- InChI
- InChI=1S/C24H38O4/c1-5-9-13-19(7-3)17-27-23(25)21-15-11-12-16-22(21)24(26)28-18-20(8-4)14-10-6-2/h11-12,15-16,19-20H,5-10,13-14,17-18H2,1-4H3
- InChI Key
- BJQHLKABXJIVAM-UHFFFAOYSA-N
- Formula
- C24H38O4
- SMILES
-
CCCCC(CC)COC(=O)c1ccccc1C(=O)O
CC(CC)CCCC - Molecular Weight1
- 390.56
- CAS
- 117-81-7
- Other Names
-
- 1,2-Benzenedicarboxylic acid, 1,2-bis(2-ethylhexyl) ester
- 1,2-Benzenedicarboxylic acid, bis(2-ethylhexyl) ester
- 2-Ethylhexyl phthalate
- BEHP
- BIS (2-ETHYLHEXYL) PHTHALATE
- Bis(2-ethylhexyl) 1,2-benzenedicarboxylate
- Bis(2-ethylhexyl) o-phthalate
- Bis(2-ethylhexyl)ester phthalic acid
- Bis-(2-ethylhexyl)ester kyseliny ftalove
- Bis-(2-ethylhexyl)ester kyseliny ftalove (Czech)
- Bisoflex 81
- Bisoflex DOP
- Celluflex DOP
- Compound 889
- Corflex 400
- DAF 68
- DEHP
- DIOCTYL PHTHALATE
- DOF
- DOP
- Di(2-ethylhexyl) o-phthalate
- Di(2-ethylhexyl) phthalate
- Di(2-ethylhexyl)-phthalate
- Di(2-ethylhexyl)orthophthalate
- Di(ethylhexyl) phthalate
- Di-sec-octyl phthalate
- Ergoplast FDO
- Ergoplast FDO-S
- Ethylhexyl phthalate
- Eviplast 80
- Eviplast 81
- Fleximel
- Flexol DOP
- Flexol plasticizer DOP
- Good-rite GP 264
- Hatco DOP
- Hatcol dop
- Hercoflex 260
- Jayflex DOP
- Kodaflex DOP
- Merrol DOP
- Mollan O
- Monocizer DOP
- NCI-C52733
- Nuoplaz DOP
- Octoil
- Octyl phthalate
- PX-138
- Palatinol AH
- Palatinol AH-L
- Palatinol DOP
- Phthalic acid di(2-ethylhexyl) ester
- Phthalic acid dioctyl ester
- Phthalic acid, bis(2-ethylhexyl) ester
- Pittsburgh PX-138
- Plasthall DOP
- Platinol AH
- Platinol DOP
- Polycizer DOP
- RC plasticizer DOP
- RCRA Waste number U028
- Reomol D 79P
- Reomol DOP
- Sansocizer DOP
- Sicol 150
- Staflex DOP
- Truflex DOP
- Union carbide flexol 380
- Vestinol AH
- Vinicizer 80
- Vinycizer 80
- Witcizer 312
- bis(2-ethylhexyl) benzene-1,2-dicarboxylate
- etalon
- sconamoll DOP
- ω : Acentric Factor.
- Cp,gas : Ideal gas heat capacity (J/mol×K).
- Cp,liquid : Liquid phase heat capacity (J/mol×K).
- η : Dynamic viscosity (Pa×s).
- ΔfG° : Standard Gibbs free energy of formation (kJ/mol).
- ΔfH°gas : Enthalpy of formation at standard conditions (kJ/mol).
- ΔfusH° : Enthalpy of fusion at standard conditions (kJ/mol).
- ΔvapH° : Enthalpy of vaporization at standard conditions (kJ/mol).
- ΔvapH : Enthalpy of vaporization at a given temperature (kJ/mol).
- IE : Ionization energy (eV).
- log10WS : Log10 of Water solubility in mol/l.
- logPoct/wat : Octanol/Water partition coefficient.
- McVol : McGowan's characteristic volume (ml/mol).
- Pc : Critical Pressure (kPa).
- Pvap : Vapor pressure (kPa).
- ρl : Liquid Density (kg/m3).
- Inp : Non-polar retention indices.
- I : Polar retention indices.
- D*i : Self diffusion coefficient (m2/s).
- S°liquid : Liquid phase molar entropy at standard conditions (J/mol×K).
- Tboil : Normal Boiling Point Temperature (K).
- Tc : Critical Temperature (K).
- Tfus : Normal melting (fusion) point (K).
- Vc : Critical Volume (m3/kmol).
- 1: Molecular weight from the IUPAC atomic weights tables.
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Contents
- Physical Properties
- Temperature Dependent Properties
- Datasets
- Correlations
- Similar Compounds
- Mixtures
- Sources
Physical Properties
| Property | Value | Unit | Source |
|---|---|---|---|
| ω | 1.0404 | Relay (1.0) Calculated Property | |
| ΔfG° | -218.74 | kJ/mol | Joback Calculated Property |
| ΔfH°gas | -933.86 | kJ/mol | Relay (1.0) Calculated Property |
| ΔfusH° | 50.10 | kJ/mol | Joback Calculated Property |
| ΔvapH° | 105.17 | kJ/mol | Relay (1.0) Calculated Property |
| IE | 9.07 | eV | Relay (1.0) Calculated Property |
| log10WS | [-7.06; -6.96] |
|
|
| log10WS | -7.06 | Aq. Solubility Prediction | |
| log10WS | -6.96 | Estimated Solubility | |
| logPoct/wat | 6.433 | Crippen Calculated Property | |
| McVol | 340.140 | ml/mol | McGowan Calculated Property |
| Pc | 1070.00 | kPa | Critical Temperatures and Pressures of 12 Phthalates Using the Pulse-Heating Method |
| Inp | [402.20; 2552.00] |
|
|
| Inp | 2492.60 | NIST | |
| Inp | 2509.00 | NIST | |
| Inp | 2507.00 | NIST | |
| Inp | 2499.40 | NIST | |
| Inp | 2499.00 | NIST | |
| Inp | 2499.00 | NIST | |
| Inp | 2505.00 | NIST | |
| Inp | 2546.00 | NIST | |
| Inp | 2488.00 | NIST | |
| Inp | 2498.00 | NIST | |
| Inp | 2552.00 | NIST | |
| Inp | 2539.00 | NIST | |
| Inp | 2544.00 | NIST | |
| Inp | 2551.00 | NIST | |
| Inp | 2509.00 | NIST | |
| Inp | 2550.00 | NIST | |
| Inp | 2519.00 | NIST | |
| Inp | 2504.00 | NIST | |
| Inp | 2505.00 | NIST | |
| Inp | 2506.00 | NIST | |
| Inp | 2480.00 | NIST | |
| Inp | 2505.00 | NIST | |
| Inp | 2506.00 | NIST | |
| Inp | 2509.00 | NIST | |
| Inp | 2506.00 | NIST | |
| Inp | 2507.00 | NIST | |
| Inp | Outlier 418.60 | NIST | |
| Inp | Outlier 418.70 | NIST | |
| Inp | Outlier 402.20 | NIST | |
| Inp | Outlier 406.14 | NIST | |
| Inp | Outlier 406.15 | NIST | |
| Inp | 2488.00 | NIST | |
| Inp | 2505.00 | NIST | |
| Inp | 2492.60 | NIST | |
| Inp | Outlier 418.60 | NIST | |
| Inp | 2499.40 | NIST | |
| Inp | 2507.00 | NIST | |
| Inp | Outlier 406.14 | NIST | |
| Inp | 2539.00 | NIST | |
| Inp | 2519.00 | NIST | |
| I | [3106.00; 3106.00] |
|
|
| I | 3106.00 | NIST | |
| I | 3106.00 | NIST | |
| I | 3106.00 | NIST | |
| I | 3106.00 | NIST | |
| I | 3106.00 | NIST | |
| S°liquid | [755.20; 807.70] | J/mol×K |
|
| S°liquid | 807.70 | J/mol×K | NIST |
| S°liquid | 755.20 | J/mol×K | NIST |
| Tboil | 657.20 | K | NIST |
| Tc | 860.87 | K | Relay (1.0) Calculated Property |
| Tfus | 219.82 | K | Aq. Solubility Prediction |
| Vc | 1.243 | m3/kmol | Relay (1.0) Calculated Property |
Temperature Dependent Properties
Datasets
Molar heat capacity at constant pressure, J/K/mol
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Pressure, kPa - Liquid | Molar heat capacity at constant pressure, J/K/mol - Liquid |
| 293.15 | 100.00 | 703.00 |
| 293.15 | 10000.00 | 701.50 |
| 293.15 | 20000.00 | 699.90 |
| 293.15 | 30000.00 | 699.60 |
| 313.15 | 100.00 | 726.90 |
| 313.15 | 10000.00 | 724.90 |
| 313.15 | 20000.00 | 723.00 |
| 313.15 | 30000.00 | 722.00 |
| 333.15 | 100.00 | 751.30 |
| 333.15 | 10000.00 | 750.00 |
| 333.15 | 20000.00 | 747.50 |
| 333.15 | 30000.00 | 746.00 |
| 353.15 | 100.00 | 774.50 |
| 353.15 | 10000.00 | 770.50 |
| 353.15 | 20000.00 | 767.90 |
| 353.15 | 30000.00 | 763.40 |
| Reference | ||
Mass density, kg/m3
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Pressure, kPa - Liquid | Mass density, kg/m3 - Liquid |
| 373.29 | 3800.00 | 921.0 |
| 373.29 | 7600.00 | 924.0 |
| 373.29 | 12200.00 | 928.0 |
| 373.29 | 15900.00 | 931.0 |
| 373.29 | 18100.00 | 933.0 |
| 373.29 | 22300.00 | 936.0 |
| 373.29 | 28300.00 | 940.0 |
| 373.29 | 34800.00 | 945.0 |
| 373.29 | 42200.00 | 950.0 |
| 373.29 | 48900.00 | 954.0 |
| 373.29 | 56100.00 | 959.0 |
| 373.29 | 69500.00 | 967.0 |
| 373.29 | 83700.00 | 974.0 |
| 373.29 | 104200.00 | 984.0 |
| 373.29 | 125400.00 | 994.0 |
| 373.29 | 138900.00 | 1001.0 |
| 373.29 | 152900.00 | 1007.0 |
| 373.29 | 174400.00 | 1015.0 |
| 373.29 | 208300.00 | 1029.0 |
| 373.29 | 240000.00 | 1041.0 |
| 373.29 | 262100.00 | 1046.0 |
| 423.53 | 4200.00 | 878.0 |
| 423.53 | 7900.00 | 885.0 |
| 423.53 | 11100.00 | 890.0 |
| 423.53 | 14500.00 | 895.0 |
| 423.53 | 18000.00 | 898.0 |
| 423.53 | 21200.00 | 901.0 |
| 423.53 | 27800.00 | 908.0 |
| 423.53 | 35200.00 | 914.0 |
| 423.53 | 42100.00 | 918.0 |
| 423.53 | 49200.00 | 924.0 |
| 423.53 | 55700.00 | 930.0 |
| 423.53 | 70700.00 | 939.0 |
| 423.53 | 83700.00 | 948.0 |
| 423.53 | 104200.00 | 960.0 |
| 423.53 | 125400.00 | 970.0 |
| 423.53 | 139900.00 | 977.0 |
| 423.53 | 153700.00 | 983.0 |
| 423.53 | 173400.00 | 992.0 |
| 423.53 | 207100.00 | 1006.0 |
| 423.53 | 239400.00 | 1018.0 |
| 423.53 | 263800.00 | 1028.0 |
| 476.20 | 5500.00 | 847.0 |
| 476.20 | 9500.00 | 853.0 |
| 476.20 | 9400.00 | 853.0 |
| 476.20 | 15700.00 | 861.0 |
| 476.20 | 15200.00 | 861.0 |
| 476.20 | 15200.00 | 861.0 |
| 476.20 | 27500.00 | 874.0 |
| 476.20 | 27300.00 | 874.0 |
| 476.20 | 26800.00 | 874.0 |
| 476.20 | 46900.00 | 894.0 |
| 476.20 | 46700.00 | 894.0 |
| 476.20 | 59800.00 | 905.0 |
| 476.20 | 71500.00 | 913.0 |
| 476.20 | 70700.00 | 914.0 |
| 476.20 | 96400.00 | 931.0 |
| 476.20 | 95700.00 | 931.0 |
| 476.20 | 114800.00 | 942.0 |
| 476.20 | 114200.00 | 942.0 |
| 476.20 | 140400.00 | 958.0 |
| 476.20 | 139800.00 | 959.0 |
| 476.20 | 176200.00 | 975.0 |
| 476.20 | 206900.00 | 990.0 |
| 476.20 | 240200.00 | 1002.0 |
| 476.20 | 269000.00 | 1013.0 |
| 491.86 | 3900.00 | 830.0 |
| 491.86 | 4100.00 | 830.0 |
| 491.86 | 3900.00 | 831.0 |
| 491.86 | 10500.00 | 839.0 |
| 491.86 | 9900.00 | 840.0 |
| 491.86 | 23300.00 | 856.0 |
| 491.86 | 23300.00 | 856.0 |
| 491.86 | 22800.00 | 856.0 |
| 491.86 | 37500.00 | 870.0 |
| 491.86 | 37200.00 | 870.0 |
| 491.86 | 51100.00 | 885.0 |
| 491.86 | 50700.00 | 886.0 |
| 491.86 | 71500.00 | 902.0 |
| 491.86 | 71900.00 | 902.0 |
| 491.86 | 95000.00 | 918.0 |
| 491.86 | 94800.00 | 918.0 |
| 491.86 | 121700.00 | 934.0 |
| 491.86 | 121800.00 | 934.0 |
| 491.86 | 145400.00 | 948.0 |
| 491.86 | 145600.00 | 948.0 |
| 491.86 | 177200.00 | 964.0 |
| 491.86 | 177400.00 | 964.0 |
| 491.86 | 204300.00 | 977.0 |
| 491.86 | 206000.00 | 978.0 |
| 491.86 | 230800.00 | 988.0 |
| 491.86 | 229400.00 | 989.0 |
| 491.86 | 253700.00 | 998.0 |
| 491.86 | 258100.00 | 1000.0 |
| 523.60 | 5700.00 | 811.0 |
| 523.60 | 9200.00 | 817.0 |
| 523.60 | 9200.00 | 817.0 |
| 523.60 | 16100.00 | 827.0 |
| 523.60 | 16100.00 | 827.0 |
| 523.60 | 21600.00 | 835.0 |
| 523.60 | 21600.00 | 835.0 |
| 523.60 | 27500.00 | 842.0 |
| 523.60 | 27300.00 | 842.0 |
| 523.60 | 35700.00 | 851.0 |
| 523.60 | 35500.00 | 851.0 |
| 523.60 | 44400.00 | 860.0 |
| 523.60 | 44600.00 | 860.0 |
| 523.60 | 44300.00 | 860.0 |
| 523.60 | 44200.00 | 860.0 |
| 523.60 | 56300.00 | 871.0 |
| 523.60 | 55800.00 | 871.0 |
| 523.60 | 68900.00 | 882.0 |
| 523.60 | 68500.00 | 882.0 |
| 523.60 | 82500.00 | 892.0 |
| 523.60 | 82200.00 | 893.0 |
| 523.60 | 97300.00 | 903.0 |
| 523.60 | 97000.00 | 903.0 |
| 523.60 | 117000.00 | 916.0 |
| 523.60 | 117700.00 | 916.0 |
| 523.60 | 117400.00 | 916.0 |
| 523.60 | 155700.00 | 939.0 |
| 523.60 | 156100.00 | 939.0 |
| 523.60 | 181500.00 | 952.0 |
| 523.60 | 181200.00 | 952.0 |
| 523.60 | 209500.00 | 964.0 |
| 523.60 | 209900.00 | 964.0 |
| 523.60 | 233900.00 | 974.0 |
| 523.60 | 234000.00 | 974.0 |
| 523.60 | 253600.00 | 983.0 |
| 523.60 | 253400.00 | 983.0 |
| 523.60 | 263500.00 | 987.0 |
| Reference | ||
Correlations
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| Pvap | [1.33; 202.65] | kPa | [512.02; 762.10] |
The Yaws Handbook of Vapor Pressure
|
| Equation | ln(Pvp) = A + B/(T + C) | |||
| Coefficient A | 1.26088e+01 | |||
| Coefficient B | -4.47566e+03 | |||
| Coefficient C | -1.48765e+02 | |||
| Temperature range, min. | 512.02 | |||
| Temperature range, max. | 762.10 | |||
| Pvap | 1.33 | kPa | 512.02 | Calculated Property |
| Pvap | 3.20 | kPa | 539.81 | Calculated Property |
| Pvap | 6.84 | kPa | 567.59 | Calculated Property |
| Pvap | 13.30 | kPa | 595.38 | Calculated Property |
| Pvap | 23.91 | kPa | 623.17 | Calculated Property |
| Pvap | 40.30 | kPa | 650.95 | Calculated Property |
| Pvap | 64.31 | kPa | 678.74 | Calculated Property |
| Pvap | 97.95 | kPa | 706.53 | Calculated Property |
| Pvap | 143.34 | kPa | 734.31 | Calculated Property |
| Pvap | 202.65 | kPa | 762.10 | Calculated Property |
| Pvap | [9.39e-09; 1155.41] | kPa | [298.00; 806.00] |
KDB Vapor Pressure Data
|
| Equation | ln(Pvp) = A + B/T + C*ln(T) + D*T^2 | |||
| Coefficient A | 1.60562e+02 | |||
| Coefficient B | -2.04275e+04 | |||
| Coefficient C | -1.94419e+01 | |||
| Coefficient D | 2.98773e-06 | |||
| Temperature range, min. | 298.00 | |||
| Temperature range, max. | 806.00 | |||
| Pvap | 9.39e-09 | kPa | 298.00 | Calculated Property |
| Pvap | 1.98e-05 | kPa | 354.44 | Calculated Property |
| Pvap | 3.50e-03 | kPa | 410.89 | Calculated Property |
| Pvap | 0.13 | kPa | 467.33 | Calculated Property |
| Pvap | 1.92 | kPa | 523.78 | Calculated Property |
| Pvap | 14.08 | kPa | 580.22 | Calculated Property |
| Pvap | 64.50 | kPa | 636.67 | Calculated Property |
| Pvap | 211.11 | kPa | 693.11 | Calculated Property |
| Pvap | 540.72 | kPa | 749.56 | Calculated Property |
| Pvap | 1155.41 | kPa | 806.00 | Calculated Property |
Similar Compounds
Find more compounds similar to Bis(2-ethylhexyl) phthalate.
Mixtures
- n-Hexane + Bis(2-ethylhexyl) phthalate
- Toluene + Bis(2-ethylhexyl) phthalate
- Ethylbenzene + Bis(2-ethylhexyl) phthalate
- Benzene, 1,2,4-trimethyl- + Bis(2-ethylhexyl) phthalate
Sources
- KDB Vapor Pressure Data
- Cheméo Relay (1.0)
- Crippen Method
- An experimental setup for isobaric heat capacities for viscous fluids at high pressure: Squalane, bis(2-ethylhexyl) sebacate and bis(2-ethylhexyl) phthalate
- Experimental density measurements of bis(2-ethylhexyl) phthalate at elevated temperatures and pressures
- Viscous Calibration Liquids for Self-diffusion Measurements
- A Comparison of Results by Correlation Gas Chromatography with Another Gas Chromatographic Retention Time Technique. The Effects of Retention Time Coincidence on Vaporization Enthalpy and Vapor Pressure
- Solubilities at High Dilution of Toluene, Ethylbenzene, 1,2,4-Trimethylbenzene, and Hexane in Di-2-ethylhexyl, Diisoheptyl, and Diisononyl Phthalates
- Critical Temperatures and Pressures of 12 Phthalates Using the Pulse-Heating Method
- Measurements of the Viscosity of Bis(2-ethylhexyl) Sebacate, Squalane, and Bis(2-ethylhexyl) Phthalate between (283 and 363) K at 0.1 MPa
- Vapor Pressure and Enthalpy of Vaporization of Fentanyl
- Temperature and Pressure Dependence of the Viscosities of 2-Ethylhexyl Benzoate, Bis(2-ethylhexyl) Phthalate, 2,6,10,15,19,23-Hexamethyltetracosane (Squalane), and Diisodecyl Phthalate
- Joback Method
- KDB
- Aqueous Solubility Prediction Method
- Estimated Solubility Method
- McGowan Method
- NIST Webbook
- The Yaws Handbook of Vapor Pressure
Note: Cheméo is only indexing the data, follow the source links to retrieve the latest data. The source is also providing more information like the publication year, authors and more.
Take the time to validate and double check the source of the data.
Outlier This icon means
that the value is more than 2 standard deviations away from the
property mean.