- Name
- Benzene, 1,2,4-trichloro-
- InChI
- InChI=1S/C6H3Cl3/c7-4-1-2-5(8)6(9)3-4/h1-3H
- InChI Key
- PBKONEOXTCPAFI-UHFFFAOYSA-N
- Formula
- C6H3Cl3
- SMILES
- Clc1ccc(Cl)c(Cl)c1
- Mol. Weight (g/mol)
- 181.45
- CAS
- 120-82-1
- Name
- 2-Octanol
- InChI
- InChI=1S/C8H18O/c1-3-4-5-6-7-8(2)9/h8-9H,3-7H2,1-2H3
- InChI Key
- SJWFXCIHNDVPSH-UHFFFAOYSA-N
- Formula
- C8H18O
- SMILES
- CCCCCCC(C)O
- Mol. Weight (g/mol)
- 130.23
- CAS
- 123-96-6
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- η - Viscosity, Pa*s
- n0 - Refractive index (Na D-line)
- ρl - Mass density, kg/m3
- csound,fluid - Speed of Sound, m/s
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Benzene, 1,2,4-trichloro- (1) - Liquid | Viscosity, Pa*s - Liquid |
| 298.15 | 0.0762 | 0.0059 |
| 298.15 | 0.1303 | 0.0055 |
| 298.15 | 0.2045 | 0.0049 |
| 298.15 | 0.2713 | 0.0045 |
| 298.15 | 0.3461 | 0.0040 |
| 298.15 | 0.4173 | 0.0036 |
| 298.15 | 0.4857 | 0.0032 |
| 298.15 | 0.5454 | 0.0030 |
| 298.15 | 0.6115 | 0.0027 |
| 298.15 | 0.6798 | 0.0025 |
| 298.15 | 0.7466 | 0.0023 |
| 298.15 | 0.8183 | 0.0021 |
| 298.15 | 0.8713 | 0.0020 |
| 298.15 | 0.9361 | 0.0019 |
| 298.15 | 1.0000 | 0.0019 |
| 303.15 | 0.0762 | 0.0048 |
| 303.15 | 0.1303 | 0.0045 |
| 303.15 | 0.2045 | 0.0041 |
| 303.15 | 0.2713 | 0.0038 |
| 303.15 | 0.3461 | 0.0034 |
| 303.15 | 0.4173 | 0.0031 |
| 303.15 | 0.4857 | 0.0028 |
| 303.15 | 0.5454 | 0.0026 |
| 303.15 | 0.6115 | 0.0024 |
| 303.15 | 0.6798 | 0.0022 |
| 303.15 | 0.7466 | 0.0020 |
| 303.15 | 0.8183 | 0.0019 |
| 303.15 | 0.8713 | 0.0018 |
| 303.15 | 0.9361 | 0.0018 |
| 303.15 | 1.0000 | 0.0018 |
| 308.15 | 0.0762 | 0.0039 |
| 308.15 | 0.1303 | 0.0037 |
| 308.15 | 0.2045 | 0.0034 |
| 308.15 | 0.2713 | 0.0032 |
| 308.15 | 0.3461 | 0.0029 |
| 308.15 | 0.4173 | 0.0027 |
| 308.15 | 0.4857 | 0.0025 |
| 308.15 | 0.5454 | 0.0023 |
| 308.15 | 0.6115 | 0.0021 |
| 308.15 | 0.6798 | 0.0020 |
| 308.15 | 0.7466 | 0.0018 |
| 308.15 | 0.8183 | 0.0017 |
| 308.15 | 0.8713 | 0.0017 |
| 308.15 | 0.9361 | 0.0016 |
| 308.15 | 1.0000 | 0.0016 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Benzene, 1,2,4-trichloro- (1) - Liquid | Refractive index (Na D-line) - Liquid |
| 298.15 | 0.0762 | 1.4309 |
| 298.15 | 0.1303 | 1.4366 |
| 298.15 | 0.2045 | 1.4436 |
| 298.15 | 0.2713 | 1.4501 |
| 298.15 | 0.3461 | 1.4569 |
| 298.15 | 0.4173 | 1.4631 |
| 298.15 | 0.4857 | 1.4698 |
| 298.15 | 0.5454 | 1.4758 |
| 298.15 | 0.6115 | 1.4834 |
| 298.15 | 0.6798 | 1.4919 |
| 298.15 | 0.7466 | 1.5009 |
| 298.15 | 0.8183 | 1.5119 |
| 298.15 | 0.8713 | 1.521 |
| 298.15 | 0.9361 | 1.534 |
| 298.15 | 1.0000 | 1.548 |
| 303.15 | 0.0762 | 1.4285 |
| 303.15 | 0.1303 | 1.4337 |
| 303.15 | 0.2045 | 1.4406 |
| 303.15 | 0.2713 | 1.4469 |
| 303.15 | 0.3461 | 1.4539 |
| 303.15 | 0.4173 | 1.4607 |
| 303.15 | 0.4857 | 1.4676 |
| 303.15 | 0.5454 | 1.474 |
| 303.15 | 0.6115 | 1.4818 |
| 303.15 | 0.6798 | 1.4905 |
| 303.15 | 0.7466 | 1.4999 |
| 303.15 | 0.8183 | 1.511 |
| 303.15 | 0.8713 | 1.5202 |
| 303.15 | 0.9361 | 1.5329 |
| 303.15 | 1.0000 | 1.546 |
| 308.15 | 0.0762 | 1.4271 |
| 308.15 | 0.1303 | 1.4325 |
| 308.15 | 0.2045 | 1.4396 |
| 308.15 | 0.2713 | 1.4459 |
| 308.15 | 0.3461 | 1.4525 |
| 308.15 | 0.4173 | 1.4591 |
| 308.15 | 0.4857 | 1.4658 |
| 308.15 | 0.5454 | 1.4718 |
| 308.15 | 0.6115 | 1.4792 |
| 308.15 | 0.6798 | 1.4877 |
| 308.15 | 0.7466 | 1.4969 |
| 308.15 | 0.8183 | 1.5078 |
| 308.15 | 0.8713 | 1.517 |
| 308.15 | 0.9361 | 1.5295 |
| 308.15 | 1.0000 | 1.543 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Benzene, 1,2,4-trichloro- (1) - Liquid | Mass density, kg/m3 - Liquid |
| 298.15 | 0.0762 | 863.97 |
| 298.15 | 0.1303 | 896.31 |
| 298.15 | 0.2045 | 939.57 |
| 298.15 | 0.2713 | 977.28 |
| 298.15 | 0.3461 | 1018.61 |
| 298.15 | 0.4173 | 1057.62 |
| 298.15 | 0.4857 | 1095.63 |
| 298.15 | 0.5454 | 1129.39 |
| 298.15 | 0.6115 | 1167.72 |
| 298.15 | 0.6798 | 1209.26 |
| 298.15 | 0.7466 | 1252.54 |
| 298.15 | 0.8183 | 1302.0 |
| 298.15 | 0.8713 | 1341.45 |
| 298.15 | 0.9361 | 1392.95 |
| 298.15 | 1.0000 | 1448.41 |
| 303.15 | 0.0762 | 860.11 |
| 303.15 | 0.1303 | 892.4 |
| 303.15 | 0.2045 | 935.51 |
| 303.15 | 0.2713 | 973.11 |
| 303.15 | 0.3461 | 1014.26 |
| 303.15 | 0.4173 | 1053.06 |
| 303.15 | 0.4857 | 1090.83 |
| 303.15 | 0.5454 | 1124.39 |
| 303.15 | 0.6115 | 1162.51 |
| 303.15 | 0.6798 | 1203.8 |
| 303.15 | 0.7466 | 1246.93 |
| 303.15 | 0.8183 | 1296.19 |
| 303.15 | 0.8713 | 1335.49 |
| 303.15 | 0.9361 | 1386.92 |
| 303.15 | 1.0000 | 1442.43 |
| 308.15 | 0.0762 | 855.92 |
| 308.15 | 0.1303 | 887.97 |
| 308.15 | 0.2045 | 930.81 |
| 308.15 | 0.2713 | 968.5 |
| 308.15 | 0.3461 | 1009.82 |
| 308.15 | 0.4173 | 1048.71 |
| 308.15 | 0.4857 | 1086.14 |
| 308.15 | 0.5454 | 1119.57 |
| 308.15 | 0.6115 | 1157.41 |
| 308.15 | 0.6798 | 1198.89 |
| 308.15 | 0.7466 | 1241.6 |
| 308.15 | 0.8183 | 1290.6 |
| 308.15 | 0.8713 | 1329.97 |
| 308.15 | 0.9361 | 1381.4 |
| 308.15 | 1.0000 | 1436.45 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Benzene, 1,2,4-trichloro- (1) - Liquid | Speed of sound, m/s - Liquid |
| 298.15 | 0.0762 | 1301.7 |
| 298.15 | 0.1303 | 1296.7 |
| 298.15 | 0.2045 | 1290.1 |
| 298.15 | 0.2713 | 1283.7 |
| 298.15 | 0.3461 | 1278.0 |
| 298.15 | 0.4173 | 1273.2 |
| 298.15 | 0.4857 | 1269.8 |
| 298.15 | 0.5454 | 1267.0 |
| 298.15 | 0.6115 | 1264.2 |
| 298.15 | 0.6798 | 1261.9 |
| 298.15 | 0.7466 | 1259.9 |
| 298.15 | 0.8183 | 1259.2 |
| 298.15 | 0.8713 | 1260.4 |
| 298.15 | 0.9361 | 1264.2 |
| 298.15 | 1.0000 | 1272.0 |
| 303.15 | 0.0762 | 1283.9 |
| 303.15 | 0.1303 | 1279.1 |
| 303.15 | 0.2045 | 1273.0 |
| 303.15 | 0.2713 | 1266.9 |
| 303.15 | 0.3461 | 1261.6 |
| 303.15 | 0.4173 | 1256.9 |
| 303.15 | 0.4857 | 1253.5 |
| 303.15 | 0.5454 | 1250.5 |
| 303.15 | 0.6115 | 1248.0 |
| 303.15 | 0.6798 | 1245.6 |
| 303.15 | 0.7466 | 1244.1 |
| 303.15 | 0.8183 | 1243.5 |
| 303.15 | 0.8713 | 1244.9 |
| 303.15 | 0.9361 | 1248.7 |
| 303.15 | 1.0000 | 1256.4 |
| 308.15 | 0.0762 | 1266.3 |
| 308.15 | 0.1303 | 1261.9 |
| 308.15 | 0.2045 | 1255.8 |
| 308.15 | 0.2713 | 1250.3 |
| 308.15 | 0.3461 | 1244.9 |
| 308.15 | 0.4173 | 1240.3 |
| 308.15 | 0.4857 | 1237.1 |
| 308.15 | 0.5454 | 1234.6 |
| 308.15 | 0.6115 | 1232.0 |
| 308.15 | 0.6798 | 1229.9 |
| 308.15 | 0.7466 | 1228.4 |
| 308.15 | 0.8183 | 1228.0 |
| 308.15 | 0.8713 | 1229.3 |
| 308.15 | 0.9361 | 1233.4 |
| 308.15 | 1.0000 | 1240.9 |
Sources
Note: These property values are available through the Cheméo API. A free account gives you an access key.