- InChI
- InChI=1S/C13H26O2/c1-3-4-5-6-7-8-9-10-11-12-13(14)15-2/h3-12H2,1-2H3
- InChI Key
- UQDUPQYQJKYHQI-UHFFFAOYSA-N
- Formula
- C13H26O2
- SMILES
- CCCCCCCCCCCC(=O)OC
- Molecular Weight1
- 214.34
- CAS
- 111-82-0
- Other Names
-
- Dodecanoic acid methyl ester
- Metholene 2296
- Methyl dodecylate
- Methyl laurinate
- Methyl n-dodecanoate
- NSC 5027
- Uniphat A40
- lauric acid, methyl ester
- methyl dodecanoate
- methyl laurate
- ω : Acentric Factor.
- ΔcH°liquid : Standard liquid enthalpy of combustion (kJ/mol).
- Cp,gas : Ideal gas heat capacity (J/mol×K).
- Cp,liquid : Liquid phase heat capacity (J/mol×K).
- μ : Dipole Moment (debye).
- η : Dynamic viscosity (Pa×s).
- ΔfG° : Standard Gibbs free energy of formation (kJ/mol).
- ΔfH°gas : Enthalpy of formation at standard conditions (kJ/mol).
- ΔfusH° : Enthalpy of fusion at standard conditions (kJ/mol).
- ΔsubH : Enthalpy of sublimation at a given temperature (kJ/mol).
- ΔvapH° : Enthalpy of vaporization at standard conditions (kJ/mol).
- ΔvapH : Enthalpy of vaporization at a given temperature (kJ/mol).
- IE : Ionization energy (eV).
- log10WS : Log10 of Water solubility in mol/l.
- logPoct/wat : Octanol/Water partition coefficient.
- McVol : McGowan's characteristic volume (ml/mol).
- Pc : Critical Pressure (kPa).
- Ptriple : Triple Point Pressure (kPa).
- Pvap : Vapor pressure (kPa).
- n0 : Refractive Index.
- ρl : Liquid Density (kg/m3).
- Inp : Non-polar retention indices.
- Ip : Polar retention indices.
- csound,fluid : Speed of sound in fluid (m/s).
- γ : Surface Tension (N/m).
- Tboil : Normal Boiling Point Temperature (K).
- Tboilr : Boiling point at reduced pressure (K).
- Tc : Critical Temperature (K).
- λgas : Gas thermal conductivity (W/m×K).
- λliquid : Liquid thermal conductivity (W/m×K).
- Tfus : Normal melting (fusion) point (K).
- Ttriple : Triple Point Temperature (K).
- UQi : UNIQUAC Qi Parameter.
- URi : UNIQUAC Ri Parameter.
- Vc : Critical Volume (m3/kmol).
- Zc : Critical Compressibility.
- 1: Molecular weight from the IUPAC atomic weights tables.
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Contents
- Physical Properties
- Temperature Dependent Properties
- Pressure Dependent Properties
- Datasets
- Correlations
- Similar Compounds
- Mixtures
- Sources
Physical Properties
| Property | Value | Unit | Source |
|---|---|---|---|
| ω | [0.6644; 0.6737] |
|
|
| ω | 0.6737 | PSRK revision IV (2005), critical constants and acentric factors of 1000 components Compiled value | |
| ω | 0.6644 | ChemSep v8.3 pure component data Compiled value | |
| ΔcH°liquid | [-8137.80; -8117.00] | kJ/mol |
|
| ΔcH°liquid | -8117.00 ± 0.40 | kJ/mol | NIST |
| ΔcH°liquid | -8137.80 ± 1.60 | kJ/mol | NIST |
| μ | 1.70 | debye | ChemSep v8.3 pure component data Compiled value |
| ΔfG° | -244.50 | kJ/mol | ChemSep v8.3 pure component data Compiled value |
| ΔfH°gas | -617.40 | kJ/mol | ChemSep v8.3 pure component data Compiled value |
| ΔfusH° | 43.15 | kJ/mol | Heat Capacity Measurements of 13 Methyl Esters of n-Carboxylic Acids from Methyloctanoate to Methyleicosanoate between 5 K and 350 K |
| ΔvapH° | [76.50; 77.20] | kJ/mol |
|
| ΔvapH° | 77.17 | kJ/mol | NIST |
| ΔvapH° | 76.60 ± 0.40 | kJ/mol | NIST |
| ΔvapH° | 76.80 | kJ/mol | NIST |
| ΔvapH° | 76.50 ± 0.70 | kJ/mol | NIST |
| ΔvapH° | 77.17 ± 0.56 | kJ/mol | NIST |
| ΔvapH° | 77.20 ± 0.60 | kJ/mol | NIST |
| IE | 9.68 | eV | Relay (1.0) Calculated Property |
| log10WS | [-4.69; -4.69] |
|
|
| log10WS | -4.69 | Aq. Solubility Prediction | |
| log10WS | -4.69 | Estimated Solubility | |
| logPoct/wat | 4.080 | Crippen Calculated Property | |
| McVol | 201.470 | ml/mol | McGowan Calculated Property |
| Pc | [1631.33; 1650.00] | kPa |
|
| Pc | 1631.33 | kPa | PSRK revision IV (2005), critical constants and acentric factors of 1000 components Compiled value |
| Pc | 1650.00 | kPa | ChemSep v8.3 pure component data Compiled value |
| Ptriple | 7.28e-05 | kPa | ChemSep v8.3 pure component data Compiled value |
| Inp | [256.90; 1533.00] |
|
|
| Inp | 1514.90 | NIST | |
| Inp | 1510.00 | NIST | |
| Inp | 1518.00 | NIST | |
| Inp | 1508.00 | NIST | |
| Inp | 1513.00 | NIST | |
| Inp | 1513.00 | NIST | |
| Inp | 1527.00 | NIST | |
| Inp | 1525.00 | NIST | |
| Inp | 1526.00 | NIST | |
| Inp | 1527.00 | NIST | |
| Inp | 1526.00 | NIST | |
| Inp | 1509.00 | NIST | |
| Inp | 1507.00 | NIST | |
| Inp | 1527.00 | NIST | |
| Inp | 1509.00 | NIST | |
| Inp | 1505.00 | NIST | |
| Inp | 1506.00 | NIST | |
| Inp | 1506.00 | NIST | |
| Inp | 1506.00 | NIST | |
| Inp | 1509.00 | NIST | |
| Inp | 1507.00 | NIST | |
| Inp | 1524.00 | NIST | |
| Inp | 1526.00 | NIST | |
| Inp | 1527.00 | NIST | |
| Inp | 1513.00 | NIST | |
| Inp | 1521.30 | NIST | |
| Inp | 1521.70 | NIST | |
| Inp | 1526.00 | NIST | |
| Inp | 1527.00 | NIST | |
| Inp | 1514.00 | NIST | |
| Inp | 1506.00 | NIST | |
| Inp | 1503.00 | NIST | |
| Inp | 1501.00 | NIST | |
| Inp | 1523.00 | NIST | |
| Inp | 1526.00 | NIST | |
| Inp | 1526.80 | NIST | |
| Inp | 1525.00 | NIST | |
| Inp | 1521.00 | NIST | |
| Inp | 1510.00 | NIST | |
| Inp | 1533.00 | NIST | |
| Inp | 1509.00 | NIST | |
| Inp | 1525.00 | NIST | |
| Inp | 1508.00 | NIST | |
| Inp | 1508.00 | NIST | |
| Inp | 1507.00 | NIST | |
| Inp | 1505.00 | NIST | |
| Inp | 1506.00 | NIST | |
| Inp | 1509.00 | NIST | |
| Inp | 1507.00 | NIST | |
| Inp | 1510.00 | NIST | |
| Inp | 1525.00 | NIST | |
| Inp | 1526.00 | NIST | |
| Inp | 1532.00 | NIST | |
| Inp | 1532.00 | NIST | |
| Inp | 1508.00 | NIST | |
| Inp | 1526.00 | NIST | |
| Inp | 1521.00 | NIST | |
| Inp | 1528.00 | NIST | |
| Inp | 1507.00 | NIST | |
| Inp | 1525.00 | NIST | |
| Inp | 1528.00 | NIST | |
| Inp | 1531.00 | NIST | |
| Inp | 1517.00 | NIST | |
| Inp | 1510.00 | NIST | |
| Inp | 1507.00 | NIST | |
| Inp | Outlier 258.35 | NIST | |
| Inp | Outlier 260.37 | NIST | |
| Inp | Outlier 265.90 | NIST | |
| Inp | Outlier 265.80 | NIST | |
| Inp | Outlier 265.90 | NIST | |
| Inp | Outlier 256.90 | NIST | |
| Inp | Outlier 260.05 | NIST | |
| Inp | 1501.00 | NIST | |
| Inp | 1521.00 | NIST | |
| Inp | 1508.00 | NIST | |
| Inp | 1509.00 | NIST | |
| Inp | 1525.00 | NIST | |
| Inp | 1526.00 | NIST | |
| Inp | 1528.00 | NIST | |
| Inp | 1514.90 | NIST | |
| Inp | 1513.00 | NIST | |
| Inp | 1521.30 | NIST | |
| Inp | 1506.00 | NIST | |
| Ip | [1770.00; 1834.00] |
|
|
| Ip | 1802.00 | NIST | |
| Ip | Outlier 1834.00 | NIST | |
| Ip | Outlier 1770.00 | NIST | |
| Ip | 1798.00 | NIST | |
| Ip | 1805.90 | NIST | |
| Ip | 1807.10 | NIST | |
| Ip | 1813.00 | NIST | |
| Ip | 1784.90 | NIST | |
| Ip | 1801.50 | NIST | |
| Ip | 1806.70 | NIST | |
| Ip | 1819.70 | NIST | |
| Ip | 1785.00 | NIST | |
| Ip | 1801.00 | NIST | |
| Ip | 1800.00 | NIST | |
| Ip | 1813.00 | NIST | |
| Ip | 1785.00 | NIST | |
| Ip | 1812.00 | NIST | |
| Ip | 1805.00 | NIST | |
| Ip | 1810.00 | NIST | |
| Ip | 1804.00 | NIST | |
| Ip | 1800.00 | NIST | |
| Ip | 1804.00 | NIST | |
| Ip | 1793.00 | NIST | |
| Ip | 1808.00 | NIST | |
| Ip | 1806.00 | NIST | |
| Ip | Outlier 1770.00 | NIST | |
| Ip | 1814.00 | NIST | |
| Ip | 1814.00 | NIST | |
| Ip | 1791.00 | NIST | |
| Ip | 1808.00 | NIST | |
| Ip | 1811.00 | NIST | |
| Ip | 1804.00 | NIST | |
| Ip | 1793.00 | NIST | |
| Ip | 1809.00 | NIST | |
| Ip | 1793.00 | NIST | |
| Ip | 1785.00 | NIST | |
| Ip | 1815.00 | NIST | |
| Ip | 1800.00 | NIST | |
| Ip | 1800.00 | NIST | |
| Ip | 1804.00 | NIST | |
| Ip | 1815.00 | NIST | |
| Ip | 1802.00 | NIST | |
| Ip | 1807.10 | NIST | |
| Ip | 1819.70 | NIST | |
| Ip | 1808.00 | NIST | |
| Ip | 1791.00 | NIST | |
| Ip | 1785.00 | NIST | |
| Tboil | [540.00; 540.00] | K |
|
| Tboil | 540.00 | K | ChemSep v8.3 pure component data Compiled value |
| Tboil | 540.00 | K | KDB |
| Tc | [712.00; 712.15] | K |
|
| Tc | 712.00 | K | IUPAC Vapor-Liquid Critical Properties of Elements and Compounds, part 7 Compiled value |
| Tc | 712.00 | K | PSRK revision IV (2005), critical constants and acentric factors of 1000 components Compiled value |
| Tc | 712.00 | K | ChemSep v8.3 pure component data Compiled value |
| Tc | 712.00 | K | KDB |
| Tc | 712.15 ± 3.00 | K | NIST |
| Tfus | [277.95; 278.45] | K |
|
| Tfus | 278.25 | K | Jean-Claude Bradley Open Melting Point Dataset (2014, CC0) Compiled value |
| Tfus | 277.95 | K | ChemSep v8.3 pure component data Compiled value |
| Tfus | 278.30 | K | KDB |
| Tfus | 278.25 | K | Aq. Solubility Prediction |
| Tfus | 278.45 ± 0.35 | K | NIST |
| Tfus | 278.00 ± 0.05 | K | NIST |
| Ttriple | 278.15 | K | ChemSep v8.3 pure component data Compiled value |
| UQi | 7.98 | ChemSep v8.3 pure component data Compiled value | |
| URi | 9.55 | ChemSep v8.3 pure component data Compiled value | |
| Vc | [0.781; 0.850] | m3/kmol |
|
| Vc | 0.781 | m3/kmol | PSRK revision IV (2005), critical constants and acentric factors of 1000 components Compiled value |
| Vc | 0.850 | m3/kmol | ChemSep v8.3 pure component data Compiled value |
| Zc | 0.2370000 | ChemSep v8.3 pure component data Compiled value |
Temperature Dependent Properties
Pressure Dependent Properties
| Property | Value | Unit | Pressure (kPa) | Source |
|---|---|---|---|---|
| Tboilr | [414.20; 535.20] | K | [2.00; 102.00] |
|
| Tboilr | 414.20 | K | 2.00 | NIST |
| Tboilr | 535.20 | K | 102.00 | NIST |
Datasets
- Molar heat capacity at constant pressure, J/K/mol (1)
- Viscosity, Pa*s (1)
- Mass density, kg/m3 (2)
- Speed of sound, m/s (1)
Molar heat capacity at constant pressure, J/K/mol
| Fixed | Measured | |
|---|---|---|
| Pressure, kPa - Liquid | Temperature, K - Liquid | Molar heat capacity at constant pressure, J/K/mol - Liquid |
| 100.00 | 313.97 | 442.60 |
| 4040.00 | 313.99 | 441.60 |
| 8070.00 | 314.06 | 439.50 |
| 12160.00 | 314.09 | 438.30 |
| 16180.00 | 314.14 | 436.90 |
| 100.00 | 323.88 | 449.50 |
| 4070.00 | 323.93 | 447.20 |
| 8060.00 | 324.01 | 445.80 |
| 12090.00 | 323.84 | 444.80 |
| 16080.00 | 323.94 | 443.30 |
| 100.00 | 333.88 | 456.40 |
| 4050.00 | 333.96 | 453.60 |
| 8050.00 | 334.00 | 452.10 |
| 12060.00 | 334.05 | 450.50 |
| 16170.00 | 334.11 | 448.00 |
| Reference | ||
Viscosity, Pa*s
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Pressure, kPa - Liquid | Viscosity, Pa*s - Liquid |
| 303.04 | 110.00 | 0.0025 |
| 303.04 | 10512.00 | 0.0029 |
| 302.94 | 20178.00 | 0.0032 |
| 302.70 | 30290.00 | 0.0036 |
| 312.63 | 134.00 | 0.0021 |
| 312.61 | 10214.00 | 0.0023 |
| 312.50 | 20279.00 | 0.0026 |
| 312.33 | 30212.00 | 0.0029 |
| 331.66 | 132.00 | 0.0015 |
| 331.51 | 10354.00 | 0.0017 |
| 331.34 | 20420.00 | 0.0019 |
| 331.07 | 29762.00 | 0.0020 |
| 351.81 | 235.00 | 0.0011 |
| 351.74 | 10090.00 | 0.0013 |
| 351.57 | 20226.00 | 0.0014 |
| 351.24 | 29906.00 | 0.0015 |
| 362.23 | 2921.00 | 0.0010 |
| 361.75 | 10141.00 | 0.0011 |
| 361.60 | 19931.00 | 0.0013 |
| 361.57 | 30100.00 | 0.0014 |
| Reference | ||
Mass density, kg/m3
| Fixed | Measured | |
|---|---|---|
| Pressure, kPa - Liquid | Temperature, K - Liquid | Mass density, kg/m3 - Liquid |
| 100.00 | 283.15 | 876.58 |
| 1000.00 | 283.15 | 877.29 |
| 3000.00 | 283.15 | 879.12 |
| 5000.00 | 283.15 | 880.29 |
| 10000.00 | 283.15 | 883.41 |
| 15000.00 | 283.15 | 886.29 |
| 20000.00 | 283.15 | 889.1 |
| 25000.00 | 283.15 | 891.75 |
| 30000.00 | 283.15 | 894.31 |
| 35000.00 | 283.15 | 896.95 |
| 40000.00 | 283.15 | 899.33 |
| 50000.00 | 283.15 | 904.05 |
| 60000.00 | 283.15 | 909.85 |
| 100.00 | 293.15 | 869.3 |
| 1000.00 | 293.15 | 869.79 |
| 3000.00 | 293.15 | 871.19 |
| 5000.00 | 293.15 | 872.09 |
| 10000.00 | 293.15 | 875.46 |
| 15000.00 | 293.15 | 878.42 |
| 20000.00 | 293.15 | 881.47 |
| 25000.00 | 293.15 | 884.32 |
| 30000.00 | 293.15 | 887.1 |
| 35000.00 | 293.15 | 889.69 |
| 40000.00 | 293.15 | 892.27 |
| 50000.00 | 293.15 | 897.52 |
| 60000.00 | 293.15 | 901.95 |
| 100.00 | 303.15 | 860.98 |
| 1000.00 | 303.15 | 861.67 |
| 3000.00 | 303.15 | 863.19 |
| 5000.00 | 303.15 | 864.57 |
| 10000.00 | 303.15 | 867.78 |
| 15000.00 | 303.15 | 871.1 |
| 20000.00 | 303.15 | 874.06 |
| 25000.00 | 303.15 | 876.92 |
| 30000.00 | 303.15 | 879.85 |
| 35000.00 | 303.15 | 882.66 |
| 40000.00 | 303.15 | 885.34 |
| 50000.00 | 303.15 | 890.6 |
| 60000.00 | 303.15 | 895.49 |
| 100.00 | 313.15 | 853.31 |
| 1000.00 | 313.15 | 853.78 |
| 3000.00 | 313.15 | 855.32 |
| 5000.00 | 313.15 | 856.78 |
| 10000.00 | 313.15 | 860.3 |
| 15000.00 | 313.15 | 863.63 |
| 20000.00 | 313.15 | 866.74 |
| 25000.00 | 313.15 | 870.04 |
| 30000.00 | 313.15 | 872.94 |
| 35000.00 | 313.15 | 875.68 |
| 40000.00 | 313.15 | 878.33 |
| 50000.00 | 313.15 | 883.95 |
| 60000.00 | 313.15 | 888.91 |
| 100.00 | 323.15 | 845.42 |
| 1000.00 | 323.15 | 846.17 |
| 3000.00 | 323.15 | 847.65 |
| 5000.00 | 323.15 | 849.19 |
| 10000.00 | 323.15 | 852.91 |
| 15000.00 | 323.15 | 856.38 |
| 20000.00 | 323.15 | 859.88 |
| 25000.00 | 323.15 | 863.01 |
| 30000.00 | 323.15 | 866.2 |
| 35000.00 | 323.15 | 869.19 |
| 40000.00 | 323.15 | 872.15 |
| 50000.00 | 323.15 | 877.67 |
| 60000.00 | 323.15 | 883.06 |
| 100.00 | 333.15 | 837.89 |
| 1000.00 | 333.15 | 838.44 |
| 3000.00 | 333.15 | 840.13 |
| 5000.00 | 333.15 | 841.69 |
| 10000.00 | 333.15 | 845.49 |
| 15000.00 | 333.15 | 849.14 |
| 20000.00 | 333.15 | 852.7 |
| 25000.00 | 333.15 | 856.12 |
| 30000.00 | 333.15 | 859.27 |
| 35000.00 | 333.15 | 862.4 |
| 40000.00 | 333.15 | 865.66 |
| 50000.00 | 333.15 | 871.36 |
| 60000.00 | 333.15 | 876.77 |
| 100.00 | 343.15 | 829.64 |
| 1000.00 | 343.15 | 830.6 |
| 3000.00 | 343.15 | 832.28 |
| 5000.00 | 343.15 | 834.04 |
| 10000.00 | 343.15 | 837.93 |
| 15000.00 | 343.15 | 841.71 |
| 20000.00 | 343.15 | 845.7 |
| 25000.00 | 343.15 | 848.98 |
| 30000.00 | 343.15 | 852.48 |
| 35000.00 | 343.15 | 855.72 |
| 40000.00 | 343.15 | 858.94 |
| 50000.00 | 343.15 | 864.79 |
| 60000.00 | 343.15 | 870.31 |
| 100.00 | 353.15 | 821.96 |
| 1000.00 | 353.15 | 822.7 |
| 3000.00 | 353.15 | 824.65 |
| 5000.00 | 353.15 | 826.36 |
| 10000.00 | 353.15 | 830.59 |
| 15000.00 | 353.15 | 834.55 |
| 20000.00 | 353.15 | 838.32 |
| 25000.00 | 353.15 | 842.04 |
| 30000.00 | 353.15 | 845.62 |
| 35000.00 | 353.15 | 849.06 |
| 40000.00 | 353.15 | 853.14 |
| 50000.00 | 353.15 | 858.49 |
| 60000.00 | 353.15 | 864.35 |
| 100.00 | 363.15 | 813.95 |
| 1000.00 | 363.15 | 814.97 |
| 3000.00 | 363.15 | 816.88 |
| 5000.00 | 363.15 | 818.64 |
| 10000.00 | 363.15 | 822.93 |
| 15000.00 | 363.15 | 827.44 |
| 20000.00 | 363.15 | 831.22 |
| 25000.00 | 363.15 | 834.95 |
| 30000.00 | 363.15 | 838.64 |
| 35000.00 | 363.15 | 842.26 |
| 40000.00 | 363.15 | 845.87 |
| 50000.00 | 363.15 | 852.24 |
| 60000.00 | 363.15 | 858.43 |
| Reference | ||
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Pressure, kPa - Liquid | Mass density, kg/m3 - Liquid |
| 303.10 | 100.00 | 861.8 |
| 303.11 | 3010.00 | 863.7 |
| 303.13 | 6030.00 | 865.7 |
| 303.16 | 9050.00 | 867.9 |
| 303.20 | 12030.00 | 869.8 |
| 303.20 | 15040.00 | 871.7 |
| 312.95 | 100.00 | 853.4 |
| 313.11 | 3030.00 | 855.3 |
| 313.08 | 6050.00 | 857.4 |
| 313.06 | 9040.00 | 859.2 |
| 313.12 | 12030.00 | 861.2 |
| 312.95 | 15050.00 | 863.4 |
| 323.05 | 100.00 | 845.5 |
| 323.17 | 3030.00 | 847.4 |
| 323.30 | 6050.00 | 849.3 |
| 323.33 | 9050.00 | 851.6 |
| 323.27 | 12040.00 | 853.8 |
| 323.40 | 15020.00 | 855.9 |
| 333.15 | 100.00 | 837.8 |
| 333.15 | 3040.00 | 840.3 |
| 333.15 | 6040.00 | 842.3 |
| 333.18 | 9050.00 | 844.7 |
| 333.16 | 12020.00 | 846.9 |
| 333.14 | 15030.00 | 849.0 |
| 343.18 | 100.00 | 829.4 |
| 343.22 | 3020.00 | 831.9 |
| 343.22 | 6020.00 | 833.9 |
| 343.21 | 9040.00 | 836.6 |
| 343.19 | 12060.00 | 838.5 |
| 343.19 | 15050.00 | 841.1 |
| 353.27 | 100.00 | 821.6 |
| 353.28 | 3040.00 | 824.4 |
| 353.23 | 6050.00 | 826.8 |
| 353.26 | 9030.00 | 829.5 |
| 353.18 | 12030.00 | 831.6 |
| 353.16 | 15040.00 | 834.1 |
| Reference | ||
Speed of sound, m/s
Operational condition: Frequency, MHz = 2 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Pressure, kPa - Liquid | Speed of sound, m/s - Liquid |
| 293.15 | 100.00 | 1351.3 |
| 293.15 | 10000.00 | 1400.9 |
| 293.15 | 20000.00 | 1445.1 |
| 293.15 | 30000.00 | 1486.4 |
| 293.15 | 40000.00 | 1526.9 |
| 293.15 | 50000.00 | 1563.8 |
| 293.15 | 60000.00 | 1600.0 |
| 293.15 | 70000.00 | 1628.6 |
| 293.15 | 80000.00 | 1660.5 |
| 293.15 | 90000.00 | 1690.9 |
| 313.15 | 100.00 | 1276.4 |
| 313.15 | 10000.00 | 1328.0 |
| 313.15 | 20000.00 | 1375.3 |
| 313.15 | 30000.00 | 1420.0 |
| 313.15 | 40000.00 | 1461.6 |
| 313.15 | 50000.00 | 1500.9 |
| 313.15 | 60000.00 | 1537.0 |
| 313.15 | 70000.00 | 1573.3 |
| 313.15 | 80000.00 | 1607.4 |
| 313.15 | 90000.00 | 1637.8 |
| 313.15 | 100000.00 | 1671.1 |
| 313.15 | 120000.00 | 1728.6 |
| 313.15 | 140000.00 | 1784.4 |
| 333.15 | 100.00 | 1205.5 |
| 333.15 | 10000.00 | 1259.6 |
| 333.15 | 20000.00 | 1311.0 |
| 333.15 | 30000.00 | 1357.5 |
| 333.15 | 40000.00 | 1401.0 |
| 333.15 | 50000.00 | 1441.3 |
| 333.15 | 60000.00 | 1480.9 |
| 333.15 | 70000.00 | 1515.7 |
| 333.15 | 80000.00 | 1550.8 |
| 333.15 | 90000.00 | 1585.9 |
| 333.15 | 100000.00 | 1621.9 |
| 333.15 | 120000.00 | 1682.0 |
| 333.15 | 140000.00 | 1739.2 |
| 333.15 | 160000.00 | 1791.8 |
| 333.15 | 180000.00 | 1843.5 |
| 333.15 | 200000.00 | 1893.2 |
| 353.15 | 100.00 | 1133.5 |
| 353.15 | 10000.00 | 1192.2 |
| 353.15 | 20000.00 | 1247.2 |
| 353.15 | 30000.00 | 1295.9 |
| 353.15 | 40000.00 | 1342.5 |
| 353.15 | 50000.00 | 1386.1 |
| 353.15 | 60000.00 | 1426.2 |
| 353.15 | 70000.00 | 1463.8 |
| 353.15 | 80000.00 | 1500.1 |
| 353.15 | 90000.00 | 1534.8 |
| 353.15 | 100000.00 | 1568.3 |
| 353.15 | 120000.00 | 1632.8 |
| 353.15 | 140000.00 | 1690.8 |
| 353.15 | 160000.00 | 1744.4 |
| 353.15 | 180000.00 | 1802.7 |
| 353.15 | 200000.00 | 1851.2 |
| Reference | ||
Correlations
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| Cp,gas | [320.52; 807.03] | J/mol×K | [298.15; 1500.00] |
ChemSep v8.3 pure component data Compiled value
|
| Equation | Y = A + B·((C/T)/sinh(C/T))² + D·((E/T)/cosh(E/T))² Y is Cp,gas in J/mol×K, T in K | |||
| Coefficient A | 2.55340e+02 | |||
| Coefficient B | 4.84780e+02 | |||
| Coefficient C | 8.02330e+02 | |||
| Coefficient D | 2.94990e+02 | |||
| Coefficient E | 2.46630e+03 | |||
| Temperature range, min. | 298.15 | |||
| Temperature range, max. | 1500.00 | |||
| Cp,gas | 320.52 | J/mol×K | 298.15 | Calculated Property |
| Cp,gas | 426.76 | J/mol×K | 431.69 | Calculated Property |
| Cp,gas | 516.77 | J/mol×K | 565.23 | Calculated Property |
| Cp,gas | 585.96 | J/mol×K | 698.77 | Calculated Property |
| Cp,gas | 641.72 | J/mol×K | 832.31 | Calculated Property |
| Cp,gas | 688.48 | J/mol×K | 965.84 | Calculated Property |
| Cp,gas | 727.87 | J/mol×K | 1099.38 | Calculated Property |
| Cp,gas | 760.45 | J/mol×K | 1232.92 | Calculated Property |
| Cp,gas | 786.65 | J/mol×K | 1366.46 | Calculated Property |
| Cp,gas | 807.03 | J/mol×K | 1500.00 | Calculated Property |
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| Cp,liquid | [423.40; 592.53] | J/mol×K | [278.15; 540.00] |
ChemSep v8.3 pure component data Compiled value
|
| Equation | Y = A + B·T + C·T² + D·T³ + E·T⁴ Y is Cp,liquid in J/mol×K, T in K | |||
| Coefficient A | 2.43740e+02 | |||
| Coefficient B | 6.45910e-01 | |||
| Coefficient C | 0.00000e+00 | |||
| Coefficient D | 0.00000e+00 | |||
| Coefficient E | 0.00000e+00 | |||
| Temperature range, min. | 278.15 | |||
| Temperature range, max. | 540.00 | |||
| Cp,liquid | 423.40 | J/mol×K | 278.15 | Calculated Property |
| Cp,liquid | 442.19 | J/mol×K | 307.24 | Calculated Property |
| Cp,liquid | 460.98 | J/mol×K | 336.34 | Calculated Property |
| Cp,liquid | 479.78 | J/mol×K | 365.43 | Calculated Property |
| Cp,liquid | 498.57 | J/mol×K | 394.53 | Calculated Property |
| Cp,liquid | 517.36 | J/mol×K | 423.62 | Calculated Property |
| Cp,liquid | 536.15 | J/mol×K | 452.72 | Calculated Property |
| Cp,liquid | 554.95 | J/mol×K | 481.81 | Calculated Property |
| Cp,liquid | 573.74 | J/mol×K | 510.91 | Calculated Property |
| Cp,liquid | 592.53 | J/mol×K | 540.00 | Calculated Property |
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| η | [0.0042352; 0.0001907] | Pa×s | [278.15; 540.00] |
ChemSep v8.3 pure component data Compiled value
|
| Equation | Y = exp(A + B/T + C·ln(T) + D·T^E) Y is η in Pa×s, T in K | |||
| Coefficient A | -1.18580e+01 | |||
| Coefficient B | 1.77840e+03 | |||
| Coefficient C | 0.00000e+00 | |||
| Coefficient D | 0.00000e+00 | |||
| Coefficient E | 0.00000e+00 | |||
| Temperature range, min. | 278.15 | |||
| Temperature range, max. | 540.00 | |||
| η | 0.0042352 | Pa×s | 278.15 | Calculated Property |
| η | 0.0023117 | Pa×s | 307.24 | Calculated Property |
| η | 0.0014011 | Pa×s | 336.34 | Calculated Property |
| η | 0.0009197 | Pa×s | 365.43 | Calculated Property |
| η | 0.0006424 | Pa×s | 394.53 | Calculated Property |
| η | 0.0004713 | Pa×s | 423.62 | Calculated Property |
| η | 0.0003599 | Pa×s | 452.72 | Calculated Property |
| η | 0.0002839 | Pa×s | 481.81 | Calculated Property |
| η | 0.0002301 | Pa×s | 510.91 | Calculated Property |
| η | 0.0001907 | Pa×s | 540.00 | Calculated Property |
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| ΔvapH | [77.47; 0.00] | kJ/mol | [278.15; 712.00] |
ChemSep v8.3 pure component data Compiled value
|
| Equation | Y = A·(1 − Tr)^(B + C·Tr + D·Tr² + E·Tr³), Tr = T/Tc Y is ΔvapH in kJ/mol, T in K | |||
| Coefficient A | 1.10920e+02 | |||
| Coefficient B | 9.59590e-01 | |||
| Coefficient C | -6.65100e-01 | |||
| Coefficient D | 1.61540e-01 | |||
| Coefficient E | 0.00000e+00 | |||
| Critical temperature, Tc (K) | 7.12000e+02 | |||
| Temperature range, min. | 278.15 | |||
| Temperature range, max. | 712.00 | |||
| ΔvapH | 77.47 | kJ/mol | 278.15 | Calculated Property |
| ΔvapH | 72.71 | kJ/mol | 326.36 | Calculated Property |
| ΔvapH | 68.04 | kJ/mol | 374.56 | Calculated Property |
| ΔvapH | 63.36 | kJ/mol | 422.77 | Calculated Property |
| ΔvapH | 58.52 | kJ/mol | 470.97 | Calculated Property |
| ΔvapH | 53.34 | kJ/mol | 519.18 | Calculated Property |
| ΔvapH | 47.49 | kJ/mol | 567.38 | Calculated Property |
| ΔvapH | 40.39 | kJ/mol | 615.59 | Calculated Property |
| ΔvapH | 30.46 | kJ/mol | 663.79 | Calculated Property |
| ΔvapH | 0.00 | kJ/mol | 712.00 | Calculated Property |
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| Pvap | [1.33; 202.66] | kPa | [409.00; 565.34] |
The Yaws Handbook of Vapor Pressure
|
| Equation | ln(Y) = A + B/(T + C) Y is Pvap in kPa, T in K | |||
| Coefficient A | 1.55217e+01 | |||
| Coefficient B | -4.84033e+03 | |||
| Coefficient C | -9.12700e+01 | |||
| Temperature range, min. | 409.00 | |||
| Temperature range, max. | 565.34 | |||
| Pvap | 1.33 | kPa | 409.00 | Calculated Property |
| Pvap | 2.94 | kPa | 426.37 | Calculated Property |
| Pvap | 5.98 | kPa | 443.74 | Calculated Property |
| Pvap | 11.41 | kPa | 461.11 | Calculated Property |
| Pvap | 20.52 | kPa | 478.48 | Calculated Property |
| Pvap | 35.09 | kPa | 495.86 | Calculated Property |
| Pvap | 57.43 | kPa | 513.23 | Calculated Property |
| Pvap | 90.39 | kPa | 530.60 | Calculated Property |
| Pvap | 137.44 | kPa | 547.97 | Calculated Property |
| Pvap | 202.66 | kPa | 565.34 | Calculated Property |
| Pvap | [7.31e-05; 1658.84] | kPa | [278.15; 712.00] |
ChemSep v8.3 pure component data Compiled value
|
| Equation | Y = exp(A + B/T + C·ln(T) + D·T^E) Y is Pvap in kPa, T in K | |||
| Coefficient A | 9.70122e+01 | |||
| Coefficient B | -1.22850e+04 | |||
| Coefficient C | -1.10820e+01 | |||
| Coefficient D | 3.40250e-18 | |||
| Coefficient E | 6.00000e+00 | |||
| Temperature range, min. | 278.15 | |||
| Temperature range, max. | 712.00 | |||
| Pvap | 7.31e-05 | kPa | 278.15 | Calculated Property |
| Pvap | 8.49e-03 | kPa | 326.36 | Calculated Property |
| Pvap | 0.24 | kPa | 374.56 | Calculated Property |
| Pvap | 2.62 | kPa | 422.77 | Calculated Property |
| Pvap | 15.76 | kPa | 470.97 | Calculated Property |
| Pvap | 62.12 | kPa | 519.18 | Calculated Property |
| Pvap | 181.70 | kPa | 567.38 | Calculated Property |
| Pvap | 430.90 | kPa | 615.59 | Calculated Property |
| Pvap | 884.97 | kPa | 663.79 | Calculated Property |
| Pvap | 1658.84 | kPa | 712.00 | Calculated Property |
| Pvap | [5.30e-05; 1771.68] | kPa | [278.15; 712.00] |
KDB Vapor Pressure Data
|
| Equation | ln(Y) = A + B/T + C·ln(T) + D·T² + E/T² Y is Pvap in kPa, T in K | |||
| Coefficient A | 1.80226e+02 | |||
| Coefficient B | -1.60241e+04 | |||
| Coefficient C | -2.36787e+01 | |||
| Coefficient D | 1.04209e-05 | |||
| Coefficient E | 0.00000e+00 | |||
| Temperature range, min. | 278.15 | |||
| Temperature range, max. | 712.00 | |||
| Pvap | 5.30e-05 | kPa | 278.15 | Calculated Property |
| Pvap | 8.10e-03 | kPa | 326.36 | Calculated Property |
| Pvap | 0.24 | kPa | 374.56 | Calculated Property |
| Pvap | 2.73 | kPa | 422.77 | Calculated Property |
| Pvap | 16.06 | kPa | 470.97 | Calculated Property |
| Pvap | 61.91 | kPa | 519.18 | Calculated Property |
| Pvap | 179.71 | kPa | 567.38 | Calculated Property |
| Pvap | 431.09 | kPa | 615.59 | Calculated Property |
| Pvap | 910.66 | kPa | 663.79 | Calculated Property |
| Pvap | 1771.68 | kPa | 712.00 | Calculated Property |
| Pvap | [0.26; 5.17] | kPa | [373.00; 439.00] |
NIST
|
| Equation | ln(Y) = A + B/(T + C) Y is Pvap in kPa, T in K | |||
| Coefficient A | 1.56969e+01 | |||
| Coefficient B | -5.30411e+03 | |||
| Coefficient C | -6.15920e+01 | |||
| Reference | Althouse and Triebold, 1944 | |||
| Comment | Coefficents calculated by NIST from author's data. | |||
| Temperature range, min. | 373.00 | |||
| Temperature range, max. | 439.00 | |||
| Pvap | 0.26 | kPa | 373.00 | Calculated Property |
| Pvap | 0.39 | kPa | 380.33 | Calculated Property |
| Pvap | 0.57 | kPa | 387.67 | Calculated Property |
| Pvap | 0.81 | kPa | 395.00 | Calculated Property |
| Pvap | 1.14 | kPa | 402.33 | Calculated Property |
| Pvap | 1.58 | kPa | 409.67 | Calculated Property |
| Pvap | 2.17 | kPa | 417.00 | Calculated Property |
| Pvap | 2.93 | kPa | 424.33 | Calculated Property |
| Pvap | 3.91 | kPa | 431.67 | Calculated Property |
| Pvap | 5.17 | kPa | 439.00 | Calculated Property |
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| ρl | [879.77; 252.11] | kg/m3 | [278.15; 712.00] |
ChemSep v8.3 pure component data Compiled value
|
| Equation | Y = A / B^(1 + (1 − T/C)^D) Y is ρl in kg/m3, T in K | |||
| Coefficient A | 5.97420e+01 | |||
| Coefficient B | 2.36970e-01 | |||
| Coefficient C | 7.12000e+02 | |||
| Coefficient D | 2.85710e-01 | |||
| Temperature range, min. | 278.15 | |||
| Temperature range, max. | 712.00 | |||
| ρl | 879.77 | kg/m3 | 278.15 | Calculated Property |
| ρl | 844.12 | kg/m3 | 326.36 | Calculated Property |
| ρl | 806.79 | kg/m3 | 374.56 | Calculated Property |
| ρl | 767.35 | kg/m3 | 422.77 | Calculated Property |
| ρl | 725.20 | kg/m3 | 470.97 | Calculated Property |
| ρl | 679.38 | kg/m3 | 519.18 | Calculated Property |
| ρl | 628.27 | kg/m3 | 567.38 | Calculated Property |
| ρl | 568.55 | kg/m3 | 615.59 | Calculated Property |
| ρl | 491.26 | kg/m3 | 663.79 | Calculated Property |
| ρl | 252.11 | kg/m3 | 712.00 | Calculated Property |
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| γ | [0.03; 0.01] | N/m | [277.95; 535.15] |
Jasper (1972), surface tension of pure liquid compounds Compiled value
|
| Equation | Y = A + B·T + C·T² + D·T³ + E·T⁴ Y is γ in N/m, T in K | |||
| Coefficient A | 5.57623e-02 | |||
| Coefficient B | -8.93000e-05 | |||
| Coefficient C | 0.00000e+00 | |||
| Coefficient D | 0.00000e+00 | |||
| Coefficient E | 0.00000e+00 | |||
| Temperature range, min. | 277.95 | |||
| Temperature range, max. | 535.15 | |||
| γ | 0.03 | N/m | 277.95 | Calculated Property |
| γ | 0.03 | N/m | 306.53 | Calculated Property |
| γ | 0.03 | N/m | 335.11 | Calculated Property |
| γ | 0.02 | N/m | 363.68 | Calculated Property |
| γ | 0.02 | N/m | 392.26 | Calculated Property |
| γ | 0.02 | N/m | 420.84 | Calculated Property |
| γ | 0.02 | N/m | 449.42 | Calculated Property |
| γ | 0.01 | N/m | 477.99 | Calculated Property |
| γ | 0.01 | N/m | 506.57 | Calculated Property |
| γ | 0.01 | N/m | 535.15 | Calculated Property |
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| λgas | [0.02; 0.06] | W/m×K | [540.00; 1000.00] |
ChemSep v8.3 pure component data Compiled value
|
| Equation | Y = A·T^B / (1 + C/T + D/T²) Y is λgas in W/m×K, T in K | |||
| Coefficient A | 2.37380e-06 | |||
| Coefficient B | 1.45830e+00 | |||
| Coefficient C | 0.00000e+00 | |||
| Coefficient D | 0.00000e+00 | |||
| Temperature range, min. | 540.00 | |||
| Temperature range, max. | 1000.00 | |||
| λgas | 0.02 | W/m×K | 540.00 | Calculated Property |
| λgas | 0.03 | W/m×K | 591.11 | Calculated Property |
| λgas | 0.03 | W/m×K | 642.22 | Calculated Property |
| λgas | 0.03 | W/m×K | 693.33 | Calculated Property |
| λgas | 0.04 | W/m×K | 744.44 | Calculated Property |
| λgas | 0.04 | W/m×K | 795.56 | Calculated Property |
| λgas | 0.04 | W/m×K | 846.67 | Calculated Property |
| λgas | 0.05 | W/m×K | 897.78 | Calculated Property |
| λgas | 0.05 | W/m×K | 948.89 | Calculated Property |
| λgas | 0.06 | W/m×K | 1000.00 | Calculated Property |
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| λliquid | [0.14; 0.09] | W/m×K | [278.15; 540.00] |
ChemSep v8.3 pure component data Compiled value
|
| Equation | Y = A + B·T + C·T² + D·T³ + E·T⁴ Y is λliquid in W/m×K, T in K | |||
| Coefficient A | 1.99170e-01 | |||
| Coefficient B | -2.04310e-04 | |||
| Coefficient C | 0.00000e+00 | |||
| Coefficient D | 0.00000e+00 | |||
| Coefficient E | 0.00000e+00 | |||
| Temperature range, min. | 278.15 | |||
| Temperature range, max. | 540.00 | |||
| λliquid | 0.14 | W/m×K | 278.15 | Calculated Property |
| λliquid | 0.14 | W/m×K | 307.24 | Calculated Property |
| λliquid | 0.13 | W/m×K | 336.34 | Calculated Property |
| λliquid | 0.12 | W/m×K | 365.43 | Calculated Property |
| λliquid | 0.12 | W/m×K | 394.53 | Calculated Property |
| λliquid | 0.11 | W/m×K | 423.62 | Calculated Property |
| λliquid | 0.11 | W/m×K | 452.72 | Calculated Property |
| λliquid | 0.10 | W/m×K | 481.81 | Calculated Property |
| λliquid | 0.09 | W/m×K | 510.91 | Calculated Property |
| λliquid | 0.09 | W/m×K | 540.00 | Calculated Property |
Similar Compounds
Find more compounds similar to Dodecanoic acid, methyl ester.
Mixtures
- Dodecanoic acid, methyl ester + Glycerin + Methyl Alcohol
- Dodecanoic acid, methyl ester + Methyl Alcohol
- Dodecanoic acid, methyl ester + Decanoic acid, methyl ester
- 1-Propanol + Dodecanoic acid, methyl ester
- Dodecanoic acid, methyl ester + 1-Butanol
- Dodecanoic acid, methyl ester + 1-Pentanol
- Dodecanoic acid, methyl ester + Cyclohexane, methyl-
- Ethane + Dodecanoic acid, methyl ester
- Dodecanoic acid, methyl ester + Glycerin + Water
- Dodecanoic acid, methyl ester + Octanoic acid, ethyl ester
- Cyclohexane, (1-methylethyl)- + Dodecanoic acid, methyl ester
- Dodecanoic acid, methyl ester + Tetradecane
- Ethanol + Dodecanoic acid, methyl ester + Glycerin
- Dodecanoic acid, methyl ester + (3a«alpha»,4«beta»,7«beta»,7a«alpha»)-octahydro-4,7-methano-1H-indene
- Cyclohexane, (1-methylethyl)- + Dodecanoic acid, methyl ester + (3a«alpha»,4«beta»,7«beta»,7a«alpha»)-octahydro-4,7-methano-1H-indene
Sources
- KDB Vapor Pressure Data
- Jean-Claude Bradley Open Melting Point Dataset (2014, CC0) ChEDL chemicals 1.5.2, from Bradley, J.-C.; Williams, A.; Lang, A. Jean-Claude Bradley Open Melting Point Dataset. Figshare, 2014 (CC0).
- IUPAC Vapor-Liquid Critical Properties of Elements and Compounds, part 7 ChEDL chemicals 1.5.2, from Kudchadker, A. P.; Ambrose, D.; Tsonopoulos, C. Vapor-Liquid Critical Properties of Elements and Compounds. 7. Oxygen Compounds Other Than Alkanols and Cycloalkanols. J. Chem. Eng. Data 2001, 46, 457-479.
- Jasper (1972), surface tension of pure liquid compounds ChEDL chemicals 1.5.2, from Jasper, J. J. The Surface Tension of Pure Liquid Compounds. J. Phys. Chem. Ref. Data 1972, 1, 841-1010 (as transcribed in Lange's Handbook).
- PSRK revision IV (2005), critical constants and acentric factors of 1000 components ChEDL chemicals 1.5.2, from Horstmann, S.; Jabłoniec, A.; Krafczyk, J.; Fischer, K.; Gmehling, J. PSRK Group Contribution Equation of State: Comprehensive Revision and Extension IV, Including Critical Constants and α-Function Parameters for 1000 Components. Fluid Phase Equilib. 2005, 227, 157-164.
- Cheméo Relay (1.0)
- ChemSep v8.3 pure component data Converted from ChemSep v8.3 pure component data, H. Kooijman and R. Taylor (2021, 2022), Artistic License 2.0; see how the values differ.
- Crippen Method
- Measurement and correlation of vapor liquid equilibria for methanol + methyl laurate and methanol + methyl myristate systems near critical temperature of methanol
- Phase behaviour of high molecular mass methyl esters in supercritical ethane
- Measurement and correlation of ternary vapor-liquid equilibria for methanol + glycerol + fatty acid methyl ester (methyl laurate, methyl myristate, methyl palmitate) systems at elevated temperatures and pressures
- Experimental vapor pressures (from 1 Pa to 100 kPa) of six saturated Fatty Acid Methyl Esters (FAMEs): Methyl hexanoate, methyl octanoate, methyl decanoate, methyl dodecanoate, methyl tetradecanoate and methyl hexadecanoate
- High-pressure liquid densities and derived thermodynamic properties for methyl laurate and ethyl laurate
- Isobaric vapor-liquid equilibrium for binary system of methyl caprate + methyl laurate at 2, 4 and 6 kPa
- Measurement of speed of sound, density compressibility and viscosity in liquid methyl laurate and ethyl laurate up to 200 MPa by using acoustic wave sensors
- Experimental studies on the liquid thermal conductivity of three saturated fatty acid methyl esters components of biodiesel
- Heat capacities and thermal diffusivities of some n-alkanoic acid methyl esters
- Fatty acids methyl esters: Complementary measurements and comprehensive analysis of vaporization thermodynamics
- Thermophysical properties of fatty acid methyl and ethyl esters
- Liquid viscosities for methyl hexanoate, methyl heptanoate, methyl caprylate, and methyl nonanoate at high pressures
- Measurement and correlation of density and viscosity of binary mixtures of fatty acid (methyl esters + methylcyclohexane)
- Experimental studies on the thermal conductivity of methyl laurate component of biodiesel with three alcohols
- the vaporization enthaplies and vapor pressures of a series of unstaurated fatty acid methyl esters by correlation gas chromatography
- Isobaric molar heat capacities of binary mixtures containing methyl caprate and methyl laurate at pressures up to 16.2 MPa
- Measurement and correlation of viscosities and densities of methyl dodecanoate and ethyl dodecanoate at elevated pressures
- Liquid Liquid Equilibrium for the Ternary System of Methyl Laurate/Methyl Myristate + Ethanol + Glycerol at 318.15 and 333.15 K
- Isothermal Vapor Pressures of Three Binary Systems: n-Tetradecane + Methyl Dodecanoate, Methyl Tetradecanoate, or Methyl Hexadecanoate between 353.15 and 453.15 K
- Densities and Viscosities of Mixtures of Methyl Dodecanoate + Ethyl Octanoate at Pressures up to 15 MPa
- Densities and Viscosities for the Ternary Mixtures of exo-Tetrahydrodicyclopentadiene (1) + Isopropylcyclohexane (2) + Methyl Laurate (3) and Corresponding Binaries
- Heat Capacity Measurements of 13 Methyl Esters of n-Carboxylic Acids from Methyloctanoate to Methyleicosanoate between 5 K and 350 K
- Densities and Viscosities of Fatty Acid Methyl and Ethyl Esters
- Article Ternary Liquid Liquid Equilibrium of Biodiesel Compounds for Systems Consisting of a Methyl Ester + Glycerin + Water
- Group Contribution Model for Predicting Viscosity of Fatty Compounds
- KDB
- Aqueous Solubility Prediction Method
- Estimated Solubility Method
- McGowan Method
- NIST Webbook
- The Yaws Handbook of Vapor Pressure
Note: Cheméo is only indexing the data, follow the source links to retrieve the latest data. The source is also providing more information like the publication year, authors and more.
Take the time to validate and double check the source of the data.
Outlier This icon means
that the value is more than 2 standard deviations away from the
property mean.
Calculated This icon marks a calculated value or equation: a prediction, not a measurement.
Compiled This icon marks a compiled value or equation: taken from a data compilation such as ChemSep, not from an original measurement report.
These property values are available through the Cheméo API. A free account gives you an access key.