- InChI
- InChI=1S/C16H32O2/c1-3-5-6-7-8-9-10-11-12-13-14-15-16(17)18-4-2/h3-15H2,1-2H3
- InChI Key
- MMKRHZKQPFCLLS-UHFFFAOYSA-N
- Formula
- C16H32O2
- SMILES
- CCCCCCCCCCCCCC(=O)OCC
- Molecular Weight1
- 256.42
- CAS
- 124-06-1
- Other Names
-
- Ethyl N-tetradecanoate
- Ethyl ester of tetradecanoic acid
- Ethyl ester tetradecanoic acid
- Ethyl tetradecanoate (Ethyl myristate)
- Myristic acid, ethyl ester
- ethyl myristate
- ethyl tetradecanoate
- ω : Acentric Factor.
- ΔcH°liquid : Standard liquid enthalpy of combustion (kJ/mol).
- Cp,gas : Ideal gas heat capacity (J/mol×K).
- η : Dynamic viscosity (Pa×s).
- ΔfG° : Standard Gibbs free energy of formation (kJ/mol).
- ΔfH°gas : Enthalpy of formation at standard conditions (kJ/mol).
- ΔfusH° : Enthalpy of fusion at standard conditions (kJ/mol).
- ΔvapH° : Enthalpy of vaporization at standard conditions (kJ/mol).
- ΔvapH : Enthalpy of vaporization at a given temperature (kJ/mol).
- IE : Ionization energy (eV).
- log10WS : Log10 of Water solubility in mol/l.
- logPoct/wat : Octanol/Water partition coefficient.
- McVol : McGowan's characteristic volume (ml/mol).
- Pc : Critical Pressure (kPa).
- Pvap : Vapor pressure (kPa).
- n0 : Refractive Index.
- ρl : Liquid Density (kg/m3).
- Inp : Non-polar retention indices.
- I : Polar retention indices.
- csound,fluid : Speed of sound in fluid (m/s).
- Tboil : Normal Boiling Point Temperature (K).
- Tboilr : Boiling point at reduced pressure (K).
- Tc : Critical Temperature (K).
- λ : Liquid thermal conductivity (W/m×K).
- Tfus : Normal melting (fusion) point (K).
- Tfus : Melting point (K).
- Vc : Critical Volume (m3/kmol).
- 1: Molecular weight from the IUPAC atomic weights tables.
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Contents
- Physical Properties
- Temperature Dependent Properties
- Pressure Dependent Properties
- Datasets
- Correlations
- Similar Compounds
- Mixtures
- Sources
Physical Properties
| Property | Value | Unit | Source |
|---|---|---|---|
| ω | 0.8216 | Relay (1.0) Calculated Property | |
| ΔcH°liquid | -10067.00 ± 1.00 | kJ/mol | NIST |
| ΔfG° | -226.53 | kJ/mol | Joback Calculated Property |
| ΔfH°gas | -699.57 | kJ/mol | Relay (1.0) Calculated Property |
| ΔfusH° | 41.56 | kJ/mol | Joback Calculated Property |
| ΔvapH° | 87.22 | kJ/mol | Relay (1.0) Calculated Property |
| IE | 9.63 | eV | Relay (1.0) Calculated Property |
| log10WS | -5.66 | Relay (1.0) Calculated Property | |
| logPoct/wat | 5.251 | Crippen Calculated Property | |
| McVol | 243.740 | ml/mol | McGowan Calculated Property |
| Pc | 1323.28 | kPa | Joback Calculated Property |
| Inp | [1769.00; 1805.00] |
|
|
| Inp | 1778.70 | NIST | |
| Inp | 1777.00 | NIST | |
| Inp | 1777.00 | NIST | |
| Inp | 1777.00 | NIST | |
| Inp | 1779.00 | NIST | |
| Inp | 1787.00 | NIST | |
| Inp | 1778.00 | NIST | |
| Inp | 1780.00 | NIST | |
| Inp | 1772.00 | NIST | |
| Inp | 1780.00 | NIST | |
| Inp | 1780.00 | NIST | |
| Inp | 1796.00 | NIST | |
| Inp | 1794.00 | NIST | |
| Inp | 1793.00 | NIST | |
| Inp | 1793.00 | NIST | |
| Inp | 1778.00 | NIST | |
| Inp | 1782.00 | NIST | |
| Inp | 1793.00 | NIST | |
| Inp | 1790.00 | NIST | |
| Inp | 1790.00 | NIST | |
| Inp | 1790.00 | NIST | |
| Inp | Outlier 1769.00 | NIST | |
| Inp | 1779.00 | NIST | |
| Inp | 1780.00 | NIST | |
| Inp | 1799.40 | NIST | |
| Inp | 1798.00 | NIST | |
| Inp | 1792.00 | NIST | |
| Inp | 1793.00 | NIST | |
| Inp | 1795.00 | NIST | |
| Inp | 1794.00 | NIST | |
| Inp | 1793.00 | NIST | |
| Inp | 1792.00 | NIST | |
| Inp | 1796.00 | NIST | |
| Inp | 1787.00 | NIST | |
| Inp | 1793.00 | NIST | |
| Inp | 1796.00 | NIST | |
| Inp | 1795.00 | NIST | |
| Inp | 1794.00 | NIST | |
| Inp | 1794.00 | NIST | |
| Inp | 1790.00 | NIST | |
| Inp | 1775.00 | NIST | |
| Inp | 1790.00 | NIST | |
| Inp | 1777.00 | NIST | |
| Inp | 1778.00 | NIST | |
| Inp | 1774.00 | NIST | |
| Inp | 1777.00 | NIST | |
| Inp | 1778.00 | NIST | |
| Inp | 1778.00 | NIST | |
| Inp | 1778.00 | NIST | |
| Inp | 1775.00 | NIST | |
| Inp | 1776.00 | NIST | |
| Inp | 1775.00 | NIST | |
| Inp | 1779.00 | NIST | |
| Inp | 1772.00 | NIST | |
| Inp | 1792.00 | NIST | |
| Inp | 1795.00 | NIST | |
| Inp | 1796.00 | NIST | |
| Inp | 1803.00 | NIST | |
| Inp | 1803.00 | NIST | |
| Inp | 1795.00 | NIST | |
| Inp | 1794.00 | NIST | |
| Inp | 1795.00 | NIST | |
| Inp | 1794.00 | NIST | |
| Inp | 1784.00 | NIST | |
| Inp | 1795.00 | NIST | |
| Inp | 1779.00 | NIST | |
| Inp | 1793.00 | NIST | |
| Inp | 1797.00 | NIST | |
| Inp | 1793.00 | NIST | |
| Inp | 1798.00 | NIST | |
| Inp | 1780.00 | NIST | |
| Inp | 1795.00 | NIST | |
| Inp | 1795.00 | NIST | |
| Inp | 1795.00 | NIST | |
| Inp | 1793.00 | NIST | |
| Inp | 1805.00 | NIST | |
| Inp | 1780.00 | NIST | |
| I | [2015.00; 2094.00] |
|
|
| I | 2041.00 | NIST | |
| I | 2053.00 | NIST | |
| I | 2043.00 | NIST | |
| I | 2063.00 | NIST | |
| I | 2055.00 | NIST | |
| I | 2077.00 | NIST | |
| I | 2027.00 | NIST | |
| I | 2027.00 | NIST | |
| I | 2056.00 | NIST | |
| I | 2043.00 | NIST | |
| I | 2045.00 | NIST | |
| I | 2057.00 | NIST | |
| I | 2044.00 | NIST | |
| I | 2070.00 | NIST | |
| I | 2025.00 | NIST | |
| I | 2019.00 | NIST | |
| I | 2046.00 | NIST | |
| I | 2026.00 | NIST | |
| I | 2059.00 | NIST | |
| I | 2055.00 | NIST | |
| I | 2053.00 | NIST | |
| I | 2046.00 | NIST | |
| I | 2038.00 | NIST | |
| I | 2040.00 | NIST | |
| I | 2048.00 | NIST | |
| I | 2020.00 | NIST | |
| I | 2054.00 | NIST | |
| I | 2034.00 | NIST | |
| I | 2055.00 | NIST | |
| I | 2063.00 | NIST | |
| I | 2049.00 | NIST | |
| I | 2058.00 | NIST | |
| I | 2029.00 | NIST | |
| I | 2050.00 | NIST | |
| I | 2053.00 | NIST | |
| I | 2070.00 | NIST | |
| I | 2054.00 | NIST | |
| I | Outlier 2094.00 | NIST | |
| I | 2057.00 | NIST | |
| I | 2065.00 | NIST | |
| I | Outlier 2094.00 | NIST | |
| I | Outlier 2094.00 | NIST | |
| I | 2040.00 | NIST | |
| I | 2065.00 | NIST | |
| I | 2015.00 | NIST | |
| I | 2065.00 | NIST | |
| I | 2049.00 | NIST | |
| I | 2065.00 | NIST | |
| I | 2042.00 | NIST | |
| I | 2048.00 | NIST | |
| I | 2025.00 | NIST | |
| I | 2057.00 | NIST | |
| I | 2029.00 | NIST | |
| I | 2072.00 | NIST | |
| I | 2038.00 | NIST | |
| I | 2027.00 | NIST | |
| I | 2038.00 | NIST | |
| I | 2054.00 | NIST | |
| I | 2058.00 | NIST | |
| I | 2044.00 | NIST | |
| I | 2026.00 | NIST | |
| I | 2038.00 | NIST | |
| I | 2053.00 | NIST | |
| I | 2065.00 | NIST | |
| I | 2015.00 | NIST | |
| I | 2048.00 | NIST | |
| Tboil | [568.20; 582.00] | K |
|
| Tboil | 568.20 | K | NIST |
| Tboil | 582.00 ± 2.00 | K | NIST |
| Tc | 740.24 | K | Relay (1.0) Calculated Property |
| Tfus | [285.09; 287.50] | K |
|
| Tfus | 286.40 | K | High pressure solid-liquid equilibrium of fatty acid ethyl esters binary systems |
| Tfus | 287.50 | K | Influence of Additives (Isoamyl Laurate or Isoamyl Nonanoate) in the Solid-Liquid Equilibrium of Fatty Acid Ethyl Esters |
| Tfus | 285.09 ± 0.20 | K | NIST |
| Vc | 0.960 | m3/kmol | Relay (1.0) Calculated Property |
Temperature Dependent Properties
Pressure Dependent Properties
| Property | Value | Unit | Pressure (kPa) | Source |
|---|---|---|---|---|
| Tboilr | 452.20 | K | 1.60 | NIST |
| Tfus | [286.33; 286.36] | K | [0.00; 0.00] |
|
| Tfus | 286.33 | K | 0.00 | Activity coefficient at infinite dilution, azeotropic data, excess enthalpies and solid liquid-equilibria for binary systems of alkanes and aromatics with esters |
| Tfus | 286.36 | K | 0.00 | Activity coefficient at infinite dilution, azeotropic data, excess enthalpies and solid liquid-equilibria for binary systems of alkanes and aromatics with esters |
Datasets
Viscosity, Pa*s
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Pressure, kPa - Liquid | Viscosity, Pa*s - Liquid |
| 293.15 | 101.30 | 0.0047 |
| 293.15 | 20000.00 | 0.0061 |
| 293.15 | 40000.00 | 0.0077 |
| 313.15 | 101.30 | 0.0030 |
| 313.15 | 20000.00 | 0.0037 |
| 313.15 | 40000.00 | 0.0046 |
| 313.15 | 60000.00 | 0.0057 |
| 313.15 | 80000.00 | 0.0069 |
| 313.15 | 100000.00 | 0.0082 |
| 333.15 | 101.30 | 0.0020 |
| 333.15 | 20000.00 | 0.0025 |
| 333.15 | 40000.00 | 0.0031 |
| 333.15 | 60000.00 | 0.0037 |
| 333.15 | 80000.00 | 0.0045 |
| 333.15 | 100000.00 | 0.0053 |
| 353.15 | 101.30 | 0.0015 |
| 353.15 | 20000.00 | 0.0018 |
| 353.15 | 40000.00 | 0.0022 |
| 353.15 | 60000.00 | 0.0027 |
| 353.15 | 80000.00 | 0.0032 |
| 353.15 | 100000.00 | 0.0037 |
| Reference | ||
Speed of sound, m/s
| Fixed | Measured | |
|---|---|---|
| Pressure, kPa - Liquid | Temperature, K - Liquid | Speed of sound, m/s - Liquid |
| 100.00 | 293.15 | 1360.6 |
| 10000.00 | 293.15 | 1408.0 |
| 20000.00 | 293.15 | 1453.3 |
| 30000.00 | 293.15 | 1494.5 |
| 40000.00 | 293.15 | 1533.5 |
| 50000.00 | 293.15 | 1568.2 |
| 100.00 | 303.15 | 1321.8 |
| 10000.00 | 303.15 | 1370.9 |
| 20000.00 | 303.15 | 1416.8 |
| 30000.00 | 303.15 | 1460.6 |
| 40000.00 | 303.15 | 1500.8 |
| 50000.00 | 303.15 | 1539.9 |
| 100.00 | 323.15 | 1251.8 |
| 10000.00 | 323.15 | 1304.5 |
| 20000.00 | 323.15 | 1353.4 |
| 30000.00 | 323.15 | 1398.6 |
| 40000.00 | 323.15 | 1441.1 |
| 50000.00 | 323.15 | 1482.4 |
| 60000.00 | 323.15 | 1519.7 |
| 70000.00 | 323.15 | 1555.8 |
| 80000.00 | 323.15 | 1590.8 |
| 90000.00 | 323.15 | 1624.6 |
| 100000.00 | 323.15 | 1655.7 |
| 100.00 | 343.15 | 1184.7 |
| 10000.00 | 343.15 | 1241.3 |
| 20000.00 | 343.15 | 1293.0 |
| 30000.00 | 343.15 | 1341.9 |
| 40000.00 | 343.15 | 1386.7 |
| 50000.00 | 343.15 | 1428.8 |
| 60000.00 | 343.15 | 1468.1 |
| 70000.00 | 343.15 | 1506.4 |
| 80000.00 | 343.15 | 1541.9 |
| 90000.00 | 343.15 | 1576.2 |
| 100000.00 | 343.15 | 1609.1 |
| 100.00 | 363.15 | 1120.0 |
| 10000.00 | 363.15 | 1181.8 |
| 20000.00 | 363.15 | 1236.4 |
| 30000.00 | 363.15 | 1287.1 |
| 40000.00 | 363.15 | 1334.2 |
| 50000.00 | 363.15 | 1377.5 |
| 60000.00 | 363.15 | 1418.8 |
| 70000.00 | 363.15 | 1457.6 |
| 80000.00 | 363.15 | 1495.5 |
| 90000.00 | 363.15 | 1531.0 |
| 100000.00 | 363.15 | 1564.6 |
| 100.00 | 383.15 | 1056.9 |
| 10000.00 | 383.15 | 1122.3 |
| 20000.00 | 383.15 | 1181.7 |
| 30000.00 | 383.15 | 1235.6 |
| 40000.00 | 383.15 | 1284.7 |
| 50000.00 | 383.15 | 1330.3 |
| 60000.00 | 383.15 | 1372.3 |
| 70000.00 | 383.15 | 1412.6 |
| 80000.00 | 383.15 | 1450.4 |
| 90000.00 | 383.15 | 1486.9 |
| 100000.00 | 383.15 | 1521.7 |
| 100.00 | 403.15 | 996.1 |
| 10000.00 | 403.15 | 1067.2 |
| 20000.00 | 403.15 | 1130.3 |
| 30000.00 | 403.15 | 1186.1 |
| 40000.00 | 403.15 | 1237.3 |
| 50000.00 | 403.15 | 1284.9 |
| 60000.00 | 403.15 | 1327.9 |
| 70000.00 | 403.15 | 1370.0 |
| 80000.00 | 403.15 | 1409.7 |
| 90000.00 | 403.15 | 1447.5 |
| 100000.00 | 403.15 | 1483.2 |
| Reference | ||
Correlations
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| Cp,gas | [361.24; 852.89] | J/mol×K | [273.00; 1000.00] |
Joback Predicted correlation
|
| Equation | Y = A + B·T + C·T² + D·T³ + E·T⁴ Y is Cp,gas in J/mol×K, T in K | |||
| Coefficient A | 1.37530e+01 | |||
| Coefficient B | 1.46904e+00 | |||
| Coefficient C | -7.52000e-04 | |||
| Coefficient D | 1.22100e-07 | |||
| Coefficient E | 0.00000e+00 | |||
| Temperature range, min. | 273.00 | |||
| Temperature range, max. | 1000.00 | |||
| Cp,gas | 361.24 | J/mol×K | 273.00 | Calculated Property |
| Cp,gas | 444.75 | J/mol×K | 353.78 | Calculated Property |
| Cp,gas | 520.15 | J/mol×K | 434.56 | Calculated Property |
| Cp,gas | 587.80 | J/mol×K | 515.33 | Calculated Property |
| Cp,gas | 648.11 | J/mol×K | 596.11 | Calculated Property |
| Cp,gas | 701.45 | J/mol×K | 676.89 | Calculated Property |
| Cp,gas | 748.21 | J/mol×K | 757.67 | Calculated Property |
| Cp,gas | 788.78 | J/mol×K | 838.44 | Calculated Property |
| Cp,gas | 823.55 | J/mol×K | 919.22 | Calculated Property |
| Cp,gas | 852.89 | J/mol×K | 1000.00 | Calculated Property |
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| Pvap | [1.33; 202.67] | kPa | [431.52; 601.25] |
The Yaws Handbook of Vapor Pressure
|
| Equation | ln(Y) = A + B/(T + C) Y is Pvap in kPa, T in K | |||
| Coefficient A | 1.51513e+01 | |||
| Coefficient B | -4.94104e+03 | |||
| Coefficient C | -9.90960e+01 | |||
| Temperature range, min. | 431.52 | |||
| Temperature range, max. | 601.25 | |||
| Pvap | 1.33 | kPa | 431.52 | Calculated Property |
| Pvap | 2.96 | kPa | 450.38 | Calculated Property |
| Pvap | 6.06 | kPa | 469.24 | Calculated Property |
| Pvap | 11.58 | kPa | 488.10 | Calculated Property |
| Pvap | 20.84 | kPa | 506.96 | Calculated Property |
| Pvap | 35.59 | kPa | 525.81 | Calculated Property |
| Pvap | 58.10 | kPa | 544.67 | Calculated Property |
| Pvap | 91.15 | kPa | 563.53 | Calculated Property |
| Pvap | 138.05 | kPa | 582.39 | Calculated Property |
| Pvap | 202.67 | kPa | 601.25 | Calculated Property |
Similar Compounds
Find more compounds similar to Tetradecanoic acid, ethyl ester.
Mixtures
- Dodecanoic acid, ethyl ester + Tetradecanoic acid, ethyl ester
- Hexadecanoic acid, ethyl ester + Tetradecanoic acid, ethyl ester
- Benzene + Tetradecanoic acid, ethyl ester
- p-Xylene + Tetradecanoic acid, ethyl ester
- Ethanol + Tetradecanoic acid, ethyl ester
- Dodecanoic acid, ethyl ester + Hexadecanoic acid, ethyl ester + Tetradecanoic acid, ethyl ester
- Tetradecanoic acid, ethyl ester + Nonanoic acid, 3-methylbutyl ester
- Isoamyl laurate + Tetradecanoic acid, ethyl ester
- Tetradecanoic acid, ethyl ester + Tetradecane
- Carbon dioxide + Tetradecanoic acid, ethyl ester
- Cyclohexane, ethyl- + Tetradecanoic acid, ethyl ester
Sources
- Cheméo Relay (1.0)
- Crippen Method
- Crippen Method
- Activity coefficient at infinite dilution, azeotropic data, excess enthalpies and solid liquid-equilibria for binary systems of alkanes and aromatics with esters
- Measurement and correlation of vapor liquid equilibria for ethanol + ethyl laurate and ethanol + ethyl myristate systems near critical temperature of ethanol
- Isobaric vapor liquid equilibrium for binary system of ethyl myristate + ethyl palmitate at 0.5, 1.0 and 1.5 kPa
- Solid-liquid equilibrium in ternary mixtures of ethyl laurate, ethyl palmitate and ethyl myristate
- High pressure solid-liquid equilibrium of fatty acid ethyl esters binary systems
- Measurement on the thermal conductivity of five saturated fatty acid ethyl esters components of biodiesel
- Determination of the vapor pressure of ethyl esters by Differential Scanning Calorimetry
- Thermophysical properties of fatty acid methyl and ethyl esters
- Viscosities of Fatty Acid Methyl and Ethyl Esters under High Pressure: Methyl Myristate and Ethyl Myristate
- High Pressure Phase Equilibria of the CO2/Saturated Ethyl Esters Homologous Series
- Influence of Additives (Isoamyl Laurate or Isoamyl Nonanoate) in the Solid-Liquid Equilibrium of Fatty Acid Ethyl Esters
- Density, Viscosity, and Refractive Index of Binary Mixtures of Fatty Acid Ethyl Esters with Ethylcyclohexane
- Densities and Viscosities of Fatty Acid Methyl and Ethyl Esters
- Experimental Vapor Pressures of Five Saturated Fatty Acid Ethyl Ester (FAEE) Components of Biodiesel
- Isothermal Vapor Liquid Equilibria of n-Tetradecane + Ethyl Hexanoate, Ethyl Decanoate, and Ethyl Tetradecanoate
- Speed of Sound, Density, and Derivative Properties of Ethyl Myristate, Methyl Myristate, and Methyl Palmitate under High Pressure
- Joback Method
- McGowan Method
- NIST Webbook
- The Yaws Handbook of Vapor Pressure
Note: Cheméo is only indexing the data, follow the source links to retrieve the latest data. The source is also providing more information like the publication year, authors and more.
Take the time to validate and double check the source of the data.
Outlier This icon means
that the value is more than 2 standard deviations away from the
property mean.
These property values are available through the Cheméo API. A free account gives you an access key.