- Name
- 2-Octanol
- InChI
- InChI=1S/C8H18O/c1-3-4-5-6-7-8(2)9/h8-9H,3-7H2,1-2H3
- InChI Key
- SJWFXCIHNDVPSH-UHFFFAOYSA-N
- Formula
- C8H18O
- SMILES
- CCCCCCC(C)O
- Mol. Weight (g/mol)
- 130.23
- CAS
- 123-96-6
- Name
- Benzene, 1,3-dichloro-
- InChI
- InChI=1S/C6H4Cl2/c7-5-2-1-3-6(8)4-5/h1-4H
- InChI Key
- ZPQOPVIELGIULI-UHFFFAOYSA-N
- Formula
- C6H4Cl2
- SMILES
- Clc1cccc(Cl)c1
- Mol. Weight (g/mol)
- 147.00
- CAS
- 541-73-1
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- η - Viscosity, Pa*s
- n0 - Refractive index (Na D-line)
- ρl - Mass density, kg/m3
- csound,fluid - Speed of Sound, m/s
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Benzene, 1,3-dichloro- (2) - Liquid | Viscosity, Pa*s - Liquid |
| 298.15 | 0.0000 | 0.0066 |
| 298.15 | 0.0694 | 0.0051 |
| 298.15 | 0.1166 | 0.0044 |
| 298.15 | 0.1823 | 0.0037 |
| 298.15 | 0.2395 | 0.0032 |
| 298.15 | 0.3143 | 0.0028 |
| 298.15 | 0.3790 | 0.0024 |
| 298.15 | 0.4488 | 0.0021 |
| 298.15 | 0.5084 | 0.0019 |
| 298.15 | 0.5820 | 0.0017 |
| 298.15 | 0.6659 | 0.0015 |
| 298.15 | 0.7208 | 0.0014 |
| 298.15 | 0.7847 | 0.0013 |
| 298.15 | 0.8663 | 0.0012 |
| 298.15 | 0.9434 | 0.0011 |
| 298.15 | 1.0000 | 0.0010 |
| 303.15 | 0.0000 | 0.0052 |
| 303.15 | 0.0694 | 0.0044 |
| 303.15 | 0.1166 | 0.0038 |
| 303.15 | 0.1823 | 0.0032 |
| 303.15 | 0.2395 | 0.0028 |
| 303.15 | 0.3143 | 0.0024 |
| 303.15 | 0.3790 | 0.0021 |
| 303.15 | 0.4488 | 0.0019 |
| 303.15 | 0.5084 | 0.0017 |
| 303.15 | 0.5820 | 0.0015 |
| 303.15 | 0.6659 | 0.0014 |
| 303.15 | 0.7208 | 0.0013 |
| 303.15 | 0.7847 | 0.0012 |
| 303.15 | 0.8663 | 0.0011 |
| 303.15 | 0.9434 | 0.0010 |
| 303.15 | 1.0000 | 0.0009 |
| 308.15 | 0.0000 | 0.0042 |
| 308.15 | 0.0694 | 0.0035 |
| 308.15 | 0.1166 | 0.0032 |
| 308.15 | 0.1823 | 0.0028 |
| 308.15 | 0.2395 | 0.0025 |
| 308.15 | 0.3143 | 0.0021 |
| 308.15 | 0.3790 | 0.0019 |
| 308.15 | 0.4488 | 0.0017 |
| 308.15 | 0.5084 | 0.0015 |
| 308.15 | 0.5820 | 0.0014 |
| 308.15 | 0.6659 | 0.0012 |
| 308.15 | 0.7208 | 0.0011 |
| 308.15 | 0.7847 | 0.0010 |
| 308.15 | 0.8663 | 0.0010 |
| 308.15 | 0.9434 | 0.0009 |
| 308.15 | 1.0000 | 0.0009 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Benzene, 1,3-dichloro- (2) - Liquid | Refractive index (Na D-line) - Liquid |
| 298.15 | 0.0694 | 1.4312 |
| 298.15 | 0.1166 | 1.4366 |
| 298.15 | 0.1823 | 1.4436 |
| 298.15 | 0.2395 | 1.4494 |
| 298.15 | 0.3143 | 1.4567 |
| 298.15 | 0.3790 | 1.4631 |
| 298.15 | 0.4488 | 1.4698 |
| 298.15 | 0.5084 | 1.4758 |
| 298.15 | 0.5820 | 1.4838 |
| 298.15 | 0.6659 | 1.4939 |
| 298.15 | 0.7208 | 1.5009 |
| 298.15 | 0.7847 | 1.5099 |
| 298.15 | 0.8663 | 1.5224 |
| 298.15 | 0.9434 | 1.5349 |
| 298.15 | 1.0000 | 1.544 |
| 303.15 | 0.0694 | 1.4293 |
| 303.15 | 0.1166 | 1.4348 |
| 303.15 | 0.1823 | 1.4418 |
| 303.15 | 0.2395 | 1.4475 |
| 303.15 | 0.3143 | 1.4546 |
| 303.15 | 0.3790 | 1.4608 |
| 303.15 | 0.4488 | 1.4677 |
| 303.15 | 0.5084 | 1.4738 |
| 303.15 | 0.5820 | 1.4819 |
| 303.15 | 0.6659 | 1.4921 |
| 303.15 | 0.7208 | 1.4994 |
| 303.15 | 0.7847 | 1.5084 |
| 303.15 | 0.8663 | 1.5209 |
| 303.15 | 0.9434 | 1.5327 |
| 303.15 | 1.0000 | 1.541 |
| 308.15 | 0.0694 | 1.4273 |
| 308.15 | 0.1166 | 1.4327 |
| 308.15 | 0.1823 | 1.4397 |
| 308.15 | 0.2395 | 1.4455 |
| 308.15 | 0.3143 | 1.4527 |
| 308.15 | 0.3790 | 1.4589 |
| 308.15 | 0.4488 | 1.4658 |
| 308.15 | 0.5084 | 1.4718 |
| 308.15 | 0.5820 | 1.4798 |
| 308.15 | 0.6659 | 1.4898 |
| 308.15 | 0.7208 | 1.4969 |
| 308.15 | 0.7847 | 1.5057 |
| 308.15 | 0.8663 | 1.518 |
| 308.15 | 0.9434 | 1.5298 |
| 308.15 | 1.0000 | 1.538 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Benzene, 1,3-dichloro- (2) - Liquid | Mass density, kg/m3 - Liquid |
| 298.15 | 0.0694 | 840.61 |
| 298.15 | 0.1166 | 857.54 |
| 298.15 | 0.1823 | 881.65 |
| 298.15 | 0.2395 | 903.41 |
| 298.15 | 0.3143 | 932.89 |
| 298.15 | 0.3790 | 959.33 |
| 298.15 | 0.4488 | 988.41 |
| 298.15 | 0.5084 | 1014.16 |
| 298.15 | 0.5820 | 1047.42 |
| 298.15 | 0.6659 | 1086.85 |
| 298.15 | 0.7208 | 1114.21 |
| 298.15 | 0.7847 | 1147.67 |
| 298.15 | 0.8663 | 1194.04 |
| 298.15 | 0.9434 | 1243.52 |
| 298.15 | 1.0000 | 1283.45 |
| 303.15 | 0.0694 | 836.24 |
| 303.15 | 0.1166 | 852.87 |
| 303.15 | 0.1823 | 876.71 |
| 303.15 | 0.2395 | 898.21 |
| 303.15 | 0.3143 | 927.45 |
| 303.15 | 0.3790 | 953.45 |
| 303.15 | 0.4488 | 982.39 |
| 303.15 | 0.5084 | 1007.74 |
| 303.15 | 0.5820 | 1040.69 |
| 303.15 | 0.6659 | 1079.96 |
| 303.15 | 0.7208 | 1107.42 |
| 303.15 | 0.7847 | 1141.2 |
| 303.15 | 0.8663 | 1187.75 |
| 303.15 | 0.9434 | 1236.9 |
| 303.15 | 1.0000 | 1277.79 |
| 308.15 | 0.0694 | 832.14 |
| 308.15 | 0.1166 | 848.59 |
| 308.15 | 0.1823 | 871.91 |
| 308.15 | 0.2395 | 892.9 |
| 308.15 | 0.3143 | 920.82 |
| 308.15 | 0.3790 | 945.97 |
| 308.15 | 0.4488 | 974.25 |
| 308.15 | 0.5084 | 999.57 |
| 308.15 | 0.5820 | 1032.22 |
| 308.15 | 0.6659 | 1071.96 |
| 308.15 | 0.7208 | 1099.76 |
| 308.15 | 0.7847 | 1134.17 |
| 308.15 | 0.8663 | 1181.99 |
| 308.15 | 0.9434 | 1231.4 |
| 308.15 | 1.0000 | 1272.1 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Benzene, 1,3-dichloro- (2) - Liquid | Speed of sound, m/s - Liquid |
| 298.15 | 0.0694 | 1300.1 |
| 298.15 | 0.1166 | 1295.8 |
| 298.15 | 0.1823 | 1290.0 |
| 298.15 | 0.2395 | 1285.1 |
| 298.15 | 0.3143 | 1278.7 |
| 298.15 | 0.3790 | 1273.3 |
| 298.15 | 0.4488 | 1268.0 |
| 298.15 | 0.5084 | 1263.7 |
| 298.15 | 0.5820 | 1258.9 |
| 298.15 | 0.6659 | 1254.6 |
| 298.15 | 0.7208 | 1252.4 |
| 298.15 | 0.7847 | 1250.7 |
| 298.15 | 0.8663 | 1250.4 |
| 298.15 | 0.9434 | 1251.8 |
| 298.15 | 1.0000 | 1255.0 |
| 303.15 | 0.0694 | 1282.4 |
| 303.15 | 0.1166 | 1278.1 |
| 303.15 | 0.1823 | 1272.3 |
| 303.15 | 0.2395 | 1267.5 |
| 303.15 | 0.3143 | 1261.2 |
| 303.15 | 0.3790 | 1256.1 |
| 303.15 | 0.4488 | 1251.0 |
| 303.15 | 0.5084 | 1246.9 |
| 303.15 | 0.5820 | 1242.3 |
| 303.15 | 0.6659 | 1238.3 |
| 303.15 | 0.7208 | 1236.2 |
| 303.15 | 0.7847 | 1234.6 |
| 303.15 | 0.8663 | 1234.2 |
| 303.15 | 0.9434 | 1235.6 |
| 303.15 | 1.0000 | 1238.4 |
| 308.15 | 0.0694 | 1264.6 |
| 308.15 | 0.1166 | 1260.1 |
| 308.15 | 0.1823 | 1254.2 |
| 308.15 | 0.2395 | 1249.6 |
| 308.15 | 0.3143 | 1243.5 |
| 308.15 | 0.3790 | 1238.9 |
| 308.15 | 0.4488 | 1233.9 |
| 308.15 | 0.5084 | 1230.2 |
| 308.15 | 0.5820 | 1226.0 |
| 308.15 | 0.6659 | 1221.9 |
| 308.15 | 0.7208 | 1219.4 |
| 308.15 | 0.7847 | 1217.9 |
| 308.15 | 0.8663 | 1217.3 |
| 308.15 | 0.9434 | 1219.3 |
| 308.15 | 1.0000 | 1221.9 |
Sources
Note: These property values are available through the Cheméo API. A free account gives you an access key.