000.14 |
| 276.15 | 0.0036 | 1000.137 |
| 275.65 | 0.0036 | 1000.129 |
| 275.15 | 0.0036 | 1000.115 |
| 274.65 | 0.0036 | 1000.095 |
| 274.15 | 0.0036 | 1000.075 |
| 273.65 | 0.0036 | 1000.049 |
| 283.15 | 0.0110 | 1000.209 |
| 282.65 | 0.0110 | 1000.251 |
| 282.15 | 0.0110 | 1000.291 |
| 281.65 | 0.0110 | 1000.326 |
| 281.15 | 0.0110 | 1000.359 |
| 280.65 | 0.0110 | 1000.388 |
| 280.15 | 0.0110 | 1000.412 |
| 279.65 | 0.0110 | 1000.434 |
| 279.15 | 0.0110 | 1000.452 |
| 278.65 | 0.0110 | 1000.467 |
| 278.15 | 0.0110 | 1000.478 |
| 277.65 | 0.0110 | 1000.487 |
| 277.15 | 0.0110 | 1000.49 |
| 276.65 | 0.0110 | 1000.489 |
| 276.15 | 0.0110 | 1000.486 |
| 275.65 | 0.0110 | 1000.478 |
| 275.15 | 0.0110 | 1000.464 |
| 274.65 | 0.0110 | 1000.446 |
| 274.15 | 0.0110 | 1000.425 |
| 273.65 | 0.0110 | 1000.402 |
| 283.15 | 0.0183 | 1000.543 |
| 282.65 | 0.0183 | 1000.586 |
| 282.15 | 0.0183 | 1000.628 |
| 281.65 | 0.0183 | 1000.663 |
| 281.15 | 0.0183 | 1000.697 |
| 280.65 | 0.0183 | 1000.725 |
| 280.15 | 0.0183 | 1000.751 |
| 279.65 | 0.0183 | 1000.773 |
| 279.15 | 0.0183 | 1000.793 |
| 278.65 | 0.0183 | 1000.81 |
| 278.15 | 0.0183 | 1000.82 |
| 277.65 | 0.0183 | 1000.829 |
| 277.15 | 0.0183 | 1000.831 |
| 276.65 | 0.0183 | 1000.833 |
| 276.15 | 0.0183 | 1000.831 |
| 275.65 | 0.0183 | 1000.82 |
| 275.15 | 0.0183 | 1000.809 |
| 274.65 | 0.0183 | 1000.793 |
| 274.15 | 0.0183 | 1000.772 |
| 273.65 | 0.0183 | 1000.75 |
| 283.15 | 0.0330 | 1001.205 |
| 282.65 | 0.0330 | 1001.25 |
| 282.15 | 0.0330 | 1001.292 |
| 281.65 | 0.0330 | 1001.327 |
| 281.15 | 0.0330 | 1001.364 |
| 280.65 | 0.0330 | 1001.394 |
| 280.15 | 0.0330 | 1001.42 |
| 279.65 | 0.0330 | 1001.445 |
| 279.15 | 0.0330 | 1001.466 |
| 278.65 | 0.0330 | 1001.483 |
| 278.15 | 0.0330 | 1001.494 |
| 277.65 | 0.0330 | 1001.504 |
| 277.15 | 0.0330 | 1001.509 |
| 276.65 | 0.0330 | 1001.512 |
| 276.15 | 0.0330 | 1001.511 |
| 275.65 | 0.0330 | 1001.503 |
| 275.15 | 0.0330 | 1001.494 |
| 274.65 | 0.0330 | 1001.478 |
| 274.15 | 0.0330 | 1001.459 |
| 273.65 | 0.0330 | 1001.438 |
| 283.15 | 0.0443 | 1001.773 |
| 282.65 | 0.0443 | 1001.818 |
| 282.15 | 0.0443 | 1001.858 |
| 281.65 | 0.0443 | 1001.898 |
| 281.15 | 0.0443 | 1001.934 |
| 280.65 | 0.0443 | 1001.963 |
| 280.15 | 0.0443 | 1001.991 |
| 279.65 | 0.0443 | 1002.017 |
| 279.15 | 0.0443 | 1002.038 |
| 278.65 | 0.0443 | 1002.055 |
| 278.15 | 0.0443 | 1002.069 |
| 277.65 | 0.0443 | 1002.08 |
| 277.15 | 0.0443 | 1002.086 |
| 276.65 | 0.0443 | 1002.087 |
| 276.15 | 0.0443 | 1002.089 |
| 275.65 | 0.0443 | 1002.082 |
| 275.15 | 0.0443 | 1002.074 |
| 274.65 | 0.0443 | 1002.058 |
| 274.15 | 0.0443 | 1002.042 |
| 273.65 | 0.0443 | 1002.019 |
| 283.15 | 0.0536 | 1002.147 |
| 282.65 | 0.0536 | 1002.193 |
| 282.15 | 0.0536 | 1002.238 |
| 281.65 | 0.0536 | 1002.276 |
| 281.15 | 0.0536 | 1002.313 |
| 280.65 | 0.0536 | 1002.345 |
| 280.15 | 0.0536 | 1002.373 |
| 279.65 | 0.0536 | 1002.4 |
| 279.15 | 0.0536 | 1002.422 |
| 278.65 | 0.0536 | 1002.44 |
| 278.15 | 0.0536 | 1002.456 |
| 277.65 | 0.0536 | 1002.468 |
| 277.15 | 0.0536 | 1002.474 |
| 276.65 | 0.0536 | 1002.478 |
| 276.15 | 0.0536 | 1002.479 |
| 275.65 | 0.0536 | 1002.476 |
| 275.15 | 0.0536 | 1002.467 |
| 274.65 | 0.0536 | 1002.455 |
| 274.15 | 0.0536 | 1002.438 |
| 273.65 | 0.0536 | 1002.419 |
| 283.15 | 0.0623 | 1002.551 |
| 282.65 | 0.0623 | 1002.598 |
| 282.15 | 0.0623 | 1002.643 |
| 281.65 | 0.0623 | 1002.682 |
| 281.15 | 0.0623 | 1002.72 |
| 280.65 | 0.0623 | 1002.752 |
| 280.15 | 0.0623 | 1002.782 |
| 279.65 | 0.0623 | 1002.81 |
| 279.15 | 0.0623 | 1002.833 |
| 278.65 | 0.0623 | 1002.853 |
| 278.15 | 0.0623 | 1002.868 |
| 277.65 | 0.0623 | 1002.88 |
| 277.15 | 0.0623 | 1002.888 |
| 276.65 | 0.0623 | 1002.892 |
| 276.15 | 0.0623 | 1002.894 |
| 275.65 | 0.0623 | 1002.892 |
| 275.15 | 0.0623 | 1002.883 |
| 274.65 | 0.0623 | 1002.873 |
| 274.15 | 0.0623 | 1002.857 |
| 273.65 | 0.0623 | 1002.838 |
| 283.15 | 0.0740 | 1003.079 |
| 282.65 | 0.0740 | 1003.127 |
| 282.15 | 0.0740 | 1003.171 |
| 281.65 | 0.0740 | 1003.212 |
| 281.15 | 0.0740 | 1003.252 |
| 280.65 | 0.0740 | 1003.283 |
| 280.15 | 0.0740 | 1003.316 |
| 279.65 | 0.0740 | 1003.342 |
| 279.15 | 0.0740 | 1003.367 |
| 278.65 | 0.0740 | 1003.387 |
| 278.15 | 0.0740 | 1003.407 |
| 277.65 | 0.0740 | 1003.419 |
| 277.15 | 0.0740 | 1003.428 |
| 276.65 | 0.0740 | 1003.433 |
| 276.15 | 0.0740 | 1003.435 |
| 275.65 | 0.0740 | 1003.434 |
| 275.15 | 0.0740 | 1003.428 |
| 274.65 | 0.0740 | 1003.417 |
| 274.15 | 0.0740 | 1003.402 |
| 273.65 | 0.0740 | 1003.385 |
| 283.15 | 0.0855 | 1003.626 |
| 282.65 | 0.0855 | 1003.674 |
| 282.15 | 0.0855 | 1003.719 |
| 281.65 | 0.0855 | 1003.761 |
| 281.15 | 0.0855 | 1003.8 |
| 280.65 | 0.0855 | 1003.833 |
| 280.15 | 0.0855 | 1003.865 |
| 279.65 | 0.0855 | 1003.895 |
| 279.15 | 0.0855 | 1003.919 |
| 278.65 | 0.0855 | 1003.941 |
| 278.15 | 0.0855 | 1003.958 |
| 277.65 | 0.0855 | 1003.973 |
| 277.15 | 0.0855 | 1003.983 |
| 276.65 | 0.0855 | 1003.989 |
| 276.15 | 0.0855 | 1003.996 |
| 275.65 | 0.0855 | 1003.994 |
| 275.15 | 0.0855 | 1003.987 |
| 274.65 | 0.0855 | 1003.976 |
| 274.15 | 0.0855 | 1003.964 |
| 273.65 | 0.0855 | 1003.95 |
| 283.15 | 0.0981 | 1004.21 |
| 282.65 | 0.0981 | 1004.26 |
| 282.15 | 0.0981 | 1004.307 |
| 281.65 | 0.0981 | 1004.348 |
| 281.15 | 0.0981 | 1004.39 |
| 280.65 | 0.0981 | 1004.426 |
| 280.15 | 0.0981 | 1004.458 |
| 279.65 | 0.0981 | 1004.489 |
| 279.15 | 0.0981 | 1004.515 |
| 278.65 | 0.0981 | 1004.54 |
| 278.15 | 0.0981 | 1004.559 |
| 277.65 | 0.0981 | 1004.574 |
| 277.15 | 0.0981 | 1004.587 |
| 276.65 | 0.0981 | 1004.594 |
| 276.15 | 0.0981 | 1004.599 |
| 275.65 | 0.0981 | 1004.601 |
| 275.15 | 0.0981 | 1004.597 |
| 274.65 | 0.0981 | 1004.589 |
| 274.15 | 0.0981 | 1004.579 |
| 273.65 | 0.0981 | 1004.562 |
| 283.15 | 0.1158 | 1005.056 |
| 282.65 | 0.1158 | 1005.106 |
| 282.15 | 0.1158 | 1005.156 |
| 281.65 | 0.1158 | 1005.2 |
| 281.15 | 0.1158 | 1005.242 |
| 280.65 | 0.1158 | 1005.281 |
| 280.15 | 0.1158 | 1005.315 |
| 279.65 | 0.1158 | 1005.347 |
| 279.15 | 0.1158 | 1005.375 |
| 278.65 | 0.1158 | 1005.399 |
| 278.15 | 0.1158 | 1005.419 |
| 277.65 | 0.1158 | 1005.438 |
| 277.15 | 0.1158 | 1005.45 |
| 276.65 | 0.1158 | 1005.46 |
| 276.15 | 0.1158 | 1005.468 |
| 275.65 | 0.1158 | 1005.472 |
| 275.15 | 0.1158 | 1005.469 |
| 274.65 | 0.1158 | 1005.465 |
| 274.15 | 0.1158 | 1005.455 |
| 273.65 | 0.1158 | 1005.443 |
Mass density, kg/m3 [ref]
Operational conditions:
- Pressure, kPa = 101.3 (Liquid)
- Temperature, K = 298.15 (Liquid)
| Molality, mol/kg of L-Phenylalanine (1) - Liquid | Mass density, kg/m3 - Liquid |
|---|---|
| 0.0155 | 997.721 |
| 0.0210 | 997.961 |
| 0.0298 | 998.343 |
| 0.0337 | 998.516 |
| 0.0462 | 999.058 |
| 0.0530 | 999.349 |
| 0.0583 | 999.577 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of L-Phenylalanine (1) - Liquid | Mass density, kg/m3 - Liquid |
| 293.15 | 0.0000 | 998.219 |
| 293.15 | 0.0192 | 999.09 |
| 293.15 | 0.0461 | 1000.308 |
| 293.15 | 0.0687 | 1001.319 |
| 293.15 | 0.0753 | 1001.611 |
| 293.15 | 0.0856 | 1002.07 |
| 293.15 | 0.1047 | 1002.911 |
| 298.15 | 0.0000 | 997.05 |
| 298.15 | 0.0192 | 997.908 |
| 298.15 | 0.0461 | 999.107 |
| 298.15 | 0.0687 | 1000.103 |
| 298.15 | 0.0753 | 1000.391 |
| 298.15 | 0.0856 | 1000.844 |
| 298.15 | 0.1047 | 1001.671 |
| 303.15 | 0.0000 | 995.645 |
| 303.15 | 0.0192 | 996.494 |
| 303.15 | 0.0461 | 997.681 |
| 303.15 | 0.0687 | 998.668 |
| 303.15 | 0.0753 | 998.953 |
| 303.15 | 0.0856 | 999.401 |
| 303.15 | 0.1047 | 1000.223 |
| 308.15 | 0.0000 | 994.02 |
| 308.15 | 0.0192 | 994.857 |
| 308.15 | 0.0461 | 996.027 |
| 308.15 | 0.0687 | 996.999 |
| 308.15 | 0.0753 | 997.28 |
| 308.15 | 0.0856 | 997.722 |
| 308.15 | 0.1047 | 998.531 |
Speed of sound, m/s [ref]
Operational conditions:
- Pressure, kPa = 101.325 (Liquid)
- Frequency, MHz = 3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of L-Phenylalanine (1) - Liquid | Speed of sound, m/s - Liquid |
| 293.15 | 0.0000 | 1483.6 |
| 293.15 | 0.0249 | 1488.8 |
| 293.15 | 0.0498 | 1493.0 |
| 293.15 | 0.0749 | 1496.2 |
| 293.15 | 0.0999 | 1498.3 |
| 293.15 | 0.1250 | 1499.4 |
| 293.15 | 0.1499 | 1499.4 |
| 298.15 | 0.0000 | 1496.9 |
| 298.15 | 0.0249 | 1501.9 |
| 298.15 | 0.0498 | 1505.9 |
| 298.15 | 0.0749 | 1509.0 |
| 298.15 | 0.0999 | 1511.0 |
| 298.15 | 0.1250 | 1512.0 |
| 298.15 | 0.1499 | 1511.9 |
| 303.15 | 0.0000 | 1508.4 |
| 303.15 | 0.0249 | 1513.1 |
| 303.15 | 0.0498 | 1516.8 |
| 303.15 | 0.0749 | 1519.5 |
| 303.15 | 0.0999 | 1521.2 |
| 303.15 | 0.1250 | 1521.8 |
| 303.15 | 0.1499 | 1521.3 |
| 308.15 | 0.0000 | 1519.8 |
| 308.15 | 0.0249 | 1524.1 |
| 308.15 | 0.0498 | 1527.4 |
| 308.15 | 0.0749 | 1529.8 |
| 308.15 | 0.0999 | 1531.1 |
| 308.15 | 0.1250 | 1531.4 |
| 308.15 | 0.1499 | 1530.6 |
| 313.15 | 0.0000 | 1526.8 |
| 313.15 | 0.0249 | 1530.8 |
| 313.15 | 0.0498 | 1533.8 |
| 313.15 | 0.0749 | 1535.8 |
| 313.15 | 0.0999 | 1536.8 |
| 313.15 | 0.1250 | 1536.7 |
| 313.15 | 0.1499 | 1535.7 |
| 318.15 | 0.0000 | 1533.0 |
| 318.15 | 0.0249 | 1536.5 |
| 318.15 | 0.0498 | 1539.1 |
| 318.15 | 0.0749 | 1540.8 |
| 318.15 | 0.0999 | 1541.5 |
| 318.15 | 0.1250 | 1541.3 |
| 318.15 | 0.1499 | 1540.0 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of L-Phenylalanine (1) - Liquid | Speed of sound, m/s - Liquid |
| 293.15 | 0.0000 | 1482.98 |
| 293.15 | 0.0192 | 1485.3 |
| 293.15 | 0.0461 | 1488.56 |
| 293.15 | 0.0687 | 1491.3 |
| 293.15 | 0.0753 | 1492.08 |
| 293.15 | 0.0856 | 1493.33 |
| 293.15 | 0.1047 | 1495.63 |
| 298.15 | 0.0000 | 1497.2 |
| 298.15 | 0.0192 | 1499.39 |
| 298.15 | 0.0461 | 1502.47 |
| 298.15 | 0.0687 | 1505.05 |
| 298.15 | 0.0753 | 1505.78 |
| 298.15 | 0.0856 | 1506.95 |
| 298.15 | 0.1047 | 1509.09 |
| 303.15 | 0.0000 | 1509.46 |
| 303.15 | 0.0192 | 1511.52 |
| 303.15 | 0.0461 | 1514.42 |
| 303.15 | 0.0687 | 1516.85 |
| 303.15 | 0.0753 | 1517.54 |
| 303.15 | 0.0856 | 1518.62 |
| 303.15 | 0.1047 | 1520.65 |
| 308.15 | 0.0000 | 1519.91 |
| 308.15 | 0.0192 | 1521.85 |
| 308.15 | 0.0461 | 1524.58 |
| 308.15 | 0.0687 | 1526.87 |
| 308.15 | 0.0753 | 1527.52 |
| 308.15 | 0.0856 | 1528.55 |
| 308.15 | 0.1047 | 1530.46 |
Surface tension liquid-gas, N/m [ref]
| Fixed | Measured | |
|---|---|---|
| Molality, mol/kg of L-Phenylalanine (1) - Liquid | Temperature, K - Liquid | Surface tension liquid-gas, N/m - Liquid |
| 0.0000 | 293.15 | 0.0727 |
| 0.0505 | 293.15 | 0.0724 |
| 0.0759 | 293.15 | 0.0719 |
| 0.1015 | 293.15 | 0.0710 |
| 0.1273 | 293.15 | 0.0706 |
| 0.1532 | 293.15 | 0.0701 |
| 0.0000 | 298.15 | 0.0720 |
| 0.0505 | 298.15 | 0.0711 |
| 0.0759 | 298.15 | 0.0707 |
| 0.1015 | 298.15 | 0.0697 |
| 0.1273 | 298.15 | 0.0684 |
| 0.1532 | 298.15 | 0.0669 |
| 0.0000 | 303.15 | 0.0712 |
| 0.0505 | 303.15 | 0.0708 |
| 0.0759 | 303.15 | 0.0699 |
| 0.1015 | 303.15 | 0.0685 |
| 0.1273 | 303.15 | 0.0666 |
| 0.1532 | 303.15 | 0.0645 |
| 0.0000 | 308.15 | 0.0704 |
| 0.0505 | 308.15 | 0.0700 |
| 0.0759 | 308.15 | 0.0690 |
| 0.1015 | 308.15 | 0.0666 |
| 0.1273 | 308.15 | 0.0652 |
| 0.1532 | 308.15 | 0.0634 |
Binary diffusion coefficient, m2/s [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Mole fraction = 0 (Liquid)
| Temperature, K - Liquid | Binary diffusion coefficient, m2/s - Liquid |
|---|---|
| 298.20 | 0.0000 |
| 303.20 | 0.0000 |
| 313.20 | 0.0000 |
Sources
- Physicochemical and friccohesity study of glycine, L-alanine and L-phenylalanine with aqueous methyltrioctylammonium and cetylpyridinium chloride from T = (293.15 to 308.15) K
- Physicochemical study of solute-solute and solute-solvent interactions of l-phenylalanine in (water + arabinose/glucose/sucrose) solutions at different temperatures
- Study of the interactions of PAMAM-NH2 G4 dendrimer with selected natural amino acids in aqueous solutions
- Solute-solvent interactions of amino acid L-phenylalanine in aqueous 1-butyl-2,3-dimethylimidazolium bromide ionic liquid solutions
- Temperature of Maximum Density for Binary Aqueous Solutions of Five Amino Acids
- Apparent Molar Volumes and Viscosities of Some Amino Acids in Aqueous Sodium Acetate Solutions at 298.15 K
- Thermodynamic Study of Some Amino Acids, 2-Aminopropanoic Acid, 2-Amino-3-methylbutanoic Acid, 2-Amino-4-methylpentanoic Acid, and 2-Amino-3-phenylpropanoic Acid in Aqueous Saccharide Solutions at Different Temperatures: Volumetric and Ultrasonic Study
- Solubility of L-Phenylalanine Anhydrous and Monohydrate Forms: Experimental Measurements and Predictions
- Binary Diffusion Coefficients of Aqueous Phenylalanine, Tyrosine Isomers, and Aminobutyric Acids at Infinitesimal Concentration and Temperatures from (293.2 to 333.2) K
Note: These property values are available through the Cheméo API. A free account gives you an access key.