- InChI
- InChI=1S/C28H46O4/c1-3-5-7-9-11-13-15-19-23-31-27(29)25-21-17-18-22-26(25)28(30)32-24-20-16-14-12-10-8-6-4-2/h17-18,21-22H,3-16,19-20,23-24H2,1-2H3
- InChI Key
- PGIBJVOPLXHHGS-UHFFFAOYSA-N
- Formula
- C28H46O4
- SMILES
-
CCCCCCCCCCOC(=O)c1ccccc1C(=O)O
CCCCCCCCCC - Molecular Weight1
- 446.66
- CAS
- 84-77-5
- Other Names
-
- 1,2-Benzenedicarboxylic acid, didecyl ester
- 1,2-Benzenedicarboxylic acid, didecyl ester (iso)
- 1,2-benzenedicarboxylic acid, diisodecyl ester
- 3-methylnonyl 1,2-benzenedioate
- Bis(n-decyl)phthalate
- Decyl phthalate
- Di-n-decyl phthalate
- NLA-40
- Phthalic acid, didecyl ester
- Vinicizer 105
- Vinysize 105
- didecyl 1,2-benzenedicarboxylate
- diisodecyl phthalate
- ω : Acentric Factor.
- Cp,gas : Ideal gas heat capacity (J/mol×K).
- η : Dynamic viscosity (Pa×s).
- ΔfG° : Standard Gibbs free energy of formation (kJ/mol).
- ΔfH°gas : Enthalpy of formation at standard conditions (kJ/mol).
- ΔfusH° : Enthalpy of fusion at standard conditions (kJ/mol).
- ΔvapH° : Enthalpy of vaporization at standard conditions (kJ/mol).
- IE : Ionization energy (eV).
- log10WS : Log10 of Water solubility in mol/l.
- logPoct/wat : Octanol/Water partition coefficient.
- McVol : McGowan's characteristic volume (ml/mol).
- Pc : Critical Pressure (kPa).
- n0 : Refractive Index.
- ρl : Liquid Density (kg/m3).
- Inp : Non-polar retention indices.
- Tboil : Normal Boiling Point Temperature (K).
- Tc : Critical Temperature (K).
- Tfus : Normal melting (fusion) point (K).
- Vc : Critical Volume (m3/kmol).
- 1: Molecular weight from the IUPAC atomic weights tables.
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Contents
Physical Properties
| Property | Value | Unit | Source |
|---|---|---|---|
| ω | 1.2973 | Relay (1.0) Calculated Property | |
| ΔfG° | -180.18 | kJ/mol | Joback Calculated Property |
| ΔfH°gas | -987.81 | kJ/mol | Relay (1.0) Calculated Property |
| ΔfusH° | 67.50 | kJ/mol | Joback Calculated Property |
| ΔvapH° | 124.34 | kJ/mol | Relay (1.0) Calculated Property |
| IE | 9.40 | eV | Relay (1.0) Calculated Property |
| log10WS | -8.14 | Relay (1.0) Calculated Property | |
| logPoct/wat | 8.282 | Crippen Calculated Property | |
| McVol | 396.500 | ml/mol | McGowan Calculated Property |
| Pc | 940.00 | kPa | Critical Temperatures and Pressures of 12 Phthalates Using the Pulse-Heating Method |
| Inp | 3067.00 | NIST | |
| Tboil | 686.44 | K | Relay (1.0) Calculated Property |
| Tc | 887.09 | K | Relay (1.0) Calculated Property |
| Tfus | 291.76 | K | Relay (1.0) Calculated Property |
| Vc | 1.511 | m3/kmol | Relay (1.0) Calculated Property |
Temperature Dependent Properties
Datasets
Viscosity, Pa*s
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Pressure, kPa - Liquid | Viscosity, Pa*s - Liquid |
| 298.15 | 200.00 | 0.0876 |
| 298.15 | 10000.00 | 0.1121 |
| 298.15 | 20000.00 | 0.1434 |
| 298.15 | 40000.00 | 0.2309 |
| 298.15 | 200.00 | 0.0876 |
| 298.15 | 10000.00 | 0.1121 |
| 298.15 | 20000.00 | 0.1434 |
| 298.15 | 40000.00 | 0.2310 |
| 298.15 | 200.00 | 0.0876 |
| 298.15 | 10000.00 | 0.1123 |
| 298.15 | 20000.00 | 0.1437 |
| 298.15 | 40000.00 | 0.2311 |
| 298.15 | 200.00 | 0.0876 |
| 298.15 | 40000.00 | 0.2314 |
| 298.15 | 200.00 | 0.0876 |
| 298.15 | 40000.00 | 0.2316 |
| 298.15 | 200.00 | 0.0876 |
| 298.15 | 40000.00 | 0.2316 |
| 298.15 | 200.00 | 0.0877 |
| 298.15 | 200.00 | 0.0876 |
| 298.15 | 200.00 | 0.0877 |
| 298.15 | 200.00 | 0.0877 |
| 305.15 | 200.00 | 0.0570 |
| 305.15 | 200.00 | 0.0571 |
| 305.15 | 200.00 | 0.0571 |
| 305.15 | 200.00 | 0.0571 |
| 305.15 | 200.00 | 0.0572 |
| 313.15 | 200.00 | 0.0374 |
| 313.15 | 10100.00 | 0.0463 |
| 313.15 | 20000.00 | 0.0573 |
| 313.15 | 40000.00 | 0.0872 |
| 313.15 | 59900.00 | 0.1305 |
| 313.15 | 60000.00 | 0.1303 |
| 313.15 | 80000.00 | 0.1941 |
| 313.15 | 200.00 | 0.0374 |
| 313.15 | 10100.00 | 0.0463 |
| 313.15 | 20000.00 | 0.0573 |
| 313.15 | 40000.00 | 0.0871 |
| 313.15 | 59900.00 | 0.1303 |
| 313.15 | 80000.00 | 0.1944 |
| 313.15 | 200.00 | 0.0373 |
| 313.15 | 10100.00 | 0.0462 |
| 313.15 | 20000.00 | 0.0573 |
| 313.15 | 40000.00 | 0.0870 |
| 313.15 | 80000.00 | 0.1952 |
| 313.15 | 200.00 | 0.0371 |
| 313.15 | 200.00 | 0.0371 |
| 313.15 | 200.00 | 0.0371 |
| 343.15 | 200.00 | 0.0112 |
| 343.15 | 10100.00 | 0.0133 |
| 343.15 | 20100.00 | 0.0158 |
| 343.15 | 40000.00 | 0.0220 |
| 343.15 | 80100.00 | 0.0412 |
| 343.15 | 137100.00 | 0.0956 |
| 343.15 | 200.00 | 0.0112 |
| 343.15 | 10100.00 | 0.0133 |
| 343.15 | 20100.00 | 0.0159 |
| 343.15 | 40000.00 | 0.0221 |
| 343.15 | 80100.00 | 0.0412 |
| 343.15 | 137100.00 | 0.0956 |
| 343.15 | 200.00 | 0.0112 |
| 343.15 | 10100.00 | 0.0134 |
| 343.15 | 20100.00 | 0.0159 |
| 343.15 | 40000.00 | 0.0221 |
| 343.15 | 80100.00 | 0.0412 |
| 343.15 | 137100.00 | 0.0956 |
| 343.15 | 200.00 | 0.0110 |
| 343.15 | 200.00 | 0.0110 |
| 343.15 | 200.00 | 0.0110 |
| 368.15 | 300.00 | 0.0056 |
| 368.15 | 300.00 | 0.0056 |
| 368.15 | 300.00 | 0.0056 |
| 368.15 | 300.00 | 0.0056 |
| 373.15 | 300.00 | 0.0050 |
| 373.15 | 20100.00 | 0.0069 |
| 373.15 | 40000.00 | 0.0091 |
| 373.15 | 80100.00 | 0.0152 |
| 373.15 | 137200.00 | 0.0301 |
| 373.15 | 300.00 | 0.0050 |
| 373.15 | 20100.00 | 0.0069 |
| 373.15 | 40000.00 | 0.0091 |
| 373.15 | 80100.00 | 0.0152 |
| 373.15 | 137200.00 | 0.0301 |
| 373.15 | 300.00 | 0.0050 |
| 373.15 | 20100.00 | 0.0069 |
| 373.15 | 40000.00 | 0.0091 |
| 373.15 | 80100.00 | 0.0152 |
| 373.15 | 137200.00 | 0.0301 |
| 373.15 | 300.00 | 0.0049 |
| 373.15 | 300.00 | 0.0049 |
| 373.15 | 300.00 | 0.0049 |
| Reference | ||
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Pressure, kPa - Liquid | Viscosity, Pa*s - Liquid |
| 273.15 | 100.00 | 0.6258 |
| 273.15 | 9900.00 | 0.8451 |
| 298.15 | 100.00 | 0.0874 |
| 298.15 | 9600.00 | 0.1107 |
| 298.15 | 20600.00 | 0.1450 |
| 298.15 | 20700.00 | 0.1455 |
| 298.15 | 30100.00 | 0.1825 |
| 298.15 | 30300.00 | 0.1830 |
| 298.15 | 40700.00 | 0.2342 |
| 298.15 | 50200.00 | 0.2894 |
| 298.15 | 59200.00 | 0.3562 |
| 298.15 | 71600.00 | 0.4654 |
| 298.15 | 82000.00 | 0.5890 |
| 298.15 | 83300.00 | 0.6084 |
| 298.15 | 100.00 | 0.0874 |
| 313.15 | 100.00 | 0.0377 |
| 313.15 | 10900.00 | 0.0473 |
| 313.15 | 21200.00 | 0.0590 |
| 313.15 | 30600.00 | 0.0715 |
| 313.15 | 40900.00 | 0.0890 |
| 313.15 | 51600.00 | 0.1091 |
| 313.15 | 62400.00 | 0.1367 |
| 313.15 | 71300.00 | 0.1608 |
| 313.15 | 80300.00 | 0.1924 |
| 313.15 | 89800.00 | 0.2344 |
| 338.15 | 100.00 | 0.0131 |
| 338.15 | 9700.00 | 0.0155 |
| 338.15 | 10700.00 | 0.0163 |
| 338.15 | 19400.00 | 0.0186 |
| 338.15 | 20500.00 | 0.0194 |
| 338.15 | 31000.00 | 0.0233 |
| 338.15 | 31770.00 | 0.0230 |
| 338.15 | 40100.00 | 0.0272 |
| 338.15 | 41110.00 | 0.0269 |
| 338.15 | 50300.00 | 0.0324 |
| 338.15 | 51100.00 | 0.0319 |
| 338.15 | 60400.00 | 0.0383 |
| 338.15 | 60510.00 | 0.0373 |
| 338.15 | 70700.00 | 0.0452 |
| 338.15 | 70710.00 | 0.0436 |
| 338.15 | 80200.00 | 0.0525 |
| 338.15 | 80970.00 | 0.0517 |
| 338.15 | 100.00 | 0.0134 |
| 338.15 | 100.00 | 0.0134 |
| 338.15 | 100.00 | 0.0134 |
| 348.15 | 100.00 | 0.0097 |
| 348.15 | 9800.00 | 0.0115 |
| 348.15 | 20600.00 | 0.0137 |
| 348.15 | 30230.00 | 0.0160 |
| 348.15 | 31300.00 | 0.0163 |
| 348.15 | 40810.00 | 0.0189 |
| 348.15 | 50600.00 | 0.0221 |
| 348.15 | 50710.00 | 0.0221 |
| 348.15 | 61220.00 | 0.0259 |
| 348.15 | 69800.00 | 0.0298 |
| 348.15 | 72330.00 | 0.0306 |
| 348.15 | 85770.00 | 0.0372 |
| Reference | ||
Mass density, kg/m3
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Pressure, kPa - Liquid | Mass density, kg/m3 - Liquid |
| 283.15 | 100.00 | 974.5 |
| 283.15 | 200.00 | 974.5 |
| 283.15 | 400.00 | 974.6 |
| 283.15 | 600.00 | 974.7 |
| 283.15 | 800.00 | 974.9 |
| 283.15 | 1010.00 | 975.0 |
| 283.15 | 2000.00 | 975.5 |
| 283.15 | 3020.00 | 976.0 |
| 283.15 | 4000.00 | 976.6 |
| 283.15 | 5000.00 | 977.1 |
| 283.15 | 6000.00 | 977.7 |
| 283.15 | 6980.00 | 978.2 |
| 283.15 | 8010.00 | 978.7 |
| 283.15 | 9020.00 | 979.3 |
| 283.15 | 10030.00 | 979.8 |
| 283.15 | 15000.00 | 982.4 |
| 283.15 | 19970.00 | 985.0 |
| 283.15 | 25030.00 | 987.3 |
| 283.15 | 29980.00 | 989.8 |
| 283.15 | 35030.00 | 992.1 |
| 283.15 | 40000.00 | 994.5 |
| 283.15 | 45030.00 | 996.6 |
| 283.15 | 49980.00 | 998.8 |
| 283.15 | 55030.00 | 1000.9 |
| 283.15 | 59990.00 | 1002.6 |
| 283.15 | 64990.00 | 1005.1 |
| 288.15 | 100.00 | 970.7 |
| 288.15 | 200.00 | 970.8 |
| 288.15 | 420.00 | 970.9 |
| 288.15 | 600.00 | 971.0 |
| 288.15 | 790.00 | 971.1 |
| 288.15 | 1000.00 | 971.2 |
| 288.15 | 1990.00 | 971.7 |
| 288.15 | 3020.00 | 972.3 |
| 288.15 | 4010.00 | 972.9 |
| 288.15 | 5000.00 | 973.4 |
| 288.15 | 6010.00 | 974.0 |
| 288.15 | 7020.00 | 974.5 |
| 288.15 | 7980.00 | 975.0 |
| 288.15 | 9000.00 | 975.5 |
| 288.15 | 10000.00 | 976.1 |
| 288.15 | 14990.00 | 978.7 |
| 288.15 | 19970.00 | 981.4 |
| 288.15 | 25000.00 | 983.8 |
| 288.15 | 30000.00 | 986.4 |
| 288.15 | 34990.00 | 988.8 |
| 288.15 | 40020.00 | 991.1 |
| 288.15 | 45000.00 | 993.3 |
| 288.15 | 49980.00 | 995.7 |
| 288.15 | 54980.00 | 997.7 |
| 288.15 | 60000.00 | 999.9 |
| 288.15 | 65000.00 | 1002.0 |
| 293.15 | 100.00 | 967.0 |
| 293.15 | 200.00 | 967.1 |
| 293.15 | 400.00 | 967.2 |
| 293.15 | 630.00 | 967.3 |
| 293.15 | 790.00 | 967.4 |
| 293.15 | 1000.00 | 967.5 |
| 293.15 | 2010.00 | 968.1 |
| 293.15 | 3020.00 | 968.7 |
| 293.15 | 4020.00 | 969.2 |
| 293.15 | 4970.00 | 969.8 |
| 293.15 | 5980.00 | 970.3 |
| 293.15 | 7020.00 | 970.9 |
| 293.15 | 8000.00 | 971.5 |
| 293.15 | 9020.00 | 972.0 |
| 293.15 | 10010.00 | 972.6 |
| 293.15 | 15010.00 | 975.2 |
| 293.15 | 20000.00 | 977.9 |
| 293.15 | 25030.00 | 980.5 |
| 293.15 | 30020.00 | 983.0 |
| 293.15 | 35030.00 | 985.4 |
| 293.15 | 40010.00 | 987.8 |
| 293.15 | 44980.00 | 990.1 |
| 293.15 | 50020.00 | 992.4 |
| 293.15 | 55020.00 | 994.6 |
| 293.15 | 60020.00 | 996.8 |
| 293.15 | 65000.00 | 998.9 |
| 298.15 | 100.00 | 963.4 |
| 298.15 | 200.00 | 963.4 |
| 298.15 | 410.00 | 963.6 |
| 298.15 | 620.00 | 963.7 |
| 298.15 | 820.00 | 963.8 |
| 298.15 | 1000.00 | 963.9 |
| 298.15 | 2020.00 | 964.5 |
| 298.15 | 3040.00 | 965.0 |
| 298.15 | 4030.00 | 965.7 |
| 298.15 | 4980.00 | 966.2 |
| 298.15 | 6070.00 | 966.8 |
| 298.15 | 7020.00 | 967.3 |
| 298.15 | 8040.00 | 967.9 |
| 298.15 | 9040.00 | 968.5 |
| 298.15 | 10030.00 | 969.0 |
| 298.15 | 15010.00 | 971.7 |
| 298.15 | 19990.00 | 974.4 |
| 298.15 | 25000.00 | 977.0 |
| 298.15 | 30020.00 | 979.6 |
| 298.15 | 35000.00 | 982.1 |
| 298.15 | 40020.00 | 984.5 |
| 298.15 | 44970.00 | 986.9 |
| 298.15 | 49990.00 | 989.2 |
| 298.15 | 54970.00 | 991.4 |
| 298.15 | 60000.00 | 993.7 |
| 298.15 | 65020.00 | 995.8 |
| 303.15 | 100.00 | 959.7 |
| 303.15 | 200.00 | 959.8 |
| 303.15 | 400.00 | 959.9 |
| 303.15 | 580.00 | 960.0 |
| 303.15 | 800.00 | 960.2 |
| 303.15 | 1000.00 | 960.3 |
| 303.15 | 2000.00 | 960.9 |
| 303.15 | 2990.00 | 961.4 |
| 303.15 | 4000.00 | 962.0 |
| 303.15 | 5000.00 | 962.6 |
| 303.15 | 6000.00 | 963.2 |
| 303.15 | 7000.00 | 963.8 |
| 303.15 | 7980.00 | 964.3 |
| 303.15 | 9000.00 | 964.9 |
| 303.15 | 10020.00 | 965.5 |
| 303.15 | 14970.00 | 968.2 |
| 303.15 | 20010.00 | 971.0 |
| 303.15 | 25030.00 | 973.6 |
| 303.15 | 30020.00 | 976.3 |
| 303.15 | 35000.00 | 978.8 |
| 303.15 | 40000.00 | 981.2 |
| 303.15 | 45000.00 | 983.6 |
| 303.15 | 50010.00 | 986.0 |
| 303.15 | 54980.00 | 988.3 |
| 303.15 | 60000.00 | 990.5 |
| 303.15 | 64990.00 | 992.7 |
| 308.15 | 100.00 | 956.2 |
| 308.15 | 200.00 | 956.2 |
| 308.15 | 410.00 | 956.4 |
| 308.15 | 610.00 | 956.5 |
| 308.15 | 800.00 | 956.6 |
| 308.15 | 1000.00 | 956.7 |
| 308.15 | 2010.00 | 957.3 |
| 308.15 | 3020.00 | 957.9 |
| 308.15 | 4000.00 | 958.5 |
| 308.15 | 5000.00 | 959.1 |
| 308.15 | 6000.00 | 959.7 |
| 308.15 | 7020.00 | 960.3 |
| 308.15 | 8000.00 | 960.8 |
| 308.15 | 9020.00 | 961.4 |
| 308.15 | 10000.00 | 962.0 |
| 308.15 | 15010.00 | 964.8 |
| 308.15 | 19990.00 | 967.6 |
| 308.15 | 25000.00 | 970.3 |
| 308.15 | 30010.00 | 973.0 |
| 308.15 | 35000.00 | 975.5 |
| 308.15 | 39990.00 | 978.0 |
| 308.15 | 44990.00 | 980.4 |
| 308.15 | 50010.00 | 982.9 |
| 308.15 | 55000.00 | 985.2 |
| 308.15 | 60000.00 | 987.4 |
| 308.15 | 65000.00 | 989.7 |
| 313.15 | 100.00 | 952.6 |
| 313.15 | 200.00 | 952.6 |
| 313.15 | 400.00 | 952.8 |
| 313.15 | 620.00 | 952.9 |
| 313.15 | 800.00 | 953.0 |
| 313.15 | 1030.00 | 953.1 |
| 313.15 | 2010.00 | 953.7 |
| 313.15 | 3000.00 | 954.3 |
| 313.15 | 4000.00 | 955.0 |
| 313.15 | 5020.00 | 955.5 |
| 313.15 | 5990.00 | 956.2 |
| 313.15 | 7030.00 | 956.7 |
| 313.15 | 8000.00 | 957.4 |
| 313.15 | 9020.00 | 957.9 |
| 313.15 | 10010.00 | 958.5 |
| 313.15 | 15010.00 | 961.4 |
| 313.15 | 20000.00 | 964.2 |
| 313.15 | 25030.00 | 967.0 |
| 313.15 | 30000.00 | 969.7 |
| 313.15 | 35020.00 | 972.2 |
| 313.15 | 40020.00 | 974.8 |
| 313.15 | 45010.00 | 977.2 |
| 313.15 | 49970.00 | 979.7 |
| 313.15 | 55000.00 | 982.0 |
| 313.15 | 59980.00 | 984.4 |
| 313.15 | 64970.00 | 986.6 |
| 323.15 | 100.00 | 945.4 |
| 323.15 | 210.00 | 945.5 |
| 323.15 | 400.00 | 945.6 |
| 323.15 | 600.00 | 945.7 |
| 323.15 | 800.00 | 945.9 |
| 323.15 | 1000.00 | 946.0 |
| 323.15 | 2000.00 | 946.6 |
| 323.15 | 3030.00 | 947.2 |
| 323.15 | 4030.00 | 947.9 |
| 323.15 | 5020.00 | 948.5 |
| 323.15 | 6010.00 | 949.1 |
| 323.15 | 7000.00 | 949.7 |
| 323.15 | 8000.00 | 950.3 |
| 323.15 | 9010.00 | 950.9 |
| 323.15 | 10020.00 | 951.6 |
| 323.15 | 15000.00 | 954.5 |
| 323.15 | 20010.00 | 957.5 |
| 323.15 | 25030.00 | 960.3 |
| 323.15 | 30010.00 | 963.2 |
| 323.15 | 34970.00 | 965.8 |
| 323.15 | 40000.00 | 968.5 |
| 323.15 | 45000.00 | 970.9 |
| 323.15 | 49980.00 | 973.5 |
| 323.15 | 54980.00 | 975.8 |
| 323.15 | 60000.00 | 978.3 |
| 323.15 | 65000.00 | 980.6 |
| 333.15 | 100.00 | 938.3 |
| 333.15 | 200.00 | 938.4 |
| 333.15 | 400.00 | 938.5 |
| 333.15 | 630.00 | 938.7 |
| 333.15 | 800.00 | 938.8 |
| 333.15 | 1000.00 | 938.9 |
| 333.15 | 2010.00 | 939.6 |
| 333.15 | 3000.00 | 940.2 |
| 333.15 | 4000.00 | 940.9 |
| 333.15 | 5000.00 | 941.5 |
| 333.15 | 6000.00 | 942.2 |
| 333.15 | 7030.00 | 942.8 |
| 333.15 | 7980.00 | 943.5 |
| 333.15 | 9010.00 | 944.1 |
| 333.15 | 10030.00 | 944.8 |
| 333.15 | 14990.00 | 947.9 |
| 333.15 | 20000.00 | 951.0 |
| 333.15 | 25000.00 | 953.8 |
| 333.15 | 30020.00 | 956.7 |
| 333.15 | 34990.00 | 959.4 |
| 333.15 | 39970.00 | 962.2 |
| 333.15 | 45020.00 | 964.8 |
| 333.15 | 50000.00 | 967.4 |
| 333.15 | 55020.00 | 969.8 |
| 333.15 | 60000.00 | 972.3 |
| 333.15 | 65000.00 | 974.7 |
| 343.15 | 100.00 | 931.2 |
| 343.15 | 220.00 | 931.3 |
| 343.15 | 430.00 | 931.5 |
| 343.15 | 610.00 | 931.6 |
| 343.15 | 810.00 | 931.8 |
| 343.15 | 1000.00 | 931.9 |
| 343.15 | 2000.00 | 932.6 |
| 343.15 | 3000.00 | 933.3 |
| 343.15 | 3980.00 | 934.0 |
| 343.15 | 5010.00 | 934.6 |
| 343.15 | 5980.00 | 935.3 |
| 343.15 | 7000.00 | 936.0 |
| 343.15 | 7990.00 | 936.6 |
| 343.15 | 9020.00 | 937.3 |
| 343.15 | 9980.00 | 937.9 |
| 343.15 | 15010.00 | 941.2 |
| 343.15 | 19990.00 | 944.3 |
| 343.15 | 25010.00 | 947.4 |
| 343.15 | 29980.00 | 950.4 |
| 343.15 | 35030.00 | 953.3 |
| 343.15 | 40030.00 | 956.1 |
| 343.15 | 45010.00 | 958.7 |
| 343.15 | 50050.00 | 961.4 |
| 343.15 | 55000.00 | 964.0 |
| 343.15 | 60000.00 | 966.5 |
| 343.15 | 65020.00 | 968.9 |
| 353.15 | 100.00 | 924.2 |
| 353.15 | 200.00 | 924.3 |
| 353.15 | 410.00 | 924.5 |
| 353.15 | 630.00 | 924.6 |
| 353.15 | 800.00 | 924.8 |
| 353.15 | 1010.00 | 924.9 |
| 353.15 | 2000.00 | 925.6 |
| 353.15 | 3000.00 | 926.3 |
| 353.15 | 3980.00 | 927.0 |
| 353.15 | 4990.00 | 927.7 |
| 353.15 | 6000.00 | 928.4 |
| 353.15 | 7000.00 | 929.1 |
| 353.15 | 8010.00 | 929.8 |
| 353.15 | 9000.00 | 930.5 |
| 353.15 | 10010.00 | 931.2 |
| 353.15 | 15040.00 | 934.6 |
| 353.15 | 20000.00 | 937.9 |
| 353.15 | 24970.00 | 941.0 |
| 353.15 | 29980.00 | 944.1 |
| 353.15 | 35010.00 | 947.1 |
| 353.15 | 40000.00 | 950.0 |
| 353.15 | 45000.00 | 952.7 |
| 353.15 | 49990.00 | 955.5 |
| 353.15 | 55000.00 | 958.1 |
| 353.15 | 60010.00 | 960.7 |
| 353.15 | 65020.00 | 963.2 |
| 363.15 | 100.00 | 917.2 |
| 363.15 | 200.00 | 917.3 |
| 363.15 | 420.00 | 917.4 |
| 363.15 | 600.00 | 917.6 |
| 363.15 | 800.00 | 917.7 |
| 363.15 | 990.00 | 917.9 |
| 363.15 | 2000.00 | 918.6 |
| 363.15 | 2980.00 | 919.4 |
| 363.15 | 3960.00 | 920.1 |
| 363.15 | 4970.00 | 920.9 |
| 363.15 | 5990.00 | 921.6 |
| 363.15 | 7020.00 | 922.3 |
| 363.15 | 7980.00 | 923.0 |
| 363.15 | 9030.00 | 923.8 |
| 363.15 | 10000.00 | 924.5 |
| 363.15 | 15000.00 | 928.0 |
| 363.15 | 19990.00 | 931.4 |
| 363.15 | 25010.00 | 934.7 |
| 363.15 | 30020.00 | 937.9 |
| 363.15 | 34980.00 | 940.9 |
| 363.15 | 39990.00 | 943.9 |
| 363.15 | 44980.00 | 946.8 |
| 363.15 | 49990.00 | 949.6 |
| 363.15 | 55000.00 | 952.3 |
| 363.15 | 60040.00 | 955.0 |
| 363.15 | 64990.00 | 957.6 |
| Reference | ||
Similar Compounds
Find more compounds similar to Didecyl phthalate.
Sources
- Cheméo Relay (1.0)
- Crippen Method
- Crippen Method
- Study of the effects of pressure on the viscosity and density of diisodecyl phthalate
- Thermodynamic properties and equation of state of liquid di-isodecyl phthalate at temperature between (273 and 423) K and at pressures up to 140 MPa
- New Measurements of the Viscosity of Diisodecyl Phthalate Using a Vibrating Wire Technique
- Critical Temperatures and Pressures of 12 Phthalates Using the Pulse-Heating Method
- Temperature and Pressure Dependence of the Viscosity of Diisodecyl Phthalate at Temperatures between (0 and 100) deg C and at Pressures to 1 GPa
- Density of Diisodecyl Phthalate at Temperatures from (283.15 to 363.15) K and Pressures from (0.1 to 65) MPa
- Viscosity of Liquid Di-isodecyl Phthalate at Temperatures Between (274 and 373) K and at Pressures up to 140 MPa
- Density and Viscosity of Diisodecyl Phthalate C6H4(COOC10H21)2, with Nominal Viscosity at T ) 298 K and p ) 0.1 MPa of 87 mPaas, at Temperatures from (298.15 to 423.15) K and Pressures up to 70 MPa
- Viscosity of Diisodecyl Phthalate by Surface Light Scattering (SLS)
- Viscosity Measurements of Diisodecyl Phthalate Using a Vibrating Wire Instrument Operated In Free Decay Mode: Comparison with Results Obtained with the Forced Mode of Operation
- Temperature and Pressure Dependence of the Viscosities of 2-Ethylhexyl Benzoate, Bis(2-ethylhexyl) Phthalate, 2,6,10,15,19,23-Hexamethyltetracosane (Squalane), and Diisodecyl Phthalate
- Joback Method
- KDB
- McGowan Method
- NIST Webbook
Note: Cheméo is only indexing the data, follow the source links to retrieve the latest data. The source is also providing more information like the publication year, authors and more. Take the time to validate and double check the source of the data.