- Name
- Formamide, N,N-dimethyl-
- InChI
- InChI=1S/C3H7NO/c1-4(2)3-5/h3H,1-2H3
- InChI Key
- ZMXDDKWLCZADIW-UHFFFAOYSA-N
- Formula
- C3H7NO
- SMILES
- CN(C)C=O
- Mol. Weight (g/mol)
- 73.09
- CAS
- 68-12-2
- Name
- 1-Nonanol
- InChI
- InChI=1S/C9H20O/c1-2-3-4-5-6-7-8-9-10/h10H,2-9H2,1H3
- InChI Key
- ZWRUINPWMLAQRD-UHFFFAOYSA-N
- Formula
- C9H20O
- SMILES
- CCCCCCCCCO
- Mol. Weight (g/mol)
- 144.25
- CAS
- 143-08-8
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Formamide, N,N-dimethyl- (1) - Liquid | Viscosity, Pa*s - Liquid |
| 298.15 | 0.0000 | 0.0097 |
| 298.15 | 0.2201 | 0.0048 |
| 298.15 | 0.3969 | 0.0027 |
| 298.15 | 0.5458 | 0.0018 |
| 298.15 | 0.6515 | 0.0014 |
| 298.15 | 0.7321 | 0.0012 |
| 298.15 | 0.8042 | 0.0010 |
| 298.15 | 0.8644 | 0.0009 |
| 298.15 | 0.9168 | 0.0009 |
| 298.15 | 0.9596 | 0.0009 |
| 298.15 | 1.0000 | 0.0008 |
| 303.15 | 0.0000 | 0.0079 |
| 303.15 | 0.2201 | 0.0036 |
| 303.15 | 0.3969 | 0.0019 |
| 303.15 | 0.5458 | 0.0012 |
| 303.15 | 0.6515 | 0.0009 |
| 303.15 | 0.7321 | 0.0008 |
| 303.15 | 0.8042 | 0.0008 |
| 303.15 | 0.8644 | 0.0008 |
| 303.15 | 0.9168 | 0.0008 |
| 303.15 | 0.9596 | 0.0008 |
| 303.15 | 1.0000 | 0.0008 |
| 308.15 | 0.0000 | 0.0067 |
| 308.15 | 0.2201 | 0.0030 |
| 308.15 | 0.3969 | 0.0015 |
| 308.15 | 0.5458 | 0.0010 |
| 308.15 | 0.6515 | 0.0008 |
| 308.15 | 0.7321 | 0.0007 |
| 308.15 | 0.8042 | 0.0007 |
| 308.15 | 0.8644 | 0.0007 |
| 308.15 | 0.9168 | 0.0007 |
| 308.15 | 0.9596 | 0.0007 |
| 308.15 | 1.0000 | 0.0007 |
| 313.15 | 0.0000 | 0.0056 |
| 313.15 | 0.2201 | 0.0024 |
| 313.15 | 0.3969 | 0.0012 |
| 313.15 | 0.5458 | 0.0007 |
| 313.15 | 0.6515 | 0.0006 |
| 313.15 | 0.7321 | 0.0006 |
| 313.15 | 0.8042 | 0.0006 |
| 313.15 | 0.8644 | 0.0006 |
| 313.15 | 0.9168 | 0.0006 |
| 313.15 | 0.9596 | 0.0007 |
| 313.15 | 1.0000 | 0.0007 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Formamide, N,N-dimethyl- (1) - Liquid | Mass density, kg/m3 - Liquid |
| 298.15 | 0.0000 | 824.478 |
| 298.15 | 0.2201 | 836.826 |
| 298.15 | 0.3969 | 849.646 |
| 298.15 | 0.5458 | 863.512 |
| 298.15 | 0.6515 | 875.893 |
| 298.15 | 0.7321 | 887.234 |
| 298.15 | 0.8042 | 899.18 |
| 298.15 | 0.8644 | 910.842 |
| 298.15 | 0.9168 | 922.441 |
| 298.15 | 0.9596 | 933.098 |
| 298.15 | 1.0000 | 944.29 |
| 303.15 | 0.0000 | 821.044 |
| 303.15 | 0.2201 | 833.085 |
| 303.15 | 0.3969 | 845.647 |
| 303.15 | 0.5458 | 859.175 |
| 303.15 | 0.6515 | 871.335 |
| 303.15 | 0.7321 | 882.498 |
| 303.15 | 0.8042 | 894.281 |
| 303.15 | 0.8644 | 905.742 |
| 303.15 | 0.9168 | 917.225 |
| 303.15 | 0.9596 | 927.834 |
| 303.15 | 1.0000 | 939.047 |
| 308.15 | 0.0000 | 817.582 |
| 308.15 | 0.2201 | 829.399 |
| 308.15 | 0.3969 | 841.793 |
| 308.15 | 0.5458 | 855.283 |
| 308.15 | 0.6515 | 867.284 |
| 308.15 | 0.7321 | 878.301 |
| 308.15 | 0.8042 | 889.932 |
| 308.15 | 0.8644 | 901.314 |
| 308.15 | 0.9168 | 912.742 |
| 308.15 | 0.9596 | 923.379 |
| 308.15 | 1.0000 | 934.721 |
| 313.15 | 0.0000 | 814.098 |
| 313.15 | 0.2201 | 825.49 |
| 313.15 | 0.3969 | 837.685 |
| 313.15 | 0.5458 | 851.074 |
| 313.15 | 0.6515 | 862.916 |
| 313.15 | 0.7321 | 873.711 |
| 313.15 | 0.8042 | 885.08 |
| 313.15 | 0.8644 | 896.217 |
| 313.15 | 0.9168 | 907.487 |
| 313.15 | 0.9596 | 918.072 |
| 313.15 | 1.0000 | 929.478 |
Surface tension liquid-gas, N/m [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Formamide, N,N-dimethyl- (1) - Liquid | Surface tension liquid-gas, N/m - Liquid |
| 298.15 | 0.0000 | 0.0276 |
| 298.15 | 0.2201 | 0.0281 |
| 298.15 | 0.3969 | 0.0285 |
| 298.15 | 0.5458 | 0.0290 |
| 298.15 | 0.6515 | 0.0296 |
| 298.15 | 0.7321 | 0.0303 |
| 298.15 | 0.8042 | 0.0312 |
| 298.15 | 0.8644 | 0.0322 |
| 298.15 | 0.9168 | 0.0332 |
| 298.15 | 0.9596 | 0.0342 |
| 298.15 | 1.0000 | 0.0352 |
| 303.15 | 0.0000 | 0.0265 |
| 303.15 | 0.2201 | 0.0270 |
| 303.15 | 0.3969 | 0.0274 |
| 303.15 | 0.5458 | 0.0278 |
| 303.15 | 0.6515 | 0.0284 |
| 303.15 | 0.7321 | 0.0291 |
| 303.15 | 0.8042 | 0.0300 |
| 303.15 | 0.8644 | 0.0310 |
| 303.15 | 0.9168 | 0.0321 |
| 303.15 | 0.9596 | 0.0331 |
| 303.15 | 1.0000 | 0.0341 |
| 308.15 | 0.0000 | 0.0255 |
| 308.15 | 0.2201 | 0.0260 |
| 308.15 | 0.3969 | 0.0263 |
| 308.15 | 0.5458 | 0.0267 |
| 308.15 | 0.6515 | 0.0273 |
| 308.15 | 0.7321 | 0.0280 |
| 308.15 | 0.8042 | 0.0289 |
| 308.15 | 0.8644 | 0.0299 |
| 308.15 | 0.9168 | 0.0310 |
| 308.15 | 0.9596 | 0.0320 |
| 308.15 | 1.0000 | 0.0330 |
| 313.15 | 0.0000 | 0.0244 |
| 313.15 | 0.2201 | 0.0249 |
| 313.15 | 0.3969 | 0.0253 |
| 313.15 | 0.5458 | 0.0256 |
| 313.15 | 0.6515 | 0.0262 |
| 313.15 | 0.7321 | 0.0269 |
| 313.15 | 0.8042 | 0.0278 |
| 313.15 | 0.8644 | 0.0289 |
| 313.15 | 0.9168 | 0.0299 |
| 313.15 | 0.9596 | 0.0309 |
| 313.15 | 1.0000 | 0.0320 |
Sources
- Physico-chemical properties of binary mixtures of N,N-dimethylformamide with 1-octanol, 1-nonanol and 1-decanol at different temperatures
- Effect of temperature and chain length on the viscosity and surface tension of binary systems of N,N-dimethylformamide with 1-octanol, 1-nonanol and 1-decanol
Note: These property values are available through the Cheméo API. A free account gives you an access key.