- Name
- 2(3H)-Furanone, dihydro-5-methyl-
- InChI
- InChI=1S/C5H8O2/c1-4-2-3-5(6)7-4/h4H,2-3H2,1H3
- InChI Key
- GAEKPEKOJKCEMS-UHFFFAOYSA-N
- Formula
- C5H8O2
- SMILES
- CC1CCC(=O)O1
- Mol. Weight (g/mol)
- 100.12
- CAS
- 108-29-2
- Name
- Water
- InChI
- InChI=1S/H2O/h1H2
- InChI Key
- XLYOFNOQVPJJNP-UHFFFAOYSA-N
- Formula
- H2O
- SMILES
- O
- Mol. Weight (g/mol)
- 18.02
- CAS
- 7732-18-5
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- Mole fraction (2)
- Excess molar enthalpy (molar enthalpy (2)
- n0 - Refractive index (Na D-line)
- ρl - Mass density, kg/m3 (2)
- Tboil(P) - Boiling temperature at pressure P, K
- Vapor or sublimation pressure, kPa
Mole fraction of Water (2) [ref]
| Fixed | Measured | |
|---|---|---|
| Mole fraction of Water (2) - Liquid | Temperature, K - Liquid | Mole fraction of Water (2) - Gas |
| 1.0000 | 373.20 | 1.0000 |
| 0.9986 | 373.20 | 0.9991 |
| 0.9983 | 373.20 | 0.9990 |
| 0.9967 | 373.20 | 0.9980 |
| 0.9917 | 373.20 | 0.9953 |
| 0.9891 | 373.20 | 0.9940 |
| 0.9862 | 373.20 | 0.9931 |
| 0.9849 | 373.20 | 0.9926 |
| 0.9815 | 373.20 | 0.9917 |
| 0.9775 | 373.30 | 0.9905 |
| 0.9720 | 373.40 | 0.9887 |
| 0.9275 | 373.70 | 0.9845 |
| 0.8270 | 374.10 | 0.9813 |
| 0.7943 | 374.20 | 0.9811 |
| 0.7222 | 374.50 | 0.9801 |
| 0.6641 | 375.00 | 0.9791 |
| 0.5990 | 375.50 | 0.9789 |
| 0.4780 | 377.60 | 0.9751 |
| 0.4481 | 378.50 | 0.9749 |
| 0.0000 | 480.20 | 0.0000 |
| 1.0000 | 354.80 | 1.0000 |
| 0.9866 | 354.90 | 0.9930 |
| 0.9579 | 354.90 | 0.9868 |
| 0.9567 | 355.00 | 0.9867 |
| 0.8030 | 355.50 | 0.9826 |
| 0.7801 | 355.80 | 0.9824 |
| 0.4952 | 357.30 | 0.9775 |
| 0.4575 | 359.20 | 0.9753 |
| 0.3252 | 361.80 | 0.9720 |
| 0.1983 | 372.40 | 0.9526 |
| 0.0000 | 451.50 | 0.0000 |
| 1.0000 | 319.60 | 1.0000 |
| 0.9967 | 319.60 | 0.9986 |
| 0.9826 | 319.80 | 0.9947 |
| 0.9361 | 320.00 | 0.9889 |
| 0.7984 | 320.30 | 0.9823 |
| 0.7509 | 320.30 | 0.9839 |
| 0.4994 | 321.20 | 0.9832 |
| 0.3052 | 323.10 | 0.9767 |
| 0.1853 | 329.80 | 0.9686 |
| 0.1099 | 340.10 | 0.9389 |
| 0.0000 | 401.40 | 0.0000 |
Mole fraction of Water (2) [ref]
| Fixed | Measured | |
|---|---|---|
| Mole fraction of Water (2) - Liquid | Temperature, K - Liquid | Mole fraction of Water (2) - Gas |
| 0.0000 | 350.18 | 0.0000 |
| 0.0510 | 350.18 | 0.8800 |
| 0.0970 | 350.19 | 0.9300 |
| 0.2000 | 350.19 | 0.9600 |
| 0.3010 | 350.19 | 0.9700 |
| 0.3960 | 350.19 | 0.9800 |
| 0.5010 | 350.20 | 0.9800 |
| 0.5510 | 350.19 | 0.9800 |
| 0.5930 | 350.24 | 0.9800 |
| 0.6060 | 350.19 | 0.9800 |
| 0.6930 | 350.24 | 0.9810 |
| 0.7960 | 350.24 | 0.9810 |
| 0.8980 | 350.23 | 0.9810 |
| 0.9688 | 350.23 | 0.9870 |
| 0.9878 | 350.21 | 0.9940 |
| 1.0000 | 350.12 | 1.0000 |
Excess molar enthalpy (molar enthalpy of mixing), kJ/mol [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of 2(3H)-Furanone, dihydro-5-methyl- (1) - Liquid | Excess molar enthalpy (molar enthalpy of mixing), kJ/mol - Liquid |
| 288.15 | 0.0057 | -0.0273 |
| 288.15 | 0.0047 | -0.0231 |
| 288.15 | 0.0038 | -0.0187 |
| 288.15 | 0.0028 | -0.0143 |
| 288.15 | 0.0019 | -0.0096 |
| 288.15 | 0.0009 | -0.0049 |
| 298.15 | 0.0057 | -0.0200 |
| 298.15 | 0.0057 | -0.0201 |
| 298.15 | 0.0047 | -0.0170 |
| 298.15 | 0.0047 | -0.0170 |
| 298.15 | 0.0038 | -0.0138 |
| 298.15 | 0.0038 | -0.0139 |
| 298.15 | 0.0028 | -0.0106 |
| 298.15 | 0.0028 | -0.0106 |
| 298.15 | 0.0019 | -0.0072 |
| 298.15 | 0.0019 | -0.0072 |
| 298.15 | 0.0009 | -0.0037 |
| 298.15 | 0.0009 | -0.0037 |
| 308.15 | 0.0057 | -0.0128 |
| 308.15 | 0.0057 | -0.0129 |
| 308.15 | 0.0047 | -0.0109 |
| 308.15 | 0.0047 | -0.0110 |
| 308.15 | 0.0038 | -0.0090 |
| 308.15 | 0.0038 | -0.0090 |
| 308.15 | 0.0028 | -0.0069 |
| 308.15 | 0.0028 | -0.0069 |
| 308.15 | 0.0019 | -0.0047 |
| 308.15 | 0.0019 | -0.0047 |
| 308.15 | 0.0009 | -0.0024 |
| 308.15 | 0.0009 | -0.0024 |
| 318.15 | 0.0057 | -0.0055 |
| 318.15 | 0.0057 | -0.0055 |
| 318.15 | 0.0047 | -0.0048 |
| 318.15 | 0.0047 | -0.0048 |
| 318.15 | 0.0038 | -0.0040 |
| 318.15 | 0.0038 | -0.0041 |
| 318.15 | 0.0028 | -0.0032 |
| 318.15 | 0.0028 | -0.0032 |
| 318.15 | 0.0019 | -0.0022 |
| 318.15 | 0.0019 | -0.0022 |
| 318.15 | 0.0009 | -0.0011 |
| 318.15 | 0.0009 | -0.0011 |
Excess molar enthalpy (molar enthalpy of mixing), kJ/mol [ref]
Operational condition: Pressure, kPa = 130 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Water (2) - Liquid | Excess molar enthalpy (molar enthalpy of mixing), kJ/mol - Liquid |
| 322.60 | 0.2040 | 0.8640 |
| 322.60 | 0.4010 | 1.043 |
| 322.60 | 0.5030 | 0.9690 |
| 322.60 | 0.6020 | 0.8230 |
| 322.60 | 0.6020 | 0.8260 |
| 322.60 | 0.7000 | 0.6350 |
| 322.60 | 0.8010 | 0.4060 |
| 322.60 | 0.9000 | 0.1680 |
| 322.60 | 0.9500 | 0.0484 |
| 303.20 | 0.0970 | 0.5200 |
| 303.20 | 0.2030 | 0.8260 |
| 303.20 | 0.3030 | 0.9280 |
| 303.20 | 0.4000 | 0.9070 |
| 303.20 | 0.5140 | 0.8120 |
| 303.20 | 0.6010 | 0.6290 |
| 303.20 | 0.7000 | 0.4460 |
| 303.20 | 0.8010 | 0.2430 |
| 303.20 | 0.9000 | 0.0430 |
| 303.20 | 0.8410 | 0.1620 |
| 303.20 | 0.8940 | 0.0530 |
| 303.20 | 0.9140 | 0.0129 |
| 303.20 | 0.9140 | 0.0100 |
| 303.20 | 0.9300 | -0.0183 |
| 303.20 | 0.9460 | -0.0410 |
| 303.20 | 0.9815 | -0.0760 |
| 303.20 | 0.9906 | -0.0430 |
| 303.20 | 0.9962 | -0.0174 |
| 303.20 | 0.9981 | -0.0088 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of 2(3H)-Furanone, dihydro-5-methyl- (1) - Liquid | Refractive index (Na D-line) - Liquid |
| 293.20 | 0.0000 | 1.3332 |
| 293.20 | 0.0158 | 1.342 |
| 293.20 | 0.0318 | 1.3505 |
| 293.20 | 0.0532 | 1.3591 |
| 293.20 | 0.0789 | 1.3682 |
| 293.20 | 0.1066 | 1.3761 |
| 293.20 | 0.1405 | 1.3837 |
| 293.20 | 0.1855 | 1.3913 |
| 293.20 | 0.2295 | 1.3987 |
| 293.20 | 0.2964 | 1.4062 |
| 293.20 | 0.3833 | 1.4135 |
| 293.20 | 0.5097 | 1.4204 |
| 293.20 | 0.7092 | 1.4273 |
| 293.20 | 1.0000 | 1.4339 |
| 298.20 | 0.0000 | 1.3327 |
| 298.20 | 0.0158 | 1.3411 |
| 298.20 | 0.0318 | 1.3499 |
| 298.20 | 0.0532 | 1.3585 |
| 298.20 | 0.0789 | 1.3671 |
| 298.20 | 0.1066 | 1.3751 |
| 298.20 | 0.1405 | 1.3826 |
| 298.20 | 0.1855 | 1.39 |
| 298.20 | 0.2295 | 1.397 |
| 298.20 | 0.2964 | 1.4046 |
| 298.20 | 0.3833 | 1.4119 |
| 298.20 | 0.5097 | 1.4186 |
| 298.20 | 0.7092 | 1.4259 |
| 298.20 | 1.0000 | 1.4316 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of 2(3H)-Furanone, dihydro-5-methyl- (1) - Liquid | Mass density, kg/m3 - Liquid |
| 288.15 | 0.0057 | 1002.113 |
| 288.15 | 0.0047 | 1001.619 |
| 288.15 | 0.0038 | 1001.124 |
| 288.15 | 0.0028 | 1000.622 |
| 288.15 | 0.0019 | 1000.117 |
| 288.15 | 0.0009 | 999.61 |
| 298.15 | 0.0057 | 999.717 |
| 298.15 | 0.0057 | 999.723 |
| 298.15 | 0.0047 | 999.28 |
| 298.15 | 0.0047 | 999.282 |
| 298.15 | 0.0038 | 998.843 |
| 298.15 | 0.0038 | 998.844 |
| 298.15 | 0.0028 | 998.399 |
| 298.15 | 0.0028 | 998.397 |
| 298.15 | 0.0019 | 997.952 |
| 298.15 | 0.0019 | 997.948 |
| 298.15 | 0.0009 | 997.5 |
| 298.15 | 0.0009 | 997.5 |
| 308.15 | 0.0057 | 996.412 |
| 308.15 | 0.0057 | 996.415 |
| 308.15 | 0.0047 | 996.023 |
| 308.15 | 0.0047 | 996.023 |
| 308.15 | 0.0038 | 995.634 |
| 308.15 | 0.0038 | 995.637 |
| 308.15 | 0.0028 | 995.239 |
| 308.15 | 0.0028 | 995.239 |
| 308.15 | 0.0019 | 994.839 |
| 308.15 | 0.0019 | 994.839 |
| 308.15 | 0.0009 | 994.435 |
| 308.15 | 0.0009 | 994.435 |
| 318.15 | 0.0057 | 992.329 |
| 318.15 | 0.0057 | 992.332 |
| 318.15 | 0.0047 | 991.985 |
| 318.15 | 0.0047 | 991.983 |
| 318.15 | 0.0038 | 991.641 |
| 318.15 | 0.0038 | 991.639 |
| 318.15 | 0.0028 | 991.289 |
| 318.15 | 0.0028 | 991.289 |
| 318.15 | 0.0019 | 990.933 |
| 318.15 | 0.0019 | 990.933 |
| 318.15 | 0.0009 | 990.572 |
| 318.15 | 0.0009 | 990.573 |
Mass density, kg/m3 [ref]
Operational condition: Temperature, K = 298.1 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Mass fraction of Water (2) - Liquid | Pressure, kPa - Liquid | Mass density, kg/m3 - Liquid |
| 1.0000 | 109.00 | 997.0 |
| 0.8997 | 109.00 | 1005.5 |
| 0.7999 | 109.00 | 1013.8 |
| 0.6999 | 108.00 | 1021.1 |
| 0.6000 | 107.00 | 1027.1 |
| 0.5000 | 107.00 | 1032.9 |
| 0.4000 | 107.00 | 1037.6 |
| 0.3025 | 107.00 | 1041.7 |
| 0.2005 | 107.00 | 1044.9 |
| 0.1004 | 107.00 | 1047.0 |
| 0.0000 | 107.00 | 1048.8 |
Boiling temperature at pressure P, K [ref]
| Fixed | Measured | |
|---|---|---|
| Pressure, kPa - Liquid | Mole fraction of Water (2) - Liquid | Boiling temperature at pressure P, K - Liquid |
| 101.33 | 1.0000 | 373.20 |
| 101.33 | 0.9986 | 373.20 |
| 101.33 | 0.9983 | 373.20 |
| 101.33 | 0.9967 | 373.20 |
| 101.33 | 0.9917 | 373.20 |
| 101.33 | 0.9891 | 373.20 |
| 101.33 | 0.9862 | 373.20 |
| 101.33 | 0.9849 | 373.20 |
| 101.33 | 0.9815 | 373.20 |
| 101.33 | 0.9775 | 373.30 |
| 101.33 | 0.9720 | 373.40 |
| 101.33 | 0.9275 | 373.70 |
| 101.33 | 0.8270 | 374.10 |
| 101.33 | 0.7943 | 374.20 |
| 101.33 | 0.7222 | 374.50 |
| 101.33 | 0.6641 | 375.00 |
| 101.33 | 0.5990 | 375.50 |
| 101.33 | 0.4780 | 377.60 |
| 101.33 | 0.4481 | 378.50 |
| 101.33 | 0.0000 | 480.20 |
| 50.60 | 1.0000 | 354.80 |
| 50.60 | 0.9866 | 354.90 |
| 50.60 | 0.9579 | 354.90 |
| 50.60 | 0.9567 | 355.00 |
| 50.60 | 0.8030 | 355.50 |
| 50.60 | 0.7801 | 355.80 |
| 50.60 | 0.4952 | 357.30 |
| 50.60 | 0.4575 | 359.20 |
| 50.60 | 0.3252 | 361.80 |
| 50.60 | 0.1983 | 372.40 |
| 50.60 | 0.0000 | 451.50 |
| 10.10 | 1.0000 | 319.60 |
| 10.10 | 0.9967 | 319.60 |
| 10.10 | 0.9826 | 319.80 |
| 10.10 | 0.9361 | 320.00 |
| 10.10 | 0.7984 | 320.30 |
| 10.10 | 0.7509 | 320.30 |
| 10.10 | 0.4994 | 321.20 |
| 10.10 | 0.3052 | 323.10 |
| 10.10 | 0.1853 | 329.80 |
| 10.10 | 0.1099 | 340.10 |
| 10.10 | 0.0000 | 401.40 |
Vapor or sublimation pressure, kPa [ref]
| Fixed | Measured | |
|---|---|---|
| Mole fraction of Water (2) - Liquid | Temperature, K - Liquid | Vapor or sublimation pressure, kPa - Gas |
| 0.0000 | 350.18 | 1.20 |
| 0.0510 | 350.18 | 9.50 |
| 0.0970 | 350.19 | 15.50 |
| 0.2000 | 350.19 | 25.60 |
| 0.3010 | 350.19 | 31.90 |
| 0.3960 | 350.19 | 35.80 |
| 0.5010 | 350.20 | 38.50 |
| 0.5510 | 350.19 | 39.40 |
| 0.5930 | 350.24 | 40.10 |
| 0.6060 | 350.19 | 40.40 |
| 0.6930 | 350.24 | 40.60 |
| 0.7960 | 350.24 | 40.90 |
| 0.8980 | 350.23 | 41.20 |
| 0.9688 | 350.23 | 41.70 |
| 0.9878 | 350.21 | 41.80 |
| 1.0000 | 350.12 | 41.90 |
Sources
- Vapor - Liquid Equilibria, Excess Enthalpy and Density of Aqueous Gamma-valerolactone Solutions
- Vapor-Liquid Equilibrium Study of the Gamma- Valerolactone-Water Binary System
- Thermal and Volumetric Properties of Five Lactones at Infinite Dilution in Water
Note: These property values are available through the Cheméo API. A free account gives you an access key.