- Name
- Carbon dioxide
- InChI
- InChI=1S/CO2/c2-1-3
- InChI Key
- CURLTUGMZLYLDI-UHFFFAOYSA-N
- Formula
- CO2
- SMILES
- O=C=O
- Mol. Weight (g/mol)
- 44.01
- CAS
- 124-38-9
- Name
- Acetic acid, 2-methoxyethyl ester
- InChI
- InChI=1S/C5H10O3/c1-5(6)8-4-3-7-2/h3-4H2,1-2H3
- InChI Key
- XLLIQLLCWZCATF-UHFFFAOYSA-N
- Formula
- C5H10O3
- SMILES
- COCCOC(C)=O
- Mol. Weight (g/mol)
- 118.13
- CAS
- 32718-56-2
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Mole fraction of Carbon dioxide (1) [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Pressure, kPa - Liquid | Mole fraction of Carbon dioxide (1) - Liquid |
| 273.15 | 79.40 | 0.0268 |
| 273.15 | 148.50 | 0.0481 |
| 273.15 | 372.20 | 0.1275 |
| 273.15 | 575.50 | 0.1960 |
| 273.15 | 742.30 | 0.2515 |
| 273.15 | 950.30 | 0.3264 |
| 273.15 | 1149.50 | 0.3802 |
| 283.15 | 73.80 | 0.0207 |
| 283.15 | 205.10 | 0.0554 |
| 283.15 | 380.50 | 0.1086 |
| 283.15 | 565.50 | 0.1570 |
| 283.15 | 776.90 | 0.2157 |
| 283.15 | 980.80 | 0.2765 |
| 283.15 | 1121.10 | 0.3065 |
Mole fraction of Carbon dioxide (1) [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Pressure, kPa of Carbon dioxide (1) - Gas | Mole fraction of Carbon dioxide (1) - Liquid |
| 293.15 | 71.20 | 0.0165 |
| 293.15 | 143.60 | 0.0334 |
| 293.15 | 220.10 | 0.0472 |
| 293.15 | 401.80 | 0.0940 |
| 293.15 | 628.40 | 0.1503 |
| 293.15 | 839.10 | 0.1986 |
| 293.15 | 1032.00 | 0.2402 |
| 293.15 | 1231.10 | 0.2821 |
| 303.15 | 75.30 | 0.0147 |
| 303.15 | 165.40 | 0.0324 |
| 303.15 | 292.30 | 0.0541 |
| 303.15 | 470.50 | 0.0930 |
| 303.15 | 624.20 | 0.1245 |
| 303.15 | 816.80 | 0.1621 |
| 303.15 | 1010.90 | 0.1990 |
| 303.15 | 1228.40 | 0.2376 |
| 313.15 | 69.40 | 0.0116 |
| 313.15 | 149.80 | 0.0250 |
| 313.15 | 215.10 | 0.0348 |
| 313.15 | 431.90 | 0.0714 |
| 313.15 | 652.50 | 0.1113 |
| 313.15 | 825.20 | 0.1399 |
| 313.15 | 999.70 | 0.1677 |
| 313.15 | 1225.00 | 0.2017 |
| 323.15 | 76.10 | 0.0112 |
| 323.15 | 136.50 | 0.0201 |
| 323.15 | 226.10 | 0.0317 |
| 323.15 | 430.20 | 0.0634 |
| 323.15 | 615.30 | 0.0917 |
| 323.15 | 820.00 | 0.1232 |
| 323.15 | 1014.50 | 0.1495 |
| 323.15 | 1219.60 | 0.1776 |
| 333.15 | 73.30 | 0.0095 |
| 333.15 | 154.60 | 0.0201 |
| 333.15 | 238.90 | 0.0296 |
| 333.15 | 433.80 | 0.0563 |
| 333.15 | 630.70 | 0.0840 |
| 333.15 | 823.60 | 0.1084 |
| 333.15 | 1031.80 | 0.1336 |
| 333.15 | 1229.00 | 0.1587 |
Vapor or sublimation pressure, kPa [ref]
Operational condition: Temperature, K = 298.15 (Liquid)
| Mass fraction of Acetic acid, 2-methoxyethyl ester (2) - Liquid | Vapor or sublimation pressure, kPa - Liquid |
|---|---|
| 0.9500 | 562.00 |
| 0.9000 | 1049.00 |
| 0.8500 | 1527.00 |
| 0.8000 | 1971.00 |
| 0.7500 | 2375.00 |
| 0.7000 | 2722.00 |
| 0.6500 | 3104.00 |
| 0.6000 | 3531.00 |
Sources
- Solubilities of carbon dioxide in 2-methoxyethyl acetate, 1-methoxy-2-propyl acetate and 3-methoxybutyl acetate
- Below the room temperature measurements of CO2 solubilities in six physical absorbents
- Critical Assessment of CO2 Solubility in Volatile Solvents at 298.15 K
Note: These property values are available through the Cheméo API. A free account gives you an access key.