- InChI
- InChI=1S/C3H9N/c1-4(2)3/h1-3H3
- InChI Key
- GETQZCLCWQTVFV-UHFFFAOYSA-N
- Formula
- C3H9N
- SMILES
- CN(C)C
- Molecular Weight1
- 59.11
- CAS
- 75-50-3
- Other Names
-
- N,N-DIMETHYL-METHYLAMINE
- N,N-dimethylmethanamine
- TMA
- UN 1083
- UN 1297
- methanamine, N,N-dimethyl-
- trimethylamine
- ω : Acentric Factor.
- PAff : Proton affinity (kJ/mol).
- BasG : Gas basicity (kJ/mol).
- ΔcH°liquid : Standard liquid enthalpy of combustion (kJ/mol).
- Cp,gas : Ideal gas heat capacity (J/mol×K).
- Cp,liquid : Liquid phase heat capacity (J/mol×K).
- μ : Dipole Moment (debye).
- η : Dynamic viscosity (Pa×s).
- ΔfG° : Standard Gibbs free energy of formation (kJ/mol).
- Rg : Radius of Gyration.
- ΔfH°gas : Enthalpy of formation at standard conditions (kJ/mol).
- ΔfH°liquid : Liquid phase enthalpy of formation at standard conditions (kJ/mol).
- ΔfusH° : Enthalpy of fusion at standard conditions (kJ/mol).
- ΔfusH : Enthalpy of fusion at a given temperature (kJ/mol).
- ΔvapH° : Enthalpy of vaporization at standard conditions (kJ/mol).
- ΔvapH : Enthalpy of vaporization at a given temperature (kJ/mol).
- IE : Ionization energy (eV).
- log10WS : Log10 of Water solubility in mol/l.
- logPoct/wat : Octanol/Water partition coefficient.
- McVol : McGowan's characteristic volume (ml/mol).
- NFPA Fire : NFPA Fire Rating.
- NFPA Health : NFPA Health Rating.
- Pc : Critical Pressure (kPa).
- Ptriple : Triple Point Pressure (kPa).
- Pvap : Vapor pressure (kPa).
- ρl : Liquid Density (kg/m3).
- Inp : Non-polar retention indices.
- I : Polar retention indices.
- ΔfusS : Entropy of fusion at a given temperature (J/mol×K).
- S°liquid : Liquid phase molar entropy at standard conditions (J/mol×K).
- γ : Surface Tension (N/m).
- ΔvapS : Entropy of vaporization at a given temperature (J/mol×K).
- Tboil : Normal Boiling Point Temperature (K).
- Tc : Critical Temperature (K).
- λ : Gas thermal conductivity (W/m×K).
- λ : Liquid thermal conductivity (W/m×K).
- Tfus : Normal melting (fusion) point (K).
- Ttriple : Triple Point Temperature (K).
- UQi : UNIQUAC Qi Parameter.
- URi : UNIQUAC Ri Parameter.
- Vc : Critical Volume (m3/kmol).
- Zc : Critical Compressibility.
- Zra : Rackett Parameter.
- 1: Molecular weight from the IUPAC atomic weights tables.
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Physical Properties
| Property | Value | Unit | Source |
|---|---|---|---|
| ω | [0.2050; 0.2062] |
|
|
| ω | 0.2062 | ChemSep v8.3 pure component data | |
| ω | 0.2050 | KDB | |
| PAff | 948.90 | kJ/mol | NIST |
| BasG | 918.10 | kJ/mol | NIST |
| ΔcH°liquid | [-2484.00; -2430.00] | kJ/mol |
|
| ΔcH°liquid | -2484.00 | kJ/mol | NIST |
| ΔcH°liquid | -2430.00 | kJ/mol | NIST |
| μ | [0.60; 0.61] | debye |
|
| μ | 0.61 | debye | ChemSep v8.3 pure component data |
| μ | 0.60 | debye | KDB |
| ΔfG° | [98.98; 98.99] | kJ/mol |
|
| ΔfG° | 98.99 | kJ/mol | ChemSep v8.3 pure component data |
| ΔfG° | 98.98 | kJ/mol | KDB |
| Rg | 2.7360 | KDB | |
| ΔfH°gas | [-30.70; -23.70] | kJ/mol |
|
| ΔfH°gas | -24.31 | kJ/mol | ChemSep v8.3 pure component data |
| ΔfH°gas | -23.86 | kJ/mol | KDB |
| ΔfH°gas | -23.70 ± 0.75 | kJ/mol | NIST |
| ΔfH°gas | -30.70 | kJ/mol | NIST |
| ΔfH°liquid | [-52.70; -45.73] | kJ/mol |
|
| ΔfH°liquid | -45.73 ± 0.71 | kJ/mol | NIST |
| ΔfH°liquid | -52.70 | kJ/mol | NIST |
| ΔfusH° | 6.55 | kJ/mol | Joback Calculated Property |
| ΔvapH° | [22.00; 22.18] | kJ/mol |
|
| ΔvapH° | 22.18 | kJ/mol | NIST |
| ΔvapH° | 22.00 ± 0.08 | kJ/mol | NIST |
| ΔvapH° | 22.00 | kJ/mol | NIST |
| IE | [7.80; 8.56] | eV |
|
| IE | 7.85 ± 0.05 | eV | NIST |
| IE | 7.80 | eV | NIST |
| IE | 8.40 | eV | NIST |
| IE | 7.80 ± 0.10 | eV | NIST |
| IE | 7.88 | eV | NIST |
| IE | 7.83 ± 0.05 | eV | NIST |
| IE | 7.83 ± 0.02 | eV | NIST |
| IE | 7.95 ± 0.10 | eV | NIST |
| IE | 7.80 | eV | NIST |
| IE | 7.82 ± 0.02 | eV | NIST |
| IE | 8.54 | eV | NIST |
| IE | 8.47 | eV | NIST |
| IE | 8.45 | eV | NIST |
| IE | 8.44 | eV | NIST |
| IE | 8.56 | eV | NIST |
| IE | 8.54 | eV | NIST |
| IE | 8.50 | eV | NIST |
| IE | 8.45 ± 0.01 | eV | NIST |
| IE | 8.50 ± 0.10 | eV | NIST |
| log10WS | 0.84 | Aq. Solubility Prediction | |
| logPoct/wat | 0.178 | Crippen Calculated Property | |
| McVol | 63.110 | ml/mol | McGowan Calculated Property |
| NFPA Fire | 4 | KDB | |
| NFPA Health | 2 | KDB | |
| Pc | [4075.00; 4087.00] | kPa |
|
| Pc | 4075.00 | kPa | ChemSep v8.3 pure component data |
| Pc | 4075.00 | kPa | Air Liquide Gas Encyclopedia |
| Pc | 4087.00 | kPa | KDB |
| Pc | 4087.00 ± 3.00 | kPa | NIST |
| Pc | 4077.12 ± 10.66 | kPa | NIST |
| Ptriple | 9.92e-03 | kPa | ChemSep v8.3 pure component data |
| Inp | [479.00; 518.00] |
|
|
| Inp | 479.00 | NIST | |
| Inp | 518.00 | NIST | |
| Inp | 503.00 | NIST | |
| Inp | 479.00 | NIST | |
| Inp | 518.00 | NIST | |
| Inp | 503.00 | NIST | |
| I | [546.00; 610.00] |
|
|
| I | 576.00 | NIST | |
| I | 570.00 | NIST | |
| I | 609.00 | NIST | |
| I | 609.00 | NIST | |
| I | 570.00 | NIST | |
| I | 553.00 | NIST | |
| I | 546.00 | NIST | |
| I | 554.00 | NIST | |
| I | 570.00 | NIST | |
| I | 561.00 | NIST | |
| I | 610.00 | NIST | |
| I | 609.00 | NIST | |
| I | 546.00 | NIST | |
| S°liquid | 197.82 | J/mol×K | NIST |
| Tboil | [270.15; 276.65] | K |
|
| Tboil | 276.02 | K | ChemSep v8.3 pure component data |
| Tboil | 276.02 | K | KDB |
| Tboil | 276.10 | K | NIST |
| Tboil | 276.00 | K | NIST |
| Tboil | 276.65 ± 1.00 | K | NIST |
| Tboil | 276.05 ± 0.10 | K | NIST |
| Tboil | 276.65 ± 2.00 | K | NIST |
| Tboil | Outlier 270.15 ± 3.00 | K | NIST |
| Tc | [432.79; 433.30] | K |
|
| Tc | 433.30 | K | ChemSep v8.3 pure component data |
| Tc | 433.15 | K | Air Liquide Gas Encyclopedia |
| Tc | 432.79 | K | KDB |
| Tc | 433.20 | K | NIST |
| Tc | 432.79 ± 0.15 | K | NIST |
| Tc | 433.30 ± 0.30 | K | NIST |
| Tfus | [149.15; 156.11] | K |
|
| Tfus | 156.08 | K | ChemSep v8.3 pure component data |
| Tfus | 156.00 | K | KDB |
| Tfus | 156.11 | K | Aq. Solubility Prediction |
| Tfus | 155.95 ± 0.20 | K | NIST |
| Tfus | 149.40 ± 0.50 | K | NIST |
| Tfus | 155.95 ± 2.00 | K | NIST |
| Tfus | 155.85 ± 0.50 | K | NIST |
| Tfus | 149.15 ± 1.00 | K | NIST |
| Ttriple | [156.08; 156.08] | K |
|
| Ttriple | 156.08 | K | ChemSep v8.3 pure component data |
| Ttriple | 156.08 ± 0.05 | K | NIST |
| Ttriple | 156.08 ± 0.05 | K | NIST |
| UQi | 2.64 | ChemSep v8.3 pure component data | |
| URi | 2.99 | ChemSep v8.3 pure component data | |
| Vc | [0.254; 30.000] | m3/kmol |
|
| Vc | 0.254 | m3/kmol | ChemSep v8.3 pure component data |
| Vc | 0.254 | m3/kmol | KDB |
| Vc | 30.000 ± 0.070 | m3/kmol | NIST |
| Zc | [0.2660000; 0.2884860] |
|
|
| Zc | 0.2660000 | ChemSep v8.3 pure component data | |
| Zc | 0.2884860 | KDB | |
| Zra | 0.27 | KDB |
Temperature Dependent Properties
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| Cp,liquid | 132.55 | J/mol×K | 280.00 | NIST |
| ΔfusH | [6.54; 6.54] | kJ/mol | [156.08; 156.10] |
|
| ΔfusH | 6.54 | kJ/mol | 156.08 | NIST |
| ΔfusH | 6.54 | kJ/mol | 156.08 | NIST |
| ΔfusH | 6.54 | kJ/mol | 156.10 | NIST |
| ΔvapH | [22.94; 24.60] | kJ/mol | [234.50; 368.00] |
|
| ΔvapH | 24.60 | kJ/mol | 234.50 | NIST |
| ΔvapH | 24.60 | kJ/mol | 234.50 | NIST |
| ΔvapH | 24.50 | kJ/mol | 250.00 | NIST |
| ΔvapH | 24.50 | kJ/mol | 250.00 | NIST |
| ΔvapH | 24.10 | kJ/mol | 276.00 | KDB |
| ΔvapH | 22.94 | kJ/mol | 276.00 | NIST |
| ΔvapH | 22.94 | kJ/mol | 276.03 | NIST |
| ΔvapH | 22.94 ± 0.03 | kJ/mol | 276.03 | NIST |
| ΔvapH | 22.94 | kJ/mol | 276.03 | NIST |
| ΔvapH | 24.35 | kJ/mol | 276.20 | NIST |
| ΔvapH | 24.10 | kJ/mol | 293.00 | NIST |
| ΔvapH | 23.00 | kJ/mol | 368.00 | NIST |
| ρl | 633.00 | kg/m3 | 293.00 | KDB |
| ΔfusS | [41.93; 41.93] | J/mol×K | [156.08; 156.08] |
|
| ΔfusS | 41.93 | J/mol×K | 156.08 | NIST |
| ΔfusS | 41.93 | J/mol×K | 156.08 | NIST |
| γ | 0.01 | N/m | 293.20 | KDB |
| ΔvapS | [83.10; 83.10] | J/mol×K | [276.03; 276.03] |
|
| ΔvapS | 83.10 | J/mol×K | 276.03 | NIST |
| ΔvapS | 83.10 | J/mol×K | 276.03 | NIST |
Correlations
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| Cp,gas | [72.67; 243.92] | J/mol×K | [200.00; 1500.00] |
ChemSep v8.3 pure component data
|
| Equation | Y = A + exp(B/T + C + D·T + E·T²) Y is Cp,gas in J/mol×K, T in K | |||
| Coefficient A | 6.52030e+01 | |||
| Coefficient B | -7.94870e+02 | |||
| Coefficient C | 6.04524e+00 | |||
| Coefficient D | -3.16340e-04 | |||
| Coefficient E | 6.44260e-08 | |||
| Comment | ChemSep eq 16, IdealGasHeatCapacityCp | |||
| Temperature range, min. | 200.00 | |||
| Temperature range, max. | 1500.00 | |||
| Cp,gas | 72.67 | J/mol×K | 200.00 | Calculated Property |
| Cp,gas | 103.15 | J/mol×K | 344.44 | Calculated Property |
| Cp,gas | 137.45 | J/mol×K | 488.89 | Calculated Property |
| Cp,gas | 166.26 | J/mol×K | 633.33 | Calculated Property |
| Cp,gas | 188.70 | J/mol×K | 777.78 | Calculated Property |
| Cp,gas | 205.87 | J/mol×K | 922.22 | Calculated Property |
| Cp,gas | 219.05 | J/mol×K | 1066.67 | Calculated Property |
| Cp,gas | 229.28 | J/mol×K | 1211.11 | Calculated Property |
| Cp,gas | 237.36 | J/mol×K | 1355.56 | Calculated Property |
| Cp,gas | 243.92 | J/mol×K | 1500.00 | Calculated Property |
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| Cp,liquid | [115.22; 131.98] | J/mol×K | [156.08; 276.02] |
ChemSep v8.3 pure component data
|
| Equation | Y = A + exp(B/T + C + D·T + E·T²) Y is Cp,liquid in J/mol×K, T in K | |||
| Coefficient A | 1.12140e+02 | |||
| Coefficient B | 1.25330e+03 | |||
| Coefficient C | -1.98128e+01 | |||
| Coefficient D | 1.04240e-01 | |||
| Coefficient E | -1.37980e-04 | |||
| Comment | ChemSep eq 16, LiquidHeatCapacityCp | |||
| Temperature range, min. | 156.08 | |||
| Temperature range, max. | 276.02 | |||
| Cp,liquid | 115.22 | J/mol×K | 156.08 | Calculated Property |
| Cp,liquid | 115.75 | J/mol×K | 169.41 | Calculated Property |
| Cp,liquid | 116.56 | J/mol×K | 182.73 | Calculated Property |
| Cp,liquid | 117.69 | J/mol×K | 196.06 | Calculated Property |
| Cp,liquid | 119.17 | J/mol×K | 209.39 | Calculated Property |
| Cp,liquid | 121.04 | J/mol×K | 222.71 | Calculated Property |
| Cp,liquid | 123.32 | J/mol×K | 236.04 | Calculated Property |
| Cp,liquid | 125.97 | J/mol×K | 249.37 | Calculated Property |
| Cp,liquid | 128.91 | J/mol×K | 262.69 | Calculated Property |
| Cp,liquid | 131.98 | J/mol×K | 276.02 | Calculated Property |
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| η | [0.0005156; 0.0000937] | Pa×s | [200.00; 373.00] |
ChemSep v8.3 pure component data
|
| Equation | Y = exp(A + B/T + C·ln(T) + D·T^E) Y is η in Pa×s, T in K | |||
| Coefficient A | 9.99610e+00 | |||
| Coefficient B | -1.26460e+02 | |||
| Coefficient C | -3.19560e+00 | |||
| Coefficient D | -6.78280e-08 | |||
| Coefficient E | 2.00000e+00 | |||
| Comment | ChemSep eq 101, LiquidViscosity | |||
| Temperature range, min. | 200.00 | |||
| Temperature range, max. | 373.00 | |||
| η | 0.0005156 | Pa×s | 200.00 | Calculated Property |
| η | 0.0004062 | Pa×s | 219.22 | Calculated Property |
| η | 0.0003251 | Pa×s | 238.44 | Calculated Property |
| η | 0.0002639 | Pa×s | 257.67 | Calculated Property |
| η | 0.0002168 | Pa×s | 276.89 | Calculated Property |
| η | 0.0001801 | Pa×s | 296.11 | Calculated Property |
| η | 0.0001510 | Pa×s | 315.33 | Calculated Property |
| η | 0.0001278 | Pa×s | 334.56 | Calculated Property |
| η | 0.0001090 | Pa×s | 353.78 | Calculated Property |
| η | 0.0000937 | Pa×s | 373.00 | Calculated Property |
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| ΔvapH | [31.04; 0.67] | kJ/mol | [156.07; 433.25] |
ChemSep v8.3 pure component data
|
| Equation | Y = A·(1 − Tr)^(B + C·Tr + D·Tr² + E·Tr³), Tr = T/Tc Y is ΔvapH in kJ/mol, T in K | |||
| Coefficient A | 4.74312e+01 | |||
| Coefficient B | 9.66273e-01 | |||
| Coefficient C | 7.52593e-01 | |||
| Coefficient D | -2.76274e+00 | |||
| Coefficient E | 1.51311e+00 | |||
| Critical temperature, Tc (K) | 4.33300e+02 | |||
| Comment | ChemSep eq 106, HeatOfVaporization | |||
| Temperature range, min. | 156.07 | |||
| Temperature range, max. | 433.25 | |||
| ΔvapH | 31.04 | kJ/mol | 156.07 | Calculated Property |
| ΔvapH | 28.57 | kJ/mol | 186.87 | Calculated Property |
| ΔvapH | 26.41 | kJ/mol | 217.67 | Calculated Property |
| ΔvapH | 24.51 | kJ/mol | 248.46 | Calculated Property |
| ΔvapH | 22.79 | kJ/mol | 279.26 | Calculated Property |
| ΔvapH | 21.09 | kJ/mol | 310.06 | Calculated Property |
| ΔvapH | 19.21 | kJ/mol | 340.86 | Calculated Property |
| ΔvapH | 16.74 | kJ/mol | 371.65 | Calculated Property |
| ΔvapH | 12.85 | kJ/mol | 402.45 | Calculated Property |
| ΔvapH | 0.67 | kJ/mol | 433.25 | Calculated Property |
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| Pvap | [1.33; 4387.25] | kPa | [199.69; 433.25] |
The Yaws Handbook of Vapor Pressure
|
| Equation | ln(Y) = A + B/(T + C) Y is Pvap in kPa, T in K | |||
| Coefficient A | 1.41103e+01 | |||
| Coefficient B | -2.28172e+03 | |||
| Coefficient C | -3.46150e+01 | |||
| Temperature range, min. | 199.69 | |||
| Temperature range, max. | 433.25 | |||
| Pvap | 1.33 | kPa | 199.69 | Calculated Property |
| Pvap | 8.72 | kPa | 225.64 | Calculated Property |
| Pvap | 36.39 | kPa | 251.59 | Calculated Property |
| Pvap | 111.91 | kPa | 277.54 | Calculated Property |
| Pvap | 277.07 | kPa | 303.49 | Calculated Property |
| Pvap | 584.76 | kPa | 329.45 | Calculated Property |
| Pvap | 1093.66 | kPa | 355.40 | Calculated Property |
| Pvap | 1862.47 | kPa | 381.35 | Calculated Property |
| Pvap | 2945.07 | kPa | 407.30 | Calculated Property |
| Pvap | 4387.25 | kPa | 433.25 | Calculated Property |
| Pvap | [9.88e-03; 4740.56] | kPa | [156.08; 433.25] |
ChemSep v8.3 pure component data
|
| Equation | Y = exp(A + B/T + C·ln(T) + D·T^E) Y is Pvap in kPa, T in K | |||
| Coefficient A | 1.03346e+02 | |||
| Coefficient B | -5.77054e+03 | |||
| Coefficient C | -1.41719e+01 | |||
| Coefficient D | 2.38614e-05 | |||
| Coefficient E | 2.00000e+00 | |||
| Comment | ChemSep eq 101, VaporPressure | |||
| Temperature range, min. | 156.08 | |||
| Temperature range, max. | 433.25 | |||
| Pvap | 9.88e-03 | kPa | 156.08 | Calculated Property |
| Pvap | 0.44 | kPa | 186.88 | Calculated Property |
| Pvap | 5.36 | kPa | 217.67 | Calculated Property |
| Pvap | 30.95 | kPa | 248.47 | Calculated Property |
| Pvap | 112.79 | kPa | 279.27 | Calculated Property |
| Pvap | 307.48 | kPa | 310.06 | Calculated Property |
| Pvap | 696.60 | kPa | 340.86 | Calculated Property |
| Pvap | 1403.58 | kPa | 371.66 | Calculated Property |
| Pvap | 2632.15 | kPa | 402.45 | Calculated Property |
| Pvap | 4740.56 | kPa | 433.25 | Calculated Property |
| Pvap | [0.01; 4152.02] | kPa | [156.08; 433.25] |
KDB Vapor Pressure Data
|
| Equation | ln(Y) = A + B/T + C·ln(T) + D·T² + E/T² Y is Pvap in kPa, T in K | |||
| Coefficient A | 8.65213e+01 | |||
| Coefficient B | -5.32656e+03 | |||
| Coefficient C | -1.13601e+01 | |||
| Coefficient D | 1.63841e-05 | |||
| Coefficient E | 0.00000e+00 | |||
| Temperature range, min. | 156.08 | |||
| Temperature range, max. | 433.25 | |||
| Pvap | 0.01 | kPa | 156.08 | Calculated Property |
| Pvap | 0.44 | kPa | 186.88 | Calculated Property |
| Pvap | 5.34 | kPa | 217.67 | Calculated Property |
| Pvap | 31.21 | kPa | 248.47 | Calculated Property |
| Pvap | 114.84 | kPa | 279.27 | Calculated Property |
| Pvap | 313.25 | kPa | 310.06 | Calculated Property |
| Pvap | 700.51 | kPa | 340.86 | Calculated Property |
| Pvap | 1371.39 | kPa | 371.66 | Calculated Property |
| Pvap | 2456.58 | kPa | 402.45 | Calculated Property |
| Pvap | 4152.02 | kPa | 433.25 | Calculated Property |
| Pvap | [0.80; 103.65] | kPa | [192.84; 276.60] |
NIST
|
| Equation | ln(Y) = A + B/(T + C) Y is Pvap in kPa, T in K | |||
| Coefficient A | 1.38527e+01 | |||
| Coefficient B | -2.23419e+03 | |||
| Coefficient C | -3.40600e+01 | |||
| Reference | Aston, Sagenkahn, et al., 1944 | |||
| Comment | Coefficents calculated by NIST from author's data. | |||
| Temperature range, min. | 192.84 | |||
| Temperature range, max. | 276.60 | |||
| Pvap | 0.80 | kPa | 192.84 | Calculated Property |
| Pvap | 1.75 | kPa | 202.15 | Calculated Property |
| Pvap | 3.52 | kPa | 211.45 | Calculated Property |
| Pvap | 6.59 | kPa | 220.76 | Calculated Property |
| Pvap | 11.64 | kPa | 230.07 | Calculated Property |
| Pvap | 19.51 | kPa | 239.37 | Calculated Property |
| Pvap | 31.27 | kPa | 248.68 | Calculated Property |
| Pvap | 48.20 | kPa | 257.99 | Calculated Property |
| Pvap | 71.77 | kPa | 267.29 | Calculated Property |
| Pvap | 103.65 | kPa | 276.60 | Calculated Property |
| Pvap | [0.80; 103.65] | kPa | [192.84; 276.60] |
NIST
|
| Equation | ln(Y) = A + B/(T + C) Y is Pvap in kPa, T in K | |||
| Coefficient A | 1.38527e+01 | |||
| Coefficient B | -2.23419e+03 | |||
| Coefficient C | -3.40600e+01 | |||
| Reference | Aston, Sagenkahn, et al., 1944, 2 | |||
| Comment | Coefficents calculated by NIST from author's data. | |||
| Temperature range, min. | 192.84 | |||
| Temperature range, max. | 276.60 | |||
| Pvap | 0.80 | kPa | 192.84 | Calculated Property |
| Pvap | 1.75 | kPa | 202.15 | Calculated Property |
| Pvap | 3.52 | kPa | 211.45 | Calculated Property |
| Pvap | 6.59 | kPa | 220.76 | Calculated Property |
| Pvap | 11.64 | kPa | 230.07 | Calculated Property |
| Pvap | 19.51 | kPa | 239.37 | Calculated Property |
| Pvap | 31.27 | kPa | 248.68 | Calculated Property |
| Pvap | 48.20 | kPa | 257.99 | Calculated Property |
| Pvap | 71.77 | kPa | 267.29 | Calculated Property |
| Pvap | 103.65 | kPa | 276.60 | Calculated Property |
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| ρl | [747.45; 233.31] | kg/m3 | [156.00; 433.25] |
ChemSep v8.3 pure component data
|
| Equation | Y = A / B^(1 + (1 − T/C)^D) Y is ρl in kg/m3, T in K | |||
| Coefficient A | 4.01524e+01 | |||
| Coefficient B | 2.16490e-01 | |||
| Coefficient C | 4.33300e+02 | |||
| Coefficient D | 2.09250e-01 | |||
| Comment | ChemSep eq 105, LiquidDensity | |||
| Temperature range, min. | 156.00 | |||
| Temperature range, max. | 433.25 | |||
| ρl | 747.45 | kg/m3 | 156.00 | Calculated Property |
| ρl | 722.51 | kg/m3 | 186.81 | Calculated Property |
| ρl | 695.95 | kg/m3 | 217.61 | Calculated Property |
| ρl | 667.35 | kg/m3 | 248.42 | Calculated Property |
| ρl | 636.13 | kg/m3 | 279.22 | Calculated Property |
| ρl | 601.36 | kg/m3 | 310.03 | Calculated Property |
| ρl | 561.44 | kg/m3 | 340.83 | Calculated Property |
| ρl | 513.09 | kg/m3 | 371.64 | Calculated Property |
| ρl | 447.30 | kg/m3 | 402.44 | Calculated Property |
| ρl | 233.31 | kg/m3 | 433.25 | Calculated Property |
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| γ | [0.03; 1.87e-05] | N/m | [156.08; 430.48] |
ChemSep v8.3 pure component data
|
| Equation | Y = A + exp(B/T + C + D·T + E·T²) Y is γ in N/m, T in K | |||
| Coefficient A | -7.41590e-03 | |||
| Coefficient B | 8.07470e+01 | |||
| Coefficient C | -4.00200e+00 | |||
| Coefficient D | 4.09610e-03 | |||
| Coefficient E | -1.53820e-05 | |||
| Comment | ChemSep eq 16, SurfaceTension, ChemSep Tmax 433.25 K | |||
| Temperature range, min. | 156.08 | |||
| Temperature range, max. | 430.48 | |||
| γ | 0.03 | N/m | 156.08 | Calculated Property |
| γ | 0.03 | N/m | 186.57 | Calculated Property |
| γ | 0.02 | N/m | 217.06 | Calculated Property |
| γ | 0.02 | N/m | 247.55 | Calculated Property |
| γ | 0.02 | N/m | 278.03 | Calculated Property |
| γ | 0.01 | N/m | 308.52 | Calculated Property |
| γ | 0.01 | N/m | 339.01 | Calculated Property |
| γ | 0.01 | N/m | 369.50 | Calculated Property |
| γ | 0.00 | N/m | 399.99 | Calculated Property |
| γ | 1.87e-05 | N/m | 430.48 | Calculated Property |
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| λ | [0.00; 0.11] | W/m×K | [156.08; 1000.00] |
ChemSep v8.3 pure component data
|
| Equation | Y = A·T^B / (1 + C/T + D/T²) Y is λ in W/m×K, T in K | |||
| Coefficient A | 2.72050e-04 | |||
| Coefficient B | 9.01040e-01 | |||
| Coefficient C | 1.40750e+02 | |||
| Coefficient D | 1.39110e+05 | |||
| Comment | ChemSep eq 102, VaporThermalConductivity | |||
| Temperature range, min. | 156.08 | |||
| Temperature range, max. | 1000.00 | |||
| λ | 0.00 | W/m×K | 156.08 | Calculated Property |
| λ | 0.01 | W/m×K | 249.85 | Calculated Property |
| λ | 0.02 | W/m×K | 343.62 | Calculated Property |
| λ | 0.03 | W/m×K | 437.39 | Calculated Property |
| λ | 0.04 | W/m×K | 531.16 | Calculated Property |
| λ | 0.06 | W/m×K | 624.92 | Calculated Property |
| λ | 0.07 | W/m×K | 718.69 | Calculated Property |
| λ | 0.08 | W/m×K | 812.46 | Calculated Property |
| λ | 0.09 | W/m×K | 906.23 | Calculated Property |
| λ | 0.11 | W/m×K | 1000.00 | Calculated Property |
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| λ | [0.18; 0.13] | W/m×K | [156.07; 276.02] |
ChemSep v8.3 pure component data
|
| Equation | Y = A + exp(B/T + C + D·T + E·T²) Y is λ in W/m×K, T in K | |||
| Coefficient A | -4.31320e-03 | |||
| Coefficient B | -1.48750e+01 | |||
| Coefficient C | -1.25290e+00 | |||
| Coefficient D | -1.99690e-03 | |||
| Coefficient E | -1.75750e-06 | |||
| Comment | ChemSep eq 16, LiquidThermalConductivity | |||
| Temperature range, min. | 156.07 | |||
| Temperature range, max. | 276.02 | |||
| λ | 0.18 | W/m×K | 156.07 | Calculated Property |
| λ | 0.17 | W/m×K | 169.40 | Calculated Property |
| λ | 0.17 | W/m×K | 182.73 | Calculated Property |
| λ | 0.16 | W/m×K | 196.05 | Calculated Property |
| λ | 0.16 | W/m×K | 209.38 | Calculated Property |
| λ | 0.15 | W/m×K | 222.71 | Calculated Property |
| λ | 0.15 | W/m×K | 236.04 | Calculated Property |
| λ | 0.14 | W/m×K | 249.36 | Calculated Property |
| λ | 0.14 | W/m×K | 262.69 | Calculated Property |
| λ | 0.13 | W/m×K | 276.02 | Calculated Property |
Similar Compounds
Find more compounds similar to Methylamine, N,N-dimethyl-.
Mixtures
Sources
- KDB Vapor Pressure Data
- Air Liquide Gas Encyclopedia
- ChemSep v8.3 pure component data Converted from ChemSep v8.3 pure component data, H. Kooijman and R. Taylor (2021, 2022), Artistic License 2.0; see how the values differ.
- Crippen Method
- Chemical Modeling of the TMA-CO2-H2O System: A Draw Solution in Forward Osmosis for Process Water Recovery
- Joback Method
- KDB
- Aqueous Solubility Prediction Method
- McGowan Method
- NIST Webbook
- The Yaws Handbook of Vapor Pressure
Note: Cheméo is only indexing the data, follow the source links to retrieve the latest data. The source is also providing more information like the publication year, authors and more.
Take the time to validate and double check the source of the data.
Outlier This icon means
that the value is more than 2 standard deviations away from the
property mean.
These property values are available through the Cheméo API. A free account gives you an access key.