- InChI
- InChI=1S/C6H12O2/c1-5(2)4-8-6(3)7/h5H,4H2,1-3H3
- InChI Key
- GJRQTCIYDGXPES-UHFFFAOYSA-N
- Formula
- C6H12O2
- SMILES
- CC(=O)OCC(C)C
- Molecular Weight1
- 116.16
- CAS
- 110-19-0
- Other Names
-
- 2-METHYL-1-PROPYL ACETATE
- 2-METHYLPROPYL ESTER ACETIC ACID
- 2-Methyl-1-propanol, acetate
- 2-Methylpropyl acetate
- 2-Methylpropyl ethanoate
- Acetate d'isobutyle
- Acetic acid, 2-methylpropyl ester
- Acetic acid, isobutyl ester
- ISOBUTYL ETHANOATE
- Isobutyl acetate fcc
- Isobutylester kyseliny octove
- NSC 8035
- UN 1213
- ethanoic acid, isobutyl ester
- i-Butyl acetate
- «beta»-Methylpropyl ethanoate
- «beta»-Methylpropyl ethanoate
- ω : Acentric Factor.
- Tig : Autoignition Temperature (K).
- ΔcH°liquid : Standard liquid enthalpy of combustion (kJ/mol).
- Cp,gas : Ideal gas heat capacity (J/mol×K).
- Cp,liquid : Liquid phase heat capacity (J/mol×K).
- μ : Dipole Moment (debye).
- η : Dynamic viscosity (Pa×s).
- LFL : Lower Flammability Limit (% in Air).
- UFL : Upper Flammability Limit (% in Air).
- Tflash,cc : Flash Point (Closed Cup Method) (K).
- Tflash,oc : Flash Point (Open Cup Method) (K).
- ΔfG° : Standard Gibbs free energy of formation (kJ/mol).
- ΔfH°gas : Enthalpy of formation at standard conditions (kJ/mol).
- ΔfusH° : Enthalpy of fusion at standard conditions (kJ/mol).
- ΔvapH° : Enthalpy of vaporization at standard conditions (kJ/mol).
- ΔvapH : Enthalpy of vaporization at a given temperature (kJ/mol).
- IE : Ionization energy (eV).
- log10WS : Log10 of Water solubility in mol/l.
- logPoct/wat : Octanol/Water partition coefficient.
- McVol : McGowan's characteristic volume (ml/mol).
- NFPA Fire : NFPA Fire Rating.
- NFPA Health : NFPA Health Rating.
- Pc : Critical Pressure (kPa).
- Pvap : Vapor pressure (kPa).
- n0 : Refractive Index.
- ρc : Critical density (kg/m3).
- ρl : Liquid Density (kg/m3).
- Inp : Non-polar retention indices.
- I : Polar retention indices.
- γ : Surface Tension (N/m).
- Tboil : Normal Boiling Point Temperature (K).
- Tboil : Boiling point at given pressure (K).
- Tc : Critical Temperature (K).
- Tfus : Normal melting (fusion) point (K).
- Vc : Critical Volume (m3/kmol).
- Zc : Critical Compressibility.
- 1: Molecular weight from the IUPAC atomic weights tables.
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Physical Properties
| Property | Value | Unit | Source |
|---|---|---|---|
| ω | 0.4550 | KDB | |
| Tig | 695.93 | K | KDB |
| ΔcH°liquid | -3534.00 | kJ/mol | NIST |
| μ | 1.90 | debye | KDB |
| LFL | 2.40 | % in Air | KDB |
| UFL | 10.50 | % in Air | KDB |
| Tflash,cc | 302.59 | K | KDB |
| Tflash,oc | 289.82 | K | KDB |
| ΔfG° | -236.72 | kJ/mol | Joback Calculated Property |
| ΔfH°gas | -495.50 | kJ/mol | KDB |
| ΔfusH° | 10.56 | kJ/mol | Joback Calculated Property |
| ΔvapH° | 35.90 ± 0.04 | kJ/mol | NIST |
| IE | 9.97 | eV | NIST |
| log10WS | [-1.21; -1.21] |
|
|
| log10WS | -1.21 | Aq. Sol... | |
| log10WS | -1.21 | Estimat... | |
| logPoct/wat | 1.205 | Crippen Calculated Property | |
| McVol | 102.840 | ml/mol | McGowan Calculated Property |
| NFPA Fire | 3 | KDB | |
| NFPA Health | 1 | KDB | |
| Pc | [3010.00; 3180.00] | kPa |
|
| Pc | 3160.00 | kPa | KDB |
| Pc | 3010.00 ± 20.00 | kPa | NIST |
| Pc | 3180.00 ± 60.79 | kPa | NIST |
| ρc | 281.10 ± 8.13 | kg/m3 | NIST |
| Inp | [730.00; 788.00] |
|
|
| Inp | 757.70 | NIST | |
| Inp | 758.98 | NIST | |
| Inp | 757.00 | NIST | |
| Inp | 755.00 | NIST | |
| Inp | 757.20 | NIST | |
| Inp | 750.00 | NIST | |
| Inp | 768.00 | NIST | |
| Inp | 758.00 | NIST | |
| Inp | 750.00 | NIST | |
| Inp | 762.00 | NIST | |
| Inp | 764.00 | NIST | |
| Inp | 763.00 | NIST | |
| Inp | 764.00 | NIST | |
| Inp | 763.00 | NIST | |
| Inp | 758.00 | NIST | |
| Inp | 760.00 | NIST | |
| Inp | 764.00 | NIST | |
| Inp | 750.00 | NIST | |
| Inp | Outlier 783.00 | NIST | |
| Inp | Outlier 788.00 | NIST | |
| Inp | 753.00 | NIST | |
| Inp | 767.20 | NIST | |
| Inp | 741.00 | NIST | |
| Inp | 741.00 | NIST | |
| Inp | 781.00 | NIST | |
| Inp | 779.00 | NIST | |
| Inp | 756.00 | NIST | |
| Inp | 755.00 | NIST | |
| Inp | 755.00 | NIST | |
| Inp | 755.00 | NIST | |
| Inp | 770.00 | NIST | |
| Inp | 745.30 | NIST | |
| Inp | 748.40 | NIST | |
| Inp | 749.70 | NIST | |
| Inp | 752.10 | NIST | |
| Inp | 749.80 | NIST | |
| Inp | 748.70 | NIST | |
| Inp | 754.45 | NIST | |
| Inp | 754.00 | NIST | |
| Inp | 754.00 | NIST | |
| Inp | 747.00 | NIST | |
| Inp | 746.00 | NIST | |
| Inp | 750.00 | NIST | |
| Inp | 750.00 | NIST | |
| Inp | 748.00 | NIST | |
| Inp | 749.00 | NIST | |
| Inp | 749.00 | NIST | |
| Inp | 782.00 | NIST | |
| Inp | 780.00 | NIST | |
| Inp | Outlier 786.00 | NIST | |
| Inp | 763.00 | NIST | |
| Inp | 776.00 | NIST | |
| Inp | 768.00 | NIST | |
| Inp | 771.00 | NIST | |
| Inp | 757.00 | NIST | |
| Inp | 766.00 | NIST | |
| Inp | Outlier 734.00 | NIST | |
| Inp | 749.00 | NIST | |
| Inp | 770.00 | NIST | |
| Inp | 770.00 | NIST | |
| Inp | 767.00 | NIST | |
| Inp | 779.50 | NIST | |
| Inp | 757.00 | NIST | |
| Inp | 764.00 | NIST | |
| Inp | 760.00 | NIST | |
| Inp | 760.00 | NIST | |
| Inp | 770.00 | NIST | |
| Inp | 758.00 | NIST | |
| Inp | 744.00 | NIST | |
| Inp | 745.00 | NIST | |
| Inp | 743.00 | NIST | |
| Inp | 744.00 | NIST | |
| Inp | 754.00 | NIST | |
| Inp | 758.00 | NIST | |
| Inp | 764.00 | NIST | |
| Inp | 764.00 | NIST | |
| Inp | 758.00 | NIST | |
| Inp | Outlier 730.00 | NIST | |
| Inp | 780.00 | NIST | |
| Inp | 782.00 | NIST | |
| Inp | 771.00 | NIST | |
| Inp | 772.00 | NIST | |
| Inp | 781.00 | NIST | |
| Inp | 768.00 | NIST | |
| Inp | 750.00 | NIST | |
| Inp | 772.00 | NIST | |
| Inp | 750.00 | NIST | |
| Inp | 768.00 | NIST | |
| Inp | 758.00 | NIST | |
| Inp | 753.00 | NIST | |
| Inp | 767.00 | NIST | |
| Inp | 772.00 | NIST | |
| Inp | 753.00 | NIST | |
| Inp | 758.00 | NIST | |
| Inp | 775.00 | NIST | |
| Inp | 749.00 | NIST | |
| Inp | 758.00 | NIST | |
| Inp | 759.00 | NIST | |
| Inp | 762.00 | NIST | |
| Inp | 762.00 | NIST | |
| Inp | 759.00 | NIST | |
| Inp | 754.00 | NIST | |
| Inp | 750.00 | NIST | |
| Inp | 755.00 | NIST | |
| Inp | 748.00 | NIST | |
| Inp | 758.00 | NIST | |
| Inp | 749.00 | NIST | |
| Inp | 746.00 | NIST | |
| Inp | 748.00 | NIST | |
| Inp | 750.00 | NIST | |
| Inp | 753.00 | NIST | |
| Inp | 780.00 | NIST | |
| Inp | 771.00 | NIST | |
| Inp | Outlier 730.00 | NIST | |
| Inp | 781.00 | NIST | |
| Inp | 768.00 | NIST | |
| Inp | 753.00 | NIST | |
| Inp | 759.00 | NIST | |
| Inp | 750.00 | NIST | |
| Inp | 746.00 | NIST | |
| I | [976.00; 1047.00] |
|
|
| I | 1025.00 | NIST | |
| I | 1011.00 | NIST | |
| I | 1025.00 | NIST | |
| I | 1013.00 | NIST | |
| I | 1033.00 | NIST | |
| I | 1018.00 | NIST | |
| I | 1020.00 | NIST | |
| I | 1029.00 | NIST | |
| I | 1005.00 | NIST | |
| I | 1017.00 | NIST | |
| I | 1000.00 | NIST | |
| I | 1031.00 | NIST | |
| I | 1029.00 | NIST | |
| I | 1022.00 | NIST | |
| I | 1002.00 | NIST | |
| I | 1007.00 | NIST | |
| I | 1027.00 | NIST | |
| I | 989.00 | NIST | |
| I | 986.00 | NIST | |
| I | 1014.00 | NIST | |
| I | 993.00 | NIST | |
| I | 1012.00 | NIST | |
| I | 1013.00 | NIST | |
| I | 1019.00 | NIST | |
| I | 1011.00 | NIST | |
| I | 1009.00 | NIST | |
| I | 1009.00 | NIST | |
| I | 1012.00 | NIST | |
| I | 1002.00 | NIST | |
| I | 1018.00 | NIST | |
| I | 1016.00 | NIST | |
| I | 1034.00 | NIST | |
| I | 1010.00 | NIST | |
| I | 1012.00 | NIST | |
| I | 1009.00 | NIST | |
| I | 1009.00 | NIST | |
| I | 1035.00 | NIST | |
| I | 985.00 | NIST | |
| I | 1015.00 | NIST | |
| I | 1004.00 | NIST | |
| I | 1032.00 | NIST | |
| I | 1008.00 | NIST | |
| I | 1000.00 | NIST | |
| I | 1009.00 | NIST | |
| I | 1000.00 | NIST | |
| I | 998.00 | NIST | |
| I | 988.00 | NIST | |
| I | 988.00 | NIST | |
| I | 992.00 | NIST | |
| I | 1005.00 | NIST | |
| I | 1000.00 | NIST | |
| I | 1005.00 | NIST | |
| I | 1014.00 | NIST | |
| I | 1007.00 | NIST | |
| I | 1005.00 | NIST | |
| I | 1005.00 | NIST | |
| I | 1009.00 | NIST | |
| I | 1009.00 | NIST | |
| I | 1017.00 | NIST | |
| I | 1010.00 | NIST | |
| I | 1011.00 | NIST | |
| I | 1014.00 | NIST | |
| I | 1014.00 | NIST | |
| I | Outlier 1047.00 | NIST | |
| I | 1019.00 | NIST | |
| I | 1020.00 | NIST | |
| I | 1012.00 | NIST | |
| I | 1012.00 | NIST | |
| I | Outlier 976.00 | NIST | |
| I | 1024.00 | NIST | |
| I | 985.00 | NIST | |
| I | 1017.00 | NIST | |
| I | 1020.00 | NIST | |
| I | 1020.00 | NIST | |
| I | 987.00 | NIST | |
| I | 1020.00 | NIST | |
| I | 1020.00 | NIST | |
| I | 1000.00 | NIST | |
| I | 1020.00 | NIST | |
| I | 1023.00 | NIST | |
| I | 1023.00 | NIST | |
| I | 1023.00 | NIST | |
| I | Outlier 984.00 | NIST | |
| I | 1025.00 | NIST | |
| Tboil | [389.44; 389.90] | K |
|
| Tboil | 389.70 | K | KDB |
| Tboil | 389.44 | K | Isobari... |
| Tboil | 389.55 | K | Vapour-... |
| Tboil | 389.90 | K | Isobari... |
| Tboil | 389.75 | K | Measure... |
| Tboil | 389.55 | K | Isobari... |
| Tc | [560.80; 569.00] | K |
|
| Tc | 561.00 | K | KDB |
| Tc | 560.80 ± 0.60 | K | NIST |
| Tc | 561.50 ± 2.00 | K | NIST |
| Tc | 569.00 ± 5.00 | K | NIST |
| Tfus | [174.25; 240.15] | K |
|
| Tfus | 174.30 | K | KDB |
| Tfus | 174.25 | K | Aq. Sol... |
| Tfus | 176.05 | K | NIST |
| Tfus | 176.10 ± 0.60 | K | NIST |
| Tfus | 240.15 ± 0.50 | K | NIST |
| Vc | 0.414 | m3/kmol | KDB |
| Zc | 0.2804710 | KDB |
Temperature Dependent Properties
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| Cp,gas | [199.90; 255.87] | J/mol×K | [412.53; 594.22] |
|
| Cp,gas | 199.90 | J/mol×K | 412.53 | Joback Calculated Property |
| Cp,gas | 210.06 | J/mol×K | 442.81 | Joback Calculated Property |
| Cp,gas | 219.89 | J/mol×K | 473.09 | Joback Calculated Property |
| Cp,gas | 229.39 | J/mol×K | 503.38 | Joback Calculated Property |
| Cp,gas | 238.55 | J/mol×K | 533.66 | Joback Calculated Property |
| Cp,gas | 247.38 | J/mol×K | 563.94 | Joback Calculated Property |
| Cp,gas | 255.87 | J/mol×K | 594.22 | Joback Calculated Property |
| Cp,liquid | 240.20 | J/mol×K | 290.00 | NIST |
| η | [0.0002624; 0.0046134] | Pa×s | [214.54; 412.53] |
|
| η | 0.0046134 | Pa×s | 214.54 | Joback Calculated Property |
| η | 0.0020807 | Pa×s | 247.54 | Joback Calculated Property |
| η | 0.0011317 | Pa×s | 280.54 | Joback Calculated Property |
| η | 0.0006998 | Pa×s | 313.53 | Joback Calculated Property |
| η | 0.0004742 | Pa×s | 346.53 | Joback Calculated Property |
| η | 0.0003438 | Pa×s | 379.53 | Joback Calculated Property |
| η | 0.0002624 | Pa×s | 412.53 | Joback Calculated Property |
| ΔvapH | [39.20; 39.90] | kJ/mol | [321.50; 359.00] |
|
| ΔvapH | 39.80 | kJ/mol | 321.50 | NIST |
| ΔvapH | 39.90 | kJ/mol | 349.50 | NIST |
| ΔvapH | 39.20 | kJ/mol | 359.00 | NIST |
| Pvap | 101.30 | kPa | 389.55 | Vapour-... |
| n0 | [1.38760; 1.39050] | [293.15; 298.20] |
|
|
| n0 | 1.39050 | 293.15 | Isobari... | |
| n0 | 1.39020 | 293.15 | Measure... | |
| n0 | 1.38760 | 298.15 | Isobari... | |
| n0 | 1.38760 | 298.15 | Vapor l... | |
| n0 | 1.38760 | 298.15 | Liquid ... | |
| n0 | 1.38760 | 298.15 | Study o... | |
| n0 | 1.38760 | 298.15 | Phase e... | |
| n0 | 1.38760 | 298.15 | Phase e... | |
| n0 | 1.38780 | 298.20 | Tie-lin... | |
| ρl | [849.39; 875.00] | kg/m3 | [293.00; 313.20] |
|
| ρl | 875.00 | kg/m3 | 293.00 | KDB |
| ρl | 871.30 | kg/m3 | 293.20 | Liquid-... |
| ρl | 849.39 | kg/m3 | 313.20 | Liquid-... |
| γ | [0.02; 0.02] | N/m | [298.15; 313.15] |
|
| γ | 0.02 | N/m | 298.15 | Excess ... |
| γ | 0.02 | N/m | 308.15 | Excess ... |
| γ | 0.02 | N/m | 313.15 | Excess ... |
Pressure Dependent Properties
| Property | Value | Unit | Pressure (kPa) | Source |
|---|---|---|---|---|
| Tboil | [361.00; 403.64] | K | [39.99; 150.00] |
|
| Tboil | 361.00 | K | 39.99 | Vapor L... |
| Tboil | 367.41 | K | 49.98 | Vapor L... |
| Tboil | 372.89 | K | 59.99 | Vapor L... |
| Tboil | 377.39 | K | 70.00 | Vapor L... |
| Tboil | 381.58 | K | 80.00 | Vapor L... |
| Tboil | 385.54 | K | 90.00 | Vapor L... |
| Tboil | 389.37 | K | 100.00 | Vapor L... |
| Tboil | 392.35 | K | 110.00 | Vapor L... |
| Tboil | 395.26 | K | 120.00 | Vapor L... |
| Tboil | 398.16 | K | 130.00 | Vapor L... |
| Tboil | 400.84 | K | 140.00 | Vapor L... |
| Tboil | 403.64 | K | 150.00 | Vapor L... |
Correlations
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| Pvap | [1.33; 202.63] | kPa | [287.55; 414.85] |
The Yaw...
|
| Equation | ln(Pvp) = A + B/(T + C) | |||
| Coefficient A | 1.50519e+01 | |||
| Coefficient B | -3.64415e+03 | |||
| Coefficient C | -4.07290e+01 | |||
| Temperature range, min. | 287.55 | |||
| Temperature range, max. | 414.85 | |||
| Pvap | 1.33 | kPa | 287.55 | Calculated Property |
| Pvap | 2.97 | kPa | 301.69 | Calculated Property |
| Pvap | 6.08 | kPa | 315.84 | Calculated Property |
| Pvap | 11.63 | kPa | 329.98 | Calculated Property |
| Pvap | 20.92 | kPa | 344.13 | Calculated Property |
| Pvap | 35.72 | kPa | 358.27 | Calculated Property |
| Pvap | 58.28 | kPa | 372.42 | Calculated Property |
| Pvap | 91.34 | kPa | 386.56 | Calculated Property |
| Pvap | 138.19 | kPa | 400.71 | Calculated Property |
| Pvap | 202.63 | kPa | 414.85 | Calculated Property |
| Pvap | [4.57e-06; 3169.48] | kPa | [174.30; 561.00] |
KDB Vap...
|
| Equation | ln(Pvp) = A + B/T + C*ln(T) + D*T^2 | |||
| Coefficient A | 9.01223e+01 | |||
| Coefficient B | -7.87047e+03 | |||
| Coefficient C | -1.11424e+01 | |||
| Coefficient D | 7.93342e-06 | |||
| Temperature range, min. | 174.30 | |||
| Temperature range, max. | 561.00 | |||
| Pvap | 4.57e-06 | kPa | 174.30 | Calculated Property |
| Pvap | 3.39e-03 | kPa | 217.27 | Calculated Property |
| Pvap | 0.21 | kPa | 260.23 | Calculated Property |
| Pvap | 3.39 | kPa | 303.20 | Calculated Property |
| Pvap | 24.24 | kPa | 346.17 | Calculated Property |
| Pvap | 104.11 | kPa | 389.13 | Calculated Property |
| Pvap | 320.39 | kPa | 432.10 | Calculated Property |
| Pvap | 788.29 | kPa | 475.07 | Calculated Property |
| Pvap | 1665.25 | kPa | 518.03 | Calculated Property |
| Pvap | 3169.48 | kPa | 561.00 | Calculated Property |
Similar Compounds
Find more compounds similar to Isobutyl acetate.
Mixtures
- Isobutyl acetate + 1-Propanol, 2-methyl-
- Isobutyl acetate + Formamide, N,N-dimethyl-
- Isobutyl acetate + Formamide, N,N-dimethyl- + 1-Propanol, 2-methyl-
- Isobutyl acetate + 1-Hexanol
- Isobutyl acetate + 1-Propanol, 2-methyl- + 1-Hexanol
- Propanoic acid, butyl ester + Isobutyl acetate
- Propanoic acid, butyl ester + Isobutyl acetate + 1-Propanol, 2-methyl-
- Isobutyl acetate + 1-Propanol, 2-methyl- + Water
- Isobutyl acetate + Glycerin + 1-Propanol, 2-methyl-
- Isobutyl acetate + Acetic acid + Water
- Isobutyl acetate + Simvastatin
- Isobutyl acetate + Ethanol
- 1-Propanol + Isobutyl acetate
- Isobutyl acetate + Isopropyl Alcohol
- Isobutyl acetate + Heptane + Simvastatin
- Isobutyl acetate + Water
- Isobutyl acetate + Phenol + Water
- Isobutyl acetate + Carbonic acid, dimethyl ester
- Isobutyl acetate + Ethyl Acetate
- Isobutyl acetate + 1-Butanol, 3-methyl-, acetate
Find more mixtures with Isobutyl acetate.
Sources
- KDB Vapor Pressure Data
- Crippen Method
- Isobaric vapor-liquid equilibria for the binary systems isobutyl alcohol + isobutyl acetate and tert-butyl alcohol + tert-butyl acetate at 20 and 101.3 kPa
- Phase equilibria in the systems isobutyl alcohol +N,N-dimethylformamide, isobutyl acetate +N,N-dimethylformamide and isobutyl alcohol + isobutyl acetate +N,N-dimethylformamide at 101.3 kPa
- Phase equilibria in the ternary system isobutyl alcohol + isobutyl acetate + 1-hexanol and the binary systems isobutyl alcohol + 1-hexanol, isobutyl acetate + 1-hexanol at 101.3 kPa
- Vapor liquid equilibria in the ternary system isobutyl alcohol + isobutyl acetate + butyl propionate and the binary systems isobutyl alcohol + butyl propionate, isobutyl acetate + butyl propionate at 101.3 kPa
- Liquid liquid equilibria of the systems isobutyl acetate + isobutyl alcohol +water and isobutyl acetate + isobutyl alcohol + glycerol at different temperatures
- Study of liquid liquid equilibrium of the systems isobutyl acetate + acetic acid +water and isobutyl alcohol + acetic acid +water at different temperatures
- Solubility and limiting activity coefficient of simvastatin in different organic solvents
- Investigation on isobaric vapor-liquid equilibrium for acetic acid + water + (n-propyl acetate or iso-butyl acetate)
- Solubility of lansoprazole in different solvents
- Isobaric VLE at 0.6 MPa for binary systems isobutyl acetate + ethanol, + 1-propanol or + 2-propanol
- Phase behavior of binary mixture for the isoalkyl acetate in supercritical carbon dioxide
- Solution thermodynamics of simvastatin in pure solvents and binary solvent mixtures
- Liquid-liquid equilibrium determination and thermodynamics modeling for extraction of isopropanol from its aqueous solution
- Liquid-liquid equilibrium data for ternary systems of water + acetic acid + acetate esters at 293.2 K and 303.2 K and ~ 95 kPa
- (Liquid + liquid) equilibria in ternary aqueous mixtures of phosphoric acid with organic solvents at T = 298.2 K
- Tie-line data for the aqueous solutions of phenol with organic solvents at T = 298.2 K
- Measurement and thermodynamic modelling of ternary liquid-liquid equilibrium for extraction of thioglycolic acid from aqueous solution with different solvents
- Vapour-liquid equilibrium measurements and extractive distillation process design for separation of azeotropic mixture (dimethyl carbonate + ethanol)
- Binodal Curves and Tie Line Data of the Water - Propionic Acid - Isobutyl Acetate at T = (298.2, 308.2, 318.2, and 328.2) K
- Solubility of Benzoic Acid and Aspirin in Pure Solvents Using Focused Beam Reflective Measurement
- Vapor Liquid Equilibrium for Binary Mixtures of Acetates in the Direct Esterification of Fusel Oil
- Isobaric Vapor Liquid Equilibrium for Binary Systems of Thioglycolic Acid with Water, Butyl Acetate, Butyl Formate, and Isobutyl Acetate at 101.3 kPa
- Measurement and Correlation of Phase Equilibria for Isobutyl Acetate + {Ethanol or Methanol} + Water at 303.15 and 323.15 K
- Isobaric Vapor Liquid Equilibrium for the Binary and Ternary System with Isobutyl Alcohol, Isobutyl Acetate and Dimethyl Sulfoxide at 101.3 kPa
- Separation of Protocatechuic Acid Using Di-(2-ethylhexyl)phosphoric Acid in Isobutyl Acetate, Toluene, and Petroleum Ether
- Measurement and Correlation of Isobaric Vapor-Liquid Equilibrium for Binary Systems of Allyl Alcohol with Isobutyl Acetate, Butyl Acetate, and Butyl Propionate at 101.3 kPa
- Isobaric Vapor-Liquid Equilibrium Measurements for Separation of Azeotrope (Methanol + Methyl Acetate)
- Liquid-Liquid Equilibrium of Isobutyl Acetate + Isobutyl Alcohol + Imidazolium-Based Ionic Liquids at 298.15 and 308.15 K
- Vapor-Liquid Equilibrium for Carbon Dioxide + Isopropyl, Isobutyl, and Isoamyl Acetates
- Solubilities of Benzene Carboxylic Acids in Isobutyl Acetate from (299.73 to 353.15) K
- Ternary Liquid Liquid Equilibria of Water + Prop-2-enoic Acid + Isobutyl Ethanoate at Different Temperatures
- Fast Determination of Binary Vapor Liquid Equilibrium of CO2-Based Mixtures at Elevated Pressures
- Liquid-Liquid Equilibria for the Ternary Systems Acetic Acid + Water + Butyl Acetate and Acetic Acid + Water + 2-Methyl Propyl Acetate at 304.15 K, 332.15 K, and 366.15 K
- Excess Molar Volumes and Surface Tensions of 1,2,4-Trimethylbenzene and 1,3,5-Trimethylbenzene with Isopropyl Acetate and Isobutyl Acetate at (298.15, 308.15, and 313.15) K
- Solubility of Lovastatin in Ethyl Acetate, Propyl Acetate, Isopropyl Acetate, Butyl Acetate, sec-Butyl Acetate, Isobutyl Acetate, tert-Butyl Acetate, and 2-Butanone, between (285 and 313) K
- Solubility of Naphthalene in Isobutyl Acetate, n-Butyric Acid, Ethyl Acetate, N-Methyl Pyrrolidone, N,N-Dimethylformamide, and Tetrahydrofuran
- Joback Method
- KDB
- Aqueous Solubility Prediction Method
- Estimated Solubility Method
- McGowan Method
- NIST Webbook
- The Yaws Handbook of Vapor Pressure
Note: Cheméo is only indexing the data, follow the source links to retrieve the latest data. The source is also providing more information like the publication year, authors and more.
Take the time to validate and double check the source of the data.
Outlier This icon means
that the value is more than 2 standard deviations away from the
property mean.