- InChI
- InChI=1S/C19H38O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(20)21-2/h3-18H2,1-2H3
- InChI Key
- HPEUJPJOZXNMSJ-UHFFFAOYSA-N
- Formula
- C19H38O2
- SMILES
- CCCCCCCCCCCCCCCCCC(=O)OC
- Molecular Weight1
- 298.50
- CAS
- 112-61-8
- Other Names
-
- 28:0, Me ester
- Emery 2218
- Kemester 4516
- Kemester 9018
- Kemester 9718
- Metholene 2218
- Methyl ester of octadecanoic acid
- Methyl n-octadecanoate
- NSC 9418
- methyl octadecanoate
- n-Octadecanoic acid, methyl ester
- octadecanoic acid, methyl ester
- stearic acid, methyl ester
- ω : Acentric Factor.
- ΔcH°solid : Standard solid enthalpy of combustion (kJ/mol).
- Cp,gas : Ideal gas heat capacity (J/mol×K).
- Cp,liquid : Liquid phase heat capacity (J/mol×K).
- μ : Dipole Moment (debye).
- η : Dynamic viscosity (Pa×s).
- ΔfG° : Standard Gibbs free energy of formation (kJ/mol).
- ΔfH°gas : Enthalpy of formation at standard conditions (kJ/mol).
- ΔfusH° : Enthalpy of fusion at standard conditions (kJ/mol).
- ΔfusH : Enthalpy of fusion at a given temperature (kJ/mol).
- ΔsubH : Enthalpy of sublimation at a given temperature (kJ/mol).
- ΔvapH° : Enthalpy of vaporization at standard conditions (kJ/mol).
- ΔvapH : Enthalpy of vaporization at a given temperature (kJ/mol).
- IE : Ionization energy (eV).
- log10WS : Log10 of Water solubility in mol/l.
- logPoct/wat : Octanol/Water partition coefficient.
- McVol : McGowan's characteristic volume (ml/mol).
- Pc : Critical Pressure (kPa).
- Ptriple : Triple Point Pressure (kPa).
- Pvap : Vapor pressure (kPa).
- ρl : Liquid Density (kg/m3).
- Inp : Non-polar retention indices.
- I : Polar retention indices.
- csound,fluid : Speed of sound in fluid (m/s).
- Tboil : Normal Boiling Point Temperature (K).
- Tboil : Boiling point at given pressure (K).
- Tboilr : Boiling point at reduced pressure (K).
- Tc : Critical Temperature (K).
- λ : Gas thermal conductivity (W/m×K).
- λ : Liquid thermal conductivity (W/m×K).
- Tfus : Normal melting (fusion) point (K).
- Ttriple : Triple Point Temperature (K).
- UQi : UNIQUAC Qi Parameter.
- URi : UNIQUAC Ri Parameter.
- Vc : Critical Volume (m3/kmol).
- Zc : Critical Compressibility.
- 1: Molecular weight from the IUPAC atomic weights tables.
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Physical Properties
| Property | Value | Unit | Source |
|---|---|---|---|
| ω | 0.8595 | ChemSep v8.3 pure component data | |
| ΔcH°solid | -11962.00 ± 0.40 | kJ/mol | NIST |
| μ | 1.67 | debye | ChemSep v8.3 pure component data |
| ΔfG° | -242.20 | kJ/mol | ChemSep v8.3 pure component data |
| ΔfH°gas | -741.90 | kJ/mol | ChemSep v8.3 pure component data |
| ΔfusH° | 66.35 | kJ/mol | Heat Capacity Measurements of 13 Methyl Esters of n-Carboxylic Acids from Methyloctanoate to Methyleicosanoate between 5 K and 350 K |
| ΔvapH° | [105.90; 109.50] | kJ/mol |
|
| ΔvapH° | 109.50 ± 2.70 | kJ/mol | NIST |
| ΔvapH° | 105.90 ± 1.40 | kJ/mol | NIST |
| ΔvapH° | 106.20 | kJ/mol | NIST |
| IE | 9.83 | eV | Relay (1.0) Calculated Property |
| log10WS | -6.84 | Relay (1.0) Calculated Property | |
| logPoct/wat | 6.421 | Crippen Calculated Property | |
| McVol | 286.010 | ml/mol | McGowan Calculated Property |
| Pc | 1084.00 | kPa | ChemSep v8.3 pure component data |
| Ptriple | 5.33e-07 | kPa | ChemSep v8.3 pure component data |
| Inp | [349.48; 2141.00] |
|
|
| Inp | 2099.80 | NIST | |
| Inp | 2101.00 | NIST | |
| Inp | 2102.10 | NIST | |
| Inp | 2103.30 | NIST | |
| Inp | 2104.50 | NIST | |
| Inp | 2105.80 | NIST | |
| Inp | 2107.10 | NIST | |
| Inp | 2109.00 | NIST | |
| Inp | 2113.00 | NIST | |
| Inp | 2114.00 | NIST | |
| Inp | 2102.00 | NIST | |
| Inp | 2113.00 | NIST | |
| Inp | 2113.00 | NIST | |
| Inp | 2126.00 | NIST | |
| Inp | 2128.00 | NIST | |
| Inp | 2140.00 | NIST | |
| Inp | 2130.00 | NIST | |
| Inp | 2116.00 | NIST | |
| Inp | 2128.00 | NIST | |
| Inp | 2135.00 | NIST | |
| Inp | 2112.00 | NIST | |
| Inp | 2117.00 | NIST | |
| Inp | 2130.00 | NIST | |
| Inp | 2128.00 | NIST | |
| Inp | 2128.00 | NIST | |
| Inp | 2128.00 | NIST | |
| Inp | 2110.00 | NIST | |
| Inp | 2128.00 | NIST | |
| Inp | 2133.00 | NIST | |
| Inp | 2138.00 | NIST | |
| Inp | 2128.00 | NIST | |
| Inp | 2141.00 | NIST | |
| Inp | 2135.00 | NIST | |
| Inp | 2130.00 | NIST | |
| Inp | 2109.00 | NIST | |
| Inp | 2109.00 | NIST | |
| Inp | 2109.00 | NIST | |
| Inp | 2109.49 | NIST | |
| Inp | 2109.00 | NIST | |
| Inp | 2116.00 | NIST | |
| Inp | 2108.00 | NIST | |
| Inp | 2109.00 | NIST | |
| Inp | 2128.00 | NIST | |
| Inp | 2098.00 | NIST | |
| Inp | 2123.10 | NIST | |
| Inp | 2127.10 | NIST | |
| Inp | 2130.00 | NIST | |
| Inp | 2128.00 | NIST | |
| Inp | 2111.00 | NIST | |
| Inp | 2128.00 | NIST | |
| Inp | 2139.00 | NIST | |
| Inp | 2110.00 | NIST | |
| Inp | 2114.00 | NIST | |
| Inp | 2106.00 | NIST | |
| Inp | 2109.00 | NIST | |
| Inp | 2127.00 | NIST | |
| Inp | 2137.00 | NIST | |
| Inp | 2122.00 | NIST | |
| Inp | 2138.00 | NIST | |
| Inp | 2126.00 | NIST | |
| Inp | 2141.00 | NIST | |
| Inp | 2133.00 | NIST | |
| Inp | 2124.00 | NIST | |
| Inp | 2109.20 | NIST | |
| Inp | 2137.00 | NIST | |
| Inp | 2130.00 | NIST | |
| Inp | 2110.00 | NIST | |
| Inp | 2124.00 | NIST | |
| Inp | 2129.30 | NIST | |
| Inp | 2128.00 | NIST | |
| Inp | 2128.00 | NIST | |
| Inp | 2110.00 | NIST | |
| Inp | 2111.00 | NIST | |
| Inp | 2112.00 | NIST | |
| Inp | 2117.00 | NIST | |
| Inp | 2111.00 | NIST | |
| Inp | 2130.00 | NIST | |
| Inp | 2139.00 | NIST | |
| Inp | 2104.00 | NIST | |
| Inp | 2125.00 | NIST | |
| Inp | 2126.00 | NIST | |
| Inp | 2127.00 | NIST | |
| Inp | 2133.00 | NIST | |
| Inp | 2111.00 | NIST | |
| Inp | 2108.00 | NIST | |
| Inp | 2105.00 | NIST | |
| Inp | 2130.00 | NIST | |
| Inp | 2109.00 | NIST | |
| Inp | 2110.00 | NIST | |
| Inp | 2107.00 | NIST | |
| Inp | 2111.00 | NIST | |
| Inp | 2112.00 | NIST | |
| Inp | 2102.00 | NIST | |
| Inp | 2116.00 | NIST | |
| Inp | 2116.00 | NIST | |
| Inp | 2112.00 | NIST | |
| Inp | 2126.00 | NIST | |
| Inp | 2134.00 | NIST | |
| Inp | 2125.00 | NIST | |
| Inp | 2123.00 | NIST | |
| Inp | 2123.00 | NIST | |
| Inp | 2108.00 | NIST | |
| Inp | 2121.00 | NIST | |
| Inp | 2130.00 | NIST | |
| Inp | 2125.00 | NIST | |
| Inp | 2128.00 | NIST | |
| Inp | 2101.00 | NIST | |
| Inp | 2128.00 | NIST | |
| Inp | 2127.00 | NIST | |
| Inp | 2127.00 | NIST | |
| Inp | 2128.00 | NIST | |
| Inp | 2130.00 | NIST | |
| Inp | 2130.00 | NIST | |
| Inp | 2134.00 | NIST | |
| Inp | 2119.00 | NIST | |
| Inp | 2127.00 | NIST | |
| Inp | 2140.00 | NIST | |
| Inp | 2129.00 | NIST | |
| Inp | 2109.00 | NIST | |
| Inp | 2109.00 | NIST | |
| Inp | 2098.00 | NIST | |
| Inp | 2112.00 | NIST | |
| Inp | 2115.00 | NIST | |
| Inp | Outlier 349.48 | NIST | |
| Inp | Outlier 352.84 | NIST | |
| Inp | Outlier 362.20 | NIST | |
| Inp | Outlier 362.20 | NIST | |
| Inp | Outlier 362.20 | NIST | |
| Inp | Outlier 351.30 | NIST | |
| Inp | Outlier 351.38 | NIST | |
| Inp | Outlier 351.38 | NIST | |
| Inp | 2106.00 | NIST | |
| Inp | 2138.00 | NIST | |
| Inp | 2109.20 | NIST | |
| Inp | 2129.30 | NIST | |
| Inp | 2112.00 | NIST | |
| Inp | 2104.00 | NIST | |
| Inp | 2111.00 | NIST | |
| Inp | 2110.00 | NIST | |
| Inp | 2116.00 | NIST | |
| Inp | 2126.00 | NIST | |
| Inp | 2130.00 | NIST | |
| Inp | 2099.80 | NIST | |
| Inp | 2105.80 | NIST | |
| Inp | 2102.00 | NIST | |
| Inp | Outlier 351.38 | NIST | |
| Inp | 2123.10 | NIST | |
| Inp | 2128.00 | NIST | |
| I | [2386.00; 2445.00] |
|
|
| I | 2419.00 | NIST | |
| I | 2410.00 | NIST | |
| I | 2445.00 | NIST | |
| I | 2396.00 | NIST | |
| I | 2389.00 | NIST | |
| I | 2409.00 | NIST | |
| I | 2415.00 | NIST | |
| I | Outlier 2386.00 | NIST | |
| I | 2417.00 | NIST | |
| I | Outlier 2386.00 | NIST | |
| I | 2426.00 | NIST | |
| I | 2431.00 | NIST | |
| I | 2445.00 | NIST | |
| I | 2445.00 | NIST | |
| I | 2424.00 | NIST | |
| I | 2419.00 | NIST | |
| I | 2422.00 | NIST | |
| I | 2412.00 | NIST | |
| I | 2433.00 | NIST | |
| I | 2405.00 | NIST | |
| I | 2409.00 | NIST | |
| I | 2415.00 | NIST | |
| I | 2405.00 | NIST | |
| I | 2434.00 | NIST | |
| I | 2418.00 | NIST | |
| I | 2429.00 | NIST | |
| I | 2418.00 | NIST | |
| I | 2442.00 | NIST | |
| I | 2409.00 | NIST | |
| I | 2426.00 | NIST | |
| I | 2429.00 | NIST | |
| Tboil | 451.15 | K | ChemSep v8.3 pure component data |
| Tc | [781.10; 785.00] | K |
|
| Tc | 785.00 | K | Vapor-liquid critical point measurements of fifteen compounds by the pulse-heating method |
| Tc | 781.10 | K | ChemSep v8.3 pure component data |
| Tfus | [310.00; 312.40] | K |
|
| Tfus | 312.40 | K | ChemSep v8.3 pure component data |
| Tfus | 310.00 ± 0.50 | K | NIST |
| Tfus | 312.15 ± 0.35 | K | NIST |
| Tfus | 311.20 ± 1.00 | K | NIST |
| Tfus | 312.10 ± 0.50 | K | NIST |
| Ttriple | 310.55 | K | ChemSep v8.3 pure component data |
| UQi | 11.22 | ChemSep v8.3 pure component data | |
| URi | 13.59 | ChemSep v8.3 pure component data | |
| Vc | 1.310 | m3/kmol | ChemSep v8.3 pure component data |
| Zc | 0.2190000 | ChemSep v8.3 pure component data |
Temperature Dependent Properties
Pressure Dependent Properties
| Property | Value | Unit | Pressure (kPa) | Source |
|---|---|---|---|---|
| Tboil | [475.97; 493.38] | K | [1.20; 2.50] |
|
| Tboil | 475.97 | K | 1.20 | Vapour liquid equilibria of monocaprylin plus palmitic acid or methyl stearate at P = (1.20 and 2.50) kPa by using DSC technique |
| Tboil | 493.38 | K | 2.50 | Vapour liquid equilibria of monocaprylin plus palmitic acid or methyl stearate at P = (1.20 and 2.50) kPa by using DSC technique |
| Tboilr | 488.20 | K | 2.00 | NIST |
Correlations
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| Cp,gas | [457.83; 1164.72] | J/mol×K | [298.15; 1500.00] |
ChemSep v8.3 pure component data
|
| Equation | Y = A + B·((C/T)/sinh(C/T))² + D·((E/T)/cosh(E/T))² Y is Cp,gas in J/mol×K, T in K | |||
| Coefficient A | 3.63430e+02 | |||
| Coefficient B | 7.03170e+02 | |||
| Coefficient C | 8.02660e+02 | |||
| Coefficient D | 4.26690e+02 | |||
| Coefficient E | 2.44330e+03 | |||
| Comment | ChemSep eq 107, IdealGasHeatCapacityCp | |||
| Temperature range, min. | 298.15 | |||
| Temperature range, max. | 1500.00 | |||
| Cp,gas | 457.83 | J/mol×K | 298.15 | Calculated Property |
| Cp,gas | 611.93 | J/mol×K | 431.69 | Calculated Property |
| Cp,gas | 742.78 | J/mol×K | 565.23 | Calculated Property |
| Cp,gas | 843.67 | J/mol×K | 698.77 | Calculated Property |
| Cp,gas | 925.11 | J/mol×K | 832.31 | Calculated Property |
| Cp,gas | 993.32 | J/mol×K | 965.84 | Calculated Property |
| Cp,gas | 1050.61 | J/mol×K | 1099.38 | Calculated Property |
| Cp,gas | 1097.78 | J/mol×K | 1232.92 | Calculated Property |
| Cp,gas | 1135.52 | J/mol×K | 1366.46 | Calculated Property |
| Cp,gas | 1164.72 | J/mol×K | 1500.00 | Calculated Property |
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| Cp,liquid | [632.01; 893.06] | J/mol×K | [312.15; 623.70] |
ChemSep v8.3 pure component data
|
| Equation | Y = A + B·T + C·T² + D·T³ + E·T⁴ Y is Cp,liquid in J/mol×K, T in K | |||
| Coefficient A | 3.70460e+02 | |||
| Coefficient B | 8.37900e-01 | |||
| Coefficient C | 0.00000e+00 | |||
| Coefficient D | 0.00000e+00 | |||
| Coefficient E | 0.00000e+00 | |||
| Comment | ChemSep eq 100, LiquidHeatCapacityCp | |||
| Temperature range, min. | 312.15 | |||
| Temperature range, max. | 623.70 | |||
| Cp,liquid | 632.01 | J/mol×K | 312.15 | Calculated Property |
| Cp,liquid | 661.02 | J/mol×K | 346.77 | Calculated Property |
| Cp,liquid | 690.02 | J/mol×K | 381.38 | Calculated Property |
| Cp,liquid | 719.03 | J/mol×K | 416.00 | Calculated Property |
| Cp,liquid | 748.03 | J/mol×K | 450.62 | Calculated Property |
| Cp,liquid | 777.04 | J/mol×K | 485.23 | Calculated Property |
| Cp,liquid | 806.04 | J/mol×K | 519.85 | Calculated Property |
| Cp,liquid | 835.05 | J/mol×K | 554.47 | Calculated Property |
| Cp,liquid | 864.05 | J/mol×K | 589.08 | Calculated Property |
| Cp,liquid | 893.06 | J/mol×K | 623.70 | Calculated Property |
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| η | [0.0050857; 0.0002093] | Pa×s | [312.15; 623.70] |
ChemSep v8.3 pure component data
|
| Equation | Y = exp(A + B/T + C·ln(T) + D·T^E) Y is η in Pa×s, T in K | |||
| Coefficient A | -1.16680e+01 | |||
| Coefficient B | 1.99360e+03 | |||
| Coefficient C | 0.00000e+00 | |||
| Coefficient D | 0.00000e+00 | |||
| Coefficient E | 0.00000e+00 | |||
| Comment | ChemSep eq 101, LiquidViscosity | |||
| Temperature range, min. | 312.15 | |||
| Temperature range, max. | 623.70 | |||
| η | 0.0050857 | Pa×s | 312.15 | Calculated Property |
| η | 0.0026882 | Pa×s | 346.77 | Calculated Property |
| η | 0.0015953 | Pa×s | 381.38 | Calculated Property |
| η | 0.0010326 | Pa×s | 416.00 | Calculated Property |
| η | 0.0007146 | Pa×s | 450.62 | Calculated Property |
| η | 0.0005212 | Pa×s | 485.23 | Calculated Property |
| η | 0.0003964 | Pa×s | 519.85 | Calculated Property |
| η | 0.0003120 | Pa×s | 554.47 | Calculated Property |
| η | 0.0002526 | Pa×s | 589.08 | Calculated Property |
| η | 0.0002093 | Pa×s | 623.70 | Calculated Property |
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| ΔvapH | [96.73; 0.00] | kJ/mol | [312.15; 781.10] |
ChemSep v8.3 pure component data
|
| Equation | Y = A·(1 − Tr)^(B + C·Tr + D·Tr² + E·Tr³), Tr = T/Tc Y is ΔvapH in kJ/mol, T in K | |||
| Coefficient A | 1.45680e+02 | |||
| Coefficient B | 1.35910e+00 | |||
| Coefficient C | -1.76850e+00 | |||
| Coefficient D | 9.41210e-01 | |||
| Coefficient E | 0.00000e+00 | |||
| Critical temperature, Tc (K) | 7.81100e+02 | |||
| Comment | ChemSep eq 106, HeatOfVaporization | |||
| Temperature range, min. | 312.15 | |||
| Temperature range, max. | 781.10 | |||
| ΔvapH | 96.73 | kJ/mol | 312.15 | Calculated Property |
| ΔvapH | 91.59 | kJ/mol | 364.26 | Calculated Property |
| ΔvapH | 86.54 | kJ/mol | 416.36 | Calculated Property |
| ΔvapH | 81.30 | kJ/mol | 468.47 | Calculated Property |
| ΔvapH | 75.51 | kJ/mol | 520.57 | Calculated Property |
| ΔvapH | 68.75 | kJ/mol | 572.68 | Calculated Property |
| ΔvapH | 60.45 | kJ/mol | 624.78 | Calculated Property |
| ΔvapH | 49.75 | kJ/mol | 676.89 | Calculated Property |
| ΔvapH | 34.84 | kJ/mol | 728.99 | Calculated Property |
| ΔvapH | 0.00 | kJ/mol | 781.10 | Calculated Property |
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| Pvap | [8.04e-06; 1088.27] | kPa | [312.15; 781.10] |
ChemSep v8.3 pure component data
|
| Equation | Y = exp(A + B/T + C·ln(T) + D·T^E) Y is Pvap in kPa, T in K | |||
| Coefficient A | 1.06212e+02 | |||
| Coefficient B | -1.53720e+04 | |||
| Coefficient C | -1.19610e+01 | |||
| Coefficient D | 5.66720e-19 | |||
| Coefficient E | 6.00000e+00 | |||
| Comment | ChemSep eq 101, VaporPressure | |||
| Temperature range, min. | 312.15 | |||
| Temperature range, max. | 781.10 | |||
| Pvap | 8.04e-06 | kPa | 312.15 | Calculated Property |
| Pvap | 1.46e-03 | kPa | 364.26 | Calculated Property |
| Pvap | 0.06 | kPa | 416.36 | Calculated Property |
| Pvap | 0.86 | kPa | 468.47 | Calculated Property |
| Pvap | 6.55 | kPa | 520.57 | Calculated Property |
| Pvap | 30.99 | kPa | 572.68 | Calculated Property |
| Pvap | 104.00 | kPa | 624.78 | Calculated Property |
| Pvap | 270.72 | kPa | 676.89 | Calculated Property |
| Pvap | 582.78 | kPa | 728.99 | Calculated Property |
| Pvap | 1088.27 | kPa | 781.10 | Calculated Property |
| Pvap | [0.11; 1.73] | kPa | [427.16; 484.82] |
NIST
|
| Equation | ln(Y) = A + B/(T + C) Y is Pvap in kPa, T in K | |||
| Coefficient A | 1.81486e+01 | |||
| Coefficient B | -7.48219e+03 | |||
| Coefficient C | -5.96590e+01 | |||
| Reference | Rose and Schrodt, 1964 | |||
| Comment | Coefficents calculated by NIST from author's data. | |||
| Temperature range, min. | 427.16 | |||
| Temperature range, max. | 484.82 | |||
| Pvap | 0.11 | kPa | 427.16 | Calculated Property |
| Pvap | 0.16 | kPa | 433.57 | Calculated Property |
| Pvap | 0.22 | kPa | 439.97 | Calculated Property |
| Pvap | 0.30 | kPa | 446.38 | Calculated Property |
| Pvap | 0.41 | kPa | 452.79 | Calculated Property |
| Pvap | 0.56 | kPa | 459.19 | Calculated Property |
| Pvap | 0.75 | kPa | 465.60 | Calculated Property |
| Pvap | 1.00 | kPa | 472.01 | Calculated Property |
| Pvap | 1.32 | kPa | 478.41 | Calculated Property |
| Pvap | 1.73 | kPa | 484.82 | Calculated Property |
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| ρl | [850.11; 228.07] | kg/m3 | [312.15; 781.10] |
ChemSep v8.3 pure component data
|
| Equation | Y = A / B^(1 + (1 − T/C)^D) Y is ρl in kg/m3, T in K | |||
| Coefficient A | 4.98233e+01 | |||
| Coefficient B | 2.18460e-01 | |||
| Coefficient C | 7.81100e+02 | |||
| Coefficient D | 2.84350e-01 | |||
| Comment | ChemSep eq 105, LiquidDensity | |||
| Temperature range, min. | 312.15 | |||
| Temperature range, max. | 781.10 | |||
| ρl | 850.11 | kg/m3 | 312.15 | Calculated Property |
| ρl | 814.05 | kg/m3 | 364.26 | Calculated Property |
| ρl | 776.36 | kg/m3 | 416.36 | Calculated Property |
| ρl | 736.63 | kg/m3 | 468.47 | Calculated Property |
| ρl | 694.26 | kg/m3 | 520.57 | Calculated Property |
| ρl | 648.34 | kg/m3 | 572.68 | Calculated Property |
| ρl | 597.26 | kg/m3 | 624.78 | Calculated Property |
| ρl | 537.81 | kg/m3 | 676.89 | Calculated Property |
| ρl | 461.30 | kg/m3 | 728.99 | Calculated Property |
| ρl | 228.07 | kg/m3 | 781.10 | Calculated Property |
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| λ | [0.02; 0.05] | W/m×K | [623.70; 1000.00] |
ChemSep v8.3 pure component data
|
| Equation | Y = A·T^B / (1 + C/T + D/T²) Y is λ in W/m×K, T in K | |||
| Coefficient A | 2.21770e-06 | |||
| Coefficient B | 1.44860e+00 | |||
| Coefficient C | 0.00000e+00 | |||
| Coefficient D | 0.00000e+00 | |||
| Comment | ChemSep eq 102, VaporThermalConductivity | |||
| Temperature range, min. | 623.70 | |||
| Temperature range, max. | 1000.00 | |||
| λ | 0.02 | W/m×K | 623.70 | Calculated Property |
| λ | 0.03 | W/m×K | 665.51 | Calculated Property |
| λ | 0.03 | W/m×K | 707.32 | Calculated Property |
| λ | 0.03 | W/m×K | 749.13 | Calculated Property |
| λ | 0.04 | W/m×K | 790.94 | Calculated Property |
| λ | 0.04 | W/m×K | 832.76 | Calculated Property |
| λ | 0.04 | W/m×K | 874.57 | Calculated Property |
| λ | 0.04 | W/m×K | 916.38 | Calculated Property |
| λ | 0.05 | W/m×K | 958.19 | Calculated Property |
| λ | 0.05 | W/m×K | 1000.00 | Calculated Property |
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| λ | [0.14; 0.08] | W/m×K | [312.15; 623.70] |
ChemSep v8.3 pure component data
|
| Equation | Y = A + B·T + C·T² + D·T³ + E·T⁴ Y is λ in W/m×K, T in K | |||
| Coefficient A | 1.95310e-01 | |||
| Coefficient B | -1.85000e-04 | |||
| Coefficient C | 0.00000e+00 | |||
| Coefficient D | 0.00000e+00 | |||
| Coefficient E | 0.00000e+00 | |||
| Comment | ChemSep eq 100, LiquidThermalConductivity | |||
| Temperature range, min. | 312.15 | |||
| Temperature range, max. | 623.70 | |||
| λ | 0.14 | W/m×K | 312.15 | Calculated Property |
| λ | 0.13 | W/m×K | 346.77 | Calculated Property |
| λ | 0.12 | W/m×K | 381.38 | Calculated Property |
| λ | 0.12 | W/m×K | 416.00 | Calculated Property |
| λ | 0.11 | W/m×K | 450.62 | Calculated Property |
| λ | 0.11 | W/m×K | 485.23 | Calculated Property |
| λ | 0.10 | W/m×K | 519.85 | Calculated Property |
| λ | 0.09 | W/m×K | 554.47 | Calculated Property |
| λ | 0.09 | W/m×K | 589.08 | Calculated Property |
| λ | 0.08 | W/m×K | 623.70 | Calculated Property |
Similar Compounds
Find more compounds similar to Methyl stearate.
Mixtures
Sources
- Cheméo Relay (1.0)
- ChemSep v8.3 pure component data Converted from ChemSep v8.3 pure component data, H. Kooijman and R. Taylor (2021, 2022), Artistic License 2.0; see how the values differ.
- Crippen Method
- Crippen Method
- Phase behaviour of high molecular mass methyl esters in supercritical ethane
- Vapor-liquid critical point measurements of fifteen compounds by the pulse-heating method
- Vapour liquid equilibria of monocaprylin plus palmitic acid or methyl stearate at P = (1.20 and 2.50) kPa by using DSC technique
- Fatty acids methyl esters: Complementary measurements and comprehensive analysis of vaporization thermodynamics
- the vaporization enthaplies and vapor pressures of a series of unstaurated fatty acid methyl esters by correlation gas chromatography
- Express thermo-gravimetric method for the vaporization enthalpies appraisal for very low volatile molecular and ionic compounds.
- A Comparison of Results by Correlation Gas Chromatography with Another Gas Chromatographic Retention Time Technique. The Effects of Retention Time Coincidence on Vaporization Enthalpy and Vapor Pressure
- Heat Capacity Measurements of 13 Methyl Esters of n-Carboxylic Acids from Methyloctanoate to Methyleicosanoate between 5 K and 350 K
- Densities and Viscosities of Fatty Acid Methyl and Ethyl Esters
- Isobaric Vapor Liquid Equilibrium of the Mixture of Methyl Palmitate and Methyl Stearate at 0.1 kPa, 1 kPa, 5 kPa, and 10 kPa
- Density and Speed of Sound Measurements on Five Fatty Acid Methyl Esters at 83 kPa and Temperatures from (278.15 to 338.15) K
- McGowan Method
- NIST Webbook
Note: Cheméo is only indexing the data, follow the source links to retrieve the latest data. The source is also providing more information like the publication year, authors and more.
Take the time to validate and double check the source of the data.
Outlier This icon means
that the value is more than 2 standard deviations away from the
property mean.
These property values are available through the Cheméo API. A free account gives you an access key.