- Name
- Benzene, 1,2-dichloro-
- InChI
- InChI=1S/C6H4Cl2/c7-5-3-1-2-4-6(5)8/h1-4H
- InChI Key
- RFFLAFLAYFXFSW-UHFFFAOYSA-N
- Formula
- C6H4Cl2
- SMILES
- Clc1ccccc1Cl
- Mol. Weight (g/mol)
- 147.00
- CAS
- 95-50-1
- Name
- 2-Octanol
- InChI
- InChI=1S/C8H18O/c1-3-4-5-6-7-8(2)9/h8-9H,3-7H2,1-2H3
- InChI Key
- SJWFXCIHNDVPSH-UHFFFAOYSA-N
- Formula
- C8H18O
- SMILES
- CCCCCCC(C)O
- Mol. Weight (g/mol)
- 130.23
- CAS
- 123-96-6
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- η - Viscosity, Pa*s
- n0 - Refractive index (Na D-line)
- ρl - Mass density, kg/m3
- csound,fluid - Speed of Sound, m/s
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Benzene, 1,2-dichloro- (1) - Liquid | Viscosity, Pa*s - Liquid |
| 298.15 | 0.0721 | 0.0054 |
| 298.15 | 0.1124 | 0.0047 |
| 298.15 | 0.1868 | 0.0038 |
| 298.15 | 0.2615 | 0.0032 |
| 298.15 | 0.3223 | 0.0027 |
| 298.15 | 0.3758 | 0.0024 |
| 298.15 | 0.4495 | 0.0021 |
| 298.15 | 0.5120 | 0.0019 |
| 298.15 | 0.5923 | 0.0017 |
| 298.15 | 0.6557 | 0.0016 |
| 298.15 | 0.7312 | 0.0014 |
| 298.15 | 0.7970 | 0.0013 |
| 298.15 | 0.8672 | 0.0013 |
| 298.15 | 0.9481 | 0.0013 |
| 298.15 | 1.0000 | 0.0013 |
| 303.15 | 0.0721 | 0.0042 |
| 303.15 | 0.1124 | 0.0037 |
| 303.15 | 0.1868 | 0.0031 |
| 303.15 | 0.2615 | 0.0026 |
| 303.15 | 0.3223 | 0.0023 |
| 303.15 | 0.3758 | 0.0022 |
| 303.15 | 0.4495 | 0.0019 |
| 303.15 | 0.5120 | 0.0018 |
| 303.15 | 0.5923 | 0.0016 |
| 303.15 | 0.6557 | 0.0015 |
| 303.15 | 0.7312 | 0.0013 |
| 303.15 | 0.7970 | 0.0013 |
| 303.15 | 0.8672 | 0.0012 |
| 303.15 | 0.9481 | 0.0012 |
| 303.15 | 1.0000 | 0.0012 |
| 308.15 | 0.0721 | 0.0035 |
| 308.15 | 0.1124 | 0.0032 |
| 308.15 | 0.1868 | 0.0028 |
| 308.15 | 0.2615 | 0.0024 |
| 308.15 | 0.3223 | 0.0021 |
| 308.15 | 0.3758 | 0.0019 |
| 308.15 | 0.4495 | 0.0017 |
| 308.15 | 0.5120 | 0.0015 |
| 308.15 | 0.5923 | 0.0014 |
| 308.15 | 0.6557 | 0.0012 |
| 308.15 | 0.7312 | 0.0012 |
| 308.15 | 0.7970 | 0.0011 |
| 308.15 | 0.8672 | 0.0011 |
| 308.15 | 0.9481 | 0.0011 |
| 308.15 | 1.0000 | 0.0011 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Benzene, 1,2-dichloro- (1) - Liquid | Refractive index (Na D-line) - Liquid |
| 298.15 | 0.0721 | 1.4308 |
| 298.15 | 0.1124 | 1.4352 |
| 298.15 | 0.1868 | 1.443 |
| 298.15 | 0.2615 | 1.4507 |
| 298.15 | 0.3223 | 1.4569 |
| 298.15 | 0.3758 | 1.4624 |
| 298.15 | 0.4495 | 1.4698 |
| 298.15 | 0.5120 | 1.4763 |
| 298.15 | 0.5923 | 1.4848 |
| 298.15 | 0.6557 | 1.492 |
| 298.15 | 0.7312 | 1.5014 |
| 298.15 | 0.7970 | 1.5103 |
| 298.15 | 0.8672 | 1.521 |
| 298.15 | 0.9481 | 1.5353 |
| 298.15 | 1.0000 | 1.546 |
| 303.15 | 0.0721 | 1.4293 |
| 303.15 | 0.1124 | 1.4336 |
| 303.15 | 0.1868 | 1.4416 |
| 303.15 | 0.2615 | 1.4492 |
| 303.15 | 0.3223 | 1.4552 |
| 303.15 | 0.3758 | 1.4604 |
| 303.15 | 0.4495 | 1.4678 |
| 303.15 | 0.5120 | 1.4741 |
| 303.15 | 0.5923 | 1.4828 |
| 303.15 | 0.6557 | 1.4902 |
| 303.15 | 0.7312 | 1.4997 |
| 303.15 | 0.7970 | 1.509 |
| 303.15 | 0.8672 | 1.52 |
| 303.15 | 0.9481 | 1.5342 |
| 303.15 | 1.0000 | 1.544 |
| 308.15 | 0.0721 | 1.4274 |
| 308.15 | 0.1124 | 1.4319 |
| 308.15 | 0.1868 | 1.4399 |
| 308.15 | 0.2615 | 1.4476 |
| 308.15 | 0.3223 | 1.4534 |
| 308.15 | 0.3758 | 1.4587 |
| 308.15 | 0.4495 | 1.4658 |
| 308.15 | 0.5120 | 1.4718 |
| 308.15 | 0.5923 | 1.48 |
| 308.15 | 0.6557 | 1.4873 |
| 308.15 | 0.7312 | 1.4967 |
| 308.15 | 0.7970 | 1.5059 |
| 308.15 | 0.8672 | 1.5168 |
| 308.15 | 0.9481 | 1.531 |
| 308.15 | 1.0000 | 1.541 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Benzene, 1,2-dichloro- (1) - Liquid | Mass density, kg/m3 - Liquid |
| 298.15 | 0.0721 | 841.72 |
| 298.15 | 0.1124 | 856.33 |
| 298.15 | 0.1868 | 884.26 |
| 298.15 | 0.2615 | 913.56 |
| 298.15 | 0.3223 | 938.42 |
| 298.15 | 0.3758 | 961.09 |
| 298.15 | 0.4495 | 993.6 |
| 298.15 | 0.5120 | 1022.45 |
| 298.15 | 0.5923 | 1061.35 |
| 298.15 | 0.6557 | 1093.66 |
| 298.15 | 0.7312 | 1134.18 |
| 298.15 | 0.7970 | 1171.44 |
| 298.15 | 0.8672 | 1213.47 |
| 298.15 | 0.9481 | 1265.11 |
| 298.15 | 1.0000 | 1300.3 |
| 303.15 | 0.0721 | 837.79 |
| 303.15 | 0.1124 | 852.34 |
| 303.15 | 0.1868 | 880.15 |
| 303.15 | 0.2615 | 909.35 |
| 303.15 | 0.3223 | 934.11 |
| 303.15 | 0.3758 | 956.68 |
| 303.15 | 0.4495 | 989.05 |
| 303.15 | 0.5120 | 1017.76 |
| 303.15 | 0.5923 | 1056.48 |
| 303.15 | 0.6557 | 1088.63 |
| 303.15 | 0.7312 | 1128.95 |
| 303.15 | 0.7970 | 1166.05 |
| 303.15 | 0.8672 | 1207.93 |
| 303.15 | 0.9481 | 1259.5 |
| 303.15 | 1.0000 | 1294.72 |
| 308.15 | 0.0721 | 833.8 |
| 308.15 | 0.1124 | 848.27 |
| 308.15 | 0.1868 | 875.95 |
| 308.15 | 0.2615 | 905.03 |
| 308.15 | 0.3223 | 929.69 |
| 308.15 | 0.3758 | 952.17 |
| 308.15 | 0.4495 | 984.42 |
| 308.15 | 0.5120 | 1013.02 |
| 308.15 | 0.5923 | 1051.57 |
| 308.15 | 0.6557 | 1083.59 |
| 308.15 | 0.7312 | 1123.75 |
| 308.15 | 0.7970 | 1160.72 |
| 308.15 | 0.8672 | 1202.46 |
| 308.15 | 0.9481 | 1253.92 |
| 308.15 | 1.0000 | 1289.13 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Benzene, 1,2-dichloro- (1) - Liquid | Speed of sound, m/s - Liquid |
| 298.15 | 0.0721 | 1302.0 |
| 298.15 | 0.1124 | 1299.7 |
| 298.15 | 0.1868 | 1295.1 |
| 298.15 | 0.2615 | 1291.0 |
| 298.15 | 0.3223 | 1287.8 |
| 298.15 | 0.3758 | 1285.1 |
| 298.15 | 0.4495 | 1281.8 |
| 298.15 | 0.5120 | 1279.1 |
| 298.15 | 0.5923 | 1276.1 |
| 298.15 | 0.6557 | 1274.5 |
| 298.15 | 0.7312 | 1273.2 |
| 298.15 | 0.7970 | 1273.0 |
| 298.15 | 0.8672 | 1274.4 |
| 298.15 | 0.9481 | 1277.6 |
| 298.15 | 1.0000 | 1281.6 |
| 303.15 | 0.0721 | 1283.9 |
| 303.15 | 0.1124 | 1281.6 |
| 303.15 | 0.1868 | 1277.6 |
| 303.15 | 0.2615 | 1273.5 |
| 303.15 | 0.3223 | 1270.5 |
| 303.15 | 0.3758 | 1267.9 |
| 303.15 | 0.4495 | 1264.9 |
| 303.15 | 0.5120 | 1262.2 |
| 303.15 | 0.5923 | 1259.6 |
| 303.15 | 0.6557 | 1258.0 |
| 303.15 | 0.7312 | 1257.0 |
| 303.15 | 0.7970 | 1256.7 |
| 303.15 | 0.8672 | 1257.9 |
| 303.15 | 0.9481 | 1261.6 |
| 303.15 | 1.0000 | 1265.2 |
| 308.15 | 0.0721 | 1266.6 |
| 308.15 | 0.1124 | 1264.0 |
| 308.15 | 0.1868 | 1260.1 |
| 308.15 | 0.2615 | 1256.2 |
| 308.15 | 0.3223 | 1253.3 |
| 308.15 | 0.3758 | 1250.8 |
| 308.15 | 0.4495 | 1247.6 |
| 308.15 | 0.5120 | 1245.4 |
| 308.15 | 0.5923 | 1242.9 |
| 308.15 | 0.6557 | 1241.5 |
| 308.15 | 0.7312 | 1240.5 |
| 308.15 | 0.7970 | 1240.4 |
| 308.15 | 0.8672 | 1241.5 |
| 308.15 | 0.9481 | 1243.9 |
| 308.15 | 1.0000 | 1245.9 |
Sources
Note: These property values are available through the Cheméo API. A free account gives you an access key.