- InChI
- InChI=1S/CHClF2/c2-1(3)4/h1H
- InChI Key
- VOPWNXZWBYDODV-UHFFFAOYSA-N
- Formula
- CHClF2
- SMILES
- FC(F)Cl
- Molecular Weight1
- 86.47
- CAS
- 75-45-6
- Other Names
-
- Algeon 22
- Algofrene 22
- Algofrene 6
- Algofrene Type 6
- Arcton 22
- Arcton 4
- CFC 22
- CHClF2
- CHF2Cl
- Daiflon 22
- Difluoromonochloromethane
- Dymel 22
- Electro-CF 22
- Eskimon 22
- F 22
- F 22 (halocarbon)
- FC 22
- FKW 22
- Flon 22
- Flugene 22
- Fluorocarbon-22
- Forane 22
- Freon 22
- Frigen
- Frigen 22
- Genetron 22
- HCFC 22
- HFA-22
- Haltron 22
- Isceon 22
- Isotron 22
- Khaladon 22
- Khladon 22
- Methane, difluoro chloro
- Monochlorodifluormethane
- Monochlorodifluoromethane
- Propellant 22
- R 22
- R-22
- REFRIGERANT-22
- Refrigerant 22
- Refrigerant R 22
- UN 1018
- Ucon 22
- chlorodifluoromethane
- difluorochloromethane
- ω : Acentric Factor.
- Cp,gas : Ideal gas heat capacity (J/mol×K).
- Cp,liquid : Liquid phase heat capacity (J/mol×K).
- μ : Dipole Moment (debye).
- ΔfG° : Standard Gibbs free energy of formation (kJ/mol).
- ΔfH°gas : Enthalpy of formation at standard conditions (kJ/mol).
- ΔfusH° : Enthalpy of fusion at standard conditions (kJ/mol).
- ΔvapH° : Enthalpy of vaporization at standard conditions (kJ/mol).
- ΔvapH : Enthalpy of vaporization at a given temperature (kJ/mol).
- IE : Ionization energy (eV).
- log10WS : Log10 of Water solubility in mol/l.
- logPoct/wat : Octanol/Water partition coefficient.
- McVol : McGowan's characteristic volume (ml/mol).
- Pc : Critical Pressure (kPa).
- Pvap : Vapor pressure (kPa).
- ρl : Liquid Density (kg/m3).
- γ : Surface Tension (N/m).
- Tboil : Normal Boiling Point Temperature (K).
- Tc : Critical Temperature (K).
- Tfus : Normal melting (fusion) point (K).
- Vc : Critical Volume (m3/kmol).
- vspec : Specific Volume (m3/kg).
- Zc : Critical Compressibility.
- Zra : Rackett Parameter.
- 1: Molecular weight from the IUPAC atomic weights tables.
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Contents
- Physical Properties
- Temperature Dependent Properties
- Datasets
- Correlations
- Similar Compounds
- Mixtures
- Sources
Physical Properties
| Property | Value | Unit | Source |
|---|---|---|---|
| ω | 0.2210 | KDB | |
| μ | 1.40 | debye | KDB |
| ΔfG° | -470.90 | kJ/mol | KDB |
| ΔfH°gas | -502.00 | kJ/mol | KDB |
| ΔfusH° | 5.18 | kJ/mol | Joback Calculated Property |
| ΔvapH° | 19.34 | kJ/mol | Relay (1.0) Calculated Property |
| IE | 12.33 | eV | Relay (1.0) Calculated Property |
| log10WS | -0.52 | Relay (1.0) Calculated Property | |
| logPoct/wat | 1.448 | Crippen Calculated Property | |
| McVol | 40.730 | ml/mol | McGowan Calculated Property |
| Pc | 4990.00 | kPa | KDB |
| Tboil | 232.40 | K | KDB |
| Tc | 369.30 | K | KDB |
| Tfus | 115.73 | K | KDB |
| Vc | 0.169 | m3/kmol | KDB |
| Zc | 0.2746450 | KDB | |
| Zra | 0.27 | KDB |
Temperature Dependent Properties
Datasets
Molar heat capacity at constant pressure, J/K/mol
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Pressure, kPa - Liquid | Molar heat capacity at constant pressure, J/K/mol - Liquid |
| 305.15 | 2060.00 | 110.07 |
| 305.15 | 2560.00 | 110.16 |
| 305.15 | 3040.00 | 109.56 |
| 305.15 | 3680.00 | 109.30 |
| 305.15 | 4110.00 | 108.86 |
| 305.15 | 4570.00 | 108.26 |
| 305.15 | 5120.00 | 107.74 |
| 310.15 | 2060.00 | 112.84 |
| 310.15 | 2560.00 | 112.06 |
| 310.15 | 3040.00 | 111.54 |
| 310.15 | 3680.00 | 110.51 |
| 310.15 | 4110.00 | 110.25 |
| 310.15 | 4570.00 | 109.38 |
| 310.15 | 5120.00 | 109.04 |
| 315.15 | 2060.00 | 115.52 |
| 315.15 | 2560.00 | 114.31 |
| 315.15 | 3040.00 | 113.79 |
| 315.15 | 3680.00 | 112.41 |
| 315.15 | 4110.00 | 112.15 |
| 315.15 | 4570.00 | 111.37 |
| 315.15 | 5120.00 | 110.77 |
| 320.15 | 2560.00 | 117.08 |
| 320.15 | 3040.00 | 116.39 |
| 320.15 | 3680.00 | 114.74 |
| 320.15 | 4110.00 | 114.14 |
| 320.15 | 4570.00 | 113.45 |
| 320.15 | 5120.00 | 112.58 |
| 325.15 | 2560.00 | 120.45 |
| 325.15 | 3040.00 | 119.59 |
| 325.15 | 3680.00 | 117.60 |
| 325.15 | 4110.00 | 116.73 |
| 325.15 | 4570.00 | 115.95 |
| 325.15 | 5120.00 | 114.83 |
| 330.15 | 3040.00 | 123.74 |
| 330.15 | 3680.00 | 121.23 |
| 330.15 | 4110.00 | 120.10 |
| 330.15 | 4570.00 | 119.07 |
| 330.15 | 5120.00 | 117.60 |
| 335.15 | 4110.00 | 124.43 |
| 335.15 | 4570.00 | 122.96 |
| 335.15 | 5120.00 | 121.14 |
| 340.15 | 4570.00 | 127.89 |
| 340.15 | 5120.00 | 125.64 |
| 345.15 | 5120.00 | 131.43 |
| Reference | ||
Specific volume, m3/kg
| Fixed | Measured | |
|---|---|---|
| Pressure, kPa - Fluid (supercritical or subcritical phases) | Temperature, K - Fluid (supercritical or subcritical phases) | Specific volume, m3/kg - Fluid (supercritical or subcritical phases) |
| 10000.00 | 298.20 | 0.0008 |
| 10000.00 | 323.20 | 0.0009 |
| 10000.00 | 348.20 | 0.0010 |
| 10000.00 | 373.20 | 0.0011 |
| 10000.00 | 423.20 | 0.0020 |
| 10000.00 | 473.20 | 0.0032 |
| 10000.00 | 523.20 | 0.0041 |
| 10000.00 | 573.20 | 0.0050 |
| 20000.00 | 298.20 | 0.0008 |
| 20000.00 | 323.20 | 0.0008 |
| 20000.00 | 348.20 | 0.0009 |
| 20000.00 | 373.20 | 0.0010 |
| 20000.00 | 423.20 | 0.0012 |
| 20000.00 | 473.20 | 0.0015 |
| 20000.00 | 523.20 | 0.0019 |
| 20000.00 | 573.20 | 0.0024 |
| 30000.00 | 298.20 | 0.0008 |
| 30000.00 | 323.20 | 0.0008 |
| 30000.00 | 348.20 | 0.0009 |
| 30000.00 | 373.20 | 0.0009 |
| 30000.00 | 423.20 | 0.0010 |
| 30000.00 | 473.20 | 0.0012 |
| 30000.00 | 523.20 | 0.0014 |
| 30000.00 | 573.20 | 0.0018 |
| 40000.00 | 298.20 | 0.0008 |
| 40000.00 | 323.20 | 0.0008 |
| 40000.00 | 348.20 | 0.0008 |
| 40000.00 | 373.20 | 0.0009 |
| 40000.00 | 423.20 | 0.0010 |
| 40000.00 | 473.20 | 0.0011 |
| 40000.00 | 523.20 | 0.0012 |
| 40000.00 | 573.20 | 0.0014 |
| 50000.00 | 298.20 | 0.0007 |
| 50000.00 | 323.20 | 0.0008 |
| 50000.00 | 348.20 | 0.0008 |
| 50000.00 | 373.20 | 0.0008 |
| 50000.00 | 423.20 | 0.0009 |
| 50000.00 | 473.20 | 0.0010 |
| 50000.00 | 523.20 | 0.0011 |
| 50000.00 | 573.20 | 0.0013 |
| 75000.00 | 298.20 | 0.0007 |
| 75000.00 | 323.20 | 0.0007 |
| 75000.00 | 348.20 | 0.0008 |
| 75000.00 | 373.20 | 0.0008 |
| 75000.00 | 423.20 | 0.0009 |
| 75000.00 | 473.20 | 0.0009 |
| 75000.00 | 523.20 | 0.0010 |
| 75000.00 | 573.20 | 0.0010 |
| 100000.00 | 298.20 | 0.0007 |
| 100000.00 | 323.20 | 0.0007 |
| 100000.00 | 348.20 | 0.0007 |
| 100000.00 | 373.20 | 0.0008 |
| 100000.00 | 423.20 | 0.0008 |
| 100000.00 | 473.20 | 0.0009 |
| 100000.00 | 523.20 | 0.0009 |
| 100000.00 | 573.20 | 0.0010 |
| 125000.00 | 298.20 | 0.0007 |
| 125000.00 | 323.20 | 0.0007 |
| 125000.00 | 348.20 | 0.0007 |
| 125000.00 | 373.20 | 0.0007 |
| 125000.00 | 423.20 | 0.0008 |
| 125000.00 | 473.20 | 0.0008 |
| 125000.00 | 523.20 | 0.0009 |
| 125000.00 | 573.20 | 0.0009 |
| 150000.00 | 298.20 | 0.0007 |
| 150000.00 | 323.20 | 0.0007 |
| 150000.00 | 348.20 | 0.0007 |
| 150000.00 | 373.20 | 0.0007 |
| 150000.00 | 423.20 | 0.0008 |
| 150000.00 | 473.20 | 0.0008 |
| 150000.00 | 523.20 | 0.0008 |
| 150000.00 | 573.20 | 0.0009 |
| 175000.00 | 298.20 | 0.0007 |
| 175000.00 | 323.20 | 0.0007 |
| 175000.00 | 348.20 | 0.0007 |
| 175000.00 | 373.20 | 0.0007 |
| 175000.00 | 423.20 | 0.0007 |
| 175000.00 | 473.20 | 0.0008 |
| 175000.00 | 523.20 | 0.0008 |
| 175000.00 | 573.20 | 0.0008 |
| 200000.00 | 298.20 | 0.0006 |
| 200000.00 | 323.20 | 0.0007 |
| 200000.00 | 348.20 | 0.0007 |
| 200000.00 | 373.20 | 0.0007 |
| 200000.00 | 423.20 | 0.0007 |
| 200000.00 | 473.20 | 0.0008 |
| 200000.00 | 523.20 | 0.0008 |
| 200000.00 | 573.20 | 0.0008 |
| 225000.00 | 298.20 | 0.0006 |
| 225000.00 | 323.20 | 0.0007 |
| 225000.00 | 348.20 | 0.0007 |
| 225000.00 | 373.20 | 0.0007 |
| 225000.00 | 423.20 | 0.0007 |
| 225000.00 | 473.20 | 0.0007 |
| 225000.00 | 523.20 | 0.0008 |
| 225000.00 | 573.20 | 0.0008 |
| 250000.00 | 298.20 | 0.0006 |
| 250000.00 | 323.20 | 0.0006 |
| 250000.00 | 348.20 | 0.0007 |
| 250000.00 | 373.20 | 0.0007 |
| 250000.00 | 423.20 | 0.0007 |
| 250000.00 | 473.20 | 0.0007 |
| 250000.00 | 523.20 | 0.0007 |
| 250000.00 | 573.20 | 0.0008 |
| 275000.00 | 298.20 | 0.0006 |
| 275000.00 | 323.20 | 0.0006 |
| 275000.00 | 348.20 | 0.0006 |
| 275000.00 | 373.20 | 0.0007 |
| 275000.00 | 423.20 | 0.0007 |
| 275000.00 | 473.20 | 0.0007 |
| 275000.00 | 523.20 | 0.0007 |
| 275000.00 | 573.20 | 0.0007 |
| 300000.00 | 298.20 | 0.0006 |
| 300000.00 | 323.20 | 0.0006 |
| 300000.00 | 348.20 | 0.0006 |
| 300000.00 | 373.20 | 0.0006 |
| 300000.00 | 423.20 | 0.0007 |
| 300000.00 | 473.20 | 0.0007 |
| 300000.00 | 523.20 | 0.0007 |
| 300000.00 | 573.20 | 0.0007 |
| 325000.00 | 298.20 | 0.0006 |
| 325000.00 | 323.20 | 0.0006 |
| 325000.00 | 348.20 | 0.0006 |
| 325000.00 | 373.20 | 0.0006 |
| 325000.00 | 423.20 | 0.0007 |
| 325000.00 | 473.20 | 0.0007 |
| 325000.00 | 523.20 | 0.0007 |
| 325000.00 | 573.20 | 0.0007 |
| 350000.00 | 298.20 | 0.0006 |
| 350000.00 | 323.20 | 0.0006 |
| 350000.00 | 348.20 | 0.0006 |
| 350000.00 | 373.20 | 0.0006 |
| 350000.00 | 423.20 | 0.0007 |
| 350000.00 | 473.20 | 0.0007 |
| 350000.00 | 523.20 | 0.0007 |
| 350000.00 | 573.20 | 0.0007 |
| 375000.00 | 298.20 | 0.0006 |
| 375000.00 | 323.20 | 0.0006 |
| 375000.00 | 348.20 | 0.0006 |
| 375000.00 | 373.20 | 0.0006 |
| 375000.00 | 423.20 | 0.0006 |
| 375000.00 | 473.20 | 0.0007 |
| 375000.00 | 523.20 | 0.0007 |
| 375000.00 | 573.20 | 0.0007 |
| 400000.00 | 298.20 | 0.0006 |
| 400000.00 | 323.20 | 0.0006 |
| 400000.00 | 348.20 | 0.0006 |
| 400000.00 | 373.20 | 0.0006 |
| 400000.00 | 423.20 | 0.0006 |
| 400000.00 | 473.20 | 0.0007 |
| 400000.00 | 523.20 | 0.0007 |
| 400000.00 | 573.20 | 0.0007 |
| 425000.00 | 298.20 | 0.0006 |
| 425000.00 | 323.20 | 0.0006 |
| 425000.00 | 348.20 | 0.0006 |
| 425000.00 | 373.20 | 0.0006 |
| 425000.00 | 423.20 | 0.0006 |
| 425000.00 | 473.20 | 0.0006 |
| 425000.00 | 523.20 | 0.0007 |
| 425000.00 | 573.20 | 0.0007 |
| 450000.00 | 298.20 | 0.0006 |
| 450000.00 | 323.20 | 0.0006 |
| 450000.00 | 348.20 | 0.0006 |
| 450000.00 | 373.20 | 0.0006 |
| 450000.00 | 423.20 | 0.0006 |
| 450000.00 | 473.20 | 0.0006 |
| 450000.00 | 523.20 | 0.0006 |
| 450000.00 | 573.20 | 0.0007 |
| 475000.00 | 298.20 | 0.0006 |
| 475000.00 | 323.20 | 0.0006 |
| 475000.00 | 348.20 | 0.0006 |
| 475000.00 | 373.20 | 0.0006 |
| 475000.00 | 423.20 | 0.0006 |
| 475000.00 | 473.20 | 0.0006 |
| 475000.00 | 523.20 | 0.0006 |
| 475000.00 | 573.20 | 0.0007 |
| 500000.00 | 298.20 | 0.0006 |
| 500000.00 | 323.20 | 0.0006 |
| 500000.00 | 348.20 | 0.0006 |
| 500000.00 | 373.20 | 0.0006 |
| 500000.00 | 423.20 | 0.0006 |
| 500000.00 | 473.20 | 0.0006 |
| 500000.00 | 523.20 | 0.0006 |
| 500000.00 | 573.20 | 0.0006 |
| Reference | ||
Correlations
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| Pvap | [1.33; 4948.57] | kPa | [169.58; 369.30] |
The Yaws Handbook of Vapor Pressure
|
| Equation | ln(Pvp) = A + B/(T + C) | |||
| Coefficient A | 1.42602e+01 | |||
| Coefficient B | -1.95340e+03 | |||
| Coefficient C | -2.97740e+01 | |||
| Temperature range, min. | 169.58 | |||
| Temperature range, max. | 369.30 | |||
| Pvap | 1.33 | kPa | 169.58 | Calculated Property |
| Pvap | 9.04 | kPa | 191.77 | Calculated Property |
| Pvap | 38.66 | kPa | 213.96 | Calculated Property |
| Pvap | 120.91 | kPa | 236.15 | Calculated Property |
| Pvap | 303.08 | kPa | 258.34 | Calculated Property |
| Pvap | 645.68 | kPa | 280.54 | Calculated Property |
| Pvap | 1216.36 | kPa | 302.73 | Calculated Property |
| Pvap | 2083.28 | kPa | 324.92 | Calculated Property |
| Pvap | 3309.42 | kPa | 347.11 | Calculated Property |
| Pvap | 4948.57 | kPa | 369.30 | Calculated Property |
| Pvap | [2.11e-04; 5078.49] | kPa | [115.73; 369.30] |
KDB Vapor Pressure Data
|
| Equation | ln(Pvp) = A + B/T + C*ln(T) + D*T^2 | |||
| Coefficient A | 9.07815e+01 | |||
| Coefficient B | -4.76845e+03 | |||
| Coefficient C | -1.22837e+01 | |||
| Coefficient D | 2.40493e-05 | |||
| Temperature range, min. | 115.73 | |||
| Temperature range, max. | 369.30 | |||
| Pvap | 2.11e-04 | kPa | 115.73 | Calculated Property |
| Pvap | 0.06 | kPa | 143.90 | Calculated Property |
| Pvap | 1.73 | kPa | 172.08 | Calculated Property |
| Pvap | 17.03 | kPa | 200.25 | Calculated Property |
| Pvap | 85.26 | kPa | 228.43 | Calculated Property |
| Pvap | 280.83 | kPa | 256.60 | Calculated Property |
| Pvap | 708.68 | kPa | 284.78 | Calculated Property |
| Pvap | 1505.71 | kPa | 312.95 | Calculated Property |
| Pvap | 2863.43 | kPa | 341.13 | Calculated Property |
| Pvap | 5078.49 | kPa | 369.30 | Calculated Property |
Similar Compounds
Find more compounds similar to Methane, chlorodifluoro-.
Mixtures
- Carbon dioxide + Methane, chlorodifluoro-
- Ethylene + Methane, chlorodifluoro-
- Formamide, N,N-dimethyl- + Methane, chlorodifluoro-
- Ethane, 1-chloro-1,1-difluoro- + Methane, chlorodifluoro-
- Methane, chlorodifluoro- + Trichloromonofluoromethane
- Ethane, 1,1,1-trifluoro- + Ethane, pentafluoro- + Methane, chlorodifluoro-
- Ethane, 2-chloro-1,1,1,2-tetrafluoro- + Ethane, 1-chloro-1,1-difluoro- + Methane, chlorodifluoro-
Sources
- KDB Vapor Pressure Data
- Cheméo Relay (1.0)
- Crippen Method
- Crippen Method
- Viscosity of Gaseous Mixtures of HCFC-22 + HCFC-142b at Pressures to 6.3 MPa
- Vapor liquid equilibria for R22 +N,N-dimethylformamide system at temperatures from 283.15 to 363.15K
- Measurements of the isobaric heat capacity of R1234yf in liquid phase at temperatures from 305 K to 355 K and pressures up to to 5 MPa
- Phase equilibrium and critical point data for ethylene and chlorodifluoromethane binary mixtures using a new static-analytic apparatus
- Phase Equilibrium and Liquid Viscosity of CO2 + n-Dodecane Mixtures between 283 and 353 K
- Experimental P-T- and Enthalpy-Increment Measurements of Trichlorofluoromethane, R-11 (x=0.83) + Chlorodifluoromethane, R-22 (1-x)
- Specific Volumes of Chlorodifluoromethane in the Temperature Range from (298 to 573) K and Pressures up to 500 MPa
- Solubility of Refrigerant 1,1,1,2-Tetrafluoroethane in the N,N-Dimethyl Formamide in the Temperature Range from (263.15 to 363.15) K
- Density Data for the Refrigerant Ethyl Fluoride (HFC-161) over a Temperature Range from (230 to 344) K
- Experimental Measurements and Thermodynamic Modeling of the Dissociation Conditions of Clathrate Hydrates for (Refrigerant + NaCl + Water) Systems
- Relative Permittivity and Dipole Moments of Replacement Refrigerant Mixtures (R408A and R409A) in the Liquid State
- Joback Method
- KDB
- McGowan Method
- NIST Webbook
- The Yaws Handbook of Vapor Pressure
- Zabransky, M., Ruzicka, V., Majer, V. and Domalski, E. (1997), Heat Capacity of Liquids: Critical Review and Recommended Values - Monograph No. 6, J. Phys. & Chem. Ref. Data (JPCRD), National Institute of Standards and Technology, Gaithersburg, MD
Note: Cheméo is only indexing the data, follow the source links to retrieve the latest data. The source is also providing more information like the publication year, authors and more.
Take the time to validate and double check the source of the data.
These property values are available through the Cheméo API. A free account gives you an access key.