- Name
- Carbon dioxide
- InChI
- InChI=1S/CO2/c2-1-3
- InChI Key
- CURLTUGMZLYLDI-UHFFFAOYSA-N
- Formula
- CO2
- SMILES
- O=C=O
- Mol. Weight (g/mol)
- 44.01
- CAS
- 124-38-9
- Name
- dl-«alpha»-Tocopherol
- InChI
- InChI=1S/C29H50O2/c1-20(2)12-9-13-21(3)14-10-15-22(4)16-11-18-29(8)19-17-26-25(7)27(30)23(5)24(6)28(26)31-29/h20-22,30H,9-19H2,1-8H3
- InChI Key
- GVJHHUAWPYXKBD-UHFFFAOYSA-N
- Formula
- C29H50O2
- SMILES
-
Cc1c(C)c2c(c(C)c1O)CCC(C)(CCCC
(C)CCCC(C)CCCC(C)C)O2 - Mol. Weight (g/mol)
- 430.71
- CAS
- 10191-41-0
- Name
- Capsaicin
- InChI
- InChI=1S/C18H27NO3/c1-14(2)8-6-4-5-7-9-18(21)19-13-15-10-11-16(20)17(12-15)22-3/h6,8,10-12,14,20H,4-5,7,9,13H2,1-3H3,(H,19,21)/b8-6+
- InChI Key
- YKPUWZUDDOIDPM-SOFGYWHQSA-N
- Formula
- C18H27NO3
- SMILES
-
COc1cc(CN=C(O)CCCCC=CC(C)C)ccc
1O - Mol. Weight (g/mol)
- 305.41
- CAS
- 404-86-4
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Mole fraction of dl-«alpha»-Tocopherol (2) [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Fluid (supercritical or subcritical phases) | Pressure, kPa - Fluid (supercritical or subcritical phases) | Mole fraction of dl-«alpha»-Tocopherol (2) - Fluid (supercritical or subcritical phases) |
| 308.15 | 10270.00 | 0.0002 |
| 308.15 | 12320.00 | 0.0003 |
| 308.15 | 14240.00 | 0.0006 |
| 308.15 | 16300.00 | 0.0010 |
| 308.15 | 18340.00 | 0.0014 |
| 308.15 | 20280.00 | 0.0015 |
| 308.15 | 22290.00 | 0.0017 |
| 308.15 | 24320.00 | 0.0018 |
| 308.15 | 26340.00 | 0.0021 |
| 308.15 | 28430.00 | 0.0023 |
| 308.15 | 30330.00 | 0.0025 |
| 308.15 | 32420.00 | 0.0029 |
| 308.15 | 35350.00 | 0.0037 |
| 328.15 | 10250.00 | 0.0002 |
| 328.15 | 12290.00 | 0.0003 |
| 328.15 | 14250.00 | 0.0006 |
| 328.15 | 16320.00 | 0.0010 |
| 328.15 | 18360.00 | 0.0012 |
| 328.15 | 20320.00 | 0.0017 |
| 328.15 | 22400.00 | 0.0021 |
| 328.15 | 24400.00 | 0.0026 |
| 328.15 | 26400.00 | 0.0029 |
| 328.15 | 28410.00 | 0.0031 |
| 328.15 | 30350.00 | 0.0034 |
| 328.15 | 32440.00 | 0.0035 |
| 328.15 | 35420.00 | 0.0038 |
Mole fraction of Capsaicin (3) [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Fluid (supercritical or subcritical phases) | Pressure, kPa - Fluid (supercritical or subcritical phases) | Mole fraction of Capsaicin (3) - Fluid (supercritical or subcritical phases) |
| 308.15 | 10270.00 | 0.0001 |
| 308.15 | 12320.00 | 0.0001 |
| 308.15 | 14240.00 | 0.0001 |
| 308.15 | 16300.00 | 0.0001 |
| 308.15 | 18340.00 | 0.0002 |
| 308.15 | 20280.00 | 0.0002 |
| 308.15 | 22290.00 | 0.0002 |
| 308.15 | 24320.00 | 0.0002 |
| 308.15 | 26340.00 | 0.0002 |
| 308.15 | 28430.00 | 0.0002 |
| 308.15 | 30330.00 | 0.0003 |
| 308.15 | 32420.00 | 0.0003 |
| 308.15 | 35350.00 | 0.0003 |
| 328.15 | 10250.00 | 0.0001 |
| 328.15 | 12290.00 | 0.0002 |
| 328.15 | 14250.00 | 0.0002 |
| 328.15 | 16320.00 | 0.0003 |
| 328.15 | 18360.00 | 0.0003 |
| 328.15 | 20320.00 | 0.0004 |
| 328.15 | 22400.00 | 0.0004 |
| 328.15 | 24400.00 | 0.0005 |
| 328.15 | 26400.00 | 0.0006 |
| 328.15 | 28410.00 | 0.0007 |
| 328.15 | 30350.00 | 0.0007 |
| 328.15 | 32440.00 | 0.0008 |
| 328.15 | 35420.00 | 0.0008 |
Sources
Note: These property values are available through the Cheméo API. A free account gives you an access key.