Chemical Properties of 2,6-Pyridinedicarboxylic acid (CAS 499-83-2)

InChI

InChI=1S/C7H5NO4/c9-6(10)4-2-1-3-5(8-4)7(11)12/h1-3H,(H,9,10)(H,11,12)

InChI Key

WJJMNDUMQPNECX-UHFFFAOYSA-N

Formula

C7H5NO4

SMILES

O=C(O)c1cccc(C(=O)O)n1

Molecular Weight¹

167.12

CAS

499-83-2

Other Names

• 2,6-Dipicolinic Acid
• 2,6-Pyridinedicarboxylic acid-2,6-dipicolinic acid
• 2,6-dicarboxypyridine
• DPA
• DPac
• Dipicolinic acid
• Pyridinedicarboxylic acid-(2,6)
• pyridine-2,6-dicarboxylic acid

• ω : Acentric Factor.
• C_p,solid : Solid phase heat capacity (J/mol×K).
• Δ_fG° : Standard Gibbs free energy of formation (kJ/mol).
• Δ_fH°_gas : Enthalpy of formation at standard conditions (kJ/mol).
• Δ_subH° : Enthalpy of sublimation at standard conditions (kJ/mol).
• Δ_vapH° : Enthalpy of vaporization at standard conditions (kJ/mol).
• Δ_vapH : Enthalpy of vaporization at a given temperature (kJ/mol).
• IE : Ionization energy (eV).
• log₁₀WS : Log10 of Water solubility in mol/l.
• logP_oct/wat : Octanol/Water partition coefficient.
• McVol : McGowan's characteristic volume (ml/mol).
• P_c : Critical Pressure (kPa).
• T_boil : Normal Boiling Point Temperature (K).
• T_c : Critical Temperature (K).
• T_fus : Normal melting (fusion) point (K).
• V_c : Critical Volume (m³/kmol).
• ¹: Molecular weight from the IUPAC atomic weights tables.

Physical Properties

Temperature Dependent Properties

Property	Value	Unit	Temperature (K)	Source
Cp,solid	[56.42; 231.38]	J/mol×K	[84.05; 378.00]
Cp,solid	56.42	J/mol×K	84.05	Heat capacity and standard molar enthalpy of formation of crystalline 2,6-dicarboxypyridine (C7H5NO4)
Cp,solid	56.44	J/mol×K	86.40	Heat capacity and standard molar enthalpy of formation of crystalline 2,6-dicarboxypyridine (C7H5NO4)
Cp,solid	56.50	J/mol×K	88.71	Heat capacity and standard molar enthalpy of formation of crystalline 2,6-dicarboxypyridine (C7H5NO4)
Cp,solid	56.59	J/mol×K	90.97	Heat capacity and standard molar enthalpy of formation of crystalline 2,6-dicarboxypyridine (C7H5NO4)
Cp,solid	56.71	J/mol×K	93.19	Heat capacity and standard molar enthalpy of formation of crystalline 2,6-dicarboxypyridine (C7H5NO4)
Cp,solid	56.85	J/mol×K	95.37	Heat capacity and standard molar enthalpy of formation of crystalline 2,6-dicarboxypyridine (C7H5NO4)
Cp,solid	57.03	J/mol×K	97.51	Heat capacity and standard molar enthalpy of formation of crystalline 2,6-dicarboxypyridine (C7H5NO4)
Cp,solid	57.23	J/mol×K	99.63	Heat capacity and standard molar enthalpy of formation of crystalline 2,6-dicarboxypyridine (C7H5NO4)
Cp,solid	57.46	J/mol×K	101.72	Heat capacity and standard molar enthalpy of formation of crystalline 2,6-dicarboxypyridine (C7H5NO4)
Cp,solid	57.71	J/mol×K	103.77	Heat capacity and standard molar enthalpy of formation of crystalline 2,6-dicarboxypyridine (C7H5NO4)
Cp,solid	57.98	J/mol×K	105.81	Heat capacity and standard molar enthalpy of formation of crystalline 2,6-dicarboxypyridine (C7H5NO4)
Cp,solid	58.27	J/mol×K	107.81	Heat capacity and standard molar enthalpy of formation of crystalline 2,6-dicarboxypyridine (C7H5NO4)
Cp,solid	58.59	J/mol×K	109.80	Heat capacity and standard molar enthalpy of formation of crystalline 2,6-dicarboxypyridine (C7H5NO4)
Cp,solid	58.92	J/mol×K	111.76	Heat capacity and standard molar enthalpy of formation of crystalline 2,6-dicarboxypyridine (C7H5NO4)
Cp,solid	59.27	J/mol×K	113.70	Heat capacity and standard molar enthalpy of formation of crystalline 2,6-dicarboxypyridine (C7H5NO4)
Cp,solid	59.65	J/mol×K	115.63	Heat capacity and standard molar enthalpy of formation of crystalline 2,6-dicarboxypyridine (C7H5NO4)
Cp,solid	60.03	J/mol×K	117.53	Heat capacity and standard molar enthalpy of formation of crystalline 2,6-dicarboxypyridine (C7H5NO4)
Cp,solid	60.44	J/mol×K	119.42	Heat capacity and standard molar enthalpy of formation of crystalline 2,6-dicarboxypyridine (C7H5NO4)
Cp,solid	60.86	J/mol×K	121.29	Heat capacity and standard molar enthalpy of formation of crystalline 2,6-dicarboxypyridine (C7H5NO4)
Cp,solid	61.30	J/mol×K	123.15	Heat capacity and standard molar enthalpy of formation of crystalline 2,6-dicarboxypyridine (C7H5NO4)
Cp,solid	61.76	J/mol×K	124.99	Heat capacity and standard molar enthalpy of formation of crystalline 2,6-dicarboxypyridine (C7H5NO4)
Cp,solid	62.23	J/mol×K	126.82	Heat capacity and standard molar enthalpy of formation of crystalline 2,6-dicarboxypyridine (C7H5NO4)
Cp,solid	62.72	J/mol×K	128.63	Heat capacity and standard molar enthalpy of formation of crystalline 2,6-dicarboxypyridine (C7H5NO4)
Cp,solid	63.22	J/mol×K	130.43	Heat capacity and standard molar enthalpy of formation of crystalline 2,6-dicarboxypyridine (C7H5NO4)
Cp,solid	63.73	J/mol×K	132.22	Heat capacity and standard molar enthalpy of formation of crystalline 2,6-dicarboxypyridine (C7H5NO4)
Cp,solid	64.25	J/mol×K	133.99	Heat capacity and standard molar enthalpy of formation of crystalline 2,6-dicarboxypyridine (C7H5NO4)
Cp,solid	64.80	J/mol×K	135.76	Heat capacity and standard molar enthalpy of formation of crystalline 2,6-dicarboxypyridine (C7H5NO4)
Cp,solid	65.35	J/mol×K	137.51	Heat capacity and standard molar enthalpy of formation of crystalline 2,6-dicarboxypyridine (C7H5NO4)
Cp,solid	65.91	J/mol×K	139.25	Heat capacity and standard molar enthalpy of formation of crystalline 2,6-dicarboxypyridine (C7H5NO4)
Cp,solid	66.49	J/mol×K	140.98	Heat capacity and standard molar enthalpy of formation of crystalline 2,6-dicarboxypyridine (C7H5NO4)
Cp,solid	67.08	J/mol×K	142.69	Heat capacity and standard molar enthalpy of formation of crystalline 2,6-dicarboxypyridine (C7H5NO4)
Cp,solid	67.68	J/mol×K	144.40	Heat capacity and standard molar enthalpy of formation of crystalline 2,6-dicarboxypyridine (C7H5NO4)
Cp,solid	68.29	J/mol×K	146.10	Heat capacity and standard molar enthalpy of formation of crystalline 2,6-dicarboxypyridine (C7H5NO4)
Cp,solid	68.91	J/mol×K	147.79	Heat capacity and standard molar enthalpy of formation of crystalline 2,6-dicarboxypyridine (C7H5NO4)
Cp,solid	69.55	J/mol×K	149.46	Heat capacity and standard molar enthalpy of formation of crystalline 2,6-dicarboxypyridine (C7H5NO4)
Cp,solid	70.19	J/mol×K	151.13	Heat capacity and standard molar enthalpy of formation of crystalline 2,6-dicarboxypyridine (C7H5NO4)
Cp,solid	70.84	J/mol×K	152.79	Heat capacity and standard molar enthalpy of formation of crystalline 2,6-dicarboxypyridine (C7H5NO4)
Cp,solid	71.50	J/mol×K	154.44	Heat capacity and standard molar enthalpy of formation of crystalline 2,6-dicarboxypyridine (C7H5NO4)
Cp,solid	72.18	J/mol×K	156.08	Heat capacity and standard molar enthalpy of formation of crystalline 2,6-dicarboxypyridine (C7H5NO4)
Cp,solid	72.86	J/mol×K	157.72	Heat capacity and standard molar enthalpy of formation of crystalline 2,6-dicarboxypyridine (C7H5NO4)
Cp,solid	73.55	J/mol×K	159.35	Heat capacity and standard molar enthalpy of formation of crystalline 2,6-dicarboxypyridine (C7H5NO4)
Cp,solid	74.25	J/mol×K	160.97	Heat capacity and standard molar enthalpy of formation of crystalline 2,6-dicarboxypyridine (C7H5NO4)
Cp,solid	74.96	J/mol×K	162.58	Heat capacity and standard molar enthalpy of formation of crystalline 2,6-dicarboxypyridine (C7H5NO4)
Cp,solid	75.68	J/mol×K	164.18	Heat capacity and standard molar enthalpy of formation of crystalline 2,6-dicarboxypyridine (C7H5NO4)
Cp,solid	76.40	J/mol×K	165.77	Heat capacity and standard molar enthalpy of formation of crystalline 2,6-dicarboxypyridine (C7H5NO4)
Cp,solid	77.13	J/mol×K	167.35	Heat capacity and standard molar enthalpy of formation of crystalline 2,6-dicarboxypyridine (C7H5NO4)
Cp,solid	77.86	J/mol×K	168.92	Heat capacity and standard molar enthalpy of formation of crystalline 2,6-dicarboxypyridine (C7H5NO4)
Cp,solid	78.61	J/mol×K	170.49	Heat capacity and standard molar enthalpy of formation of crystalline 2,6-dicarboxypyridine (C7H5NO4)
Cp,solid	79.36	J/mol×K	172.04	Heat capacity and standard molar enthalpy of formation of crystalline 2,6-dicarboxypyridine (C7H5NO4)
Cp,solid	80.11	J/mol×K	173.59	Heat capacity and standard molar enthalpy of formation of crystalline 2,6-dicarboxypyridine (C7H5NO4)
Cp,solid	80.88	J/mol×K	175.13	Heat capacity and standard molar enthalpy of formation of crystalline 2,6-dicarboxypyridine (C7H5NO4)
Cp,solid	81.65	J/mol×K	176.66	Heat capacity and standard molar enthalpy of formation of crystalline 2,6-dicarboxypyridine (C7H5NO4)
Cp,solid	82.42	J/mol×K	178.19	Heat capacity and standard molar enthalpy of formation of crystalline 2,6-dicarboxypyridine (C7H5NO4)
Cp,solid	83.20	J/mol×K	179.71	Heat capacity and standard molar enthalpy of formation of crystalline 2,6-dicarboxypyridine (C7H5NO4)
Cp,solid	83.99	J/mol×K	181.22	Heat capacity and standard molar enthalpy of formation of crystalline 2,6-dicarboxypyridine (C7H5NO4)
Cp,solid	84.78	J/mol×K	182.72	Heat capacity and standard molar enthalpy of formation of crystalline 2,6-dicarboxypyridine (C7H5NO4)
Cp,solid	85.59	J/mol×K	184.23	Heat capacity and standard molar enthalpy of formation of crystalline 2,6-dicarboxypyridine (C7H5NO4)
Cp,solid	86.39	J/mol×K	185.73	Heat capacity and standard molar enthalpy of formation of crystalline 2,6-dicarboxypyridine (C7H5NO4)
Cp,solid	87.21	J/mol×K	187.22	Heat capacity and standard molar enthalpy of formation of crystalline 2,6-dicarboxypyridine (C7H5NO4)
Cp,solid	88.03	J/mol×K	188.71	Heat capacity and standard molar enthalpy of formation of crystalline 2,6-dicarboxypyridine (C7H5NO4)
Cp,solid	88.85	J/mol×K	190.19	Heat capacity and standard molar enthalpy of formation of crystalline 2,6-dicarboxypyridine (C7H5NO4)
Cp,solid	89.68	J/mol×K	191.66	Heat capacity and standard molar enthalpy of formation of crystalline 2,6-dicarboxypyridine (C7H5NO4)
Cp,solid	90.52	J/mol×K	193.13	Heat capacity and standard molar enthalpy of formation of crystalline 2,6-dicarboxypyridine (C7H5NO4)
Cp,solid	91.35	J/mol×K	194.59	Heat capacity and standard molar enthalpy of formation of crystalline 2,6-dicarboxypyridine (C7H5NO4)
Cp,solid	92.20	J/mol×K	196.06	Heat capacity and standard molar enthalpy of formation of crystalline 2,6-dicarboxypyridine (C7H5NO4)
Cp,solid	93.04	J/mol×K	197.50	Heat capacity and standard molar enthalpy of formation of crystalline 2,6-dicarboxypyridine (C7H5NO4)
Cp,solid	94.57	J/mol×K	200.08	Heat capacity and standard molar enthalpy of formation of crystalline 2,6-dicarboxypyridine (C7H5NO4)
Cp,solid	96.99	J/mol×K	204.09	Heat capacity and standard molar enthalpy of formation of crystalline 2,6-dicarboxypyridine (C7H5NO4)
Cp,solid	98.92	J/mol×K	207.23	Heat capacity and standard molar enthalpy of formation of crystalline 2,6-dicarboxypyridine (C7H5NO4)
Cp,solid	100.26	J/mol×K	209.37	Heat capacity and standard molar enthalpy of formation of crystalline 2,6-dicarboxypyridine (C7H5NO4)
Cp,solid	101.59	J/mol×K	211.49	Heat capacity and standard molar enthalpy of formation of crystalline 2,6-dicarboxypyridine (C7H5NO4)
Cp,solid	102.95	J/mol×K	213.62	Heat capacity and standard molar enthalpy of formation of crystalline 2,6-dicarboxypyridine (C7H5NO4)
Cp,solid	105.66	J/mol×K	217.80	Heat capacity and standard molar enthalpy of formation of crystalline 2,6-dicarboxypyridine (C7H5NO4)
Cp,solid	107.01	J/mol×K	219.85	Heat capacity and standard molar enthalpy of formation of crystalline 2,6-dicarboxypyridine (C7H5NO4)
Cp,solid	108.37	J/mol×K	221.90	Heat capacity and standard molar enthalpy of formation of crystalline 2,6-dicarboxypyridine (C7H5NO4)
Cp,solid	109.74	J/mol×K	223.94	Heat capacity and standard molar enthalpy of formation of crystalline 2,6-dicarboxypyridine (C7H5NO4)
Cp,solid	111.10	J/mol×K	225.95	Heat capacity and standard molar enthalpy of formation of crystalline 2,6-dicarboxypyridine (C7H5NO4)
Cp,solid	112.43	J/mol×K	227.91	Heat capacity and standard molar enthalpy of formation of crystalline 2,6-dicarboxypyridine (C7H5NO4)
Cp,solid	113.80	J/mol×K	229.90	Heat capacity and standard molar enthalpy of formation of crystalline 2,6-dicarboxypyridine (C7H5NO4)
Cp,solid	115.10	J/mol×K	231.78	Heat capacity and standard molar enthalpy of formation of crystalline 2,6-dicarboxypyridine (C7H5NO4)
Cp,solid	116.46	J/mol×K	233.73	Heat capacity and standard molar enthalpy of formation of crystalline 2,6-dicarboxypyridine (C7H5NO4)
Cp,solid	117.81	J/mol×K	235.64	Heat capacity and standard molar enthalpy of formation of crystalline 2,6-dicarboxypyridine (C7H5NO4)
Cp,solid	119.20	J/mol×K	237.61	Heat capacity and standard molar enthalpy of formation of crystalline 2,6-dicarboxypyridine (C7H5NO4)
Cp,solid	120.56	J/mol×K	239.52	Heat capacity and standard molar enthalpy of formation of crystalline 2,6-dicarboxypyridine (C7H5NO4)
Cp,solid	121.91	J/mol×K	241.40	Heat capacity and standard molar enthalpy of formation of crystalline 2,6-dicarboxypyridine (C7H5NO4)
Cp,solid	123.26	J/mol×K	243.27	Heat capacity and standard molar enthalpy of formation of crystalline 2,6-dicarboxypyridine (C7H5NO4)
Cp,solid	124.63	J/mol×K	245.17	Heat capacity and standard molar enthalpy of formation of crystalline 2,6-dicarboxypyridine (C7H5NO4)
Cp,solid	126.04	J/mol×K	247.09	Heat capacity and standard molar enthalpy of formation of crystalline 2,6-dicarboxypyridine (C7H5NO4)
Cp,solid	127.43	J/mol×K	248.98	Heat capacity and standard molar enthalpy of formation of crystalline 2,6-dicarboxypyridine (C7H5NO4)
Cp,solid	128.84	J/mol×K	250.89	Heat capacity and standard molar enthalpy of formation of crystalline 2,6-dicarboxypyridine (C7H5NO4)
Cp,solid	130.24	J/mol×K	252.77	Heat capacity and standard molar enthalpy of formation of crystalline 2,6-dicarboxypyridine (C7H5NO4)
Cp,solid	131.65	J/mol×K	254.65	Heat capacity and standard molar enthalpy of formation of crystalline 2,6-dicarboxypyridine (C7H5NO4)
Cp,solid	133.04	J/mol×K	256.51	Heat capacity and standard molar enthalpy of formation of crystalline 2,6-dicarboxypyridine (C7H5NO4)
Cp,solid	134.45	J/mol×K	258.38	Heat capacity and standard molar enthalpy of formation of crystalline 2,6-dicarboxypyridine (C7H5NO4)
Cp,solid	135.86	J/mol×K	260.23	Heat capacity and standard molar enthalpy of formation of crystalline 2,6-dicarboxypyridine (C7H5NO4)
Cp,solid	137.27	J/mol×K	262.08	Heat capacity and standard molar enthalpy of formation of crystalline 2,6-dicarboxypyridine (C7H5NO4)
Cp,solid	138.68	J/mol×K	263.92	Heat capacity and standard molar enthalpy of formation of crystalline 2,6-dicarboxypyridine (C7H5NO4)
Cp,solid	140.08	J/mol×K	265.74	Heat capacity and standard molar enthalpy of formation of crystalline 2,6-dicarboxypyridine (C7H5NO4)
Cp,solid	141.50	J/mol×K	267.58	Heat capacity and standard molar enthalpy of formation of crystalline 2,6-dicarboxypyridine (C7H5NO4)
Cp,solid	142.91	J/mol×K	269.40	Heat capacity and standard molar enthalpy of formation of crystalline 2,6-dicarboxypyridine (C7H5NO4)
Cp,solid	144.31	J/mol×K	271.20	Heat capacity and standard molar enthalpy of formation of crystalline 2,6-dicarboxypyridine (C7H5NO4)
Cp,solid	145.72	J/mol×K	273.00	Heat capacity and standard molar enthalpy of formation of crystalline 2,6-dicarboxypyridine (C7H5NO4)
Cp,solid	147.12	J/mol×K	274.79	Heat capacity and standard molar enthalpy of formation of crystalline 2,6-dicarboxypyridine (C7H5NO4)
Cp,solid	148.51	J/mol×K	276.55	Heat capacity and standard molar enthalpy of formation of crystalline 2,6-dicarboxypyridine (C7H5NO4)
Cp,solid	149.91	J/mol×K	278.32	Heat capacity and standard molar enthalpy of formation of crystalline 2,6-dicarboxypyridine (C7H5NO4)
Cp,solid	151.31	J/mol×K	280.09	Heat capacity and standard molar enthalpy of formation of crystalline 2,6-dicarboxypyridine (C7H5NO4)
Cp,solid	152.71	J/mol×K	281.85	Heat capacity and standard molar enthalpy of formation of crystalline 2,6-dicarboxypyridine (C7H5NO4)
Cp,solid	154.09	J/mol×K	283.59	Heat capacity and standard molar enthalpy of formation of crystalline 2,6-dicarboxypyridine (C7H5NO4)
Cp,solid	155.48	J/mol×K	285.32	Heat capacity and standard molar enthalpy of formation of crystalline 2,6-dicarboxypyridine (C7H5NO4)
Cp,solid	156.85	J/mol×K	287.04	Heat capacity and standard molar enthalpy of formation of crystalline 2,6-dicarboxypyridine (C7H5NO4)
Cp,solid	158.22	J/mol×K	288.74	Heat capacity and standard molar enthalpy of formation of crystalline 2,6-dicarboxypyridine (C7H5NO4)
Cp,solid	159.59	J/mol×K	290.44	Heat capacity and standard molar enthalpy of formation of crystalline 2,6-dicarboxypyridine (C7H5NO4)
Cp,solid	160.93	J/mol×K	292.10	Heat capacity and standard molar enthalpy of formation of crystalline 2,6-dicarboxypyridine (C7H5NO4)
Cp,solid	162.27	J/mol×K	293.75	Heat capacity and standard molar enthalpy of formation of crystalline 2,6-dicarboxypyridine (C7H5NO4)
Cp,solid	163.60	J/mol×K	295.39	Heat capacity and standard molar enthalpy of formation of crystalline 2,6-dicarboxypyridine (C7H5NO4)
Cp,solid	164.95	J/mol×K	297.06	Heat capacity and standard molar enthalpy of formation of crystalline 2,6-dicarboxypyridine (C7H5NO4)
Cp,solid	166.31	J/mol×K	298.72	Heat capacity and standard molar enthalpy of formation of crystalline 2,6-dicarboxypyridine (C7H5NO4)
Cp,solid	167.65	J/mol×K	300.37	Heat capacity and standard molar enthalpy of formation of crystalline 2,6-dicarboxypyridine (C7H5NO4)
Cp,solid	168.99	J/mol×K	302.01	Heat capacity and standard molar enthalpy of formation of crystalline 2,6-dicarboxypyridine (C7H5NO4)
Cp,solid	170.32	J/mol×K	303.64	Heat capacity and standard molar enthalpy of formation of crystalline 2,6-dicarboxypyridine (C7H5NO4)
Cp,solid	171.65	J/mol×K	305.27	Heat capacity and standard molar enthalpy of formation of crystalline 2,6-dicarboxypyridine (C7H5NO4)
Cp,solid	172.98	J/mol×K	306.88	Heat capacity and standard molar enthalpy of formation of crystalline 2,6-dicarboxypyridine (C7H5NO4)
Cp,solid	175.62	J/mol×K	310.09	Heat capacity and standard molar enthalpy of formation of crystalline 2,6-dicarboxypyridine (C7H5NO4)
Cp,solid	176.93	J/mol×K	311.68	Heat capacity and standard molar enthalpy of formation of crystalline 2,6-dicarboxypyridine (C7H5NO4)
Cp,solid	178.21	J/mol×K	313.25	Heat capacity and standard molar enthalpy of formation of crystalline 2,6-dicarboxypyridine (C7H5NO4)
Cp,solid	179.47	J/mol×K	314.76	Heat capacity and standard molar enthalpy of formation of crystalline 2,6-dicarboxypyridine (C7H5NO4)
Cp,solid	181.03	J/mol×K	316.65	Heat capacity and standard molar enthalpy of formation of crystalline 2,6-dicarboxypyridine (C7H5NO4)
Cp,solid	183.18	J/mol×K	319.26	Heat capacity and standard molar enthalpy of formation of crystalline 2,6-dicarboxypyridine (C7H5NO4)
Cp,solid	185.48	J/mol×K	322.04	Heat capacity and standard molar enthalpy of formation of crystalline 2,6-dicarboxypyridine (C7H5NO4)
Cp,solid	187.75	J/mol×K	324.78	Heat capacity and standard molar enthalpy of formation of crystalline 2,6-dicarboxypyridine (C7H5NO4)
Cp,solid	189.98	J/mol×K	327.48	Heat capacity and standard molar enthalpy of formation of crystalline 2,6-dicarboxypyridine (C7H5NO4)
Cp,solid	192.20	J/mol×K	330.16	Heat capacity and standard molar enthalpy of formation of crystalline 2,6-dicarboxypyridine (C7H5NO4)
Cp,solid	194.40	J/mol×K	332.81	Heat capacity and standard molar enthalpy of formation of crystalline 2,6-dicarboxypyridine (C7H5NO4)
Cp,solid	196.59	J/mol×K	335.45	Heat capacity and standard molar enthalpy of formation of crystalline 2,6-dicarboxypyridine (C7H5NO4)
Cp,solid	198.77	J/mol×K	338.09	Heat capacity and standard molar enthalpy of formation of crystalline 2,6-dicarboxypyridine (C7H5NO4)
Cp,solid	200.97	J/mol×K	340.74	Heat capacity and standard molar enthalpy of formation of crystalline 2,6-dicarboxypyridine (C7H5NO4)
Cp,solid	203.20	J/mol×K	343.44	Heat capacity and standard molar enthalpy of formation of crystalline 2,6-dicarboxypyridine (C7H5NO4)
Cp,solid	205.43	J/mol×K	346.14	Heat capacity and standard molar enthalpy of formation of crystalline 2,6-dicarboxypyridine (C7H5NO4)
Cp,solid	207.58	J/mol×K	348.74	Heat capacity and standard molar enthalpy of formation of crystalline 2,6-dicarboxypyridine (C7H5NO4)
Cp,solid	209.70	J/mol×K	351.31	Heat capacity and standard molar enthalpy of formation of crystalline 2,6-dicarboxypyridine (C7H5NO4)
Cp,solid	211.78	J/mol×K	353.85	Heat capacity and standard molar enthalpy of formation of crystalline 2,6-dicarboxypyridine (C7H5NO4)
Cp,solid	213.86	J/mol×K	356.38	Heat capacity and standard molar enthalpy of formation of crystalline 2,6-dicarboxypyridine (C7H5NO4)
Cp,solid	215.90	J/mol×K	358.86	Heat capacity and standard molar enthalpy of formation of crystalline 2,6-dicarboxypyridine (C7H5NO4)
Cp,solid	217.92	J/mol×K	361.34	Heat capacity and standard molar enthalpy of formation of crystalline 2,6-dicarboxypyridine (C7H5NO4)
Cp,solid	219.91	J/mol×K	363.79	Heat capacity and standard molar enthalpy of formation of crystalline 2,6-dicarboxypyridine (C7H5NO4)
Cp,solid	221.88	J/mol×K	366.21	Heat capacity and standard molar enthalpy of formation of crystalline 2,6-dicarboxypyridine (C7H5NO4)
Cp,solid	223.82	J/mol×K	368.60	Heat capacity and standard molar enthalpy of formation of crystalline 2,6-dicarboxypyridine (C7H5NO4)
Cp,solid	225.73	J/mol×K	370.97	Heat capacity and standard molar enthalpy of formation of crystalline 2,6-dicarboxypyridine (C7H5NO4)
Cp,solid	229.50	J/mol×K	375.64	Heat capacity and standard molar enthalpy of formation of crystalline 2,6-dicarboxypyridine (C7H5NO4)
Cp,solid	231.38	J/mol×K	378.00	Heat capacity and standard molar enthalpy of formation of crystalline 2,6-dicarboxypyridine (C7H5NO4)
ΔvapH	168.20	kJ/mol	494.00	Thermochemical and Theoretical Studies of Dimethylpyridine-2,6-dicarboxylate and Pyridine-2,3-, Pyridine-2,5-, and Pyridine-2,6-dicarboxylic Acids

Similar Compounds

Find more compounds similar to 2,6-Pyridinedicarboxylic acid.

Sources

• Cheméo Relay (1.0)
• Cheméo Relay (1.0, beta) Beta: served but experimental, data-limited and below our cross-validation release bar; the Joback value is recommended where available.
• Crippen Method
• Crippen Method
• Heat capacity and standard molar enthalpy of formation of crystalline 2,6-dicarboxypyridine (C7H5NO4)
• Thermochemistry on K2[M(DPA)2]*7H2O(s) (M= Cu and Ni, H2DPA= pyridine-2,6-dicarboxylic acid)
• Synthesis, Structural Characterization and Thermochemistry of Copper Pyridine 2,6-dicarboxylate
• Synthesis, crystal structure and thermochemistry of nickel hydrogen pyridine-2,6-dicarboxylate
• Thermochemical and Theoretical Studies of Dimethylpyridine-2,6-dicarboxylate and Pyridine-2,3-, Pyridine-2,5-, and Pyridine-2,6-dicarboxylic Acids
• McGowan Method
• NIST Webbook

Note: Cheméo is only indexing the data, follow the source links to retrieve the latest data. The source is also providing more information like the publication year, authors and more. Take the time to validate and double check the source of the data.