- Name
- Phenol, 2-methoxy-
- InChI
- InChI=1S/C7H8O2/c1-9-7-5-3-2-4-6(7)8/h2-5,8H,1H3
- InChI Key
- LHGVFZTZFXWLCP-UHFFFAOYSA-N
- Formula
- C7H8O2
- SMILES
- COc1ccccc1O
- Mol. Weight (g/mol)
- 124.14
- CAS
- 90-05-1
- Name
- Carbon dioxide
- InChI
- InChI=1S/CO2/c2-1-3
- InChI Key
- CURLTUGMZLYLDI-UHFFFAOYSA-N
- Formula
- CO2
- SMILES
- O=C=O
- Mol. Weight (g/mol)
- 44.01
- CAS
- 124-38-9
- Name
- Diethylamine, hydrochloride
- InChI
- InChI=1S/C4H11N.ClH/c1-3-5-4-2;/h5H,3-4H2,1-2H3;1H
- InChI Key
- HDITUCONWLWUJR-UHFFFAOYSA-N
- Formula
- C4H12ClN
- SMILES
- CC[NH2+]CC.[Cl-]
- Mol. Weight (g/mol)
- 109.60
- CAS
- 660-68-4
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Vapor or sublimation pressure, kPa [ref]
| Fixed | Measured | ||
|---|---|---|---|
| Molality, mol/kg of Carbon dioxide (2) - Liquid | Temperature, K - Liquid | Solvent: Amount ratio of component to other component of binary solvent of Phenol, 2-methoxy- (1) - Liquid | Vapor or sublimation pressure, kPa - Liquid |
| 0.0197 | 293.15 | 3.0 | 45.10 |
| 0.0545 | 293.15 | 3.0 | 137.10 |
| 0.0892 | 293.15 | 3.0 | 222.80 |
| 0.1299 | 293.15 | 3.0 | 320.60 |
| 0.1693 | 293.15 | 3.0 | 414.90 |
| 0.2120 | 293.15 | 3.0 | 517.70 |
| 0.0199 | 303.15 | 3.0 | 53.90 |
| 0.0499 | 303.15 | 3.0 | 133.60 |
| 0.0862 | 303.15 | 3.0 | 241.50 |
| 0.1203 | 303.15 | 3.0 | 339.10 |
| 0.1525 | 303.15 | 3.0 | 428.80 |
| 0.1834 | 303.15 | 3.0 | 513.50 |
| 0.0201 | 313.15 | 3.0 | 59.20 |
| 0.0565 | 313.15 | 3.0 | 182.90 |
| 0.0840 | 313.15 | 3.0 | 271.20 |
| 0.1103 | 313.15 | 3.0 | 357.50 |
| 0.1344 | 313.15 | 3.0 | 436.40 |
| 0.1602 | 313.15 | 3.0 | 524.60 |
| 0.0160 | 323.15 | 3.0 | 56.60 |
| 0.0388 | 323.15 | 3.0 | 143.40 |
| 0.0665 | 323.15 | 3.0 | 246.00 |
| 0.0893 | 323.15 | 3.0 | 331.90 |
| 0.1154 | 323.15 | 3.0 | 428.90 |
| 0.1421 | 323.15 | 3.0 | 525.40 |
| 0.0209 | 293.15 | 4.0 | 49.60 |
| 0.0558 | 293.15 | 4.0 | 134.60 |
| 0.0936 | 293.15 | 4.0 | 224.40 |
| 0.1344 | 293.15 | 4.0 | 323.10 |
| 0.1736 | 293.15 | 4.0 | 411.30 |
| 0.2212 | 293.15 | 4.0 | 516.10 |
| 0.0233 | 303.15 | 4.0 | 61.70 |
| 0.0525 | 303.15 | 4.0 | 142.60 |
| 0.0837 | 303.15 | 4.0 | 227.50 |
| 0.1279 | 303.15 | 4.0 | 345.80 |
| 0.1577 | 303.15 | 4.0 | 425.40 |
| 0.1947 | 303.15 | 4.0 | 524.80 |
| 0.0163 | 313.15 | 4.0 | 54.20 |
| 0.0442 | 313.15 | 4.0 | 141.10 |
| 0.0759 | 313.15 | 4.0 | 242.20 |
| 0.1099 | 313.15 | 4.0 | 346.80 |
| 0.1371 | 313.15 | 4.0 | 431.80 |
| 0.1691 | 313.15 | 4.0 | 529.20 |
| 0.0156 | 323.15 | 4.0 | 58.90 |
| 0.0415 | 323.15 | 4.0 | 148.40 |
| 0.0641 | 323.15 | 4.0 | 230.10 |
| 0.0952 | 323.15 | 4.0 | 337.70 |
| 0.1217 | 323.15 | 4.0 | 430.40 |
| 0.1483 | 323.15 | 4.0 | 526.80 |
| 0.0218 | 293.15 | 5.0 | 48.80 |
| 0.0584 | 293.15 | 5.0 | 131.90 |
| 0.1077 | 293.15 | 5.0 | 245.30 |
| 0.1440 | 293.15 | 5.0 | 326.50 |
| 0.1862 | 293.15 | 5.0 | 419.20 |
| 0.2321 | 293.15 | 5.0 | 522.30 |
| 0.0220 | 303.15 | 5.0 | 57.00 |
| 0.0557 | 303.15 | 5.0 | 148.30 |
| 0.0930 | 303.15 | 5.0 | 244.90 |
| 0.1300 | 303.15 | 5.0 | 341.20 |
| 0.1629 | 303.15 | 5.0 | 424.40 |
| 0.1995 | 303.15 | 5.0 | 520.10 |
| 0.0196 | 313.15 | 5.0 | 58.80 |
| 0.0514 | 313.15 | 5.0 | 156.00 |
| 0.0904 | 313.15 | 5.0 | 273.60 |
| 0.1109 | 313.15 | 5.0 | 336.30 |
| 0.1425 | 313.15 | 5.0 | 428.60 |
| 0.1842 | 313.15 | 5.0 | 550.70 |
| 0.0166 | 323.15 | 5.0 | 59.90 |
| 0.0563 | 323.15 | 5.0 | 193.10 |
| 0.0732 | 323.15 | 5.0 | 253.30 |
| 0.0975 | 323.15 | 5.0 | 333.80 |
| 0.1270 | 323.15 | 5.0 | 431.50 |
| 0.1592 | 323.15 | 5.0 | 535.80 |
Sources
- Solubilities and Thermodynamic Properties of Carbon Dioxide in Guaiacol-Based Deep Eutectic Solvents
Note: These property values are available through the Cheméo API. A free account gives you an access key.