- Name
- Sorbitol
- InChI
- InChI=1S/C6H14O6/c7-1-3(9)5(11)6(12)4(10)2-8/h3-12H,1-2H2/t3-,4+,5-,6-/m1/s1
- InChI Key
- FBPFZTCFMRRESA-JGWLITMVSA-N
- Formula
- C6H14O6
- SMILES
-
OC[C@@H](O)[C@H](O)[C@@H](O)[C
@@H](O)CO - Mol. Weight (g/mol)
- 182.17
- Name
- sodium chloride
- InChI
- InChI=1S/ClH.Na/h1H;/q;+1/p-1
- InChI Key
- FAPWRFPIFSIZLT-UHFFFAOYSA-M
- Formula
- ClNa
- SMILES
- [Cl-].[Na+]
- Mol. Weight (g/mol)
- 58.44
- CAS
- 7647-14-5
- Name
- Water
- InChI
- InChI=1S/H2O/h1H2
- InChI Key
- XLYOFNOQVPJJNP-UHFFFAOYSA-N
- Formula
- H2O
- SMILES
- O
- Mol. Weight (g/mol)
- 18.02
- CAS
- 7732-18-5
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Molar enthalpy of dilution, kJ/mol [ref]
Operational conditions:
- Solvent: Molality, mol/kg = 0.5 (Liquid)
- Pressure, kPa = 101.3 (Liquid)
| Fixed | Measured | ||
|---|---|---|---|
| Temperature, K - Liquid | Initial molality of solute, mol/kg - Liquid | Final molality of solute, mol/kg - Liquid | Molar enthalpy of dilution, kJ/mol - Liquid |
| 293.15 | 0.1459 | 0.0708 | -0.0033 |
| 293.15 | 0.1695 | 0.0826 | -0.0042 |
| 293.15 | 0.1943 | 0.0947 | -0.0048 |
| 293.15 | 0.2229 | 0.1091 | -0.0057 |
| 293.15 | 0.2510 | 0.1227 | -0.0064 |
| 293.15 | 0.2817 | 0.1373 | -0.0074 |
| 293.15 | 0.3094 | 0.1506 | -0.0081 |
| 293.15 | 0.3376 | 0.1643 | -0.0092 |
| 293.15 | 0.3674 | 0.1789 | -0.0102 |
| 293.15 | 0.3979 | 0.1934 | -0.0111 |
| 293.15 | 0.4354 | 0.2119 | -0.0123 |
| 293.15 | 0.4778 | 0.2326 | -0.0138 |
| 298.15 | 0.1381 | 0.0670 | -0.0035 |
| 298.15 | 0.1659 | 0.0805 | -0.0047 |
| 298.15 | 0.1920 | 0.0931 | -0.0056 |
| 298.15 | 0.2193 | 0.1067 | -0.0068 |
| 298.15 | 0.2455 | 0.1199 | -0.0081 |
| 298.15 | 0.2743 | 0.1338 | -0.0092 |
| 298.15 | 0.3019 | 0.1470 | -0.0102 |
| 298.15 | 0.3329 | 0.1617 | -0.0116 |
| 298.15 | 0.3628 | 0.1763 | -0.0128 |
| 298.15 | 0.3938 | 0.1914 | -0.0142 |
| 298.15 | 0.4249 | 0.2065 | -0.0152 |
| 298.15 | 0.4614 | 0.2239 | -0.0167 |
| 303.15 | 0.0987 | 0.0490 | -0.0050 |
| 303.15 | 0.1276 | 0.0629 | -0.0063 |
| 303.15 | 0.1550 | 0.0760 | -0.0077 |
| 303.15 | 0.1856 | 0.0913 | -0.0090 |
| 303.15 | 0.2177 | 0.1070 | -0.0106 |
| 303.15 | 0.2505 | 0.1229 | -0.0123 |
| 303.15 | 0.2843 | 0.1393 | -0.0140 |
| 303.15 | 0.3184 | 0.1560 | -0.0158 |
| 303.15 | 0.3511 | 0.1711 | -0.0175 |
| 303.15 | 0.3850 | 0.1880 | -0.0193 |
| 303.15 | 0.4132 | 0.2010 | -0.0210 |
| 303.15 | 0.4502 | 0.2186 | -0.0230 |
| 308.15 | 0.1412 | 0.0784 | -0.0096 |
| 308.15 | 0.1740 | 0.0964 | -0.0109 |
| 308.15 | 0.2063 | 0.1138 | -0.0124 |
| 308.15 | 0.2406 | 0.1327 | -0.0141 |
| 308.15 | 0.2780 | 0.1534 | -0.0159 |
| 308.15 | 0.3135 | 0.1735 | -0.0184 |
| 308.15 | 0.3458 | 0.1905 | -0.0197 |
| 308.15 | 0.3761 | 0.2067 | -0.0213 |
| 308.15 | 0.4095 | 0.2247 | -0.0231 |
| 308.15 | 0.4439 | 0.2431 | -0.0251 |
| 308.15 | 0.4744 | 0.2594 | -0.0270 |
| 308.15 | 0.4984 | 0.2721 | -0.0290 |
| 318.15 | 0.0965 | 0.0481 | -0.0066 |
| 318.15 | 0.1237 | 0.0621 | -0.0086 |
| 318.15 | 0.1540 | 0.0771 | -0.0105 |
| 318.15 | 0.1831 | 0.0919 | -0.0119 |
| 318.15 | 0.2123 | 0.1064 | -0.0134 |
| 318.15 | 0.2412 | 0.1205 | -0.0155 |
| 318.15 | 0.2720 | 0.1361 | -0.0172 |
| 318.15 | 0.3004 | 0.1501 | -0.0195 |
| 318.15 | 0.3342 | 0.1663 | -0.0218 |
| 318.15 | 0.3719 | 0.1846 | -0.0244 |
| 318.15 | 0.4186 | 0.2077 | -0.0275 |
| 318.15 | 0.4543 | 0.2253 | -0.0301 |
Vapor or sublimation pressure, kPa [ref]
| Fixed | Measured | ||
|---|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of sodium chloride (2) - Liquid | Molality, mol/kg of Sorbitol (1) - Liquid | Vapor or sublimation pressure, kPa - Liquid |
| 338.00 | 0.0000 | 1.0000 | 24.51 |
| 338.00 | 0.0000 | 1.9962 | 24.06 |
| 338.00 | 0.0000 | 1.9992 | 24.07 |
| 338.00 | 0.0000 | 2.9978 | 23.51 |
| 338.00 | 0.0000 | 4.993 | 22.79 |
| 338.00 | 0.0000 | 5.9498 | 22.28 |
| 338.00 | 0.0000 | 7.7271 | 21.49 |
| 338.00 | 0.1555 | 1.3482 | 24.27 |
| 338.00 | 0.2047 | 0.8001 | 24.41 |
| 338.00 | 0.3193 | 2.247 | 23.71 |
| 338.00 | 0.3482 | 3.132 | 23.35 |
| 338.00 | 0.4016 | 1.5951 | 24.14 |
| 338.00 | 0.4040 | 0.5975 | 24.60 |
| 338.00 | 0.4543 | 1.046 | 24.10 |
| 338.00 | 0.5977 | 0.4004 | 24.37 |
| 338.00 | 0.5981 | 2.3972 | 23.57 |
| 338.00 | 0.7514 | 0.7503 | 24.04 |
| 338.00 | 0.7704 | 0.7500 | 23.95 |
| 338.00 | 0.8006 | 1.735 | 23.63 |
| 338.00 | 0.8020 | 0.2066 | 24.23 |
| 338.00 | 0.8084 | 1.2064 | 24.10 |
| 338.00 | 0.8169 | 3.2006 | 23.00 |
| 338.00 | 1.05 | 0.4489 | 24.13 |
| 338.00 | 1.0617 | 2.4501 | 22.97 |
| 338.00 | 1.1899 | 0.8007 | 23.82 |
| 338.00 | 1.2142 | 1.801 | 23.01 |
| 338.00 | 1.2574 | 1.261 | 23.60 |
| 338.00 | 1.3496 | 0.1497 | 23.95 |
| 338.00 | 1.5966 | 0.4000 | 23.68 |
| 338.00 | 1.6032 | 2.3992 | 22.69 |
| 338.00 | 1.6049 | 0.3998 | 23.37 |
| 338.00 | 1.6189 | 0.3989 | 23.56 |
| 338.00 | 1.7471 | 0.7487 | 23.54 |
| 338.00 | 1.8004 | 1.2047 | 22.91 |
| 338.00 | 1.8384 | 1.7448 | 22.71 |
| 338.00 | 2.2479 | 2.2482 | 22.17 |
| 338.00 | 2.2505 | 0.2499 | 22.86 |
| 338.00 | 2.3957 | 0.5977 | 22.79 |
| 338.00 | 2.4089 | 1.5982 | 22.57 |
| 338.00 | 3.1461 | 0.3499 | 22.00 |
| 348.00 | 0.0000 | 1.0000 | 37.67 |
| 348.00 | 0.0000 | 1.9962 | 37.07 |
| 348.00 | 0.0000 | 1.9992 | 36.91 |
| 348.00 | 0.0000 | 2.9978 | 36.14 |
| 348.00 | 0.0000 | 4.993 | 35.20 |
| 348.00 | 0.0000 | 5.9498 | 34.31 |
| 348.00 | 0.0000 | 7.7271 | 32.99 |
| 348.00 | 0.1555 | 1.3482 | 37.34 |
| 348.00 | 0.2047 | 0.8001 | 37.73 |
| 348.00 | 0.3193 | 2.247 | 36.79 |
| 348.00 | 0.4016 | 1.5951 | 37.11 |
| 348.00 | 0.4543 | 1.046 | 37.24 |
| 348.00 | 0.5977 | 0.4004 | 37.87 |
| 348.00 | 0.5981 | 2.3972 | 36.34 |
| 348.00 | 0.7514 | 0.7503 | 37.39 |
| 348.00 | 0.8006 | 1.735 | 36.27 |
| 348.00 | 0.8020 | 0.2066 | 37.58 |
| 348.00 | 0.8084 | 1.2064 | 37.42 |
| 348.00 | 0.8169 | 3.2006 | 35.51 |
| 348.00 | 1.05 | 0.4489 | 37.13 |
| 348.00 | 1.0617 | 2.4501 | 35.51 |
| 348.00 | 1.1899 | 0.8007 | 37.06 |
| 348.00 | 1.2142 | 1.801 | 35.87 |
| 348.00 | 1.2574 | 1.261 | 36.43 |
| 348.00 | 1.5966 | 0.4000 | 36.51 |
| 348.00 | 1.6032 | 2.3992 | 35.13 |
| 348.00 | 1.7471 | 0.7487 | 36.36 |
| 348.00 | 1.7678 | 2.7065 | 34.29 |
| 348.00 | 1.8004 | 1.2047 | 35.83 |
| 348.00 | 1.8384 | 1.7448 | 34.99 |
| 348.00 | 2.0077 | 3.0119 | 33.37 |
| 348.00 | 2.2479 | 2.2482 | 33.63 |
| 348.00 | 2.2505 | 0.2499 | 35.73 |
| 348.00 | 2.3957 | 0.5977 | 35.73 |
| 348.00 | 2.4089 | 1.5982 | 34.96 |
| 348.00 | 2.4431 | 1.0471 | 35.34 |
| 348.00 | 3.003 | 1.998 | 32.79 |
| 348.00 | 3.1192 | 1.3366 | 33.45 |
| 348.00 | 3.1461 | 0.3499 | 34.61 |
| 348.00 | 3.2125 | 0.8023 | 33.84 |
| 348.00 | 3.9958 | 1.0002 | 32.69 |
| 348.00 | 4.0232 | 0.4478 | 32.63 |
Sources
- Evaluation of the vapour pressure of aqueous NaCl-sorbitol solution and correlation of the water activity on composition and temperature
- Enthalpies of Dilution of (2S,3R,4R,5R)-Hexane-1,2,3,4,5,6-hexol in Water and Aqueous Sodium Halide Solutions at T = (293.15 to 318.15) K
Note: These property values are available through the Cheméo API. A free account gives you an access key.